Dashboard
PHP:
8.0.30
OS:
Linux
User:
hoozgot
/
/
home
/
hoozgot
/
www
/
mountainpassions
/
summer
/
wp-content
/
plugins
/
hmenu
/
assets
/
js
📤 Upload
📝 New File
📁 New Folder
Close
Editing: jquery-ui.js
/*! jQuery UI - v1.12.1 - 2021-01-02 * http://jqueryui.com * Includes: widget.js, position.js, data.js, disable-selection.js, focusable.js, form-reset-mixin.js, jquery-1-7.js, keycode.js, labels.js, scroll-parent.js, tabbable.js, unique-id.js, widgets/draggable.js, widgets/droppable.js, widgets/resizable.js, widgets/selectable.js, widgets/sortable.js, widgets/accordion.js, widgets/autocomplete.js, widgets/button.js, widgets/checkboxradio.js, widgets/controlgroup.js, widgets/datepicker.js, widgets/dialog.js, widgets/menu.js, widgets/mouse.js, widgets/progressbar.js, widgets/selectmenu.js, widgets/slider.js, widgets/spinner.js, widgets/tabs.js, widgets/tooltip.js, effect.js, effects/effect-blind.js, effects/effect-bounce.js, effects/effect-clip.js, effects/effect-drop.js, effects/effect-explode.js, effects/effect-fade.js, effects/effect-fold.js, effects/effect-highlight.js, effects/effect-puff.js, effects/effect-pulsate.js, effects/effect-scale.js, effects/effect-shake.js, effects/effect-size.js, effects/effect-slide.js, effects/effect-transfer.js * Copyright jQuery Foundation and other contributors; Licensed MIT */ (function (factory) { if (typeof define === "function" && define.amd) { // AMD. Register as an anonymous module. define(["jquery"], factory); } else { // Browser globals factory(jQuery); } }(function ($) { $.ui = $.ui || {}; var version = $.ui.version = "1.12.1"; /*! * jQuery UI Widget 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Widget //>>group: Core //>>description: Provides a factory for creating stateful widgets with a common API. //>>docs: http://api.jqueryui.com/jQuery.widget/ //>>demos: http://jqueryui.com/widget/ var widgetUuid = 0; var widgetSlice = Array.prototype.slice; $.cleanData = (function (orig) { return function (elems) { var events, elem, i; for (i = 0; (elem = elems[i]) != null; i++) { try { // Only trigger remove when necessary to save time events = $._data(elem, "events"); if (events && events.remove) { $(elem).triggerHandler("remove"); } // Http://bugs.jquery.com/ticket/8235 } catch (e) { } } orig(elems); }; })($.cleanData); $.widget = function (name, base, prototype) { var existingConstructor, constructor, basePrototype; // ProxiedPrototype allows the provided prototype to remain unmodified // so that it can be used as a mixin for multiple widgets (#8876) var proxiedPrototype = {}; var namespace = name.split(".")[0]; name = name.split(".")[1]; var fullName = namespace + "-" + name; if (!prototype) { prototype = base; base = $.Widget; } if ($.isArray(prototype)) { prototype = $.extend.apply(null, [{}].concat(prototype)); } // Create selector for plugin $.expr[":"][fullName.toLowerCase()] = function (elem) { return !!$.data(elem, fullName); }; $[namespace] = $[namespace] || {}; existingConstructor = $[namespace][name]; constructor = $[namespace][name] = function (options, element) { // Allow instantiation without "new" keyword if (!this._createWidget) { return new constructor(options, element); } // Allow instantiation without initializing for simple inheritance // must use "new" keyword (the code above always passes args) if (arguments.length) { this._createWidget(options, element); } }; // Extend with the existing constructor to carry over any static properties $.extend(constructor, existingConstructor, { version: prototype.version, // Copy the object used to create the prototype in case we need to // redefine the widget later _proto: $.extend({}, prototype), // Track widgets that inherit from this widget in case this widget is // redefined after a widget inherits from it _childConstructors: [] }); basePrototype = new base(); // We need to make the options hash a property directly on the new instance // otherwise we'll modify the options hash on the prototype that we're // inheriting from basePrototype.options = $.widget.extend({}, basePrototype.options); $.each(prototype, function (prop, value) { if (!$.isFunction(value)) { proxiedPrototype[prop] = value; return; } proxiedPrototype[prop] = (function () { function _super() { return base.prototype[prop].apply(this, arguments); } function _superApply(args) { return base.prototype[prop].apply(this, args); } return function () { var __super = this._super; var __superApply = this._superApply; var returnValue; this._super = _super; this._superApply = _superApply; returnValue = value.apply(this, arguments); this._super = __super; this._superApply = __superApply; return returnValue; }; })(); }); constructor.prototype = $.widget.extend(basePrototype, { // TODO: remove support for widgetEventPrefix // always use the name + a colon as the prefix, e.g., draggable:start // don't prefix for widgets that aren't DOM-based widgetEventPrefix: existingConstructor ? (basePrototype.widgetEventPrefix || name) : name }, proxiedPrototype, { constructor: constructor, namespace: namespace, widgetName: name, widgetFullName: fullName }); // If this widget is being redefined then we need to find all widgets that // are inheriting from it and redefine all of them so that they inherit from // the new version of this widget. We're essentially trying to replace one // level in the prototype chain. if (existingConstructor) { $.each(existingConstructor._childConstructors, function (i, child) { var childPrototype = child.prototype; // Redefine the child widget using the same prototype that was // originally used, but inherit from the new version of the base $.widget(childPrototype.namespace + "." + childPrototype.widgetName, constructor, child._proto); }); // Remove the list of existing child constructors from the old constructor // so the old child constructors can be garbage collected delete existingConstructor._childConstructors; } else { base._childConstructors.push(constructor); } $.widget.bridge(name, constructor); return constructor; }; $.widget.extend = function (target) { var input = widgetSlice.call(arguments, 1); var inputIndex = 0; var inputLength = input.length; var key; var value; for (; inputIndex < inputLength; inputIndex++) { for (key in input[inputIndex]) { value = input[inputIndex][key]; if (input[inputIndex].hasOwnProperty(key) && value !== undefined) { // Clone objects if ($.isPlainObject(value)) { target[key] = $.isPlainObject(target[key]) ? $.widget.extend({}, target[key], value) : // Don't extend strings, arrays, etc. with objects $.widget.extend({}, value); // Copy everything else by reference } else { target[key] = value; } } } } return target; }; $.widget.bridge = function (name, object) { var fullName = object.prototype.widgetFullName || name; $.fn[name] = function (options) { var isMethodCall = typeof options === "string"; var args = widgetSlice.call(arguments, 1); var returnValue = this; if (isMethodCall) { // If this is an empty collection, we need to have the instance method // return undefined instead of the jQuery instance if (!this.length && options === "instance") { returnValue = undefined; } else { this.each(function () { var methodValue; var instance = $.data(this, fullName); if (options === "instance") { returnValue = instance; return false; } if (!instance) { return $.error("cannot call methods on " + name + " prior to initialization; " + "attempted to call method '" + options + "'"); } if (!$.isFunction(instance[options]) || options.charAt(0) === "_") { return $.error("no such method '" + options + "' for " + name + " widget instance"); } methodValue = instance[options].apply(instance, args); if (methodValue !== instance && methodValue !== undefined) { returnValue = methodValue && methodValue.jquery ? returnValue.pushStack(methodValue.get()) : methodValue; return false; } }); } } else { // Allow multiple hashes to be passed on init if (args.length) { options = $.widget.extend.apply(null, [options].concat(args)); } this.each(function () { var instance = $.data(this, fullName); if (instance) { instance.option(options || {}); if (instance._init) { instance._init(); } } else { $.data(this, fullName, new object(options, this)); } }); } return returnValue; }; }; $.Widget = function ( /* options, element */) { }; $.Widget._childConstructors = []; $.Widget.prototype = { widgetName: "widget", widgetEventPrefix: "", defaultElement: "<div>", options: { classes: {}, disabled: false, // Callbacks create: null }, _createWidget: function (options, element) { element = $(element || this.defaultElement || this)[0]; this.element = $(element); this.uuid = widgetUuid++; this.eventNamespace = "." + this.widgetName + this.uuid; this.bindings = $(); this.hoverable = $(); this.focusable = $(); this.classesElementLookup = {}; if (element !== this) { $.data(element, this.widgetFullName, this); this._on(true, this.element, { remove: function (event) { if (event.target === element) { this.destroy(); } } }); this.document = $(element.style ? // Element within the document element.ownerDocument : // Element is window or document element.document || element); this.window = $(this.document[0].defaultView || this.document[0].parentWindow); } this.options = $.widget.extend({}, this.options, this._getCreateOptions(), options); this._create(); if (this.options.disabled) { this._setOptionDisabled(this.options.disabled); } this._trigger("create", null, this._getCreateEventData()); this._init(); }, _getCreateOptions: function () { return {}; }, _getCreateEventData: $.noop, _create: $.noop, _init: $.noop, destroy: function () { var that = this; this._destroy(); $.each(this.classesElementLookup, function (key, value) { that._removeClass(value, key); }); // We can probably remove the unbind calls in 2.0 // all event bindings should go through this._on() this.element .off(this.eventNamespace) .removeData(this.widgetFullName); this.widget() .off(this.eventNamespace) .removeAttr("aria-disabled"); // Clean up events and states this.bindings.off(this.eventNamespace); }, _destroy: $.noop, widget: function () { return this.element; }, option: function (key, value) { var options = key; var parts; var curOption; var i; if (arguments.length === 0) { // Don't return a reference to the internal hash return $.widget.extend({}, this.options); } if (typeof key === "string") { // Handle nested keys, e.g., "foo.bar" => { foo: { bar: ___ } } options = {}; parts = key.split("."); key = parts.shift(); if (parts.length) { curOption = options[key] = $.widget.extend({}, this.options[key]); for (i = 0; i < parts.length - 1; i++) { curOption[parts[i]] = curOption[parts[i]] || {}; curOption = curOption[parts[i]]; } key = parts.pop(); if (arguments.length === 1) { return curOption[key] === undefined ? null : curOption[key]; } curOption[key] = value; } else { if (arguments.length === 1) { return this.options[key] === undefined ? null : this.options[key]; } options[key] = value; } } this._setOptions(options); return this; }, _setOptions: function (options) { var key; for (key in options) { this._setOption(key, options[key]); } return this; }, _setOption: function (key, value) { if (key === "classes") { this._setOptionClasses(value); } this.options[key] = value; if (key === "disabled") { this._setOptionDisabled(value); } return this; }, _setOptionClasses: function (value) { var classKey, elements, currentElements; for (classKey in value) { currentElements = this.classesElementLookup[classKey]; if (value[classKey] === this.options.classes[classKey] || !currentElements || !currentElements.length) { continue; } // We are doing this to create a new jQuery object because the _removeClass() call // on the next line is going to destroy the reference to the current elements being // tracked. We need to save a copy of this collection so that we can add the new classes // below. elements = $(currentElements.get()); this._removeClass(currentElements, classKey); // We don't use _addClass() here, because that uses this.options.classes // for generating the string of classes. We want to use the value passed in from // _setOption(), this is the new value of the classes option which was passed to // _setOption(). We pass this value directly to _classes(). elements.addClass(this._classes({ element: elements, keys: classKey, classes: value, add: true })); } }, _setOptionDisabled: function (value) { this._toggleClass(this.widget(), this.widgetFullName + "-disabled", null, !!value); // If the widget is becoming disabled, then nothing is interactive if (value) { this._removeClass(this.hoverable, null, "ui-state-hover"); this._removeClass(this.focusable, null, "ui-state-focus"); } }, enable: function () { return this._setOptions({ disabled: false }); }, disable: function () { return this._setOptions({ disabled: true }); }, _classes: function (options) { var full = []; var that = this; options = $.extend({ element: this.element, classes: this.options.classes || {} }, options); function processClassString(classes, checkOption) { var current, i; for (i = 0; i < classes.length; i++) { current = that.classesElementLookup[classes[i]] || $(); if (options.add) { current = $($.unique(current.get().concat(options.element.get()))); } else { current = $(current.not(options.element).get()); } that.classesElementLookup[classes[i]] = current; full.push(classes[i]); if (checkOption && options.classes[classes[i]]) { full.push(options.classes[classes[i]]); } } } this._on(options.element, { "remove": "_untrackClassesElement" }); if (options.keys) { processClassString(options.keys.match(/\S+/g) || [], true); } if (options.extra) { processClassString(options.extra.match(/\S+/g) || []); } return full.join(" "); }, _untrackClassesElement: function (event) { var that = this; $.each(that.classesElementLookup, function (key, value) { if ($.inArray(event.target, value) !== -1) { that.classesElementLookup[key] = $(value.not(event.target).get()); } }); }, _removeClass: function (element, keys, extra) { return this._toggleClass(element, keys, extra, false); }, _addClass: function (element, keys, extra) { return this._toggleClass(element, keys, extra, true); }, _toggleClass: function (element, keys, extra, add) { add = (typeof add === "boolean") ? add : extra; var shift = (typeof element === "string" || element === null), options = { extra: shift ? keys : extra, keys: shift ? element : keys, element: shift ? this.element : element, add: add }; options.element.toggleClass(this._classes(options), add); return this; }, _on: function (suppressDisabledCheck, element, handlers) { var delegateElement; var instance = this; // No suppressDisabledCheck flag, shuffle arguments if (typeof suppressDisabledCheck !== "boolean") { handlers = element; element = suppressDisabledCheck; suppressDisabledCheck = false; } // No element argument, shuffle and use this.element if (!handlers) { handlers = element; element = this.element; delegateElement = this.widget(); } else { element = delegateElement = $(element); this.bindings = this.bindings.add(element); } $.each(handlers, function (event, handler) { function handlerProxy() { // Allow widgets to customize the disabled handling // - disabled as an array instead of boolean // - disabled class as method for disabling individual parts if (!suppressDisabledCheck && (instance.options.disabled === true || $(this).hasClass("ui-state-disabled"))) { return; } return (typeof handler === "string" ? instance[handler] : handler) .apply(instance, arguments); } // Copy the guid so direct unbinding works if (typeof handler !== "string") { handlerProxy.guid = handler.guid = handler.guid || handlerProxy.guid || $.guid++; } var match = event.match(/^([\w:-]*)\s*(.*)$/); var eventName = match[1] + instance.eventNamespace; var selector = match[2]; if (selector) { delegateElement.on(eventName, selector, handlerProxy); } else { element.on(eventName, handlerProxy); } }); }, _off: function (element, eventName) { eventName = (eventName || "").split(" ").join(this.eventNamespace + " ") + this.eventNamespace; element.off(eventName).off(eventName); // Clear the stack to avoid memory leaks (#10056) this.bindings = $(this.bindings.not(element).get()); this.focusable = $(this.focusable.not(element).get()); this.hoverable = $(this.hoverable.not(element).get()); }, _delay: function (handler, delay) { function handlerProxy() { return (typeof handler === "string" ? instance[handler] : handler) .apply(instance, arguments); } var instance = this; return setTimeout(handlerProxy, delay || 0); }, _hoverable: function (element) { this.hoverable = this.hoverable.add(element); this._on(element, { mouseenter: function (event) { this._addClass($(event.currentTarget), null, "ui-state-hover"); }, mouseleave: function (event) { this._removeClass($(event.currentTarget), null, "ui-state-hover"); } }); }, _focusable: function (element) { this.focusable = this.focusable.add(element); this._on(element, { focusin: function (event) { this._addClass($(event.currentTarget), null, "ui-state-focus"); }, focusout: function (event) { this._removeClass($(event.currentTarget), null, "ui-state-focus"); } }); }, _trigger: function (type, event, data) { var prop, orig; var callback = this.options[type]; data = data || {}; event = $.Event(event); event.type = (type === this.widgetEventPrefix ? type : this.widgetEventPrefix + type).toLowerCase(); // The original event may come from any element // so we need to reset the target on the new event event.target = this.element[0]; // Copy original event properties over to the new event orig = event.originalEvent; if (orig) { for (prop in orig) { if (!(prop in event)) { event[prop] = orig[prop]; } } } this.element.trigger(event, data); return !($.isFunction(callback) && callback.apply(this.element[0], [event].concat(data)) === false || event.isDefaultPrevented()); } }; $.each({ show: "fadeIn", hide: "fadeOut" }, function (method, defaultEffect) { $.Widget.prototype["_" + method] = function (element, options, callback) { if (typeof options === "string") { options = { effect: options }; } var hasOptions; var effectName = !options ? method : options === true || typeof options === "number" ? defaultEffect : options.effect || defaultEffect; options = options || {}; if (typeof options === "number") { options = { duration: options }; } hasOptions = !$.isEmptyObject(options); options.complete = callback; if (options.delay) { element.delay(options.delay); } if (hasOptions && $.effects && $.effects.effect[effectName]) { element[method](options); } else if (effectName !== method && element[effectName]) { element[effectName](options.duration, options.easing, callback); } else { element.queue(function (next) { $(this)[method](); if (callback) { callback.call(element[0]); } next(); }); } }; }); var widget = $.widget; /*! * jQuery UI Position 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license * * http://api.jqueryui.com/position/ */ //>>label: Position //>>group: Core //>>description: Positions elements relative to other elements. //>>docs: http://api.jqueryui.com/position/ //>>demos: http://jqueryui.com/position/ (function () { var cachedScrollbarWidth, max = Math.max, abs = Math.abs, rhorizontal = /left|center|right/, rvertical = /top|center|bottom/, roffset = /[\+\-]\d+(\.[\d]+)?%?/, rposition = /^\w+/, rpercent = /%$/, _position = $.fn.position; function getOffsets(offsets, width, height) { return [ parseFloat(offsets[0]) * (rpercent.test(offsets[0]) ? width / 100 : 1), parseFloat(offsets[1]) * (rpercent.test(offsets[1]) ? height / 100 : 1) ]; } function parseCss(element, property) { return parseInt($.css(element, property), 10) || 0; } function getDimensions(elem) { var raw = elem[0]; if (raw.nodeType === 9) { return { width: elem.width(), height: elem.height(), offset: { top: 0, left: 0 } }; } if ($.isWindow(raw)) { return { width: elem.width(), height: elem.height(), offset: { top: elem.scrollTop(), left: elem.scrollLeft() } }; } if (raw.preventDefault) { return { width: 0, height: 0, offset: { top: raw.pageY, left: raw.pageX } }; } return { width: elem.outerWidth(), height: elem.outerHeight(), offset: elem.offset() }; } $.position = { scrollbarWidth: function () { if (cachedScrollbarWidth !== undefined) { return cachedScrollbarWidth; } var w1, w2, div = $("<div " + "style='display:block;position:absolute;width:50px;height:50px;overflow:hidden;'>" + "<div style='height:100px;width:auto;'></div></div>"), innerDiv = div.children()[0]; $("body").append(div); w1 = innerDiv.offsetWidth; div.css("overflow", "scroll"); w2 = innerDiv.offsetWidth; if (w1 === w2) { w2 = div[0].clientWidth; } div.remove(); return (cachedScrollbarWidth = w1 - w2); }, getScrollInfo: function (within) { var overflowX = within.isWindow || within.isDocument ? "" : within.element.css("overflow-x"), overflowY = within.isWindow || within.isDocument ? "" : within.element.css("overflow-y"), hasOverflowX = overflowX === "scroll" || (overflowX === "auto" && within.width < within.element[0].scrollWidth), hasOverflowY = overflowY === "scroll" || (overflowY === "auto" && within.height < within.element[0].scrollHeight); return { width: hasOverflowY ? $.position.scrollbarWidth() : 0, height: hasOverflowX ? $.position.scrollbarWidth() : 0 }; }, getWithinInfo: function (element) { var withinElement = $(element || window), isWindow = $.isWindow(withinElement[0]), isDocument = !!withinElement[0] && withinElement[0].nodeType === 9, hasOffset = !isWindow && !isDocument; return { element: withinElement, isWindow: isWindow, isDocument: isDocument, offset: hasOffset ? $(element).offset() : { left: 0, top: 0 }, scrollLeft: withinElement.scrollLeft(), scrollTop: withinElement.scrollTop(), width: withinElement.outerWidth(), height: withinElement.outerHeight() }; } }; $.fn.position = function (options) { if (!options || !options.of) { return _position.apply(this, arguments); } // Make a copy, we don't want to modify arguments options = $.extend({}, options); var atOffset, targetWidth, targetHeight, targetOffset, basePosition, dimensions, target = $(options.of), within = $.position.getWithinInfo(options.within), scrollInfo = $.position.getScrollInfo(within), collision = (options.collision || "flip").split(" "), offsets = {}; dimensions = getDimensions(target); if (target[0].preventDefault) { // Force left top to allow flipping options.at = "left top"; } targetWidth = dimensions.width; targetHeight = dimensions.height; targetOffset = dimensions.offset; // Clone to reuse original targetOffset later basePosition = $.extend({}, targetOffset); // Force my and at to have valid horizontal and vertical positions // if a value is missing or invalid, it will be converted to center $.each(["my", "at"], function () { var pos = (options[this] || "").split(" "), horizontalOffset, verticalOffset; if (pos.length === 1) { pos = rhorizontal.test(pos[0]) ? pos.concat(["center"]) : rvertical.test(pos[0]) ? ["center"].concat(pos) : ["center", "center"]; } pos[0] = rhorizontal.test(pos[0]) ? pos[0] : "center"; pos[1] = rvertical.test(pos[1]) ? pos[1] : "center"; // Calculate offsets horizontalOffset = roffset.exec(pos[0]); verticalOffset = roffset.exec(pos[1]); offsets[this] = [ horizontalOffset ? horizontalOffset[0] : 0, verticalOffset ? verticalOffset[0] : 0 ]; // Reduce to just the positions without the offsets options[this] = [ rposition.exec(pos[0])[0], rposition.exec(pos[1])[0] ]; }); // Normalize collision option if (collision.length === 1) { collision[1] = collision[0]; } if (options.at[0] === "right") { basePosition.left += targetWidth; } else if (options.at[0] === "center") { basePosition.left += targetWidth / 2; } if (options.at[1] === "bottom") { basePosition.top += targetHeight; } else if (options.at[1] === "center") { basePosition.top += targetHeight / 2; } atOffset = getOffsets(offsets.at, targetWidth, targetHeight); basePosition.left += atOffset[0]; basePosition.top += atOffset[1]; return this.each(function () { var collisionPosition, using, elem = $(this), elemWidth = elem.outerWidth(), elemHeight = elem.outerHeight(), marginLeft = parseCss(this, "marginLeft"), marginTop = parseCss(this, "marginTop"), collisionWidth = elemWidth + marginLeft + parseCss(this, "marginRight") + scrollInfo.width, collisionHeight = elemHeight + marginTop + parseCss(this, "marginBottom") + scrollInfo.height, position = $.extend({}, basePosition), myOffset = getOffsets(offsets.my, elem.outerWidth(), elem.outerHeight()); if (options.my[0] === "right") { position.left -= elemWidth; } else if (options.my[0] === "center") { position.left -= elemWidth / 2; } if (options.my[1] === "bottom") { position.top -= elemHeight; } else if (options.my[1] === "center") { position.top -= elemHeight / 2; } position.left += myOffset[0]; position.top += myOffset[1]; collisionPosition = { marginLeft: marginLeft, marginTop: marginTop }; $.each(["left", "top"], function (i, dir) { if ($.ui.position[collision[i]]) { $.ui.position[collision[i]][dir](position, { targetWidth: targetWidth, targetHeight: targetHeight, elemWidth: elemWidth, elemHeight: elemHeight, collisionPosition: collisionPosition, collisionWidth: collisionWidth, collisionHeight: collisionHeight, offset: [atOffset[0] + myOffset[0], atOffset[1] + myOffset[1]], my: options.my, at: options.at, within: within, elem: elem }); } }); if (options.using) { // Adds feedback as second argument to using callback, if present using = function (props) { var left = targetOffset.left - position.left, right = left + targetWidth - elemWidth, top = targetOffset.top - position.top, bottom = top + targetHeight - elemHeight, feedback = { target: { element: target, left: targetOffset.left, top: targetOffset.top, width: targetWidth, height: targetHeight }, element: { element: elem, left: position.left, top: position.top, width: elemWidth, height: elemHeight }, horizontal: right < 0 ? "left" : left > 0 ? "right" : "center", vertical: bottom < 0 ? "top" : top > 0 ? "bottom" : "middle" }; if (targetWidth < elemWidth && abs(left + right) < targetWidth) { feedback.horizontal = "center"; } if (targetHeight < elemHeight && abs(top + bottom) < targetHeight) { feedback.vertical = "middle"; } if (max(abs(left), abs(right)) > max(abs(top), abs(bottom))) { feedback.important = "horizontal"; } else { feedback.important = "vertical"; } options.using.call(this, props, feedback); }; } elem.offset($.extend(position, { using: using })); }); }; $.ui.position = { fit: { left: function (position, data) { var within = data.within, withinOffset = within.isWindow ? within.scrollLeft : within.offset.left, outerWidth = within.width, collisionPosLeft = position.left - data.collisionPosition.marginLeft, overLeft = withinOffset - collisionPosLeft, overRight = collisionPosLeft + data.collisionWidth - outerWidth - withinOffset, newOverRight; // Element is wider than within if (data.collisionWidth > outerWidth) { // Element is initially over the left side of within if (overLeft > 0 && overRight <= 0) { newOverRight = position.left + overLeft + data.collisionWidth - outerWidth - withinOffset; position.left += overLeft - newOverRight; // Element is initially over right side of within } else if (overRight > 0 && overLeft <= 0) { position.left = withinOffset; // Element is initially over both left and right sides of within } else { if (overLeft > overRight) { position.left = withinOffset + outerWidth - data.collisionWidth; } else { position.left = withinOffset; } } // Too far left -> align with left edge } else if (overLeft > 0) { position.left += overLeft; // Too far right -> align with right edge } else if (overRight > 0) { position.left -= overRight; // Adjust based on position and margin } else { position.left = max(position.left - collisionPosLeft, position.left); } }, top: function (position, data) { var within = data.within, withinOffset = within.isWindow ? within.scrollTop : within.offset.top, outerHeight = data.within.height, collisionPosTop = position.top - data.collisionPosition.marginTop, overTop = withinOffset - collisionPosTop, overBottom = collisionPosTop + data.collisionHeight - outerHeight - withinOffset, newOverBottom; // Element is taller than within if (data.collisionHeight > outerHeight) { // Element is initially over the top of within if (overTop > 0 && overBottom <= 0) { newOverBottom = position.top + overTop + data.collisionHeight - outerHeight - withinOffset; position.top += overTop - newOverBottom; // Element is initially over bottom of within } else if (overBottom > 0 && overTop <= 0) { position.top = withinOffset; // Element is initially over both top and bottom of within } else { if (overTop > overBottom) { position.top = withinOffset + outerHeight - data.collisionHeight; } else { position.top = withinOffset; } } // Too far up -> align with top } else if (overTop > 0) { position.top += overTop; // Too far down -> align with bottom edge } else if (overBottom > 0) { position.top -= overBottom; // Adjust based on position and margin } else { position.top = max(position.top - collisionPosTop, position.top); } } }, flip: { left: function (position, data) { var within = data.within, withinOffset = within.offset.left + within.scrollLeft, outerWidth = within.width, offsetLeft = within.isWindow ? within.scrollLeft : within.offset.left, collisionPosLeft = position.left - data.collisionPosition.marginLeft, overLeft = collisionPosLeft - offsetLeft, overRight = collisionPosLeft + data.collisionWidth - outerWidth - offsetLeft, myOffset = data.my[0] === "left" ? -data.elemWidth : data.my[0] === "right" ? data.elemWidth : 0, atOffset = data.at[0] === "left" ? data.targetWidth : data.at[0] === "right" ? -data.targetWidth : 0, offset = -2 * data.offset[0], newOverRight, newOverLeft; if (overLeft < 0) { newOverRight = position.left + myOffset + atOffset + offset + data.collisionWidth - outerWidth - withinOffset; if (newOverRight < 0 || newOverRight < abs(overLeft)) { position.left += myOffset + atOffset + offset; } } else if (overRight > 0) { newOverLeft = position.left - data.collisionPosition.marginLeft + myOffset + atOffset + offset - offsetLeft; if (newOverLeft > 0 || abs(newOverLeft) < overRight) { position.left += myOffset + atOffset + offset; } } }, top: function (position, data) { var within = data.within, withinOffset = within.offset.top + within.scrollTop, outerHeight = within.height, offsetTop = within.isWindow ? within.scrollTop : within.offset.top, collisionPosTop = position.top - data.collisionPosition.marginTop, overTop = collisionPosTop - offsetTop, overBottom = collisionPosTop + data.collisionHeight - outerHeight - offsetTop, top = data.my[1] === "top", myOffset = top ? -data.elemHeight : data.my[1] === "bottom" ? data.elemHeight : 0, atOffset = data.at[1] === "top" ? data.targetHeight : data.at[1] === "bottom" ? -data.targetHeight : 0, offset = -2 * data.offset[1], newOverTop, newOverBottom; if (overTop < 0) { newOverBottom = position.top + myOffset + atOffset + offset + data.collisionHeight - outerHeight - withinOffset; if (newOverBottom < 0 || newOverBottom < abs(overTop)) { position.top += myOffset + atOffset + offset; } } else if (overBottom > 0) { newOverTop = position.top - data.collisionPosition.marginTop + myOffset + atOffset + offset - offsetTop; if (newOverTop > 0 || abs(newOverTop) < overBottom) { position.top += myOffset + atOffset + offset; } } } }, flipfit: { left: function () { $.ui.position.flip.left.apply(this, arguments); $.ui.position.fit.left.apply(this, arguments); }, top: function () { $.ui.position.flip.top.apply(this, arguments); $.ui.position.fit.top.apply(this, arguments); } } }; })(); var position = $.ui.position; /*! * jQuery UI :data 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: :data Selector //>>group: Core //>>description: Selects elements which have data stored under the specified key. //>>docs: http://api.jqueryui.com/data-selector/ var data = $.extend($.expr[":"], { data: $.expr.createPseudo ? $.expr.createPseudo(function (dataName) { return function (elem) { return !!$.data(elem, dataName); }; }) : // Support: jQuery <1.8 function (elem, i, match) { return !!$.data(elem, match[3]); } }); /*! * jQuery UI Disable Selection 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: disableSelection //>>group: Core //>>description: Disable selection of text content within the set of matched elements. //>>docs: http://api.jqueryui.com/disableSelection/ // This file is deprecated var disableSelection = $.fn.extend({ disableSelection: (function () { var eventType = "onselectstart" in document.createElement("div") ? "selectstart" : "mousedown"; return function () { return this.on(eventType + ".ui-disableSelection", function (event) { event.preventDefault(); }); }; })(), enableSelection: function () { return this.off(".ui-disableSelection"); } }); /*! * jQuery UI Focusable 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: :focusable Selector //>>group: Core //>>description: Selects elements which can be focused. //>>docs: http://api.jqueryui.com/focusable-selector/ // Selectors $.ui.focusable = function (element, hasTabindex) { var map, mapName, img, focusableIfVisible, fieldset, nodeName = element.nodeName.toLowerCase(); if ("area" === nodeName) { map = element.parentNode; mapName = map.name; if (!element.href || !mapName || map.nodeName.toLowerCase() !== "map") { return false; } img = $("img[usemap='#" + mapName + "']"); return img.length > 0 && img.is(":visible"); } if (/^(input|select|textarea|button|object)$/.test(nodeName)) { focusableIfVisible = !element.disabled; if (focusableIfVisible) { // Form controls within a disabled fieldset are disabled. // However, controls within the fieldset's legend do not get disabled. // Since controls generally aren't placed inside legends, we skip // this portion of the check. fieldset = $(element).closest("fieldset")[0]; if (fieldset) { focusableIfVisible = !fieldset.disabled; } } } else if ("a" === nodeName) { focusableIfVisible = element.href || hasTabindex; } else { focusableIfVisible = hasTabindex; } return focusableIfVisible && $(element).is(":visible") && visible($(element)); }; // Support: IE 8 only // IE 8 doesn't resolve inherit to visible/hidden for computed values function visible(element) { var visibility = element.css("visibility"); while (visibility === "inherit") { element = element.parent(); visibility = element.css("visibility"); } return visibility !== "hidden"; } $.extend($.expr[":"], { focusable: function (element) { return $.ui.focusable(element, $.attr(element, "tabindex") != null); } }); var focusable = $.ui.focusable; // Support: IE8 Only // IE8 does not support the form attribute and when it is supplied. It overwrites the form prop // with a string, so we need to find the proper form. var form = $.fn.form = function () { return typeof this[0].form === "string" ? this.closest("form") : $(this[0].form); }; /*! * jQuery UI Form Reset Mixin 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Form Reset Mixin //>>group: Core //>>description: Refresh input widgets when their form is reset //>>docs: http://api.jqueryui.com/form-reset-mixin/ var formResetMixin = $.ui.formResetMixin = { _formResetHandler: function () { var form = $(this); // Wait for the form reset to actually happen before refreshing setTimeout(function () { var instances = form.data("ui-form-reset-instances"); $.each(instances, function () { this.refresh(); }); }); }, _bindFormResetHandler: function () { this.form = this.element.form(); if (!this.form.length) { return; } var instances = this.form.data("ui-form-reset-instances") || []; if (!instances.length) { // We don't use _on() here because we use a single event handler per form this.form.on("reset.ui-form-reset", this._formResetHandler); } instances.push(this); this.form.data("ui-form-reset-instances", instances); }, _unbindFormResetHandler: function () { if (!this.form.length) { return; } var instances = this.form.data("ui-form-reset-instances"); instances.splice($.inArray(this, instances), 1); if (instances.length) { this.form.data("ui-form-reset-instances", instances); } else { this.form .removeData("ui-form-reset-instances") .off("reset.ui-form-reset"); } } }; /*! * jQuery UI Support for jQuery core 1.7.x 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license * */ //>>label: jQuery 1.7 Support //>>group: Core //>>description: Support version 1.7.x of jQuery core // Support: jQuery 1.7 only // Not a great way to check versions, but since we only support 1.7+ and only // need to detect <1.8, this is a simple check that should suffice. Checking // for "1.7." would be a bit safer, but the version string is 1.7, not 1.7.0 // and we'll never reach 1.70.0 (if we do, we certainly won't be supporting // 1.7 anymore). See #11197 for why we're not using feature detection. if ($.fn.jquery.substring(0, 3) === "1.7") { // Setters for .innerWidth(), .innerHeight(), .outerWidth(), .outerHeight() // Unlike jQuery Core 1.8+, these only support numeric values to set the // dimensions in pixels $.each(["Width", "Height"], function (i, name) { var side = name === "Width" ? ["Left", "Right"] : ["Top", "Bottom"], type = name.toLowerCase(), orig = { innerWidth: $.fn.innerWidth, innerHeight: $.fn.innerHeight, outerWidth: $.fn.outerWidth, outerHeight: $.fn.outerHeight }; function reduce(elem, size, border, margin) { $.each(side, function () { size -= parseFloat($.css(elem, "padding" + this)) || 0; if (border) { size -= parseFloat($.css(elem, "border" + this + "Width")) || 0; } if (margin) { size -= parseFloat($.css(elem, "margin" + this)) || 0; } }); return size; } $.fn["inner" + name] = function (size) { if (size === undefined) { return orig["inner" + name].call(this); } return this.each(function () { $(this).css(type, reduce(this, size) + "px"); }); }; $.fn["outer" + name] = function (size, margin) { if (typeof size !== "number") { return orig["outer" + name].call(this, size); } return this.each(function () { $(this).css(type, reduce(this, size, true, margin) + "px"); }); }; }); $.fn.addBack = function (selector) { return this.add(selector == null ? this.prevObject : this.prevObject.filter(selector) ); }; } ; /*! * jQuery UI Keycode 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Keycode //>>group: Core //>>description: Provide keycodes as keynames //>>docs: http://api.jqueryui.com/jQuery.ui.keyCode/ var keycode = $.ui.keyCode = { BACKSPACE: 8, COMMA: 188, DELETE: 46, DOWN: 40, END: 35, ENTER: 13, ESCAPE: 27, HOME: 36, LEFT: 37, PAGE_DOWN: 34, PAGE_UP: 33, PERIOD: 190, RIGHT: 39, SPACE: 32, TAB: 9, UP: 38 }; // Internal use only var escapeSelector = $.ui.escapeSelector = (function () { var selectorEscape = /([!"#$%&'()*+,./:;<=>?@[\]^`{|}~])/g; return function (selector) { return selector.replace(selectorEscape, "\\$1"); }; })(); /*! * jQuery UI Labels 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: labels //>>group: Core //>>description: Find all the labels associated with a given input //>>docs: http://api.jqueryui.com/labels/ var labels = $.fn.labels = function () { var ancestor, selector, id, labels, ancestors; // Check control.labels first if (this[0].labels && this[0].labels.length) { return this.pushStack(this[0].labels); } // Support: IE <= 11, FF <= 37, Android <= 2.3 only // Above browsers do not support control.labels. Everything below is to support them // as well as document fragments. control.labels does not work on document fragments labels = this.eq(0).parents("label"); // Look for the label based on the id id = this.attr("id"); if (id) { // We don't search against the document in case the element // is disconnected from the DOM ancestor = this.eq(0).parents().last(); // Get a full set of top level ancestors ancestors = ancestor.add(ancestor.length ? ancestor.siblings() : this.siblings()); // Create a selector for the label based on the id selector = "label[for='" + $.ui.escapeSelector(id) + "']"; labels = labels.add(ancestors.find(selector).addBack(selector)); } // Return whatever we have found for labels return this.pushStack(labels); }; /*! * jQuery UI Scroll Parent 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: scrollParent //>>group: Core //>>description: Get the closest ancestor element that is scrollable. //>>docs: http://api.jqueryui.com/scrollParent/ var scrollParent = $.fn.scrollParent = function (includeHidden) { var position = this.css("position"), excludeStaticParent = position === "absolute", overflowRegex = includeHidden ? /(auto|scroll|hidden)/ : /(auto|scroll)/, scrollParent = this.parents().filter(function () { var parent = $(this); if (excludeStaticParent && parent.css("position") === "static") { return false; } return overflowRegex.test(parent.css("overflow") + parent.css("overflow-y") + parent.css("overflow-x")); }).eq(0); return position === "fixed" || !scrollParent.length ? $(this[0].ownerDocument || document) : scrollParent; }; /*! * jQuery UI Tabbable 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: :tabbable Selector //>>group: Core //>>description: Selects elements which can be tabbed to. //>>docs: http://api.jqueryui.com/tabbable-selector/ var tabbable = $.extend($.expr[":"], { tabbable: function (element) { var tabIndex = $.attr(element, "tabindex"), hasTabindex = tabIndex != null; return (!hasTabindex || tabIndex >= 0) && $.ui.focusable(element, hasTabindex); } }); /*! * jQuery UI Unique ID 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: uniqueId //>>group: Core //>>description: Functions to generate and remove uniqueId's //>>docs: http://api.jqueryui.com/uniqueId/ var uniqueId = $.fn.extend({ uniqueId: (function () { var uuid = 0; return function () { return this.each(function () { if (!this.id) { this.id = "ui-id-" + (++uuid); } }); }; })(), removeUniqueId: function () { return this.each(function () { if (/^ui-id-\d+$/.test(this.id)) { $(this).removeAttr("id"); } }); } }); // This file is deprecated var ie = $.ui.ie = !!/msie [\w.]+/.exec(navigator.userAgent.toLowerCase()); /*! * jQuery UI Mouse 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Mouse //>>group: Widgets //>>description: Abstracts mouse-based interactions to assist in creating certain widgets. //>>docs: http://api.jqueryui.com/mouse/ var mouseHandled = false; $(document).on("mouseup", function () { mouseHandled = false; }); var widgetsMouse = $.widget("ui.mouse", { version: "1.12.1", options: { cancel: "input, textarea, button, select, option", distance: 1, delay: 0 }, _mouseInit: function () { var that = this; this.element .on("mousedown." + this.widgetName, function (event) { return that._mouseDown(event); }) .on("click." + this.widgetName, function (event) { if (true === $.data(event.target, that.widgetName + ".preventClickEvent")) { $.removeData(event.target, that.widgetName + ".preventClickEvent"); event.stopImmediatePropagation(); return false; } }); this.started = false; }, // TODO: make sure destroying one instance of mouse doesn't mess with // other instances of mouse _mouseDestroy: function () { this.element.off("." + this.widgetName); if (this._mouseMoveDelegate) { this.document .off("mousemove." + this.widgetName, this._mouseMoveDelegate) .off("mouseup." + this.widgetName, this._mouseUpDelegate); } }, _mouseDown: function (event) { // don't let more than one widget handle mouseStart if (mouseHandled) { return; } this._mouseMoved = false; // We may have missed mouseup (out of window) (this._mouseStarted && this._mouseUp(event)); this._mouseDownEvent = event; var that = this, btnIsLeft = (event.which === 1), // event.target.nodeName works around a bug in IE 8 with // disabled inputs (#7620) elIsCancel = (typeof this.options.cancel === "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false); if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { return true; } this.mouseDelayMet = !this.options.delay; if (!this.mouseDelayMet) { this._mouseDelayTimer = setTimeout(function () { that.mouseDelayMet = true; }, this.options.delay); } if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { this._mouseStarted = (this._mouseStart(event) !== false); if (!this._mouseStarted) { event.preventDefault(); return true; } } // Click event may never have fired (Gecko & Opera) if (true === $.data(event.target, this.widgetName + ".preventClickEvent")) { $.removeData(event.target, this.widgetName + ".preventClickEvent"); } // These delegates are required to keep context this._mouseMoveDelegate = function (event) { return that._mouseMove(event); }; this._mouseUpDelegate = function (event) { return that._mouseUp(event); }; this.document .on("mousemove." + this.widgetName, this._mouseMoveDelegate) .on("mouseup." + this.widgetName, this._mouseUpDelegate); event.preventDefault(); mouseHandled = true; return true; }, _mouseMove: function (event) { // Only check for mouseups outside the document if you've moved inside the document // at least once. This prevents the firing of mouseup in the case of IE<9, which will // fire a mousemove event if content is placed under the cursor. See #7778 // Support: IE <9 if (this._mouseMoved) { // IE mouseup check - mouseup happened when mouse was out of window if ($.ui.ie && (!document.documentMode || document.documentMode < 9) && !event.button) { return this._mouseUp(event); // Iframe mouseup check - mouseup occurred in another document } else if (!event.which) { // Support: Safari <=8 - 9 // Safari sets which to 0 if you press any of the following keys // during a drag (#14461) if (event.originalEvent.altKey || event.originalEvent.ctrlKey || event.originalEvent.metaKey || event.originalEvent.shiftKey) { this.ignoreMissingWhich = true; } else if (!this.ignoreMissingWhich) { return this._mouseUp(event); } } } if (event.which || event.button) { this._mouseMoved = true; } if (this._mouseStarted) { this._mouseDrag(event); return event.preventDefault(); } if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { this._mouseStarted = (this._mouseStart(this._mouseDownEvent, event) !== false); (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); } return !this._mouseStarted; }, _mouseUp: function (event) { this.document .off("mousemove." + this.widgetName, this._mouseMoveDelegate) .off("mouseup." + this.widgetName, this._mouseUpDelegate); if (this._mouseStarted) { this._mouseStarted = false; if (event.target === this._mouseDownEvent.target) { $.data(event.target, this.widgetName + ".preventClickEvent", true); } this._mouseStop(event); } if (this._mouseDelayTimer) { clearTimeout(this._mouseDelayTimer); delete this._mouseDelayTimer; } this.ignoreMissingWhich = false; mouseHandled = false; event.preventDefault(); }, _mouseDistanceMet: function (event) { return (Math.max( Math.abs(this._mouseDownEvent.pageX - event.pageX), Math.abs(this._mouseDownEvent.pageY - event.pageY) ) >= this.options.distance ); }, _mouseDelayMet: function ( /* event */) { return this.mouseDelayMet; }, // These are placeholder methods, to be overriden by extending plugin _mouseStart: function ( /* event */) { }, _mouseDrag: function ( /* event */) { }, _mouseStop: function ( /* event */) { }, _mouseCapture: function ( /* event */) { return true; } }); // $.ui.plugin is deprecated. Use $.widget() extensions instead. var plugin = $.ui.plugin = { add: function (module, option, set) { var i, proto = $.ui[module].prototype; for (i in set) { proto.plugins[i] = proto.plugins[i] || []; proto.plugins[i].push([option, set[i]]); } }, call: function (instance, name, args, allowDisconnected) { var i, set = instance.plugins[name]; if (!set) { return; } if (!allowDisconnected && (!instance.element[0].parentNode || instance.element[0].parentNode.nodeType === 11)) { return; } for (i = 0; i < set.length; i++) { if (instance.options[set[i][0]]) { set[i][1].apply(instance.element, args); } } } }; var safeActiveElement = $.ui.safeActiveElement = function (document) { var activeElement; // Support: IE 9 only // IE9 throws an "Unspecified error" accessing document.activeElement from an <iframe> try { activeElement = document.activeElement; } catch (error) { activeElement = document.body; } // Support: IE 9 - 11 only // IE may return null instead of an element // Interestingly, this only seems to occur when NOT in an iframe if (!activeElement) { activeElement = document.body; } // Support: IE 11 only // IE11 returns a seemingly empty object in some cases when accessing // document.activeElement from an <iframe> if (!activeElement.nodeName) { activeElement = document.body; } return activeElement; }; var safeBlur = $.ui.safeBlur = function (element) { // Support: IE9 - 10 only // If the <body> is blurred, IE will switch windows, see #9420 if (element && element.nodeName.toLowerCase() !== "body") { $(element).trigger("blur"); } }; /*! * jQuery UI Draggable 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Draggable //>>group: Interactions //>>description: Enables dragging functionality for any element. //>>docs: http://api.jqueryui.com/draggable/ //>>demos: http://jqueryui.com/draggable/ //>>css.structure: ../../themes/base/draggable.css $.widget("ui.draggable", $.ui.mouse, { version: "1.12.1", widgetEventPrefix: "drag", options: { addClasses: true, appendTo: "parent", axis: false, connectToSortable: false, containment: false, cursor: "auto", cursorAt: false, grid: false, handle: false, helper: "original", iframeFix: false, opacity: false, refreshPositions: false, revert: false, revertDuration: 500, scope: "default", scroll: true, scrollSensitivity: 20, scrollSpeed: 20, snap: false, snapMode: "both", snapTolerance: 20, stack: false, zIndex: false, // Callbacks drag: null, start: null, stop: null }, _create: function () { if (this.options.helper === "original") { this._setPositionRelative(); } if (this.options.addClasses) { this._addClass("ui-draggable"); } this._setHandleClassName(); this._mouseInit(); }, _setOption: function (key, value) { this._super(key, value); if (key === "handle") { this._removeHandleClassName(); this._setHandleClassName(); } }, _destroy: function () { if ((this.helper || this.element).is(".ui-draggable-dragging")) { this.destroyOnClear = true; return; } this._removeHandleClassName(); this._mouseDestroy(); }, _mouseCapture: function (event) { var o = this.options; // Among others, prevent a drag on a resizable-handle if (this.helper || o.disabled || $(event.target).closest(".ui-resizable-handle").length > 0) { return false; } //Quit if we're not on a valid handle this.handle = this._getHandle(event); if (!this.handle) { return false; } this._blurActiveElement(event); this._blockFrames(o.iframeFix === true ? "iframe" : o.iframeFix); return true; }, _blockFrames: function (selector) { this.iframeBlocks = this.document.find(selector).map(function () { var iframe = $(this); return $("<div>") .css("position", "absolute") .appendTo(iframe.parent()) .outerWidth(iframe.outerWidth()) .outerHeight(iframe.outerHeight()) .offset(iframe.offset())[0]; }); }, _unblockFrames: function () { if (this.iframeBlocks) { this.iframeBlocks.remove(); delete this.iframeBlocks; } }, _blurActiveElement: function (event) { var activeElement = $.ui.safeActiveElement(this.document[0]), target = $(event.target); // Don't blur if the event occurred on an element that is within // the currently focused element // See #10527, #12472 if (target.closest(activeElement).length) { return; } // Blur any element that currently has focus, see #4261 $.ui.safeBlur(activeElement); }, _mouseStart: function (event) { var o = this.options; //Create and append the visible helper this.helper = this._createHelper(event); this._addClass(this.helper, "ui-draggable-dragging"); //Cache the helper size this._cacheHelperProportions(); //If ddmanager is used for droppables, set the global draggable if ($.ui.ddmanager) { $.ui.ddmanager.current = this; } /* * - Position generation - * This block generates everything position related - it's the core of draggables. */ //Cache the margins of the original element this._cacheMargins(); //Store the helper's css position this.cssPosition = this.helper.css("position"); this.scrollParent = this.helper.scrollParent(true); this.offsetParent = this.helper.offsetParent(); this.hasFixedAncestor = this.helper.parents().filter(function () { return $(this).css("position") === "fixed"; }).length > 0; //The element's absolute position on the page minus margins this.positionAbs = this.element.offset(); this._refreshOffsets(event); //Generate the original position this.originalPosition = this.position = this._generatePosition(event, false); this.originalPageX = event.pageX; this.originalPageY = event.pageY; //Adjust the mouse offset relative to the helper if "cursorAt" is supplied (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); //Set a containment if given in the options this._setContainment(); //Trigger event + callbacks if (this._trigger("start", event) === false) { this._clear(); return false; } //Recache the helper size this._cacheHelperProportions(); //Prepare the droppable offsets if ($.ui.ddmanager && !o.dropBehaviour) { $.ui.ddmanager.prepareOffsets(this, event); } // Execute the drag once - this causes the helper not to be visible before getting its // correct position this._mouseDrag(event, true); // If the ddmanager is used for droppables, inform the manager that dragging has started // (see #5003) if ($.ui.ddmanager) { $.ui.ddmanager.dragStart(this, event); } return true; }, _refreshOffsets: function (event) { this.offset = { top: this.positionAbs.top - this.margins.top, left: this.positionAbs.left - this.margins.left, scroll: false, parent: this._getParentOffset(), relative: this._getRelativeOffset() }; this.offset.click = { left: event.pageX - this.offset.left, top: event.pageY - this.offset.top }; }, _mouseDrag: function (event, noPropagation) { // reset any necessary cached properties (see #5009) if (this.hasFixedAncestor) { this.offset.parent = this._getParentOffset(); } //Compute the helpers position this.position = this._generatePosition(event, true); this.positionAbs = this._convertPositionTo("absolute"); //Call plugins and callbacks and use the resulting position if something is returned if (!noPropagation) { var ui = this._uiHash(); if (this._trigger("drag", event, ui) === false) { this._mouseUp(new $.Event("mouseup", event)); return false; } this.position = ui.position; } this.helper[0].style.left = this.position.left + "px"; this.helper[0].style.top = this.position.top + "px"; if ($.ui.ddmanager) { $.ui.ddmanager.drag(this, event); } return false; }, _mouseStop: function (event) { //If we are using droppables, inform the manager about the drop var that = this, dropped = false; if ($.ui.ddmanager && !this.options.dropBehaviour) { dropped = $.ui.ddmanager.drop(this, event); } //if a drop comes from outside (a sortable) if (this.dropped) { dropped = this.dropped; this.dropped = false; } if ((this.options.revert === "invalid" && !dropped) || (this.options.revert === "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped)) ) { $(this.helper).animate( this.originalPosition, parseInt(this.options.revertDuration, 10), function () { if (that._trigger("stop", event) !== false) { that._clear(); } } ); } else { if (this._trigger("stop", event) !== false) { this._clear(); } } return false; }, _mouseUp: function (event) { this._unblockFrames(); // If the ddmanager is used for droppables, inform the manager that dragging has stopped // (see #5003) if ($.ui.ddmanager) { $.ui.ddmanager.dragStop(this, event); } // Only need to focus if the event occurred on the draggable itself, see #10527 if (this.handleElement.is(event.target)) { // The interaction is over; whether or not the click resulted in a drag, // focus the element this.element.trigger("focus"); } return $.ui.mouse.prototype._mouseUp.call(this, event); }, cancel: function () { if (this.helper.is(".ui-draggable-dragging")) { this._mouseUp(new $.Event("mouseup", { target: this.element[0] })); } else { this._clear(); } return this; }, _getHandle: function (event) { return this.options.handle ? !!$(event.target).closest(this.element.find(this.options.handle)).length : true; }, _setHandleClassName: function () { this.handleElement = this.options.handle ? this.element.find(this.options.handle) : this.element; this._addClass(this.handleElement, "ui-draggable-handle"); }, _removeHandleClassName: function () { this._removeClass(this.handleElement, "ui-draggable-handle"); }, _createHelper: function (event) { var o = this.options, helperIsFunction = $.isFunction(o.helper), helper = helperIsFunction ? $(o.helper.apply(this.element[0], [event])) : (o.helper === "clone" ? this.element.clone().removeAttr("id") : this.element); if (!helper.parents("body").length) { helper.appendTo((o.appendTo === "parent" ? this.element[0].parentNode : o.appendTo)); } // Http://bugs.jqueryui.com/ticket/9446 // a helper function can return the original element // which wouldn't have been set to relative in _create if (helperIsFunction && helper[0] === this.element[0]) { this._setPositionRelative(); } if (helper[0] !== this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) { helper.css("position", "absolute"); } return helper; }, _setPositionRelative: function () { if (!(/^(?:r|a|f)/).test(this.element.css("position"))) { this.element[0].style.position = "relative"; } }, _adjustOffsetFromHelper: function (obj) { if (typeof obj === "string") { obj = obj.split(" "); } if ($.isArray(obj)) { obj = { left: +obj[0], top: +obj[1] || 0 }; } if ("left" in obj) { this.offset.click.left = obj.left + this.margins.left; } if ("right" in obj) { this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; } if ("top" in obj) { this.offset.click.top = obj.top + this.margins.top; } if ("bottom" in obj) { this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; } }, _isRootNode: function (element) { return (/(html|body)/i).test(element.tagName) || element === this.document[0]; }, _getParentOffset: function () { //Get the offsetParent and cache its position var po = this.offsetParent.offset(), document = this.document[0]; // This is a special case where we need to modify a offset calculated on start, since the // following happened: // 1. The position of the helper is absolute, so it's position is calculated based on the // next positioned parent // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't // the document, which means that the scroll is included in the initial calculation of the // offset of the parent, and never recalculated upon drag if (this.cssPosition === "absolute" && this.scrollParent[0] !== document && $.contains(this.scrollParent[0], this.offsetParent[0])) { po.left += this.scrollParent.scrollLeft(); po.top += this.scrollParent.scrollTop(); } if (this._isRootNode(this.offsetParent[0])) { po = { top: 0, left: 0 }; } return { top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"), 10) || 0), left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"), 10) || 0) }; }, _getRelativeOffset: function () { if (this.cssPosition !== "relative") { return { top: 0, left: 0 }; } var p = this.element.position(), scrollIsRootNode = this._isRootNode(this.scrollParent[0]); return { top: p.top - (parseInt(this.helper.css("top"), 10) || 0) + (!scrollIsRootNode ? this.scrollParent.scrollTop() : 0), left: p.left - (parseInt(this.helper.css("left"), 10) || 0) + (!scrollIsRootNode ? this.scrollParent.scrollLeft() : 0) }; }, _cacheMargins: function () { this.margins = { left: (parseInt(this.element.css("marginLeft"), 10) || 0), top: (parseInt(this.element.css("marginTop"), 10) || 0), right: (parseInt(this.element.css("marginRight"), 10) || 0), bottom: (parseInt(this.element.css("marginBottom"), 10) || 0) }; }, _cacheHelperProportions: function () { this.helperProportions = { width: this.helper.outerWidth(), height: this.helper.outerHeight() }; }, _setContainment: function () { var isUserScrollable, c, ce, o = this.options, document = this.document[0]; this.relativeContainer = null; if (!o.containment) { this.containment = null; return; } if (o.containment === "window") { this.containment = [ $(window).scrollLeft() - this.offset.relative.left - this.offset.parent.left, $(window).scrollTop() - this.offset.relative.top - this.offset.parent.top, $(window).scrollLeft() + $(window).width() - this.helperProportions.width - this.margins.left, $(window).scrollTop() + ($(window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top ]; return; } if (o.containment === "document") { this.containment = [ 0, 0, $(document).width() - this.helperProportions.width - this.margins.left, ($(document).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top ]; return; } if (o.containment.constructor === Array) { this.containment = o.containment; return; } if (o.containment === "parent") { o.containment = this.helper[0].parentNode; } c = $(o.containment); ce = c[0]; if (!ce) { return; } isUserScrollable = /(scroll|auto)/.test(c.css("overflow")); this.containment = [ (parseInt(c.css("borderLeftWidth"), 10) || 0) + (parseInt(c.css("paddingLeft"), 10) || 0), (parseInt(c.css("borderTopWidth"), 10) || 0) + (parseInt(c.css("paddingTop"), 10) || 0), (isUserScrollable ? Math.max(ce.scrollWidth, ce.offsetWidth) : ce.offsetWidth) - (parseInt(c.css("borderRightWidth"), 10) || 0) - (parseInt(c.css("paddingRight"), 10) || 0) - this.helperProportions.width - this.margins.left - this.margins.right, (isUserScrollable ? Math.max(ce.scrollHeight, ce.offsetHeight) : ce.offsetHeight) - (parseInt(c.css("borderBottomWidth"), 10) || 0) - (parseInt(c.css("paddingBottom"), 10) || 0) - this.helperProportions.height - this.margins.top - this.margins.bottom ]; this.relativeContainer = c; }, _convertPositionTo: function (d, pos) { if (!pos) { pos = this.position; } var mod = d === "absolute" ? 1 : -1, scrollIsRootNode = this._isRootNode(this.scrollParent[0]); return { top: ( // The absolute mouse position pos.top + // Only for relative positioned nodes: Relative offset from element to offset parent this.offset.relative.top * mod + // The offsetParent's offset without borders (offset + border) this.offset.parent.top * mod - ((this.cssPosition === "fixed" ? -this.offset.scroll.top : (scrollIsRootNode ? 0 : this.offset.scroll.top)) * mod) ), left: ( // The absolute mouse position pos.left + // Only for relative positioned nodes: Relative offset from element to offset parent this.offset.relative.left * mod + // The offsetParent's offset without borders (offset + border) this.offset.parent.left * mod - ((this.cssPosition === "fixed" ? -this.offset.scroll.left : (scrollIsRootNode ? 0 : this.offset.scroll.left)) * mod) ) }; }, _generatePosition: function (event, constrainPosition) { var containment, co, top, left, o = this.options, scrollIsRootNode = this._isRootNode(this.scrollParent[0]), pageX = event.pageX, pageY = event.pageY; // Cache the scroll if (!scrollIsRootNode || !this.offset.scroll) { this.offset.scroll = { top: this.scrollParent.scrollTop(), left: this.scrollParent.scrollLeft() }; } /* * - Position constraining - * Constrain the position to a mix of grid, containment. */ // If we are not dragging yet, we won't check for options if (constrainPosition) { if (this.containment) { if (this.relativeContainer) { co = this.relativeContainer.offset(); containment = [ this.containment[0] + co.left, this.containment[1] + co.top, this.containment[2] + co.left, this.containment[3] + co.top ]; } else { containment = this.containment; } if (event.pageX - this.offset.click.left < containment[0]) { pageX = containment[0] + this.offset.click.left; } if (event.pageY - this.offset.click.top < containment[1]) { pageY = containment[1] + this.offset.click.top; } if (event.pageX - this.offset.click.left > containment[2]) { pageX = containment[2] + this.offset.click.left; } if (event.pageY - this.offset.click.top > containment[3]) { pageY = containment[3] + this.offset.click.top; } } if (o.grid) { //Check for grid elements set to 0 to prevent divide by 0 error causing invalid // argument errors in IE (see ticket #6950) top = o.grid[1] ? this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1] : this.originalPageY; pageY = containment ? ((top - this.offset.click.top >= containment[1] || top - this.offset.click.top > containment[3]) ? top : ((top - this.offset.click.top >= containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; left = o.grid[0] ? this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0] : this.originalPageX; pageX = containment ? ((left - this.offset.click.left >= containment[0] || left - this.offset.click.left > containment[2]) ? left : ((left - this.offset.click.left >= containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; } if (o.axis === "y") { pageX = this.originalPageX; } if (o.axis === "x") { pageY = this.originalPageY; } } return { top: ( // The absolute mouse position pageY - // Click offset (relative to the element) this.offset.click.top - // Only for relative positioned nodes: Relative offset from element to offset parent this.offset.relative.top - // The offsetParent's offset without borders (offset + border) this.offset.parent.top + (this.cssPosition === "fixed" ? -this.offset.scroll.top : (scrollIsRootNode ? 0 : this.offset.scroll.top)) ), left: ( // The absolute mouse position pageX - // Click offset (relative to the element) this.offset.click.left - // Only for relative positioned nodes: Relative offset from element to offset parent this.offset.relative.left - // The offsetParent's offset without borders (offset + border) this.offset.parent.left + (this.cssPosition === "fixed" ? -this.offset.scroll.left : (scrollIsRootNode ? 0 : this.offset.scroll.left)) ) }; }, _clear: function () { this._removeClass(this.helper, "ui-draggable-dragging"); if (this.helper[0] !== this.element[0] && !this.cancelHelperRemoval) { this.helper.remove(); } this.helper = null; this.cancelHelperRemoval = false; if (this.destroyOnClear) { this.destroy(); } }, // From now on bulk stuff - mainly helpers _trigger: function (type, event, ui) { ui = ui || this._uiHash(); $.ui.plugin.call(this, type, [event, ui, this], true); // Absolute position and offset (see #6884 ) have to be recalculated after plugins if (/^(drag|start|stop)/.test(type)) { this.positionAbs = this._convertPositionTo("absolute"); ui.offset = this.positionAbs; } return $.Widget.prototype._trigger.call(this, type, event, ui); }, plugins: {}, _uiHash: function () { return { helper: this.helper, position: this.position, originalPosition: this.originalPosition, offset: this.positionAbs }; } }); $.ui.plugin.add("draggable", "connectToSortable", { start: function (event, ui, draggable) { var uiSortable = $.extend({}, ui, { item: draggable.element }); draggable.sortables = []; $(draggable.options.connectToSortable).each(function () { var sortable = $(this).sortable("instance"); if (sortable && !sortable.options.disabled) { draggable.sortables.push(sortable); // RefreshPositions is called at drag start to refresh the containerCache // which is used in drag. This ensures it's initialized and synchronized // with any changes that might have happened on the page since initialization. sortable.refreshPositions(); sortable._trigger("activate", event, uiSortable); } }); }, stop: function (event, ui, draggable) { var uiSortable = $.extend({}, ui, { item: draggable.element }); draggable.cancelHelperRemoval = false; $.each(draggable.sortables, function () { var sortable = this; if (sortable.isOver) { sortable.isOver = 0; // Allow this sortable to handle removing the helper draggable.cancelHelperRemoval = true; sortable.cancelHelperRemoval = false; // Use _storedCSS To restore properties in the sortable, // as this also handles revert (#9675) since the draggable // may have modified them in unexpected ways (#8809) sortable._storedCSS = { position: sortable.placeholder.css("position"), top: sortable.placeholder.css("top"), left: sortable.placeholder.css("left") }; sortable._mouseStop(event); // Once drag has ended, the sortable should return to using // its original helper, not the shared helper from draggable sortable.options.helper = sortable.options._helper; } else { // Prevent this Sortable from removing the helper. // However, don't set the draggable to remove the helper // either as another connected Sortable may yet handle the removal. sortable.cancelHelperRemoval = true; sortable._trigger("deactivate", event, uiSortable); } }); }, drag: function (event, ui, draggable) { $.each(draggable.sortables, function () { var innermostIntersecting = false, sortable = this; // Copy over variables that sortable's _intersectsWith uses sortable.positionAbs = draggable.positionAbs; sortable.helperProportions = draggable.helperProportions; sortable.offset.click = draggable.offset.click; if (sortable._intersectsWith(sortable.containerCache)) { innermostIntersecting = true; $.each(draggable.sortables, function () { // Copy over variables that sortable's _intersectsWith uses this.positionAbs = draggable.positionAbs; this.helperProportions = draggable.helperProportions; this.offset.click = draggable.offset.click; if (this !== sortable && this._intersectsWith(this.containerCache) && $.contains(sortable.element[0], this.element[0])) { innermostIntersecting = false; } return innermostIntersecting; }); } if (innermostIntersecting) { // If it intersects, we use a little isOver variable and set it once, // so that the move-in stuff gets fired only once. if (!sortable.isOver) { sortable.isOver = 1; // Store draggable's parent in case we need to reappend to it later. draggable._parent = ui.helper.parent(); sortable.currentItem = ui.helper .appendTo(sortable.element) .data("ui-sortable-item", true); // Store helper option to later restore it sortable.options._helper = sortable.options.helper; sortable.options.helper = function () { return ui.helper[0]; }; // Fire the start events of the sortable with our passed browser event, // and our own helper (so it doesn't create a new one) event.target = sortable.currentItem[0]; sortable._mouseCapture(event, true); sortable._mouseStart(event, true, true); // Because the browser event is way off the new appended portlet, // modify necessary variables to reflect the changes sortable.offset.click.top = draggable.offset.click.top; sortable.offset.click.left = draggable.offset.click.left; sortable.offset.parent.left -= draggable.offset.parent.left - sortable.offset.parent.left; sortable.offset.parent.top -= draggable.offset.parent.top - sortable.offset.parent.top; draggable._trigger("toSortable", event); // Inform draggable that the helper is in a valid drop zone, // used solely in the revert option to handle "valid/invalid". draggable.dropped = sortable.element; // Need to refreshPositions of all sortables in the case that // adding to one sortable changes the location of the other sortables (#9675) $.each(draggable.sortables, function () { this.refreshPositions(); }); // Hack so receive/update callbacks work (mostly) draggable.currentItem = draggable.element; sortable.fromOutside = draggable; } if (sortable.currentItem) { sortable._mouseDrag(event); // Copy the sortable's position because the draggable's can potentially reflect // a relative position, while sortable is always absolute, which the dragged // element has now become. (#8809) ui.position = sortable.position; } } else { // If it doesn't intersect with the sortable, and it intersected before, // we fake the drag stop of the sortable, but make sure it doesn't remove // the helper by using cancelHelperRemoval. if (sortable.isOver) { sortable.isOver = 0; sortable.cancelHelperRemoval = true; // Calling sortable's mouseStop would trigger a revert, // so revert must be temporarily false until after mouseStop is called. sortable.options._revert = sortable.options.revert; sortable.options.revert = false; sortable._trigger("out", event, sortable._uiHash(sortable)); sortable._mouseStop(event, true); // Restore sortable behaviors that were modfied // when the draggable entered the sortable area (#9481) sortable.options.revert = sortable.options._revert; sortable.options.helper = sortable.options._helper; if (sortable.placeholder) { sortable.placeholder.remove(); } // Restore and recalculate the draggable's offset considering the sortable // may have modified them in unexpected ways. (#8809, #10669) ui.helper.appendTo(draggable._parent); draggable._refreshOffsets(event); ui.position = draggable._generatePosition(event, true); draggable._trigger("fromSortable", event); // Inform draggable that the helper is no longer in a valid drop zone draggable.dropped = false; // Need to refreshPositions of all sortables just in case removing // from one sortable changes the location of other sortables (#9675) $.each(draggable.sortables, function () { this.refreshPositions(); }); } } }); } }); $.ui.plugin.add("draggable", "cursor", { start: function (event, ui, instance) { var t = $("body"), o = instance.options; if (t.css("cursor")) { o._cursor = t.css("cursor"); } t.css("cursor", o.cursor); }, stop: function (event, ui, instance) { var o = instance.options; if (o._cursor) { $("body").css("cursor", o._cursor); } } }); $.ui.plugin.add("draggable", "opacity", { start: function (event, ui, instance) { var t = $(ui.helper), o = instance.options; if (t.css("opacity")) { o._opacity = t.css("opacity"); } t.css("opacity", o.opacity); }, stop: function (event, ui, instance) { var o = instance.options; if (o._opacity) { $(ui.helper).css("opacity", o._opacity); } } }); $.ui.plugin.add("draggable", "scroll", { start: function (event, ui, i) { if (!i.scrollParentNotHidden) { i.scrollParentNotHidden = i.helper.scrollParent(false); } if (i.scrollParentNotHidden[0] !== i.document[0] && i.scrollParentNotHidden[0].tagName !== "HTML") { i.overflowOffset = i.scrollParentNotHidden.offset(); } }, drag: function (event, ui, i) { var o = i.options, scrolled = false, scrollParent = i.scrollParentNotHidden[0], document = i.document[0]; if (scrollParent !== document && scrollParent.tagName !== "HTML") { if (!o.axis || o.axis !== "x") { if ((i.overflowOffset.top + scrollParent.offsetHeight) - event.pageY < o.scrollSensitivity) { scrollParent.scrollTop = scrolled = scrollParent.scrollTop + o.scrollSpeed; } else if (event.pageY - i.overflowOffset.top < o.scrollSensitivity) { scrollParent.scrollTop = scrolled = scrollParent.scrollTop - o.scrollSpeed; } } if (!o.axis || o.axis !== "y") { if ((i.overflowOffset.left + scrollParent.offsetWidth) - event.pageX < o.scrollSensitivity) { scrollParent.scrollLeft = scrolled = scrollParent.scrollLeft + o.scrollSpeed; } else if (event.pageX - i.overflowOffset.left < o.scrollSensitivity) { scrollParent.scrollLeft = scrolled = scrollParent.scrollLeft - o.scrollSpeed; } } } else { if (!o.axis || o.axis !== "x") { if (event.pageY - $(document).scrollTop() < o.scrollSensitivity) { scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); } else if ($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) { scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); } } if (!o.axis || o.axis !== "y") { if (event.pageX - $(document).scrollLeft() < o.scrollSensitivity) { scrolled = $(document).scrollLeft( $(document).scrollLeft() - o.scrollSpeed ); } else if ($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) { scrolled = $(document).scrollLeft( $(document).scrollLeft() + o.scrollSpeed ); } } } if (scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) { $.ui.ddmanager.prepareOffsets(i, event); } } }); $.ui.plugin.add("draggable", "snap", { start: function (event, ui, i) { var o = i.options; i.snapElements = []; $(o.snap.constructor !== String ? (o.snap.items || ":data(ui-draggable)") : o.snap) .each(function () { var $t = $(this), $o = $t.offset(); if (this !== i.element[0]) { i.snapElements.push({ item: this, width: $t.outerWidth(), height: $t.outerHeight(), top: $o.top, left: $o.left }); } }); }, drag: function (event, ui, inst) { var ts, bs, ls, rs, l, r, t, b, i, first, o = inst.options, d = o.snapTolerance, x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width, y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height; for (i = inst.snapElements.length - 1; i >= 0; i--) { l = inst.snapElements[i].left - inst.margins.left; r = l + inst.snapElements[i].width; t = inst.snapElements[i].top - inst.margins.top; b = t + inst.snapElements[i].height; if (x2 < l - d || x1 > r + d || y2 < t - d || y1 > b + d || !$.contains(inst.snapElements[i].item.ownerDocument, inst.snapElements[i].item)) { if (inst.snapElements[i].snapping) { (inst.options.snap.release && inst.options.snap.release.call( inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }) )); } inst.snapElements[i].snapping = false; continue; } if (o.snapMode !== "inner") { ts = Math.abs(t - y2) <= d; bs = Math.abs(b - y1) <= d; ls = Math.abs(l - x2) <= d; rs = Math.abs(r - x1) <= d; if (ts) { ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top; } if (bs) { ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top; } if (ls) { ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left; } if (rs) { ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left; } } first = (ts || bs || ls || rs); if (o.snapMode !== "outer") { ts = Math.abs(t - y1) <= d; bs = Math.abs(b - y2) <= d; ls = Math.abs(l - x1) <= d; rs = Math.abs(r - x2) <= d; if (ts) { ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top; } if (bs) { ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top; } if (ls) { ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left; } if (rs) { ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left; } } if (!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) { (inst.options.snap.snap && inst.options.snap.snap.call( inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); } inst.snapElements[i].snapping = (ts || bs || ls || rs || first); } } }); $.ui.plugin.add("draggable", "stack", { start: function (event, ui, instance) { var min, o = instance.options, group = $.makeArray($(o.stack)).sort(function (a, b) { return (parseInt($(a).css("zIndex"), 10) || 0) - (parseInt($(b).css("zIndex"), 10) || 0); }); if (!group.length) { return; } min = parseInt($(group[0]).css("zIndex"), 10) || 0; $(group).each(function (i) { $(this).css("zIndex", min + i); }); this.css("zIndex", (min + group.length)); } }); $.ui.plugin.add("draggable", "zIndex", { start: function (event, ui, instance) { var t = $(ui.helper), o = instance.options; if (t.css("zIndex")) { o._zIndex = t.css("zIndex"); } t.css("zIndex", o.zIndex); }, stop: function (event, ui, instance) { var o = instance.options; if (o._zIndex) { $(ui.helper).css("zIndex", o._zIndex); } } }); var widgetsDraggable = $.ui.draggable; /*! * jQuery UI Droppable 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Droppable //>>group: Interactions //>>description: Enables drop targets for draggable elements. //>>docs: http://api.jqueryui.com/droppable/ //>>demos: http://jqueryui.com/droppable/ $.widget("ui.droppable", { version: "1.12.1", widgetEventPrefix: "drop", options: { accept: "*", addClasses: true, greedy: false, scope: "default", tolerance: "intersect", // Callbacks activate: null, deactivate: null, drop: null, out: null, over: null }, _create: function () { var proportions, o = this.options, accept = o.accept; this.isover = false; this.isout = true; this.accept = $.isFunction(accept) ? accept : function (d) { return d.is(accept); }; this.proportions = function ( /* valueToWrite */) { if (arguments.length) { // Store the droppable's proportions proportions = arguments[0]; } else { // Retrieve or derive the droppable's proportions return proportions ? proportions : proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight }; } }; this._addToManager(o.scope); o.addClasses && this._addClass("ui-droppable"); }, _addToManager: function (scope) { // Add the reference and positions to the manager $.ui.ddmanager.droppables[scope] = $.ui.ddmanager.droppables[scope] || []; $.ui.ddmanager.droppables[scope].push(this); }, _splice: function (drop) { var i = 0; for (; i < drop.length; i++) { if (drop[i] === this) { drop.splice(i, 1); } } }, _destroy: function () { var drop = $.ui.ddmanager.droppables[this.options.scope]; this._splice(drop); }, _setOption: function (key, value) { if (key === "accept") { this.accept = $.isFunction(value) ? value : function (d) { return d.is(value); }; } else if (key === "scope") { var drop = $.ui.ddmanager.droppables[this.options.scope]; this._splice(drop); this._addToManager(value); } this._super(key, value); }, _activate: function (event) { var draggable = $.ui.ddmanager.current; this._addActiveClass(); if (draggable) { this._trigger("activate", event, this.ui(draggable)); } }, _deactivate: function (event) { var draggable = $.ui.ddmanager.current; this._removeActiveClass(); if (draggable) { this._trigger("deactivate", event, this.ui(draggable)); } }, _over: function (event) { var draggable = $.ui.ddmanager.current; // Bail if draggable and droppable are same element if (!draggable || (draggable.currentItem || draggable.element)[0] === this.element[0]) { return; } if (this.accept.call(this.element[0], (draggable.currentItem || draggable.element))) { this._addHoverClass(); this._trigger("over", event, this.ui(draggable)); } }, _out: function (event) { var draggable = $.ui.ddmanager.current; // Bail if draggable and droppable are same element if (!draggable || (draggable.currentItem || draggable.element)[0] === this.element[0]) { return; } if (this.accept.call(this.element[0], (draggable.currentItem || draggable.element))) { this._removeHoverClass(); this._trigger("out", event, this.ui(draggable)); } }, _drop: function (event, custom) { var draggable = custom || $.ui.ddmanager.current, childrenIntersection = false; // Bail if draggable and droppable are same element if (!draggable || (draggable.currentItem || draggable.element)[0] === this.element[0]) { return false; } this.element .find(":data(ui-droppable)") .not(".ui-draggable-dragging") .each(function () { var inst = $(this).droppable("instance"); if ( inst.options.greedy && !inst.options.disabled && inst.options.scope === draggable.options.scope && inst.accept.call( inst.element[0], (draggable.currentItem || draggable.element) ) && intersect( draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance, event ) ) { childrenIntersection = true; return false; } }); if (childrenIntersection) { return false; } if (this.accept.call(this.element[0], (draggable.currentItem || draggable.element))) { this._removeActiveClass(); this._removeHoverClass(); this._trigger("drop", event, this.ui(draggable)); return this.element; } return false; }, ui: function (c) { return { draggable: (c.currentItem || c.element), helper: c.helper, position: c.position, offset: c.positionAbs }; }, // Extension points just to make backcompat sane and avoid duplicating logic // TODO: Remove in 1.13 along with call to it below _addHoverClass: function () { this._addClass("ui-droppable-hover"); }, _removeHoverClass: function () { this._removeClass("ui-droppable-hover"); }, _addActiveClass: function () { this._addClass("ui-droppable-active"); }, _removeActiveClass: function () { this._removeClass("ui-droppable-active"); } }); var intersect = $.ui.intersect = (function () { function isOverAxis(x, reference, size) { return (x >= reference) && (x < (reference + size)); } return function (draggable, droppable, toleranceMode, event) { if (!droppable.offset) { return false; } var x1 = (draggable.positionAbs || draggable.position.absolute).left + draggable.margins.left, y1 = (draggable.positionAbs || draggable.position.absolute).top + draggable.margins.top, x2 = x1 + draggable.helperProportions.width, y2 = y1 + draggable.helperProportions.height, l = droppable.offset.left, t = droppable.offset.top, r = l + droppable.proportions().width, b = t + droppable.proportions().height; switch (toleranceMode) { case "fit": return (l <= x1 && x2 <= r && t <= y1 && y2 <= b); case "intersect": return (l < x1 + (draggable.helperProportions.width / 2) && // Right Half x2 - (draggable.helperProportions.width / 2) < r && // Left Half t < y1 + (draggable.helperProportions.height / 2) && // Bottom Half y2 - (draggable.helperProportions.height / 2) < b); // Top Half case "pointer": return isOverAxis(event.pageY, t, droppable.proportions().height) && isOverAxis(event.pageX, l, droppable.proportions().width); case "touch": return ( (y1 >= t && y1 <= b) || // Top edge touching (y2 >= t && y2 <= b) || // Bottom edge touching (y1 < t && y2 > b) // Surrounded vertically ) && ( (x1 >= l && x1 <= r) || // Left edge touching (x2 >= l && x2 <= r) || // Right edge touching (x1 < l && x2 > r) // Surrounded horizontally ); default: return false; } }; })(); /* This manager tracks offsets of draggables and droppables */ $.ui.ddmanager = { current: null, droppables: { "default": [] }, prepareOffsets: function (t, event) { var i, j, m = $.ui.ddmanager.droppables[t.options.scope] || [], type = event ? event.type : null, // workaround for #2317 list = (t.currentItem || t.element).find(":data(ui-droppable)").addBack(); droppablesLoop: for (i = 0; i < m.length; i++) { // No disabled and non-accepted if (m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0], (t.currentItem || t.element)))) { continue; } // Filter out elements in the current dragged item for (j = 0; j < list.length; j++) { if (list[j] === m[i].element[0]) { m[i].proportions().height = 0; continue droppablesLoop; } } m[i].visible = m[i].element.css("display") !== "none"; if (!m[i].visible) { continue; } // Activate the droppable if used directly from draggables if (type === "mousedown") { m[i]._activate.call(m[i], event); } m[i].offset = m[i].element.offset(); m[i].proportions({ width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight }); } }, drop: function (draggable, event) { var dropped = false; // Create a copy of the droppables in case the list changes during the drop (#9116) $.each(($.ui.ddmanager.droppables[draggable.options.scope] || []).slice(), function () { if (!this.options) { return; } if (!this.options.disabled && this.visible && intersect(draggable, this, this.options.tolerance, event)) { dropped = this._drop.call(this, event) || dropped; } if (!this.options.disabled && this.visible && this.accept.call(this.element[0], (draggable.currentItem || draggable.element))) { this.isout = true; this.isover = false; this._deactivate.call(this, event); } }); return dropped; }, dragStart: function (draggable, event) { // Listen for scrolling so that if the dragging causes scrolling the position of the // droppables can be recalculated (see #5003) draggable.element.parentsUntil("body").on("scroll.droppable", function () { if (!draggable.options.refreshPositions) { $.ui.ddmanager.prepareOffsets(draggable, event); } }); }, drag: function (draggable, event) { // If you have a highly dynamic page, you might try this option. It renders positions // every time you move the mouse. if (draggable.options.refreshPositions) { $.ui.ddmanager.prepareOffsets(draggable, event); } // Run through all droppables and check their positions based on specific tolerance options $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function () { if (this.options.disabled || this.greedyChild || !this.visible) { return; } var parentInstance, scope, parent, intersects = intersect(draggable, this, this.options.tolerance, event), c = !intersects && this.isover ? "isout" : (intersects && !this.isover ? "isover" : null); if (!c) { return; } if (this.options.greedy) { // find droppable parents with same scope scope = this.options.scope; parent = this.element.parents(":data(ui-droppable)").filter(function () { return $(this).droppable("instance").options.scope === scope; }); if (parent.length) { parentInstance = $(parent[0]).droppable("instance"); parentInstance.greedyChild = (c === "isover"); } } // We just moved into a greedy child if (parentInstance && c === "isover") { parentInstance.isover = false; parentInstance.isout = true; parentInstance._out.call(parentInstance, event); } this[c] = true; this[c === "isout" ? "isover" : "isout"] = false; this[c === "isover" ? "_over" : "_out"].call(this, event); // We just moved out of a greedy child if (parentInstance && c === "isout") { parentInstance.isout = false; parentInstance.isover = true; parentInstance._over.call(parentInstance, event); } }); }, dragStop: function (draggable, event) { draggable.element.parentsUntil("body").off("scroll.droppable"); // Call prepareOffsets one final time since IE does not fire return scroll events when // overflow was caused by drag (see #5003) if (!draggable.options.refreshPositions) { $.ui.ddmanager.prepareOffsets(draggable, event); } } }; // DEPRECATED // TODO: switch return back to widget declaration at top of file when this is removed if ($.uiBackCompat !== false) { // Backcompat for activeClass and hoverClass options $.widget("ui.droppable", $.ui.droppable, { options: { hoverClass: false, activeClass: false }, _addActiveClass: function () { this._super(); if (this.options.activeClass) { this.element.addClass(this.options.activeClass); } }, _removeActiveClass: function () { this._super(); if (this.options.activeClass) { this.element.removeClass(this.options.activeClass); } }, _addHoverClass: function () { this._super(); if (this.options.hoverClass) { this.element.addClass(this.options.hoverClass); } }, _removeHoverClass: function () { this._super(); if (this.options.hoverClass) { this.element.removeClass(this.options.hoverClass); } } }); } var widgetsDroppable = $.ui.droppable; /*! * jQuery UI Resizable 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Resizable //>>group: Interactions //>>description: Enables resize functionality for any element. //>>docs: http://api.jqueryui.com/resizable/ //>>demos: http://jqueryui.com/resizable/ //>>css.structure: ../../themes/base/core.css //>>css.structure: ../../themes/base/resizable.css //>>css.theme: ../../themes/base/theme.css $.widget("ui.resizable", $.ui.mouse, { version: "1.12.1", widgetEventPrefix: "resize", options: { alsoResize: false, animate: false, animateDuration: "slow", animateEasing: "swing", aspectRatio: false, autoHide: false, classes: { "ui-resizable-se": "ui-icon ui-icon-gripsmall-diagonal-se" }, containment: false, ghost: false, grid: false, handles: "e,s,se", helper: false, maxHeight: null, maxWidth: null, minHeight: 10, minWidth: 10, // See #7960 zIndex: 90, // Callbacks resize: null, start: null, stop: null }, _num: function (value) { return parseFloat(value) || 0; }, _isNumber: function (value) { return !isNaN(parseFloat(value)); }, _hasScroll: function (el, a) { if ($(el).css("overflow") === "hidden") { return false; } var scroll = (a && a === "left") ? "scrollLeft" : "scrollTop", has = false; if (el[scroll] > 0) { return true; } // TODO: determine which cases actually cause this to happen // if the element doesn't have the scroll set, see if it's possible to // set the scroll el[scroll] = 1; has = (el[scroll] > 0); el[scroll] = 0; return has; }, _create: function () { var margins, o = this.options, that = this; this._addClass("ui-resizable"); $.extend(this, { _aspectRatio: !!(o.aspectRatio), aspectRatio: o.aspectRatio, originalElement: this.element, _proportionallyResizeElements: [], _helper: o.helper || o.ghost || o.animate ? o.helper || "ui-resizable-helper" : null }); // Wrap the element if it cannot hold child nodes if (this.element[0].nodeName.match(/^(canvas|textarea|input|select|button|img)$/i)) { this.element.wrap( $("<div class='ui-wrapper' style='overflow: hidden;'></div>").css({ position: this.element.css("position"), width: this.element.outerWidth(), height: this.element.outerHeight(), top: this.element.css("top"), left: this.element.css("left") }) ); this.element = this.element.parent().data( "ui-resizable", this.element.resizable("instance") ); this.elementIsWrapper = true; margins = { marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom"), marginLeft: this.originalElement.css("marginLeft") }; this.element.css(margins); this.originalElement.css("margin", 0); // support: Safari // Prevent Safari textarea resize this.originalResizeStyle = this.originalElement.css("resize"); this.originalElement.css("resize", "none"); this._proportionallyResizeElements.push(this.originalElement.css({ position: "static", zoom: 1, display: "block" })); // Support: IE9 // avoid IE jump (hard set the margin) this.originalElement.css(margins); this._proportionallyResize(); } this._setupHandles(); if (o.autoHide) { $(this.element) .on("mouseenter", function () { if (o.disabled) { return; } that._removeClass("ui-resizable-autohide"); that._handles.show(); }) .on("mouseleave", function () { if (o.disabled) { return; } if (!that.resizing) { that._addClass("ui-resizable-autohide"); that._handles.hide(); } }); } this._mouseInit(); }, _destroy: function () { this._mouseDestroy(); var wrapper, _destroy = function (exp) { $(exp) .removeData("resizable") .removeData("ui-resizable") .off(".resizable") .find(".ui-resizable-handle") .remove(); }; // TODO: Unwrap at same DOM position if (this.elementIsWrapper) { _destroy(this.element); wrapper = this.element; this.originalElement.css({ position: wrapper.css("position"), width: wrapper.outerWidth(), height: wrapper.outerHeight(), top: wrapper.css("top"), left: wrapper.css("left") }).insertAfter(wrapper); wrapper.remove(); } this.originalElement.css("resize", this.originalResizeStyle); _destroy(this.originalElement); return this; }, _setOption: function (key, value) { this._super(key, value); switch (key) { case "handles": this._removeHandles(); this._setupHandles(); break; default: break; } }, _setupHandles: function () { var o = this.options, handle, i, n, hname, axis, that = this; this.handles = o.handles || (!$(".ui-resizable-handle", this.element).length ? "e,s,se" : { n: ".ui-resizable-n", e: ".ui-resizable-e", s: ".ui-resizable-s", w: ".ui-resizable-w", se: ".ui-resizable-se", sw: ".ui-resizable-sw", ne: ".ui-resizable-ne", nw: ".ui-resizable-nw" }); this._handles = $(); if (this.handles.constructor === String) { if (this.handles === "all") { this.handles = "n,e,s,w,se,sw,ne,nw"; } n = this.handles.split(","); this.handles = {}; for (i = 0; i < n.length; i++) { handle = $.trim(n[i]); hname = "ui-resizable-" + handle; axis = $("<div>"); this._addClass(axis, "ui-resizable-handle " + hname); axis.css({ zIndex: o.zIndex }); this.handles[handle] = ".ui-resizable-" + handle; this.element.append(axis); } } this._renderAxis = function (target) { var i, axis, padPos, padWrapper; target = target || this.element; for (i in this.handles) { if (this.handles[i].constructor === String) { this.handles[i] = this.element.children(this.handles[i]).first().show(); } else if (this.handles[i].jquery || this.handles[i].nodeType) { this.handles[i] = $(this.handles[i]); this._on(this.handles[i], { "mousedown": that._mouseDown }); } if (this.elementIsWrapper && this.originalElement[0] .nodeName .match(/^(textarea|input|select|button)$/i)) { axis = $(this.handles[i], this.element); padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth(); padPos = ["padding", /ne|nw|n/.test(i) ? "Top" : /se|sw|s/.test(i) ? "Bottom" : /^e$/.test(i) ? "Right" : "Left"].join(""); target.css(padPos, padWrapper); this._proportionallyResize(); } this._handles = this._handles.add(this.handles[i]); } }; // TODO: make renderAxis a prototype function this._renderAxis(this.element); this._handles = this._handles.add(this.element.find(".ui-resizable-handle")); this._handles.disableSelection(); this._handles.on("mouseover", function () { if (!that.resizing) { if (this.className) { axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i); } that.axis = axis && axis[1] ? axis[1] : "se"; } }); if (o.autoHide) { this._handles.hide(); this._addClass("ui-resizable-autohide"); } }, _removeHandles: function () { this._handles.remove(); }, _mouseCapture: function (event) { var i, handle, capture = false; for (i in this.handles) { handle = $(this.handles[i])[0]; if (handle === event.target || $.contains(handle, event.target)) { capture = true; } } return !this.options.disabled && capture; }, _mouseStart: function (event) { var curleft, curtop, cursor, o = this.options, el = this.element; this.resizing = true; this._renderProxy(); curleft = this._num(this.helper.css("left")); curtop = this._num(this.helper.css("top")); if (o.containment) { curleft += $(o.containment).scrollLeft() || 0; curtop += $(o.containment).scrollTop() || 0; } this.offset = this.helper.offset(); this.position = { left: curleft, top: curtop }; this.size = this._helper ? { width: this.helper.width(), height: this.helper.height() } : { width: el.width(), height: el.height() }; this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() }; this.originalPosition = { left: curleft, top: curtop }; this.originalMousePosition = { left: event.pageX, top: event.pageY }; this.aspectRatio = (typeof o.aspectRatio === "number") ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1); cursor = $(".ui-resizable-" + this.axis).css("cursor"); $("body").css("cursor", cursor === "auto" ? this.axis + "-resize" : cursor); this._addClass("ui-resizable-resizing"); this._propagate("start", event); return true; }, _mouseDrag: function (event) { var data, props, smp = this.originalMousePosition, a = this.axis, dx = (event.pageX - smp.left) || 0, dy = (event.pageY - smp.top) || 0, trigger = this._change[a]; this._updatePrevProperties(); if (!trigger) { return false; } data = trigger.apply(this, [event, dx, dy]); this._updateVirtualBoundaries(event.shiftKey); if (this._aspectRatio || event.shiftKey) { data = this._updateRatio(data, event); } data = this._respectSize(data, event); this._updateCache(data); this._propagate("resize", event); props = this._applyChanges(); if (!this._helper && this._proportionallyResizeElements.length) { this._proportionallyResize(); } if (!$.isEmptyObject(props)) { this._updatePrevProperties(); this._trigger("resize", event, this.ui()); this._applyChanges(); } return false; }, _mouseStop: function (event) { this.resizing = false; var pr, ista, soffseth, soffsetw, s, left, top, o = this.options, that = this; if (this._helper) { pr = this._proportionallyResizeElements; ista = pr.length && (/textarea/i).test(pr[0].nodeName); soffseth = ista && this._hasScroll(pr[0], "left") ? 0 : that.sizeDiff.height; soffsetw = ista ? 0 : that.sizeDiff.width; s = { width: (that.helper.width() - soffsetw), height: (that.helper.height() - soffseth) }; left = (parseFloat(that.element.css("left")) + (that.position.left - that.originalPosition.left)) || null; top = (parseFloat(that.element.css("top")) + (that.position.top - that.originalPosition.top)) || null; if (!o.animate) { this.element.css($.extend(s, { top: top, left: left })); } that.helper.height(that.size.height); that.helper.width(that.size.width); if (this._helper && !o.animate) { this._proportionallyResize(); } } $("body").css("cursor", "auto"); this._removeClass("ui-resizable-resizing"); this._propagate("stop", event); if (this._helper) { this.helper.remove(); } return false; }, _updatePrevProperties: function () { this.prevPosition = { top: this.position.top, left: this.position.left }; this.prevSize = { width: this.size.width, height: this.size.height }; }, _applyChanges: function () { var props = {}; if (this.position.top !== this.prevPosition.top) { props.top = this.position.top + "px"; } if (this.position.left !== this.prevPosition.left) { props.left = this.position.left + "px"; } if (this.size.width !== this.prevSize.width) { props.width = this.size.width + "px"; } if (this.size.height !== this.prevSize.height) { props.height = this.size.height + "px"; } this.helper.css(props); return props; }, _updateVirtualBoundaries: function (forceAspectRatio) { var pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b, o = this.options; b = { minWidth: this._isNumber(o.minWidth) ? o.minWidth : 0, maxWidth: this._isNumber(o.maxWidth) ? o.maxWidth : Infinity, minHeight: this._isNumber(o.minHeight) ? o.minHeight : 0, maxHeight: this._isNumber(o.maxHeight) ? o.maxHeight : Infinity }; if (this._aspectRatio || forceAspectRatio) { pMinWidth = b.minHeight * this.aspectRatio; pMinHeight = b.minWidth / this.aspectRatio; pMaxWidth = b.maxHeight * this.aspectRatio; pMaxHeight = b.maxWidth / this.aspectRatio; if (pMinWidth > b.minWidth) { b.minWidth = pMinWidth; } if (pMinHeight > b.minHeight) { b.minHeight = pMinHeight; } if (pMaxWidth < b.maxWidth) { b.maxWidth = pMaxWidth; } if (pMaxHeight < b.maxHeight) { b.maxHeight = pMaxHeight; } } this._vBoundaries = b; }, _updateCache: function (data) { this.offset = this.helper.offset(); if (this._isNumber(data.left)) { this.position.left = data.left; } if (this._isNumber(data.top)) { this.position.top = data.top; } if (this._isNumber(data.height)) { this.size.height = data.height; } if (this._isNumber(data.width)) { this.size.width = data.width; } }, _updateRatio: function (data) { var cpos = this.position, csize = this.size, a = this.axis; if (this._isNumber(data.height)) { data.width = (data.height * this.aspectRatio); } else if (this._isNumber(data.width)) { data.height = (data.width / this.aspectRatio); } if (a === "sw") { data.left = cpos.left + (csize.width - data.width); data.top = null; } if (a === "nw") { data.top = cpos.top + (csize.height - data.height); data.left = cpos.left + (csize.width - data.width); } return data; }, _respectSize: function (data) { var o = this._vBoundaries, a = this.axis, ismaxw = this._isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = this._isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height), isminw = this._isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = this._isNumber(data.height) && o.minHeight && (o.minHeight > data.height), dw = this.originalPosition.left + this.originalSize.width, dh = this.originalPosition.top + this.originalSize.height, cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a); if (isminw) { data.width = o.minWidth; } if (isminh) { data.height = o.minHeight; } if (ismaxw) { data.width = o.maxWidth; } if (ismaxh) { data.height = o.maxHeight; } if (isminw && cw) { data.left = dw - o.minWidth; } if (ismaxw && cw) { data.left = dw - o.maxWidth; } if (isminh && ch) { data.top = dh - o.minHeight; } if (ismaxh && ch) { data.top = dh - o.maxHeight; } // Fixing jump error on top/left - bug #2330 if (!data.width && !data.height && !data.left && data.top) { data.top = null; } else if (!data.width && !data.height && !data.top && data.left) { data.left = null; } return data; }, _getPaddingPlusBorderDimensions: function (element) { var i = 0, widths = [], borders = [ element.css("borderTopWidth"), element.css("borderRightWidth"), element.css("borderBottomWidth"), element.css("borderLeftWidth") ], paddings = [ element.css("paddingTop"), element.css("paddingRight"), element.css("paddingBottom"), element.css("paddingLeft") ]; for (; i < 4; i++) { widths[i] = (parseFloat(borders[i]) || 0); widths[i] += (parseFloat(paddings[i]) || 0); } return { height: widths[0] + widths[2], width: widths[1] + widths[3] }; }, _proportionallyResize: function () { if (!this._proportionallyResizeElements.length) { return; } var prel, i = 0, element = this.helper || this.element; for (; i < this._proportionallyResizeElements.length; i++) { prel = this._proportionallyResizeElements[i]; // TODO: Seems like a bug to cache this.outerDimensions // considering that we are in a loop. if (!this.outerDimensions) { this.outerDimensions = this._getPaddingPlusBorderDimensions(prel); } prel.css({ height: (element.height() - this.outerDimensions.height) || 0, width: (element.width() - this.outerDimensions.width) || 0 }); } }, _renderProxy: function () { var el = this.element, o = this.options; this.elementOffset = el.offset(); if (this._helper) { this.helper = this.helper || $("<div style='overflow:hidden;'></div>"); this._addClass(this.helper, this._helper); this.helper.css({ width: this.element.outerWidth(), height: this.element.outerHeight(), position: "absolute", left: this.elementOffset.left + "px", top: this.elementOffset.top + "px", zIndex: ++o.zIndex //TODO: Don't modify option }); this.helper .appendTo("body") .disableSelection(); } else { this.helper = this.element; } }, _change: { e: function (event, dx) { return { width: this.originalSize.width + dx }; }, w: function (event, dx) { var cs = this.originalSize, sp = this.originalPosition; return { left: sp.left + dx, width: cs.width - dx }; }, n: function (event, dx, dy) { var cs = this.originalSize, sp = this.originalPosition; return { top: sp.top + dy, height: cs.height - dy }; }, s: function (event, dx, dy) { return { height: this.originalSize.height + dy }; }, se: function (event, dx, dy) { return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); }, sw: function (event, dx, dy) { return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); }, ne: function (event, dx, dy) { return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); }, nw: function (event, dx, dy) { return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); } }, _propagate: function (n, event) { $.ui.plugin.call(this, n, [event, this.ui()]); (n !== "resize" && this._trigger(n, event, this.ui())); }, plugins: {}, ui: function () { return { originalElement: this.originalElement, element: this.element, helper: this.helper, position: this.position, size: this.size, originalSize: this.originalSize, originalPosition: this.originalPosition }; } }); /* * Resizable Extensions */ $.ui.plugin.add("resizable", "animate", { stop: function (event) { var that = $(this).resizable("instance"), o = that.options, pr = that._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), soffseth = ista && that._hasScroll(pr[0], "left") ? 0 : that.sizeDiff.height, soffsetw = ista ? 0 : that.sizeDiff.width, style = { width: (that.size.width - soffsetw), height: (that.size.height - soffseth) }, left = (parseFloat(that.element.css("left")) + (that.position.left - that.originalPosition.left)) || null, top = (parseFloat(that.element.css("top")) + (that.position.top - that.originalPosition.top)) || null; that.element.animate( $.extend(style, top && left ? { top: top, left: left } : {}), { duration: o.animateDuration, easing: o.animateEasing, step: function () { var data = { width: parseFloat(that.element.css("width")), height: parseFloat(that.element.css("height")), top: parseFloat(that.element.css("top")), left: parseFloat(that.element.css("left")) }; if (pr && pr.length) { $(pr[0]).css({ width: data.width, height: data.height }); } // Propagating resize, and updating values for each animation step that._updateCache(data); that._propagate("resize", event); } } ); } }); $.ui.plugin.add("resizable", "containment", { start: function () { var element, p, co, ch, cw, width, height, that = $(this).resizable("instance"), o = that.options, el = that.element, oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc; if (!ce) { return; } that.containerElement = $(ce); if (/document/.test(oc) || oc === document) { that.containerOffset = { left: 0, top: 0 }; that.containerPosition = { left: 0, top: 0 }; that.parentData = { element: $(document), left: 0, top: 0, width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight }; } else { element = $(ce); p = []; $(["Top", "Right", "Left", "Bottom"]).each(function (i, name) { p[i] = that._num(element.css("padding" + name)); }); that.containerOffset = element.offset(); that.containerPosition = element.position(); that.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) }; co = that.containerOffset; ch = that.containerSize.height; cw = that.containerSize.width; width = (that._hasScroll(ce, "left") ? ce.scrollWidth : cw); height = (that._hasScroll(ce) ? ce.scrollHeight : ch); that.parentData = { element: ce, left: co.left, top: co.top, width: width, height: height }; } }, resize: function (event) { var woset, hoset, isParent, isOffsetRelative, that = $(this).resizable("instance"), o = that.options, co = that.containerOffset, cp = that.position, pRatio = that._aspectRatio || event.shiftKey, cop = { top: 0, left: 0 }, ce = that.containerElement, continueResize = true; if (ce[0] !== document && (/static/).test(ce.css("position"))) { cop = co; } if (cp.left < (that._helper ? co.left : 0)) { that.size.width = that.size.width + (that._helper ? (that.position.left - co.left) : (that.position.left - cop.left)); if (pRatio) { that.size.height = that.size.width / that.aspectRatio; continueResize = false; } that.position.left = o.helper ? co.left : 0; } if (cp.top < (that._helper ? co.top : 0)) { that.size.height = that.size.height + (that._helper ? (that.position.top - co.top) : that.position.top); if (pRatio) { that.size.width = that.size.height * that.aspectRatio; continueResize = false; } that.position.top = that._helper ? co.top : 0; } isParent = that.containerElement.get(0) === that.element.parent().get(0); isOffsetRelative = /relative|absolute/.test(that.containerElement.css("position")); if (isParent && isOffsetRelative) { that.offset.left = that.parentData.left + that.position.left; that.offset.top = that.parentData.top + that.position.top; } else { that.offset.left = that.element.offset().left; that.offset.top = that.element.offset().top; } woset = Math.abs(that.sizeDiff.width + (that._helper ? that.offset.left - cop.left : (that.offset.left - co.left))); hoset = Math.abs(that.sizeDiff.height + (that._helper ? that.offset.top - cop.top : (that.offset.top - co.top))); if (woset + that.size.width >= that.parentData.width) { that.size.width = that.parentData.width - woset; if (pRatio) { that.size.height = that.size.width / that.aspectRatio; continueResize = false; } } if (hoset + that.size.height >= that.parentData.height) { that.size.height = that.parentData.height - hoset; if (pRatio) { that.size.width = that.size.height * that.aspectRatio; continueResize = false; } } if (!continueResize) { that.position.left = that.prevPosition.left; that.position.top = that.prevPosition.top; that.size.width = that.prevSize.width; that.size.height = that.prevSize.height; } }, stop: function () { var that = $(this).resizable("instance"), o = that.options, co = that.containerOffset, cop = that.containerPosition, ce = that.containerElement, helper = $(that.helper), ho = helper.offset(), w = helper.outerWidth() - that.sizeDiff.width, h = helper.outerHeight() - that.sizeDiff.height; if (that._helper && !o.animate && (/relative/).test(ce.css("position"))) { $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); } if (that._helper && !o.animate && (/static/).test(ce.css("position"))) { $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); } } }); $.ui.plugin.add("resizable", "alsoResize", { start: function () { var that = $(this).resizable("instance"), o = that.options; $(o.alsoResize).each(function () { var el = $(this); el.data("ui-resizable-alsoresize", { width: parseFloat(el.width()), height: parseFloat(el.height()), left: parseFloat(el.css("left")), top: parseFloat(el.css("top")) }); }); }, resize: function (event, ui) { var that = $(this).resizable("instance"), o = that.options, os = that.originalSize, op = that.originalPosition, delta = { height: (that.size.height - os.height) || 0, width: (that.size.width - os.width) || 0, top: (that.position.top - op.top) || 0, left: (that.position.left - op.left) || 0 }; $(o.alsoResize).each(function () { var el = $(this), start = $(this).data("ui-resizable-alsoresize"), style = {}, css = el.parents(ui.originalElement[0]).length ? ["width", "height"] : ["width", "height", "top", "left"]; $.each(css, function (i, prop) { var sum = (start[prop] || 0) + (delta[prop] || 0); if (sum && sum >= 0) { style[prop] = sum || null; } }); el.css(style); }); }, stop: function () { $(this).removeData("ui-resizable-alsoresize"); } }); $.ui.plugin.add("resizable", "ghost", { start: function () { var that = $(this).resizable("instance"), cs = that.size; that.ghost = that.originalElement.clone(); that.ghost.css({ opacity: 0.25, display: "block", position: "relative", height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 }); that._addClass(that.ghost, "ui-resizable-ghost"); // DEPRECATED // TODO: remove after 1.12 if ($.uiBackCompat !== false && typeof that.options.ghost === "string") { // Ghost option that.ghost.addClass(this.options.ghost); } that.ghost.appendTo(that.helper); }, resize: function () { var that = $(this).resizable("instance"); if (that.ghost) { that.ghost.css({ position: "relative", height: that.size.height, width: that.size.width }); } }, stop: function () { var that = $(this).resizable("instance"); if (that.ghost && that.helper) { that.helper.get(0).removeChild(that.ghost.get(0)); } } }); $.ui.plugin.add("resizable", "grid", { resize: function () { var outerDimensions, that = $(this).resizable("instance"), o = that.options, cs = that.size, os = that.originalSize, op = that.originalPosition, a = that.axis, grid = typeof o.grid === "number" ? [o.grid, o.grid] : o.grid, gridX = (grid[0] || 1), gridY = (grid[1] || 1), ox = Math.round((cs.width - os.width) / gridX) * gridX, oy = Math.round((cs.height - os.height) / gridY) * gridY, newWidth = os.width + ox, newHeight = os.height + oy, isMaxWidth = o.maxWidth && (o.maxWidth < newWidth), isMaxHeight = o.maxHeight && (o.maxHeight < newHeight), isMinWidth = o.minWidth && (o.minWidth > newWidth), isMinHeight = o.minHeight && (o.minHeight > newHeight); o.grid = grid; if (isMinWidth) { newWidth += gridX; } if (isMinHeight) { newHeight += gridY; } if (isMaxWidth) { newWidth -= gridX; } if (isMaxHeight) { newHeight -= gridY; } if (/^(se|s|e)$/.test(a)) { that.size.width = newWidth; that.size.height = newHeight; } else if (/^(ne)$/.test(a)) { that.size.width = newWidth; that.size.height = newHeight; that.position.top = op.top - oy; } else if (/^(sw)$/.test(a)) { that.size.width = newWidth; that.size.height = newHeight; that.position.left = op.left - ox; } else { if (newHeight - gridY <= 0 || newWidth - gridX <= 0) { outerDimensions = that._getPaddingPlusBorderDimensions(this); } if (newHeight - gridY > 0) { that.size.height = newHeight; that.position.top = op.top - oy; } else { newHeight = gridY - outerDimensions.height; that.size.height = newHeight; that.position.top = op.top + os.height - newHeight; } if (newWidth - gridX > 0) { that.size.width = newWidth; that.position.left = op.left - ox; } else { newWidth = gridX - outerDimensions.width; that.size.width = newWidth; that.position.left = op.left + os.width - newWidth; } } } }); var widgetsResizable = $.ui.resizable; /*! * jQuery UI Selectable 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Selectable //>>group: Interactions //>>description: Allows groups of elements to be selected with the mouse. //>>docs: http://api.jqueryui.com/selectable/ //>>demos: http://jqueryui.com/selectable/ //>>css.structure: ../../themes/base/selectable.css var widgetsSelectable = $.widget("ui.selectable", $.ui.mouse, { version: "1.12.1", options: { appendTo: "body", autoRefresh: true, distance: 0, filter: "*", tolerance: "touch", // Callbacks selected: null, selecting: null, start: null, stop: null, unselected: null, unselecting: null }, _create: function () { var that = this; this._addClass("ui-selectable"); this.dragged = false; // Cache selectee children based on filter this.refresh = function () { that.elementPos = $(that.element[0]).offset(); that.selectees = $(that.options.filter, that.element[0]); that._addClass(that.selectees, "ui-selectee"); that.selectees.each(function () { var $this = $(this), selecteeOffset = $this.offset(), pos = { left: selecteeOffset.left - that.elementPos.left, top: selecteeOffset.top - that.elementPos.top }; $.data(this, "selectable-item", { element: this, $element: $this, left: pos.left, top: pos.top, right: pos.left + $this.outerWidth(), bottom: pos.top + $this.outerHeight(), startselected: false, selected: $this.hasClass("ui-selected"), selecting: $this.hasClass("ui-selecting"), unselecting: $this.hasClass("ui-unselecting") }); }); }; this.refresh(); this._mouseInit(); this.helper = $("<div>"); this._addClass(this.helper, "ui-selectable-helper"); }, _destroy: function () { this.selectees.removeData("selectable-item"); this._mouseDestroy(); }, _mouseStart: function (event) { var that = this, options = this.options; this.opos = [event.pageX, event.pageY]; this.elementPos = $(this.element[0]).offset(); if (this.options.disabled) { return; } this.selectees = $(options.filter, this.element[0]); this._trigger("start", event); $(options.appendTo).append(this.helper); // position helper (lasso) this.helper.css({ "left": event.pageX, "top": event.pageY, "width": 0, "height": 0 }); if (options.autoRefresh) { this.refresh(); } this.selectees.filter(".ui-selected").each(function () { var selectee = $.data(this, "selectable-item"); selectee.startselected = true; if (!event.metaKey && !event.ctrlKey) { that._removeClass(selectee.$element, "ui-selected"); selectee.selected = false; that._addClass(selectee.$element, "ui-unselecting"); selectee.unselecting = true; // selectable UNSELECTING callback that._trigger("unselecting", event, { unselecting: selectee.element }); } }); $(event.target).parents().addBack().each(function () { var doSelect, selectee = $.data(this, "selectable-item"); if (selectee) { doSelect = (!event.metaKey && !event.ctrlKey) || !selectee.$element.hasClass("ui-selected"); that._removeClass(selectee.$element, doSelect ? "ui-unselecting" : "ui-selected") ._addClass(selectee.$element, doSelect ? "ui-selecting" : "ui-unselecting"); selectee.unselecting = !doSelect; selectee.selecting = doSelect; selectee.selected = doSelect; // selectable (UN)SELECTING callback if (doSelect) { that._trigger("selecting", event, { selecting: selectee.element }); } else { that._trigger("unselecting", event, { unselecting: selectee.element }); } return false; } }); }, _mouseDrag: function (event) { this.dragged = true; if (this.options.disabled) { return; } var tmp, that = this, options = this.options, x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY; if (x1 > x2) { tmp = x2; x2 = x1; x1 = tmp; } if (y1 > y2) { tmp = y2; y2 = y1; y1 = tmp; } this.helper.css({ left: x1, top: y1, width: x2 - x1, height: y2 - y1 }); this.selectees.each(function () { var selectee = $.data(this, "selectable-item"), hit = false, offset = {}; //prevent helper from being selected if appendTo: selectable if (!selectee || selectee.element === that.element[0]) { return; } offset.left = selectee.left + that.elementPos.left; offset.right = selectee.right + that.elementPos.left; offset.top = selectee.top + that.elementPos.top; offset.bottom = selectee.bottom + that.elementPos.top; if (options.tolerance === "touch") { hit = (!(offset.left > x2 || offset.right < x1 || offset.top > y2 || offset.bottom < y1)); } else if (options.tolerance === "fit") { hit = (offset.left > x1 && offset.right < x2 && offset.top > y1 && offset.bottom < y2); } if (hit) { // SELECT if (selectee.selected) { that._removeClass(selectee.$element, "ui-selected"); selectee.selected = false; } if (selectee.unselecting) { that._removeClass(selectee.$element, "ui-unselecting"); selectee.unselecting = false; } if (!selectee.selecting) { that._addClass(selectee.$element, "ui-selecting"); selectee.selecting = true; // selectable SELECTING callback that._trigger("selecting", event, { selecting: selectee.element }); } } else { // UNSELECT if (selectee.selecting) { if ((event.metaKey || event.ctrlKey) && selectee.startselected) { that._removeClass(selectee.$element, "ui-selecting"); selectee.selecting = false; that._addClass(selectee.$element, "ui-selected"); selectee.selected = true; } else { that._removeClass(selectee.$element, "ui-selecting"); selectee.selecting = false; if (selectee.startselected) { that._addClass(selectee.$element, "ui-unselecting"); selectee.unselecting = true; } // selectable UNSELECTING callback that._trigger("unselecting", event, { unselecting: selectee.element }); } } if (selectee.selected) { if (!event.metaKey && !event.ctrlKey && !selectee.startselected) { that._removeClass(selectee.$element, "ui-selected"); selectee.selected = false; that._addClass(selectee.$element, "ui-unselecting"); selectee.unselecting = true; // selectable UNSELECTING callback that._trigger("unselecting", event, { unselecting: selectee.element }); } } } }); return false; }, _mouseStop: function (event) { var that = this; this.dragged = false; $(".ui-unselecting", this.element[0]).each(function () { var selectee = $.data(this, "selectable-item"); that._removeClass(selectee.$element, "ui-unselecting"); selectee.unselecting = false; selectee.startselected = false; that._trigger("unselected", event, { unselected: selectee.element }); }); $(".ui-selecting", this.element[0]).each(function () { var selectee = $.data(this, "selectable-item"); that._removeClass(selectee.$element, "ui-selecting") ._addClass(selectee.$element, "ui-selected"); selectee.selecting = false; selectee.selected = true; selectee.startselected = true; that._trigger("selected", event, { selected: selectee.element }); }); this._trigger("stop", event); this.helper.remove(); return false; } }); /*! * jQuery UI Sortable 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Sortable //>>group: Interactions //>>description: Enables items in a list to be sorted using the mouse. //>>docs: http://api.jqueryui.com/sortable/ //>>demos: http://jqueryui.com/sortable/ //>>css.structure: ../../themes/base/sortable.css var widgetsSortable = $.widget("ui.sortable", $.ui.mouse, { version: "1.12.1", widgetEventPrefix: "sort", ready: false, options: { appendTo: "parent", axis: false, connectWith: false, containment: false, cursor: "auto", cursorAt: false, dropOnEmpty: true, forcePlaceholderSize: false, forceHelperSize: false, grid: false, handle: false, helper: "original", items: "> *", opacity: false, placeholder: false, revert: false, scroll: true, scrollSensitivity: 20, scrollSpeed: 20, scope: "default", tolerance: "intersect", zIndex: 1000, // Callbacks activate: null, beforeStop: null, change: null, deactivate: null, out: null, over: null, receive: null, remove: null, sort: null, start: null, stop: null, update: null }, _isOverAxis: function (x, reference, size) { return (x >= reference) && (x < (reference + size)); }, _isFloating: function (item) { return (/left|right/).test(item.css("float")) || (/inline|table-cell/).test(item.css("display")); }, _create: function () { this.containerCache = {}; this._addClass("ui-sortable"); //Get the items this.refresh(); //Let's determine the parent's offset this.offset = this.element.offset(); //Initialize mouse events for interaction this._mouseInit(); this._setHandleClassName(); //We're ready to go this.ready = true; }, _setOption: function (key, value) { this._super(key, value); if (key === "handle") { this._setHandleClassName(); } }, _setHandleClassName: function () { var that = this; this._removeClass(this.element.find(".ui-sortable-handle"), "ui-sortable-handle"); $.each(this.items, function () { that._addClass( this.instance.options.handle ? this.item.find(this.instance.options.handle) : this.item, "ui-sortable-handle" ); }); }, _destroy: function () { this._mouseDestroy(); for (var i = this.items.length - 1; i >= 0; i--) { this.items[i].item.removeData(this.widgetName + "-item"); } return this; }, _mouseCapture: function (event, overrideHandle) { var currentItem = null, validHandle = false, that = this; if (this.reverting) { return false; } if (this.options.disabled || this.options.type === "static") { return false; } //We have to refresh the items data once first this._refreshItems(event); //Find out if the clicked node (or one of its parents) is a actual item in this.items $(event.target).parents().each(function () { if ($.data(this, that.widgetName + "-item") === that) { currentItem = $(this); return false; } }); if ($.data(event.target, that.widgetName + "-item") === that) { currentItem = $(event.target); } if (!currentItem) { return false; } if (this.options.handle && !overrideHandle) { $(this.options.handle, currentItem).find("*").addBack().each(function () { if (this === event.target) { validHandle = true; } }); if (!validHandle) { return false; } } this.currentItem = currentItem; this._removeCurrentsFromItems(); return true; }, _mouseStart: function (event, overrideHandle, noActivation) { var i, body, o = this.options; this.currentContainer = this; //We only need to call refreshPositions, because the refreshItems call has been moved to // mouseCapture this.refreshPositions(); //Create and append the visible helper this.helper = this._createHelper(event); //Cache the helper size this._cacheHelperProportions(); /* * - Position generation - * This block generates everything position related - it's the core of draggables. */ //Cache the margins of the original element this._cacheMargins(); //Get the next scrolling parent this.scrollParent = this.helper.scrollParent(); //The element's absolute position on the page minus margins this.offset = this.currentItem.offset(); this.offset = { top: this.offset.top - this.margins.top, left: this.offset.left - this.margins.left }; $.extend(this.offset, { click: { //Where the click happened, relative to the element left: event.pageX - this.offset.left, top: event.pageY - this.offset.top }, parent: this._getParentOffset(), // This is a relative to absolute position minus the actual position calculation - // only used for relative positioned helper relative: this._getRelativeOffset() }); // Only after we got the offset, we can change the helper's position to absolute // TODO: Still need to figure out a way to make relative sorting possible this.helper.css("position", "absolute"); this.cssPosition = this.helper.css("position"); //Generate the original position this.originalPosition = this._generatePosition(event); this.originalPageX = event.pageX; this.originalPageY = event.pageY; //Adjust the mouse offset relative to the helper if "cursorAt" is supplied (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); //Cache the former DOM position this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] }; // If the helper is not the original, hide the original so it's not playing any role during // the drag, won't cause anything bad this way if (this.helper[0] !== this.currentItem[0]) { this.currentItem.hide(); } //Create the placeholder this._createPlaceholder(); //Set a containment if given in the options if (o.containment) { this._setContainment(); } if (o.cursor && o.cursor !== "auto") { // cursor option body = this.document.find("body"); // Support: IE this.storedCursor = body.css("cursor"); body.css("cursor", o.cursor); this.storedStylesheet = $("<style>*{ cursor: " + o.cursor + " !important; }</style>").appendTo(body); } if (o.opacity) { // opacity option if (this.helper.css("opacity")) { this._storedOpacity = this.helper.css("opacity"); } this.helper.css("opacity", o.opacity); } if (o.zIndex) { // zIndex option if (this.helper.css("zIndex")) { this._storedZIndex = this.helper.css("zIndex"); } this.helper.css("zIndex", o.zIndex); } //Prepare scrolling if (this.scrollParent[0] !== this.document[0] && this.scrollParent[0].tagName !== "HTML") { this.overflowOffset = this.scrollParent.offset(); } //Call callbacks this._trigger("start", event, this._uiHash()); //Recache the helper size if (!this._preserveHelperProportions) { this._cacheHelperProportions(); } //Post "activate" events to possible containers if (!noActivation) { for (i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, this._uiHash(this)); } } //Prepare possible droppables if ($.ui.ddmanager) { $.ui.ddmanager.current = this; } if ($.ui.ddmanager && !o.dropBehaviour) { $.ui.ddmanager.prepareOffsets(this, event); } this.dragging = true; this._addClass(this.helper, "ui-sortable-helper"); // Execute the drag once - this causes the helper not to be visiblebefore getting its // correct position this._mouseDrag(event); return true; }, _mouseDrag: function (event) { var i, item, itemElement, intersection, o = this.options, scrolled = false; //Compute the helpers position this.position = this._generatePosition(event); this.positionAbs = this._convertPositionTo("absolute"); if (!this.lastPositionAbs) { this.lastPositionAbs = this.positionAbs; } //Do scrolling if (this.options.scroll) { if (this.scrollParent[0] !== this.document[0] && this.scrollParent[0].tagName !== "HTML") { if ((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) { this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed; } else if (event.pageY - this.overflowOffset.top < o.scrollSensitivity) { this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed; } if ((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) { this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed; } else if (event.pageX - this.overflowOffset.left < o.scrollSensitivity) { this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed; } } else { if (event.pageY - this.document.scrollTop() < o.scrollSensitivity) { scrolled = this.document.scrollTop(this.document.scrollTop() - o.scrollSpeed); } else if (this.window.height() - (event.pageY - this.document.scrollTop()) < o.scrollSensitivity) { scrolled = this.document.scrollTop(this.document.scrollTop() + o.scrollSpeed); } if (event.pageX - this.document.scrollLeft() < o.scrollSensitivity) { scrolled = this.document.scrollLeft( this.document.scrollLeft() - o.scrollSpeed ); } else if (this.window.width() - (event.pageX - this.document.scrollLeft()) < o.scrollSensitivity) { scrolled = this.document.scrollLeft( this.document.scrollLeft() + o.scrollSpeed ); } } if (scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) { $.ui.ddmanager.prepareOffsets(this, event); } } //Regenerate the absolute position used for position checks this.positionAbs = this._convertPositionTo("absolute"); //Set the helper position if (!this.options.axis || this.options.axis !== "y") { this.helper[0].style.left = this.position.left + "px"; } if (!this.options.axis || this.options.axis !== "x") { this.helper[0].style.top = this.position.top + "px"; } //Rearrange for (i = this.items.length - 1; i >= 0; i--) { //Cache variables and intersection, continue if no intersection item = this.items[i]; itemElement = item.item[0]; intersection = this._intersectsWithPointer(item); if (!intersection) { continue; } // Only put the placeholder inside the current Container, skip all // items from other containers. This works because when moving // an item from one container to another the // currentContainer is switched before the placeholder is moved. // // Without this, moving items in "sub-sortables" can cause // the placeholder to jitter between the outer and inner container. if (item.instance !== this.currentContainer) { continue; } // Cannot intersect with itself // no useless actions that have been done before // no action if the item moved is the parent of the item checked if (itemElement !== this.currentItem[0] && this.placeholder[intersection === 1 ? "next" : "prev"]()[0] !== itemElement && !$.contains(this.placeholder[0], itemElement) && (this.options.type === "semi-dynamic" ? !$.contains(this.element[0], itemElement) : true ) ) { this.direction = intersection === 1 ? "down" : "up"; if (this.options.tolerance === "pointer" || this._intersectsWithSides(item)) { this._rearrange(event, item); } else { break; } this._trigger("change", event, this._uiHash()); break; } } //Post events to containers this._contactContainers(event); //Interconnect with droppables if ($.ui.ddmanager) { $.ui.ddmanager.drag(this, event); } //Call callbacks this._trigger("sort", event, this._uiHash()); this.lastPositionAbs = this.positionAbs; return false; }, _mouseStop: function (event, noPropagation) { if (!event) { return; } //If we are using droppables, inform the manager about the drop if ($.ui.ddmanager && !this.options.dropBehaviour) { $.ui.ddmanager.drop(this, event); } if (this.options.revert) { var that = this, cur = this.placeholder.offset(), axis = this.options.axis, animation = {}; if (!axis || axis === "x") { animation.left = cur.left - this.offset.parent.left - this.margins.left + (this.offsetParent[0] === this.document[0].body ? 0 : this.offsetParent[0].scrollLeft ); } if (!axis || axis === "y") { animation.top = cur.top - this.offset.parent.top - this.margins.top + (this.offsetParent[0] === this.document[0].body ? 0 : this.offsetParent[0].scrollTop ); } this.reverting = true; $(this.helper).animate( animation, parseInt(this.options.revert, 10) || 500, function () { that._clear(event); } ); } else { this._clear(event, noPropagation); } return false; }, cancel: function () { if (this.dragging) { this._mouseUp(new $.Event("mouseup", { target: null })); if (this.options.helper === "original") { this.currentItem.css(this._storedCSS); this._removeClass(this.currentItem, "ui-sortable-helper"); } else { this.currentItem.show(); } //Post deactivating events to containers for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("deactivate", null, this._uiHash(this)); if (this.containers[i].containerCache.over) { this.containers[i]._trigger("out", null, this._uiHash(this)); this.containers[i].containerCache.over = 0; } } } if (this.placeholder) { //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, // it unbinds ALL events from the original node! if (this.placeholder[0].parentNode) { this.placeholder[0].parentNode.removeChild(this.placeholder[0]); } if (this.options.helper !== "original" && this.helper && this.helper[0].parentNode) { this.helper.remove(); } $.extend(this, { helper: null, dragging: false, reverting: false, _noFinalSort: null }); if (this.domPosition.prev) { $(this.domPosition.prev).after(this.currentItem); } else { $(this.domPosition.parent).prepend(this.currentItem); } } return this; }, serialize: function (o) { var items = this._getItemsAsjQuery(o && o.connected), str = []; o = o || {}; $(items).each(function () { var res = ($(o.item || this).attr(o.attribute || "id") || "") .match(o.expression || (/(.+)[\-=_](.+)/)); if (res) { str.push( (o.key || res[1] + "[]") + "=" + (o.key && o.expression ? res[1] : res[2])); } }); if (!str.length && o.key) { str.push(o.key + "="); } return str.join("&"); }, toArray: function (o) { var items = this._getItemsAsjQuery(o && o.connected), ret = []; o = o || {}; items.each(function () { ret.push($(o.item || this).attr(o.attribute || "id") || ""); }); return ret; }, /* Be careful with the following core functions */ _intersectsWith: function (item) { var x1 = this.positionAbs.left, x2 = x1 + this.helperProportions.width, y1 = this.positionAbs.top, y2 = y1 + this.helperProportions.height, l = item.left, r = l + item.width, t = item.top, b = t + item.height, dyClick = this.offset.click.top, dxClick = this.offset.click.left, isOverElementHeight = (this.options.axis === "x") || ((y1 + dyClick) > t && (y1 + dyClick) < b), isOverElementWidth = (this.options.axis === "y") || ((x1 + dxClick) > l && (x1 + dxClick) < r), isOverElement = isOverElementHeight && isOverElementWidth; if (this.options.tolerance === "pointer" || this.options.forcePointerForContainers || (this.options.tolerance !== "pointer" && this.helperProportions[this.floating ? "width" : "height"] > item[this.floating ? "width" : "height"]) ) { return isOverElement; } else { return (l < x1 + (this.helperProportions.width / 2) && // Right Half x2 - (this.helperProportions.width / 2) < r && // Left Half t < y1 + (this.helperProportions.height / 2) && // Bottom Half y2 - (this.helperProportions.height / 2) < b); // Top Half } }, _intersectsWithPointer: function (item) { var verticalDirection, horizontalDirection, isOverElementHeight = (this.options.axis === "x") || this._isOverAxis( this.positionAbs.top + this.offset.click.top, item.top, item.height), isOverElementWidth = (this.options.axis === "y") || this._isOverAxis( this.positionAbs.left + this.offset.click.left, item.left, item.width), isOverElement = isOverElementHeight && isOverElementWidth; if (!isOverElement) { return false; } verticalDirection = this._getDragVerticalDirection(); horizontalDirection = this._getDragHorizontalDirection(); return this.floating ? ((horizontalDirection === "right" || verticalDirection === "down") ? 2 : 1) : (verticalDirection && (verticalDirection === "down" ? 2 : 1)); }, _intersectsWithSides: function (item) { var isOverBottomHalf = this._isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height / 2), item.height), isOverRightHalf = this._isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width / 2), item.width), verticalDirection = this._getDragVerticalDirection(), horizontalDirection = this._getDragHorizontalDirection(); if (this.floating && horizontalDirection) { return ((horizontalDirection === "right" && isOverRightHalf) || (horizontalDirection === "left" && !isOverRightHalf)); } else { return verticalDirection && ((verticalDirection === "down" && isOverBottomHalf) || (verticalDirection === "up" && !isOverBottomHalf)); } }, _getDragVerticalDirection: function () { var delta = this.positionAbs.top - this.lastPositionAbs.top; return delta !== 0 && (delta > 0 ? "down" : "up"); }, _getDragHorizontalDirection: function () { var delta = this.positionAbs.left - this.lastPositionAbs.left; return delta !== 0 && (delta > 0 ? "right" : "left"); }, refresh: function (event) { this._refreshItems(event); this._setHandleClassName(); this.refreshPositions(); return this; }, _connectWith: function () { var options = this.options; return options.connectWith.constructor === String ? [options.connectWith] : options.connectWith; }, _getItemsAsjQuery: function (connected) { var i, j, cur, inst, items = [], queries = [], connectWith = this._connectWith(); if (connectWith && connected) { for (i = connectWith.length - 1; i >= 0; i--) { cur = $(connectWith[i], this.document[0]); for (j = cur.length - 1; j >= 0; j--) { inst = $.data(cur[j], this.widgetFullName); if (inst && inst !== this && !inst.options.disabled) { queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element) .not(".ui-sortable-helper") .not(".ui-sortable-placeholder"), inst]); } } } } queries.push([$.isFunction(this.options.items) ? this.options.items .call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element) .not(".ui-sortable-helper") .not(".ui-sortable-placeholder"), this]); function addItems() { items.push(this); } for (i = queries.length - 1; i >= 0; i--) { queries[i][0].each(addItems); } return $(items); }, _removeCurrentsFromItems: function () { var list = this.currentItem.find(":data(" + this.widgetName + "-item)"); this.items = $.grep(this.items, function (item) { for (var j = 0; j < list.length; j++) { if (list[j] === item.item[0]) { return false; } } return true; }); }, _refreshItems: function (event) { this.items = []; this.containers = [this]; var i, j, cur, inst, targetData, _queries, item, queriesLength, items = this.items, queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]], connectWith = this._connectWith(); //Shouldn't be run the first time through due to massive slow-down if (connectWith && this.ready) { for (i = connectWith.length - 1; i >= 0; i--) { cur = $(connectWith[i], this.document[0]); for (j = cur.length - 1; j >= 0; j--) { inst = $.data(cur[j], this.widgetFullName); if (inst && inst !== this && !inst.options.disabled) { queries.push([$.isFunction(inst.options.items) ? inst.options.items .call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]); this.containers.push(inst); } } } } for (i = queries.length - 1; i >= 0; i--) { targetData = queries[i][1]; _queries = queries[i][0]; for (j = 0, queriesLength = _queries.length; j < queriesLength; j++) { item = $(_queries[j]); // Data for target checking (mouse manager) item.data(this.widgetName + "-item", targetData); items.push({ item: item, instance: targetData, width: 0, height: 0, left: 0, top: 0 }); } } }, refreshPositions: function (fast) { // Determine whether items are being displayed horizontally this.floating = this.items.length ? this.options.axis === "x" || this._isFloating(this.items[0].item) : false; //This has to be redone because due to the item being moved out/into the offsetParent, // the offsetParent's position will change if (this.offsetParent && this.helper) { this.offset.parent = this._getParentOffset(); } var i, item, t, p; for (i = this.items.length - 1; i >= 0; i--) { item = this.items[i]; //We ignore calculating positions of all connected containers when we're not over them if (item.instance !== this.currentContainer && this.currentContainer && item.item[0] !== this.currentItem[0]) { continue; } t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item; if (!fast) { item.width = t.outerWidth(); item.height = t.outerHeight(); } p = t.offset(); item.left = p.left; item.top = p.top; } if (this.options.custom && this.options.custom.refreshContainers) { this.options.custom.refreshContainers.call(this); } else { for (i = this.containers.length - 1; i >= 0; i--) { p = this.containers[i].element.offset(); this.containers[i].containerCache.left = p.left; this.containers[i].containerCache.top = p.top; this.containers[i].containerCache.width = this.containers[i].element.outerWidth(); this.containers[i].containerCache.height = this.containers[i].element.outerHeight(); } } return this; }, _createPlaceholder: function (that) { that = that || this; var className, o = that.options; if (!o.placeholder || o.placeholder.constructor === String) { className = o.placeholder; o.placeholder = { element: function () { var nodeName = that.currentItem[0].nodeName.toLowerCase(), element = $("<" + nodeName + ">", that.document[0]); that._addClass(element, "ui-sortable-placeholder", className || that.currentItem[0].className) ._removeClass(element, "ui-sortable-helper"); if (nodeName === "tbody") { that._createTrPlaceholder( that.currentItem.find("tr").eq(0), $("<tr>", that.document[0]).appendTo(element) ); } else if (nodeName === "tr") { that._createTrPlaceholder(that.currentItem, element); } else if (nodeName === "img") { element.attr("src", that.currentItem.attr("src")); } if (!className) { element.css("visibility", "hidden"); } return element; }, update: function (container, p) { // 1. If a className is set as 'placeholder option, we don't force sizes - // the class is responsible for that // 2. The option 'forcePlaceholderSize can be enabled to force it even if a // class name is specified if (className && !o.forcePlaceholderSize) { return; } //If the element doesn't have a actual height by itself (without styles coming // from a stylesheet), it receives the inline height from the dragged item if (!p.height()) { p.height( that.currentItem.innerHeight() - parseInt(that.currentItem.css("paddingTop") || 0, 10) - parseInt(that.currentItem.css("paddingBottom") || 0, 10)); } if (!p.width()) { p.width( that.currentItem.innerWidth() - parseInt(that.currentItem.css("paddingLeft") || 0, 10) - parseInt(that.currentItem.css("paddingRight") || 0, 10)); } } }; } //Create the placeholder that.placeholder = $(o.placeholder.element.call(that.element, that.currentItem)); //Append it after the actual current item that.currentItem.after(that.placeholder); //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317) o.placeholder.update(that, that.placeholder); }, _createTrPlaceholder: function (sourceTr, targetTr) { var that = this; sourceTr.children().each(function () { $("<td> </td>", that.document[0]) .attr("colspan", $(this).attr("colspan") || 1) .appendTo(targetTr); }); }, _contactContainers: function (event) { var i, j, dist, itemWithLeastDistance, posProperty, sizeProperty, cur, nearBottom, floating, axis, innermostContainer = null, innermostIndex = null; // Get innermost container that intersects with item for (i = this.containers.length - 1; i >= 0; i--) { // Never consider a container that's located within the item itself if ($.contains(this.currentItem[0], this.containers[i].element[0])) { continue; } if (this._intersectsWith(this.containers[i].containerCache)) { // If we've already found a container and it's more "inner" than this, then continue if (innermostContainer && $.contains( this.containers[i].element[0], innermostContainer.element[0])) { continue; } innermostContainer = this.containers[i]; innermostIndex = i; } else { // container doesn't intersect. trigger "out" event if necessary if (this.containers[i].containerCache.over) { this.containers[i]._trigger("out", event, this._uiHash(this)); this.containers[i].containerCache.over = 0; } } } // If no intersecting containers found, return if (!innermostContainer) { return; } // Move the item into the container if it's not there already if (this.containers.length === 1) { if (!this.containers[innermostIndex].containerCache.over) { this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); this.containers[innermostIndex].containerCache.over = 1; } } else { // When entering a new container, we will find the item with the least distance and // append our item near it dist = 10000; itemWithLeastDistance = null; floating = innermostContainer.floating || this._isFloating(this.currentItem); posProperty = floating ? "left" : "top"; sizeProperty = floating ? "width" : "height"; axis = floating ? "pageX" : "pageY"; for (j = this.items.length - 1; j >= 0; j--) { if (!$.contains( this.containers[innermostIndex].element[0], this.items[j].item[0]) ) { continue; } if (this.items[j].item[0] === this.currentItem[0]) { continue; } cur = this.items[j].item.offset()[posProperty]; nearBottom = false; if (event[axis] - cur > this.items[j][sizeProperty] / 2) { nearBottom = true; } if (Math.abs(event[axis] - cur) < dist) { dist = Math.abs(event[axis] - cur); itemWithLeastDistance = this.items[j]; this.direction = nearBottom ? "up" : "down"; } } //Check if dropOnEmpty is enabled if (!itemWithLeastDistance && !this.options.dropOnEmpty) { return; } if (this.currentContainer === this.containers[innermostIndex]) { if (!this.currentContainer.containerCache.over) { this.containers[innermostIndex]._trigger("over", event, this._uiHash()); this.currentContainer.containerCache.over = 1; } return; } itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true); this._trigger("change", event, this._uiHash()); this.containers[innermostIndex]._trigger("change", event, this._uiHash(this)); this.currentContainer = this.containers[innermostIndex]; //Update the placeholder this.options.placeholder.update(this.currentContainer, this.placeholder); this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); this.containers[innermostIndex].containerCache.over = 1; } }, _createHelper: function (event) { var o = this.options, helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper === "clone" ? this.currentItem.clone() : this.currentItem); //Add the helper to the DOM if that didn't happen already if (!helper.parents("body").length) { $(o.appendTo !== "parent" ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]); } if (helper[0] === this.currentItem[0]) { this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") }; } if (!helper[0].style.width || o.forceHelperSize) { helper.width(this.currentItem.width()); } if (!helper[0].style.height || o.forceHelperSize) { helper.height(this.currentItem.height()); } return helper; }, _adjustOffsetFromHelper: function (obj) { if (typeof obj === "string") { obj = obj.split(" "); } if ($.isArray(obj)) { obj = { left: +obj[0], top: +obj[1] || 0 }; } if ("left" in obj) { this.offset.click.left = obj.left + this.margins.left; } if ("right" in obj) { this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; } if ("top" in obj) { this.offset.click.top = obj.top + this.margins.top; } if ("bottom" in obj) { this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; } }, _getParentOffset: function () { //Get the offsetParent and cache its position this.offsetParent = this.helper.offsetParent(); var po = this.offsetParent.offset(); // This is a special case where we need to modify a offset calculated on start, since the // following happened: // 1. The position of the helper is absolute, so it's position is calculated based on the // next positioned parent // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't // the document, which means that the scroll is included in the initial calculation of the // offset of the parent, and never recalculated upon drag if (this.cssPosition === "absolute" && this.scrollParent[0] !== this.document[0] && $.contains(this.scrollParent[0], this.offsetParent[0])) { po.left += this.scrollParent.scrollLeft(); po.top += this.scrollParent.scrollTop(); } // This needs to be actually done for all browsers, since pageX/pageY includes this // information with an ugly IE fix if (this.offsetParent[0] === this.document[0].body || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() === "html" && $.ui.ie)) { po = { top: 0, left: 0 }; } return { top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"), 10) || 0), left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"), 10) || 0) }; }, _getRelativeOffset: function () { if (this.cssPosition === "relative") { var p = this.currentItem.position(); return { top: p.top - (parseInt(this.helper.css("top"), 10) || 0) + this.scrollParent.scrollTop(), left: p.left - (parseInt(this.helper.css("left"), 10) || 0) + this.scrollParent.scrollLeft() }; } else { return { top: 0, left: 0 }; } }, _cacheMargins: function () { this.margins = { left: (parseInt(this.currentItem.css("marginLeft"), 10) || 0), top: (parseInt(this.currentItem.css("marginTop"), 10) || 0) }; }, _cacheHelperProportions: function () { this.helperProportions = { width: this.helper.outerWidth(), height: this.helper.outerHeight() }; }, _setContainment: function () { var ce, co, over, o = this.options; if (o.containment === "parent") { o.containment = this.helper[0].parentNode; } if (o.containment === "document" || o.containment === "window") { this.containment = [ 0 - this.offset.relative.left - this.offset.parent.left, 0 - this.offset.relative.top - this.offset.parent.top, o.containment === "document" ? this.document.width() : this.window.width() - this.helperProportions.width - this.margins.left, (o.containment === "document" ? (this.document.height() || document.body.parentNode.scrollHeight) : this.window.height() || this.document[0].body.parentNode.scrollHeight ) - this.helperProportions.height - this.margins.top ]; } if (!(/^(document|window|parent)$/).test(o.containment)) { ce = $(o.containment)[0]; co = $(o.containment).offset(); over = ($(ce).css("overflow") !== "hidden"); this.containment = [ co.left + (parseInt($(ce).css("borderLeftWidth"), 10) || 0) + (parseInt($(ce).css("paddingLeft"), 10) || 0) - this.margins.left, co.top + (parseInt($(ce).css("borderTopWidth"), 10) || 0) + (parseInt($(ce).css("paddingTop"), 10) || 0) - this.margins.top, co.left + (over ? Math.max(ce.scrollWidth, ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"), 10) || 0) - (parseInt($(ce).css("paddingRight"), 10) || 0) - this.helperProportions.width - this.margins.left, co.top + (over ? Math.max(ce.scrollHeight, ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"), 10) || 0) - (parseInt($(ce).css("paddingBottom"), 10) || 0) - this.helperProportions.height - this.margins.top ]; } }, _convertPositionTo: function (d, pos) { if (!pos) { pos = this.position; } var mod = d === "absolute" ? 1 : -1, scroll = this.cssPosition === "absolute" && !(this.scrollParent[0] !== this.document[0] && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); return { top: ( // The absolute mouse position pos.top + // Only for relative positioned nodes: Relative offset from element to offset parent this.offset.relative.top * mod + // The offsetParent's offset without borders (offset + border) this.offset.parent.top * mod - ((this.cssPosition === "fixed" ? -this.scrollParent.scrollTop() : (scrollIsRootNode ? 0 : scroll.scrollTop())) * mod) ), left: ( // The absolute mouse position pos.left + // Only for relative positioned nodes: Relative offset from element to offset parent this.offset.relative.left * mod + // The offsetParent's offset without borders (offset + border) this.offset.parent.left * mod - ((this.cssPosition === "fixed" ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft()) * mod) ) }; }, _generatePosition: function (event) { var top, left, o = this.options, pageX = event.pageX, pageY = event.pageY, scroll = this.cssPosition === "absolute" && !(this.scrollParent[0] !== this.document[0] && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); // This is another very weird special case that only happens for relative elements: // 1. If the css position is relative // 2. and the scroll parent is the document or similar to the offset parent // we have to refresh the relative offset during the scroll so there are no jumps if (this.cssPosition === "relative" && !(this.scrollParent[0] !== this.document[0] && this.scrollParent[0] !== this.offsetParent[0])) { this.offset.relative = this._getRelativeOffset(); } /* * - Position constraining - * Constrain the position to a mix of grid, containment. */ if (this.originalPosition) { //If we are not dragging yet, we won't check for options if (this.containment) { if (event.pageX - this.offset.click.left < this.containment[0]) { pageX = this.containment[0] + this.offset.click.left; } if (event.pageY - this.offset.click.top < this.containment[1]) { pageY = this.containment[1] + this.offset.click.top; } if (event.pageX - this.offset.click.left > this.containment[2]) { pageX = this.containment[2] + this.offset.click.left; } if (event.pageY - this.offset.click.top > this.containment[3]) { pageY = this.containment[3] + this.offset.click.top; } } if (o.grid) { top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; pageY = this.containment ? ((top - this.offset.click.top >= this.containment[1] && top - this.offset.click.top <= this.containment[3]) ? top : ((top - this.offset.click.top >= this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; pageX = this.containment ? ((left - this.offset.click.left >= this.containment[0] && left - this.offset.click.left <= this.containment[2]) ? left : ((left - this.offset.click.left >= this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; } } return { top: ( // The absolute mouse position pageY - // Click offset (relative to the element) this.offset.click.top - // Only for relative positioned nodes: Relative offset from element to offset parent this.offset.relative.top - // The offsetParent's offset without borders (offset + border) this.offset.parent.top + ((this.cssPosition === "fixed" ? -this.scrollParent.scrollTop() : (scrollIsRootNode ? 0 : scroll.scrollTop()))) ), left: ( // The absolute mouse position pageX - // Click offset (relative to the element) this.offset.click.left - // Only for relative positioned nodes: Relative offset from element to offset parent this.offset.relative.left - // The offsetParent's offset without borders (offset + border) this.offset.parent.left + ((this.cssPosition === "fixed" ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft())) ) }; }, _rearrange: function (event, i, a, hardRefresh) { a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction === "down" ? i.item[0] : i.item[0].nextSibling)); //Various things done here to improve the performance: // 1. we create a setTimeout, that calls refreshPositions // 2. on the instance, we have a counter variable, that get's higher after every append // 3. on the local scope, we copy the counter variable, and check in the timeout, // if it's still the same // 4. this lets only the last addition to the timeout stack through this.counter = this.counter ? ++this.counter : 1; var counter = this.counter; this._delay(function () { if (counter === this.counter) { //Precompute after each DOM insertion, NOT on mousemove this.refreshPositions(!hardRefresh); } }); }, _clear: function (event, noPropagation) { this.reverting = false; // We delay all events that have to be triggered to after the point where the placeholder // has been removed and everything else normalized again var i, delayedTriggers = []; // We first have to update the dom position of the actual currentItem // Note: don't do it if the current item is already removed (by a user), or it gets // reappended (see #4088) if (!this._noFinalSort && this.currentItem.parent().length) { this.placeholder.before(this.currentItem); } this._noFinalSort = null; if (this.helper[0] === this.currentItem[0]) { for (i in this._storedCSS) { if (this._storedCSS[i] === "auto" || this._storedCSS[i] === "static") { this._storedCSS[i] = ""; } } this.currentItem.css(this._storedCSS); this._removeClass(this.currentItem, "ui-sortable-helper"); } else { this.currentItem.show(); } if (this.fromOutside && !noPropagation) { delayedTriggers.push(function (event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); }); } if ((this.fromOutside || this.domPosition.prev !== this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent !== this.currentItem.parent()[0]) && !noPropagation) { // Trigger update callback if the DOM position has changed delayedTriggers.push(function (event) { this._trigger("update", event, this._uiHash()); }); } // Check if the items Container has Changed and trigger appropriate // events. if (this !== this.currentContainer) { if (!noPropagation) { delayedTriggers.push(function (event) { this._trigger("remove", event, this._uiHash()); }); delayedTriggers.push((function (c) { return function (event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.currentContainer)); delayedTriggers.push((function (c) { return function (event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.currentContainer)); } } //Post events to containers function delayEvent(type, instance, container) { return function (event) { container._trigger(type, event, instance._uiHash(instance)); }; } for (i = this.containers.length - 1; i >= 0; i--) { if (!noPropagation) { delayedTriggers.push(delayEvent("deactivate", this, this.containers[i])); } if (this.containers[i].containerCache.over) { delayedTriggers.push(delayEvent("out", this, this.containers[i])); this.containers[i].containerCache.over = 0; } } //Do what was originally in plugins if (this.storedCursor) { this.document.find("body").css("cursor", this.storedCursor); this.storedStylesheet.remove(); } if (this._storedOpacity) { this.helper.css("opacity", this._storedOpacity); } if (this._storedZIndex) { this.helper.css("zIndex", this._storedZIndex === "auto" ? "" : this._storedZIndex); } this.dragging = false; if (!noPropagation) { this._trigger("beforeStop", event, this._uiHash()); } //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, // it unbinds ALL events from the original node! this.placeholder[0].parentNode.removeChild(this.placeholder[0]); if (!this.cancelHelperRemoval) { if (this.helper[0] !== this.currentItem[0]) { this.helper.remove(); } this.helper = null; } if (!noPropagation) { for (i = 0; i < delayedTriggers.length; i++) { // Trigger all delayed events delayedTriggers[i].call(this, event); } this._trigger("stop", event, this._uiHash()); } this.fromOutside = false; return !this.cancelHelperRemoval; }, _trigger: function () { if ($.Widget.prototype._trigger.apply(this, arguments) === false) { this.cancel(); } }, _uiHash: function (_inst) { var inst = _inst || this; return { helper: inst.helper, placeholder: inst.placeholder || $([]), position: inst.position, originalPosition: inst.originalPosition, offset: inst.positionAbs, item: inst.currentItem, sender: _inst ? _inst.element : null }; } }); /*! * jQuery UI Accordion 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Accordion //>>group: Widgets // jscs:disable maximumLineLength //>>description: Displays collapsible content panels for presenting information in a limited amount of space. // jscs:enable maximumLineLength //>>docs: http://api.jqueryui.com/accordion/ //>>demos: http://jqueryui.com/accordion/ //>>css.structure: ../../themes/base/core.css //>>css.structure: ../../themes/base/accordion.css //>>css.theme: ../../themes/base/theme.css var widgetsAccordion = $.widget("ui.accordion", { version: "1.12.1", options: { active: 0, animate: {}, classes: { "ui-accordion-header": "ui-corner-top", "ui-accordion-header-collapsed": "ui-corner-all", "ui-accordion-content": "ui-corner-bottom" }, collapsible: false, event: "click", header: "> li > :first-child, > :not(li):even", heightStyle: "auto", icons: { activeHeader: "ui-icon-triangle-1-s", header: "ui-icon-triangle-1-e" }, // Callbacks activate: null, beforeActivate: null }, hideProps: { borderTopWidth: "hide", borderBottomWidth: "hide", paddingTop: "hide", paddingBottom: "hide", height: "hide" }, showProps: { borderTopWidth: "show", borderBottomWidth: "show", paddingTop: "show", paddingBottom: "show", height: "show" }, _create: function () { var options = this.options; this.prevShow = this.prevHide = $(); this._addClass("ui-accordion", "ui-widget ui-helper-reset"); this.element.attr("role", "tablist"); // Don't allow collapsible: false and active: false / null if (!options.collapsible && (options.active === false || options.active == null)) { options.active = 0; } this._processPanels(); // handle negative values if (options.active < 0) { options.active += this.headers.length; } this._refresh(); }, _getCreateEventData: function () { return { header: this.active, panel: !this.active.length ? $() : this.active.next() }; }, _createIcons: function () { var icon, children, icons = this.options.icons; if (icons) { icon = $("<span>"); this._addClass(icon, "ui-accordion-header-icon", "ui-icon " + icons.header); icon.prependTo(this.headers); children = this.active.children(".ui-accordion-header-icon"); this._removeClass(children, icons.header) ._addClass(children, null, icons.activeHeader) ._addClass(this.headers, "ui-accordion-icons"); } }, _destroyIcons: function () { this._removeClass(this.headers, "ui-accordion-icons"); this.headers.children(".ui-accordion-header-icon").remove(); }, _destroy: function () { var contents; // Clean up main element this.element.removeAttr("role"); // Clean up headers this.headers .removeAttr("role aria-expanded aria-selected aria-controls tabIndex") .removeUniqueId(); this._destroyIcons(); // Clean up content panels contents = this.headers.next() .css("display", "") .removeAttr("role aria-hidden aria-labelledby") .removeUniqueId(); if (this.options.heightStyle !== "content") { contents.css("height", ""); } }, _setOption: function (key, value) { if (key === "active") { // _activate() will handle invalid values and update this.options this._activate(value); return; } if (key === "event") { if (this.options.event) { this._off(this.headers, this.options.event); } this._setupEvents(value); } this._super(key, value); // Setting collapsible: false while collapsed; open first panel if (key === "collapsible" && !value && this.options.active === false) { this._activate(0); } if (key === "icons") { this._destroyIcons(); if (value) { this._createIcons(); } } }, _setOptionDisabled: function (value) { this._super(value); this.element.attr("aria-disabled", value); // Support: IE8 Only // #5332 / #6059 - opacity doesn't cascade to positioned elements in IE // so we need to add the disabled class to the headers and panels this._toggleClass(null, "ui-state-disabled", !!value); this._toggleClass(this.headers.add(this.headers.next()), null, "ui-state-disabled", !!value); }, _keydown: function (event) { if (event.altKey || event.ctrlKey) { return; } var keyCode = $.ui.keyCode, length = this.headers.length, currentIndex = this.headers.index(event.target), toFocus = false; switch (event.keyCode) { case keyCode.RIGHT: case keyCode.DOWN: toFocus = this.headers[(currentIndex + 1) % length]; break; case keyCode.LEFT: case keyCode.UP: toFocus = this.headers[(currentIndex - 1 + length) % length]; break; case keyCode.SPACE: case keyCode.ENTER: this._eventHandler(event); break; case keyCode.HOME: toFocus = this.headers[0]; break; case keyCode.END: toFocus = this.headers[length - 1]; break; } if (toFocus) { $(event.target).attr("tabIndex", -1); $(toFocus).attr("tabIndex", 0); $(toFocus).trigger("focus"); event.preventDefault(); } }, _panelKeyDown: function (event) { if (event.keyCode === $.ui.keyCode.UP && event.ctrlKey) { $(event.currentTarget).prev().trigger("focus"); } }, refresh: function () { var options = this.options; this._processPanels(); // Was collapsed or no panel if ((options.active === false && options.collapsible === true) || !this.headers.length) { options.active = false; this.active = $(); // active false only when collapsible is true } else if (options.active === false) { this._activate(0); // was active, but active panel is gone } else if (this.active.length && !$.contains(this.element[0], this.active[0])) { // all remaining panel are disabled if (this.headers.length === this.headers.find(".ui-state-disabled").length) { options.active = false; this.active = $(); // activate previous panel } else { this._activate(Math.max(0, options.active - 1)); } // was active, active panel still exists } else { // make sure active index is correct options.active = this.headers.index(this.active); } this._destroyIcons(); this._refresh(); }, _processPanels: function () { var prevHeaders = this.headers, prevPanels = this.panels; this.headers = this.element.find(this.options.header); this._addClass(this.headers, "ui-accordion-header ui-accordion-header-collapsed", "ui-state-default"); this.panels = this.headers.next().filter(":not(.ui-accordion-content-active)").hide(); this._addClass(this.panels, "ui-accordion-content", "ui-helper-reset ui-widget-content"); // Avoid memory leaks (#10056) if (prevPanels) { this._off(prevHeaders.not(this.headers)); this._off(prevPanels.not(this.panels)); } }, _refresh: function () { var maxHeight, options = this.options, heightStyle = options.heightStyle, parent = this.element.parent(); this.active = this._findActive(options.active); this._addClass(this.active, "ui-accordion-header-active", "ui-state-active") ._removeClass(this.active, "ui-accordion-header-collapsed"); this._addClass(this.active.next(), "ui-accordion-content-active"); this.active.next().show(); this.headers .attr("role", "tab") .each(function () { var header = $(this), headerId = header.uniqueId().attr("id"), panel = header.next(), panelId = panel.uniqueId().attr("id"); header.attr("aria-controls", panelId); panel.attr("aria-labelledby", headerId); }) .next() .attr("role", "tabpanel"); this.headers .not(this.active) .attr({ "aria-selected": "false", "aria-expanded": "false", tabIndex: -1 }) .next() .attr({ "aria-hidden": "true" }) .hide(); // Make sure at least one header is in the tab order if (!this.active.length) { this.headers.eq(0).attr("tabIndex", 0); } else { this.active.attr({ "aria-selected": "true", "aria-expanded": "true", tabIndex: 0 }) .next() .attr({ "aria-hidden": "false" }); } this._createIcons(); this._setupEvents(options.event); if (heightStyle === "fill") { maxHeight = parent.height(); this.element.siblings(":visible").each(function () { var elem = $(this), position = elem.css("position"); if (position === "absolute" || position === "fixed") { return; } maxHeight -= elem.outerHeight(true); }); this.headers.each(function () { maxHeight -= $(this).outerHeight(true); }); this.headers.next() .each(function () { $(this).height(Math.max(0, maxHeight - $(this).innerHeight() + $(this).height())); }) .css("overflow", "auto"); } else if (heightStyle === "auto") { maxHeight = 0; this.headers.next() .each(function () { var isVisible = $(this).is(":visible"); if (!isVisible) { $(this).show(); } maxHeight = Math.max(maxHeight, $(this).css("height", "").height()); if (!isVisible) { $(this).hide(); } }) .height(maxHeight); } }, _activate: function (index) { var active = this._findActive(index)[0]; // Trying to activate the already active panel if (active === this.active[0]) { return; } // Trying to collapse, simulate a click on the currently active header active = active || this.active[0]; this._eventHandler({ target: active, currentTarget: active, preventDefault: $.noop }); }, _findActive: function (selector) { return typeof selector === "number" ? this.headers.eq(selector) : $(); }, _setupEvents: function (event) { var events = { keydown: "_keydown" }; if (event) { $.each(event.split(" "), function (index, eventName) { events[eventName] = "_eventHandler"; }); } this._off(this.headers.add(this.headers.next())); this._on(this.headers, events); this._on(this.headers.next(), { keydown: "_panelKeyDown" }); this._hoverable(this.headers); this._focusable(this.headers); }, _eventHandler: function (event) { var activeChildren, clickedChildren, options = this.options, active = this.active, clicked = $(event.currentTarget), clickedIsActive = clicked[0] === active[0], collapsing = clickedIsActive && options.collapsible, toShow = collapsing ? $() : clicked.next(), toHide = active.next(), eventData = { oldHeader: active, oldPanel: toHide, newHeader: collapsing ? $() : clicked, newPanel: toShow }; event.preventDefault(); if ( // click on active header, but not collapsible (clickedIsActive && !options.collapsible) || // allow canceling activation (this._trigger("beforeActivate", event, eventData) === false)) { return; } options.active = collapsing ? false : this.headers.index(clicked); // When the call to ._toggle() comes after the class changes // it causes a very odd bug in IE 8 (see #6720) this.active = clickedIsActive ? $() : clicked; this._toggle(eventData); // Switch classes // corner classes on the previously active header stay after the animation this._removeClass(active, "ui-accordion-header-active", "ui-state-active"); if (options.icons) { activeChildren = active.children(".ui-accordion-header-icon"); this._removeClass(activeChildren, null, options.icons.activeHeader) ._addClass(activeChildren, null, options.icons.header); } if (!clickedIsActive) { this._removeClass(clicked, "ui-accordion-header-collapsed") ._addClass(clicked, "ui-accordion-header-active", "ui-state-active"); if (options.icons) { clickedChildren = clicked.children(".ui-accordion-header-icon"); this._removeClass(clickedChildren, null, options.icons.header) ._addClass(clickedChildren, null, options.icons.activeHeader); } this._addClass(clicked.next(), "ui-accordion-content-active"); } }, _toggle: function (data) { var toShow = data.newPanel, toHide = this.prevShow.length ? this.prevShow : data.oldPanel; // Handle activating a panel during the animation for another activation this.prevShow.add(this.prevHide).stop(true, true); this.prevShow = toShow; this.prevHide = toHide; if (this.options.animate) { this._animate(toShow, toHide, data); } else { toHide.hide(); toShow.show(); this._toggleComplete(data); } toHide.attr({ "aria-hidden": "true" }); toHide.prev().attr({ "aria-selected": "false", "aria-expanded": "false" }); // if we're switching panels, remove the old header from the tab order // if we're opening from collapsed state, remove the previous header from the tab order // if we're collapsing, then keep the collapsing header in the tab order if (toShow.length && toHide.length) { toHide.prev().attr({ "tabIndex": -1, "aria-expanded": "false" }); } else if (toShow.length) { this.headers.filter(function () { return parseInt($(this).attr("tabIndex"), 10) === 0; }) .attr("tabIndex", -1); } toShow .attr("aria-hidden", "false") .prev() .attr({ "aria-selected": "true", "aria-expanded": "true", tabIndex: 0 }); }, _animate: function (toShow, toHide, data) { var total, easing, duration, that = this, adjust = 0, boxSizing = toShow.css("box-sizing"), down = toShow.length && (!toHide.length || (toShow.index() < toHide.index())), animate = this.options.animate || {}, options = down && animate.down || animate, complete = function () { that._toggleComplete(data); }; if (typeof options === "number") { duration = options; } if (typeof options === "string") { easing = options; } // fall back from options to animation in case of partial down settings easing = easing || options.easing || animate.easing; duration = duration || options.duration || animate.duration; if (!toHide.length) { return toShow.animate(this.showProps, duration, easing, complete); } if (!toShow.length) { return toHide.animate(this.hideProps, duration, easing, complete); } total = toShow.show().outerHeight(); toHide.animate(this.hideProps, { duration: duration, easing: easing, step: function (now, fx) { fx.now = Math.round(now); } }); toShow .hide() .animate(this.showProps, { duration: duration, easing: easing, complete: complete, step: function (now, fx) { fx.now = Math.round(now); if (fx.prop !== "height") { if (boxSizing === "content-box") { adjust += fx.now; } } else if (that.options.heightStyle !== "content") { fx.now = Math.round(total - toHide.outerHeight() - adjust); adjust = 0; } } }); }, _toggleComplete: function (data) { var toHide = data.oldPanel, prev = toHide.prev(); this._removeClass(toHide, "ui-accordion-content-active"); this._removeClass(prev, "ui-accordion-header-active") ._addClass(prev, "ui-accordion-header-collapsed"); // Work around for rendering bug in IE (#5421) if (toHide.length) { toHide.parent()[0].className = toHide.parent()[0].className; } this._trigger("activate", null, data); } }); /*! * jQuery UI Menu 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Menu //>>group: Widgets //>>description: Creates nestable menus. //>>docs: http://api.jqueryui.com/menu/ //>>demos: http://jqueryui.com/menu/ //>>css.structure: ../../themes/base/core.css //>>css.structure: ../../themes/base/menu.css //>>css.theme: ../../themes/base/theme.css var widgetsMenu = $.widget("ui.menu", { version: "1.12.1", defaultElement: "<ul>", delay: 300, options: { icons: { submenu: "ui-icon-caret-1-e" }, items: "> *", menus: "ul", position: { my: "left top", at: "right top" }, role: "menu", // Callbacks blur: null, focus: null, select: null }, _create: function () { this.activeMenu = this.element; // Flag used to prevent firing of the click handler // as the event bubbles up through nested menus this.mouseHandled = false; this.element .uniqueId() .attr({ role: this.options.role, tabIndex: 0 }); this._addClass("ui-menu", "ui-widget ui-widget-content"); this._on({ // Prevent focus from sticking to links inside menu after clicking // them (focus should always stay on UL during navigation). "mousedown .ui-menu-item": function (event) { event.preventDefault(); }, "click .ui-menu-item": function (event) { var target = $(event.target); var active = $($.ui.safeActiveElement(this.document[0])); if (!this.mouseHandled && target.not(".ui-state-disabled").length) { this.select(event); // Only set the mouseHandled flag if the event will bubble, see #9469. if (!event.isPropagationStopped()) { this.mouseHandled = true; } // Open submenu on click if (target.has(".ui-menu").length) { this.expand(event); } else if (!this.element.is(":focus") && active.closest(".ui-menu").length) { // Redirect focus to the menu this.element.trigger("focus", [true]); // If the active item is on the top level, let it stay active. // Otherwise, blur the active item since it is no longer visible. if (this.active && this.active.parents(".ui-menu").length === 1) { clearTimeout(this.timer); } } } }, "mouseenter .ui-menu-item": function (event) { // Ignore mouse events while typeahead is active, see #10458. // Prevents focusing the wrong item when typeahead causes a scroll while the mouse // is over an item in the menu if (this.previousFilter) { return; } var actualTarget = $(event.target).closest(".ui-menu-item"), target = $(event.currentTarget); // Ignore bubbled events on parent items, see #11641 if (actualTarget[0] !== target[0]) { return; } // Remove ui-state-active class from siblings of the newly focused menu item // to avoid a jump caused by adjacent elements both having a class with a border this._removeClass(target.siblings().children(".ui-state-active"), null, "ui-state-active"); this.focus(event, target); }, mouseleave: "collapseAll", "mouseleave .ui-menu": "collapseAll", focus: function (event, keepActiveItem) { // If there's already an active item, keep it active // If not, activate the first item var item = this.active || this.element.find(this.options.items).eq(0); if (!keepActiveItem) { this.focus(event, item); } }, blur: function (event) { this._delay(function () { var notContained = !$.contains( this.element[0], $.ui.safeActiveElement(this.document[0]) ); if (notContained) { this.collapseAll(event); } }); }, keydown: "_keydown" }); this.refresh(); // Clicks outside of a menu collapse any open menus this._on(this.document, { click: function (event) { if (this._closeOnDocumentClick(event)) { this.collapseAll(event); } // Reset the mouseHandled flag this.mouseHandled = false; } }); }, _destroy: function () { var items = this.element.find(".ui-menu-item") .removeAttr("role aria-disabled"), submenus = items.children(".ui-menu-item-wrapper") .removeUniqueId() .removeAttr("tabIndex role aria-haspopup"); // Destroy (sub)menus this.element .removeAttr("aria-activedescendant") .find(".ui-menu").addBack() .removeAttr("role aria-labelledby aria-expanded aria-hidden aria-disabled " + "tabIndex") .removeUniqueId() .show(); submenus.children().each(function () { var elem = $(this); if (elem.data("ui-menu-submenu-caret")) { elem.remove(); } }); }, _keydown: function (event) { var match, prev, character, skip, preventDefault = true; switch (event.keyCode) { case $.ui.keyCode.PAGE_UP: this.previousPage(event); break; case $.ui.keyCode.PAGE_DOWN: this.nextPage(event); break; case $.ui.keyCode.HOME: this._move("first", "first", event); break; case $.ui.keyCode.END: this._move("last", "last", event); break; case $.ui.keyCode.UP: this.previous(event); break; case $.ui.keyCode.DOWN: this.next(event); break; case $.ui.keyCode.LEFT: this.collapse(event); break; case $.ui.keyCode.RIGHT: if (this.active && !this.active.is(".ui-state-disabled")) { this.expand(event); } break; case $.ui.keyCode.ENTER: case $.ui.keyCode.SPACE: this._activate(event); break; case $.ui.keyCode.ESCAPE: this.collapse(event); break; default: preventDefault = false; prev = this.previousFilter || ""; skip = false; // Support number pad values character = event.keyCode >= 96 && event.keyCode <= 105 ? (event.keyCode - 96).toString() : String.fromCharCode(event.keyCode); clearTimeout(this.filterTimer); if (character === prev) { skip = true; } else { character = prev + character; } match = this._filterMenuItems(character); match = skip && match.index(this.active.next()) !== -1 ? this.active.nextAll(".ui-menu-item") : match; // If no matches on the current filter, reset to the last character pressed // to move down the menu to the first item that starts with that character if (!match.length) { character = String.fromCharCode(event.keyCode); match = this._filterMenuItems(character); } if (match.length) { this.focus(event, match); this.previousFilter = character; this.filterTimer = this._delay(function () { delete this.previousFilter; }, 1000); } else { delete this.previousFilter; } } if (preventDefault) { event.preventDefault(); } }, _activate: function (event) { if (this.active && !this.active.is(".ui-state-disabled")) { if (this.active.children("[aria-haspopup='true']").length) { this.expand(event); } else { this.select(event); } } }, refresh: function () { var menus, items, newSubmenus, newItems, newWrappers, that = this, icon = this.options.icons.submenu, submenus = this.element.find(this.options.menus); this._toggleClass("ui-menu-icons", null, !!this.element.find(".ui-icon").length); // Initialize nested menus newSubmenus = submenus.filter(":not(.ui-menu)") .hide() .attr({ role: this.options.role, "aria-hidden": "true", "aria-expanded": "false" }) .each(function () { var menu = $(this), item = menu.prev(), submenuCaret = $("<span>").data("ui-menu-submenu-caret", true); that._addClass(submenuCaret, "ui-menu-icon", "ui-icon " + icon); item .attr("aria-haspopup", "true") .prepend(submenuCaret); menu.attr("aria-labelledby", item.attr("id")); }); this._addClass(newSubmenus, "ui-menu", "ui-widget ui-widget-content ui-front"); menus = submenus.add(this.element); items = menus.find(this.options.items); // Initialize menu-items containing spaces and/or dashes only as dividers items.not(".ui-menu-item").each(function () { var item = $(this); if (that._isDivider(item)) { that._addClass(item, "ui-menu-divider", "ui-widget-content"); } }); // Don't refresh list items that are already adapted newItems = items.not(".ui-menu-item, .ui-menu-divider"); newWrappers = newItems.children() .not(".ui-menu") .uniqueId() .attr({ tabIndex: -1, role: this._itemRole() }); this._addClass(newItems, "ui-menu-item") ._addClass(newWrappers, "ui-menu-item-wrapper"); // Add aria-disabled attribute to any disabled menu item items.filter(".ui-state-disabled").attr("aria-disabled", "true"); // If the active item has been removed, blur the menu if (this.active && !$.contains(this.element[0], this.active[0])) { this.blur(); } }, _itemRole: function () { return { menu: "menuitem", listbox: "option" }[this.options.role]; }, _setOption: function (key, value) { if (key === "icons") { var icons = this.element.find(".ui-menu-icon"); this._removeClass(icons, null, this.options.icons.submenu) ._addClass(icons, null, value.submenu); } this._super(key, value); }, _setOptionDisabled: function (value) { this._super(value); this.element.attr("aria-disabled", String(value)); this._toggleClass(null, "ui-state-disabled", !!value); }, focus: function (event, item) { var nested, focused, activeParent; this.blur(event, event && event.type === "focus"); this._scrollIntoView(item); this.active = item.first(); focused = this.active.children(".ui-menu-item-wrapper"); this._addClass(focused, null, "ui-state-active"); // Only update aria-activedescendant if there's a role // otherwise we assume focus is managed elsewhere if (this.options.role) { this.element.attr("aria-activedescendant", focused.attr("id")); } // Highlight active parent menu item, if any activeParent = this.active .parent() .closest(".ui-menu-item") .children(".ui-menu-item-wrapper"); this._addClass(activeParent, null, "ui-state-active"); if (event && event.type === "keydown") { this._close(); } else { this.timer = this._delay(function () { this._close(); }, this.delay); } nested = item.children(".ui-menu"); if (nested.length && event && (/^mouse/.test(event.type))) { this._startOpening(nested); } this.activeMenu = item.parent(); this._trigger("focus", event, { item: item }); }, _scrollIntoView: function (item) { var borderTop, paddingTop, offset, scroll, elementHeight, itemHeight; if (this._hasScroll()) { borderTop = parseFloat($.css(this.activeMenu[0], "borderTopWidth")) || 0; paddingTop = parseFloat($.css(this.activeMenu[0], "paddingTop")) || 0; offset = item.offset().top - this.activeMenu.offset().top - borderTop - paddingTop; scroll = this.activeMenu.scrollTop(); elementHeight = this.activeMenu.height(); itemHeight = item.outerHeight(); if (offset < 0) { this.activeMenu.scrollTop(scroll + offset); } else if (offset + itemHeight > elementHeight) { this.activeMenu.scrollTop(scroll + offset - elementHeight + itemHeight); } } }, blur: function (event, fromFocus) { if (!fromFocus) { clearTimeout(this.timer); } if (!this.active) { return; } this._removeClass(this.active.children(".ui-menu-item-wrapper"), null, "ui-state-active"); this._trigger("blur", event, { item: this.active }); this.active = null; }, _startOpening: function (submenu) { clearTimeout(this.timer); // Don't open if already open fixes a Firefox bug that caused a .5 pixel // shift in the submenu position when mousing over the caret icon if (submenu.attr("aria-hidden") !== "true") { return; } this.timer = this._delay(function () { this._close(); this._open(submenu); }, this.delay); }, _open: function (submenu) { var position = $.extend({ of: this.active }, this.options.position); clearTimeout(this.timer); this.element.find(".ui-menu").not(submenu.parents(".ui-menu")) .hide() .attr("aria-hidden", "true"); submenu .show() .removeAttr("aria-hidden") .attr("aria-expanded", "true") .position(position); }, collapseAll: function (event, all) { clearTimeout(this.timer); this.timer = this._delay(function () { // If we were passed an event, look for the submenu that contains the event var currentMenu = all ? this.element : $(event && event.target).closest(this.element.find(".ui-menu")); // If we found no valid submenu ancestor, use the main menu to close all // sub menus anyway if (!currentMenu.length) { currentMenu = this.element; } this._close(currentMenu); this.blur(event); // Work around active item staying active after menu is blurred this._removeClass(currentMenu.find(".ui-state-active"), null, "ui-state-active"); this.activeMenu = currentMenu; }, this.delay); }, // With no arguments, closes the currently active menu - if nothing is active // it closes all menus. If passed an argument, it will search for menus BELOW _close: function (startMenu) { if (!startMenu) { startMenu = this.active ? this.active.parent() : this.element; } startMenu.find(".ui-menu") .hide() .attr("aria-hidden", "true") .attr("aria-expanded", "false"); }, _closeOnDocumentClick: function (event) { return !$(event.target).closest(".ui-menu").length; }, _isDivider: function (item) { // Match hyphen, em dash, en dash return !/[^\-\u2014\u2013\s]/.test(item.text()); }, collapse: function (event) { var newItem = this.active && this.active.parent().closest(".ui-menu-item", this.element); if (newItem && newItem.length) { this._close(); this.focus(event, newItem); } }, expand: function (event) { var newItem = this.active && this.active .children(".ui-menu ") .find(this.options.items) .first(); if (newItem && newItem.length) { this._open(newItem.parent()); // Delay so Firefox will not hide activedescendant change in expanding submenu from AT this._delay(function () { this.focus(event, newItem); }); } }, next: function (event) { this._move("next", "first", event); }, previous: function (event) { this._move("prev", "last", event); }, isFirstItem: function () { return this.active && !this.active.prevAll(".ui-menu-item").length; }, isLastItem: function () { return this.active && !this.active.nextAll(".ui-menu-item").length; }, _move: function (direction, filter, event) { var next; if (this.active) { if (direction === "first" || direction === "last") { next = this.active [direction === "first" ? "prevAll" : "nextAll"](".ui-menu-item") .eq(-1); } else { next = this.active [direction + "All"](".ui-menu-item") .eq(0); } } if (!next || !next.length || !this.active) { next = this.activeMenu.find(this.options.items)[filter](); } this.focus(event, next); }, nextPage: function (event) { var item, base, height; if (!this.active) { this.next(event); return; } if (this.isLastItem()) { return; } if (this._hasScroll()) { base = this.active.offset().top; height = this.element.height(); this.active.nextAll(".ui-menu-item").each(function () { item = $(this); return item.offset().top - base - height < 0; }); this.focus(event, item); } else { this.focus(event, this.activeMenu.find(this.options.items) [!this.active ? "first" : "last"]()); } }, previousPage: function (event) { var item, base, height; if (!this.active) { this.next(event); return; } if (this.isFirstItem()) { return; } if (this._hasScroll()) { base = this.active.offset().top; height = this.element.height(); this.active.prevAll(".ui-menu-item").each(function () { item = $(this); return item.offset().top - base + height > 0; }); this.focus(event, item); } else { this.focus(event, this.activeMenu.find(this.options.items).first()); } }, _hasScroll: function () { return this.element.outerHeight() < this.element.prop("scrollHeight"); }, select: function (event) { // TODO: It should never be possible to not have an active item at this // point, but the tests don't trigger mouseenter before click. this.active = this.active || $(event.target).closest(".ui-menu-item"); var ui = { item: this.active }; if (!this.active.has(".ui-menu").length) { this.collapseAll(event, true); } this._trigger("select", event, ui); }, _filterMenuItems: function (character) { var escapedCharacter = character.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&"), regex = new RegExp("^" + escapedCharacter, "i"); return this.activeMenu .find(this.options.items) // Only match on items, not dividers or other content (#10571) .filter(".ui-menu-item") .filter(function () { return regex.test( $.trim($(this).children(".ui-menu-item-wrapper").text())); }); } }); /*! * jQuery UI Autocomplete 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Autocomplete //>>group: Widgets //>>description: Lists suggested words as the user is typing. //>>docs: http://api.jqueryui.com/autocomplete/ //>>demos: http://jqueryui.com/autocomplete/ //>>css.structure: ../../themes/base/core.css //>>css.structure: ../../themes/base/autocomplete.css //>>css.theme: ../../themes/base/theme.css $.widget("ui.autocomplete", { version: "1.12.1", defaultElement: "<input>", options: { appendTo: null, autoFocus: false, delay: 300, minLength: 1, position: { my: "left top", at: "left bottom", collision: "none" }, source: null, // Callbacks change: null, close: null, focus: null, open: null, response: null, search: null, select: null }, requestIndex: 0, pending: 0, _create: function () { // Some browsers only repeat keydown events, not keypress events, // so we use the suppressKeyPress flag to determine if we've already // handled the keydown event. #7269 // Unfortunately the code for & in keypress is the same as the up arrow, // so we use the suppressKeyPressRepeat flag to avoid handling keypress // events when we know the keydown event was used to modify the // search term. #7799 var suppressKeyPress, suppressKeyPressRepeat, suppressInput, nodeName = this.element[0].nodeName.toLowerCase(), isTextarea = nodeName === "textarea", isInput = nodeName === "input"; // Textareas are always multi-line // Inputs are always single-line, even if inside a contentEditable element // IE also treats inputs as contentEditable // All other element types are determined by whether or not they're contentEditable this.isMultiLine = isTextarea || !isInput && this._isContentEditable(this.element); this.valueMethod = this.element[isTextarea || isInput ? "val" : "text"]; this.isNewMenu = true; this._addClass("ui-autocomplete-input"); this.element.attr("autocomplete", "off"); this._on(this.element, { keydown: function (event) { if (this.element.prop("readOnly")) { suppressKeyPress = true; suppressInput = true; suppressKeyPressRepeat = true; return; } suppressKeyPress = false; suppressInput = false; suppressKeyPressRepeat = false; var keyCode = $.ui.keyCode; switch (event.keyCode) { case keyCode.PAGE_UP: suppressKeyPress = true; this._move("previousPage", event); break; case keyCode.PAGE_DOWN: suppressKeyPress = true; this._move("nextPage", event); break; case keyCode.UP: suppressKeyPress = true; this._keyEvent("previous", event); break; case keyCode.DOWN: suppressKeyPress = true; this._keyEvent("next", event); break; case keyCode.ENTER: // when menu is open and has focus if (this.menu.active) { // #6055 - Opera still allows the keypress to occur // which causes forms to submit suppressKeyPress = true; event.preventDefault(); this.menu.select(event); } break; case keyCode.TAB: if (this.menu.active) { this.menu.select(event); } break; case keyCode.ESCAPE: if (this.menu.element.is(":visible")) { if (!this.isMultiLine) { this._value(this.term); } this.close(event); // Different browsers have different default behavior for escape // Single press can mean undo or clear // Double press in IE means clear the whole form event.preventDefault(); } break; default: suppressKeyPressRepeat = true; // search timeout should be triggered before the input value is changed this._searchTimeout(event); break; } }, keypress: function (event) { if (suppressKeyPress) { suppressKeyPress = false; if (!this.isMultiLine || this.menu.element.is(":visible")) { event.preventDefault(); } return; } if (suppressKeyPressRepeat) { return; } // Replicate some key handlers to allow them to repeat in Firefox and Opera var keyCode = $.ui.keyCode; switch (event.keyCode) { case keyCode.PAGE_UP: this._move("previousPage", event); break; case keyCode.PAGE_DOWN: this._move("nextPage", event); break; case keyCode.UP: this._keyEvent("previous", event); break; case keyCode.DOWN: this._keyEvent("next", event); break; } }, input: function (event) { if (suppressInput) { suppressInput = false; event.preventDefault(); return; } this._searchTimeout(event); }, focus: function () { this.selectedItem = null; this.previous = this._value(); }, blur: function (event) { if (this.cancelBlur) { delete this.cancelBlur; return; } clearTimeout(this.searching); this.close(event); this._change(event); } }); this._initSource(); this.menu = $("<ul>") .appendTo(this._appendTo()) .menu({ // disable ARIA support, the live region takes care of that role: null }) .hide() .menu("instance"); this._addClass(this.menu.element, "ui-autocomplete", "ui-front"); this._on(this.menu.element, { mousedown: function (event) { // prevent moving focus out of the text field event.preventDefault(); // IE doesn't prevent moving focus even with event.preventDefault() // so we set a flag to know when we should ignore the blur event this.cancelBlur = true; this._delay(function () { delete this.cancelBlur; // Support: IE 8 only // Right clicking a menu item or selecting text from the menu items will // result in focus moving out of the input. However, we've already received // and ignored the blur event because of the cancelBlur flag set above. So // we restore focus to ensure that the menu closes properly based on the user's // next actions. if (this.element[0] !== $.ui.safeActiveElement(this.document[0])) { this.element.trigger("focus"); } }); }, menufocus: function (event, ui) { var label, item; // support: Firefox // Prevent accidental activation of menu items in Firefox (#7024 #9118) if (this.isNewMenu) { this.isNewMenu = false; if (event.originalEvent && /^mouse/.test(event.originalEvent.type)) { this.menu.blur(); this.document.one("mousemove", function () { $(event.target).trigger(event.originalEvent); }); return; } } item = ui.item.data("ui-autocomplete-item"); if (false !== this._trigger("focus", event, { item: item })) { // use value to match what will end up in the input, if it was a key event if (event.originalEvent && /^key/.test(event.originalEvent.type)) { this._value(item.value); } } // Announce the value in the liveRegion label = ui.item.attr("aria-label") || item.value; if (label && $.trim(label).length) { this.liveRegion.children().hide(); $("<div>").text(label).appendTo(this.liveRegion); } }, menuselect: function (event, ui) { var item = ui.item.data("ui-autocomplete-item"), previous = this.previous; // Only trigger when focus was lost (click on menu) if (this.element[0] !== $.ui.safeActiveElement(this.document[0])) { this.element.trigger("focus"); this.previous = previous; // #6109 - IE triggers two focus events and the second // is asynchronous, so we need to reset the previous // term synchronously and asynchronously :-( this._delay(function () { this.previous = previous; this.selectedItem = item; }); } if (false !== this._trigger("select", event, { item: item })) { this._value(item.value); } // reset the term after the select event // this allows custom select handling to work properly this.term = this._value(); this.close(event); this.selectedItem = item; } }); this.liveRegion = $("<div>", { role: "status", "aria-live": "assertive", "aria-relevant": "additions" }) .appendTo(this.document[0].body); this._addClass(this.liveRegion, null, "ui-helper-hidden-accessible"); // Turning off autocomplete prevents the browser from remembering the // value when navigating through history, so we re-enable autocomplete // if the page is unloaded before the widget is destroyed. #7790 this._on(this.window, { beforeunload: function () { this.element.removeAttr("autocomplete"); } }); }, _destroy: function () { clearTimeout(this.searching); this.element.removeAttr("autocomplete"); this.menu.element.remove(); this.liveRegion.remove(); }, _setOption: function (key, value) { this._super(key, value); if (key === "source") { this._initSource(); } if (key === "appendTo") { this.menu.element.appendTo(this._appendTo()); } if (key === "disabled" && value && this.xhr) { this.xhr.abort(); } }, _isEventTargetInWidget: function (event) { var menuElement = this.menu.element[0]; return event.target === this.element[0] || event.target === menuElement || $.contains(menuElement, event.target); }, _closeOnClickOutside: function (event) { if (!this._isEventTargetInWidget(event)) { this.close(); } }, _appendTo: function () { var element = this.options.appendTo; if (element) { element = element.jquery || element.nodeType ? $(element) : this.document.find(element).eq(0); } if (!element || !element[0]) { element = this.element.closest(".ui-front, dialog"); } if (!element.length) { element = this.document[0].body; } return element; }, _initSource: function () { var array, url, that = this; if ($.isArray(this.options.source)) { array = this.options.source; this.source = function (request, response) { response($.ui.autocomplete.filter(array, request.term)); }; } else if (typeof this.options.source === "string") { url = this.options.source; this.source = function (request, response) { if (that.xhr) { that.xhr.abort(); } that.xhr = $.ajax({ url: url, data: request, dataType: "json", success: function (data) { response(data); }, error: function () { response([]); } }); }; } else { this.source = this.options.source; } }, _searchTimeout: function (event) { clearTimeout(this.searching); this.searching = this._delay(function () { // Search if the value has changed, or if the user retypes the same value (see #7434) var equalValues = this.term === this._value(), menuVisible = this.menu.element.is(":visible"), modifierKey = event.altKey || event.ctrlKey || event.metaKey || event.shiftKey; if (!equalValues || (equalValues && !menuVisible && !modifierKey)) { this.selectedItem = null; this.search(null, event); } }, this.options.delay); }, search: function (value, event) { value = value != null ? value : this._value(); // Always save the actual value, not the one passed as an argument this.term = this._value(); if (value.length < this.options.minLength) { return this.close(event); } if (this._trigger("search", event) === false) { return; } return this._search(value); }, _search: function (value) { this.pending++; this._addClass("ui-autocomplete-loading"); this.cancelSearch = false; this.source({ term: value }, this._response()); }, _response: function () { var index = ++this.requestIndex; return $.proxy(function (content) { if (index === this.requestIndex) { this.__response(content); } this.pending--; if (!this.pending) { this._removeClass("ui-autocomplete-loading"); } }, this); }, __response: function (content) { if (content) { content = this._normalize(content); } this._trigger("response", null, { content: content }); if (!this.options.disabled && content && content.length && !this.cancelSearch) { this._suggest(content); this._trigger("open"); } else { // use ._close() instead of .close() so we don't cancel future searches this._close(); } }, close: function (event) { this.cancelSearch = true; this._close(event); }, _close: function (event) { // Remove the handler that closes the menu on outside clicks this._off(this.document, "mousedown"); if (this.menu.element.is(":visible")) { this.menu.element.hide(); this.menu.blur(); this.isNewMenu = true; this._trigger("close", event); } }, _change: function (event) { if (this.previous !== this._value()) { this._trigger("change", event, { item: this.selectedItem }); } }, _normalize: function (items) { // assume all items have the right format when the first item is complete if (items.length && items[0].label && items[0].value) { return items; } return $.map(items, function (item) { if (typeof item === "string") { return { label: item, value: item }; } return $.extend({}, item, { label: item.label || item.value, value: item.value || item.label }); }); }, _suggest: function (items) { var ul = this.menu.element.empty(); this._renderMenu(ul, items); this.isNewMenu = true; this.menu.refresh(); // Size and position menu ul.show(); this._resizeMenu(); ul.position($.extend({ of: this.element }, this.options.position)); if (this.options.autoFocus) { this.menu.next(); } // Listen for interactions outside of the widget (#6642) this._on(this.document, { mousedown: "_closeOnClickOutside" }); }, _resizeMenu: function () { var ul = this.menu.element; ul.outerWidth(Math.max( // Firefox wraps long text (possibly a rounding bug) // so we add 1px to avoid the wrapping (#7513) ul.width("").outerWidth() + 1, this.element.outerWidth() )); }, _renderMenu: function (ul, items) { var that = this; $.each(items, function (index, item) { that._renderItemData(ul, item); }); }, _renderItemData: function (ul, item) { return this._renderItem(ul, item).data("ui-autocomplete-item", item); }, _renderItem: function (ul, item) { return $("<li>") .append($("<div>").text(item.label)) .appendTo(ul); }, _move: function (direction, event) { if (!this.menu.element.is(":visible")) { this.search(null, event); return; } if (this.menu.isFirstItem() && /^previous/.test(direction) || this.menu.isLastItem() && /^next/.test(direction)) { if (!this.isMultiLine) { this._value(this.term); } this.menu.blur(); return; } this.menu[direction](event); }, widget: function () { return this.menu.element; }, _value: function () { return this.valueMethod.apply(this.element, arguments); }, _keyEvent: function (keyEvent, event) { if (!this.isMultiLine || this.menu.element.is(":visible")) { this._move(keyEvent, event); // Prevents moving cursor to beginning/end of the text field in some browsers event.preventDefault(); } }, // Support: Chrome <=50 // We should be able to just use this.element.prop( "isContentEditable" ) // but hidden elements always report false in Chrome. // https://code.google.com/p/chromium/issues/detail?id=313082 _isContentEditable: function (element) { if (!element.length) { return false; } var editable = element.prop("contentEditable"); if (editable === "inherit") { return this._isContentEditable(element.parent()); } return editable === "true"; } }); $.extend($.ui.autocomplete, { escapeRegex: function (value) { return value.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&"); }, filter: function (array, term) { var matcher = new RegExp($.ui.autocomplete.escapeRegex(term), "i"); return $.grep(array, function (value) { return matcher.test(value.label || value.value || value); }); } }); // Live region extension, adding a `messages` option // NOTE: This is an experimental API. We are still investigating // a full solution for string manipulation and internationalization. $.widget("ui.autocomplete", $.ui.autocomplete, { options: { messages: { noResults: "No search results.", results: function (amount) { return amount + (amount > 1 ? " results are" : " result is") + " available, use up and down arrow keys to navigate."; } } }, __response: function (content) { var message; this._superApply(arguments); if (this.options.disabled || this.cancelSearch) { return; } if (content && content.length) { message = this.options.messages.results(content.length); } else { message = this.options.messages.noResults; } this.liveRegion.children().hide(); $("<div>").text(message).appendTo(this.liveRegion); } }); var widgetsAutocomplete = $.ui.autocomplete; /*! * jQuery UI Controlgroup 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Controlgroup //>>group: Widgets //>>description: Visually groups form control widgets //>>docs: http://api.jqueryui.com/controlgroup/ //>>demos: http://jqueryui.com/controlgroup/ //>>css.structure: ../../themes/base/core.css //>>css.structure: ../../themes/base/controlgroup.css //>>css.theme: ../../themes/base/theme.css var controlgroupCornerRegex = /ui-corner-([a-z]){2,6}/g; var widgetsControlgroup = $.widget("ui.controlgroup", { version: "1.12.1", defaultElement: "<div>", options: { direction: "horizontal", disabled: null, onlyVisible: true, items: { "button": "input[type=button], input[type=submit], input[type=reset], button, a", "controlgroupLabel": ".ui-controlgroup-label", "checkboxradio": "input[type='checkbox'], input[type='radio']", "selectmenu": "select", "spinner": ".ui-spinner-input" } }, _create: function () { this._enhance(); }, // To support the enhanced option in jQuery Mobile, we isolate DOM manipulation _enhance: function () { this.element.attr("role", "toolbar"); this.refresh(); }, _destroy: function () { this._callChildMethod("destroy"); this.childWidgets.removeData("ui-controlgroup-data"); this.element.removeAttr("role"); if (this.options.items.controlgroupLabel) { this.element .find(this.options.items.controlgroupLabel) .find(".ui-controlgroup-label-contents") .contents().unwrap(); } }, _initWidgets: function () { var that = this, childWidgets = []; // First we iterate over each of the items options $.each(this.options.items, function (widget, selector) { var labels; var options = {}; // Make sure the widget has a selector set if (!selector) { return; } if (widget === "controlgroupLabel") { labels = that.element.find(selector); labels.each(function () { var element = $(this); if (element.children(".ui-controlgroup-label-contents").length) { return; } element.contents() .wrapAll("<span class='ui-controlgroup-label-contents'></span>"); }); that._addClass(labels, null, "ui-widget ui-widget-content ui-state-default"); childWidgets = childWidgets.concat(labels.get()); return; } // Make sure the widget actually exists if (!$.fn[widget]) { return; } // We assume everything is in the middle to start because we can't determine // first / last elements until all enhancments are done. if (that["_" + widget + "Options"]) { options = that["_" + widget + "Options"]("middle"); } else { options = { classes: {} }; } // Find instances of this widget inside controlgroup and init them that.element .find(selector) .each(function () { var element = $(this); var instance = element[widget]("instance"); // We need to clone the default options for this type of widget to avoid // polluting the variable options which has a wider scope than a single widget. var instanceOptions = $.widget.extend({}, options); // If the button is the child of a spinner ignore it // TODO: Find a more generic solution if (widget === "button" && element.parent(".ui-spinner").length) { return; } // Create the widget if it doesn't exist if (!instance) { instance = element[widget]()[widget]("instance"); } if (instance) { instanceOptions.classes = that._resolveClassesValues(instanceOptions.classes, instance); } element[widget](instanceOptions); // Store an instance of the controlgroup to be able to reference // from the outermost element for changing options and refresh var widgetElement = element[widget]("widget"); $.data(widgetElement[0], "ui-controlgroup-data", instance ? instance : element[widget]("instance")); childWidgets.push(widgetElement[0]); }); }); this.childWidgets = $($.unique(childWidgets)); this._addClass(this.childWidgets, "ui-controlgroup-item"); }, _callChildMethod: function (method) { this.childWidgets.each(function () { var element = $(this), data = element.data("ui-controlgroup-data"); if (data && data[method]) { data[method](); } }); }, _updateCornerClass: function (element, position) { var remove = "ui-corner-top ui-corner-bottom ui-corner-left ui-corner-right ui-corner-all"; var add = this._buildSimpleOptions(position, "label").classes.label; this._removeClass(element, null, remove); this._addClass(element, null, add); }, _buildSimpleOptions: function (position, key) { var direction = this.options.direction === "vertical"; var result = { classes: {} }; result.classes[key] = { "middle": "", "first": "ui-corner-" + (direction ? "top" : "left"), "last": "ui-corner-" + (direction ? "bottom" : "right"), "only": "ui-corner-all" }[position]; return result; }, _spinnerOptions: function (position) { var options = this._buildSimpleOptions(position, "ui-spinner"); options.classes["ui-spinner-up"] = ""; options.classes["ui-spinner-down"] = ""; return options; }, _buttonOptions: function (position) { return this._buildSimpleOptions(position, "ui-button"); }, _checkboxradioOptions: function (position) { return this._buildSimpleOptions(position, "ui-checkboxradio-label"); }, _selectmenuOptions: function (position) { var direction = this.options.direction === "vertical"; return { width: direction ? "auto" : false, classes: { middle: { "ui-selectmenu-button-open": "", "ui-selectmenu-button-closed": "" }, first: { "ui-selectmenu-button-open": "ui-corner-" + (direction ? "top" : "tl"), "ui-selectmenu-button-closed": "ui-corner-" + (direction ? "top" : "left") }, last: { "ui-selectmenu-button-open": direction ? "" : "ui-corner-tr", "ui-selectmenu-button-closed": "ui-corner-" + (direction ? "bottom" : "right") }, only: { "ui-selectmenu-button-open": "ui-corner-top", "ui-selectmenu-button-closed": "ui-corner-all" } }[position] }; }, _resolveClassesValues: function (classes, instance) { var result = {}; $.each(classes, function (key) { var current = instance.options.classes[key] || ""; current = $.trim(current.replace(controlgroupCornerRegex, "")); result[key] = (current + " " + classes[key]).replace(/\s+/g, " "); }); return result; }, _setOption: function (key, value) { if (key === "direction") { this._removeClass("ui-controlgroup-" + this.options.direction); } this._super(key, value); if (key === "disabled") { this._callChildMethod(value ? "disable" : "enable"); return; } this.refresh(); }, refresh: function () { var children, that = this; this._addClass("ui-controlgroup ui-controlgroup-" + this.options.direction); if (this.options.direction === "horizontal") { this._addClass(null, "ui-helper-clearfix"); } this._initWidgets(); children = this.childWidgets; // We filter here because we need to track all childWidgets not just the visible ones if (this.options.onlyVisible) { children = children.filter(":visible"); } if (children.length) { // We do this last because we need to make sure all enhancment is done // before determining first and last $.each(["first", "last"], function (index, value) { var instance = children[value]().data("ui-controlgroup-data"); if (instance && that["_" + instance.widgetName + "Options"]) { var options = that["_" + instance.widgetName + "Options"]( children.length === 1 ? "only" : value ); options.classes = that._resolveClassesValues(options.classes, instance); instance.element[instance.widgetName](options); } else { that._updateCornerClass(children[value](), value); } }); // Finally call the refresh method on each of the child widgets. this._callChildMethod("refresh"); } } }); /*! * jQuery UI Checkboxradio 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Checkboxradio //>>group: Widgets //>>description: Enhances a form with multiple themeable checkboxes or radio buttons. //>>docs: http://api.jqueryui.com/checkboxradio/ //>>demos: http://jqueryui.com/checkboxradio/ //>>css.structure: ../../themes/base/core.css //>>css.structure: ../../themes/base/button.css //>>css.structure: ../../themes/base/checkboxradio.css //>>css.theme: ../../themes/base/theme.css $.widget("ui.checkboxradio", [$.ui.formResetMixin, { version: "1.12.1", options: { disabled: null, label: null, icon: true, classes: { "ui-checkboxradio-label": "ui-corner-all", "ui-checkboxradio-icon": "ui-corner-all" } }, _getCreateOptions: function () { var disabled, labels; var that = this; var options = this._super() || {}; // We read the type here, because it makes more sense to throw a element type error first, // rather then the error for lack of a label. Often if its the wrong type, it // won't have a label (e.g. calling on a div, btn, etc) this._readType(); labels = this.element.labels(); // If there are multiple labels, use the last one this.label = $(labels[labels.length - 1]); if (!this.label.length) { $.error("No label found for checkboxradio widget"); } this.originalLabel = ""; // We need to get the label text but this may also need to make sure it does not contain the // input itself. this.label.contents().not(this.element[0]).each(function () { // The label contents could be text, html, or a mix. We concat each element to get a // string representation of the label, without the input as part of it. that.originalLabel += this.nodeType === 3 ? $(this).text() : this.outerHTML; }); // Set the label option if we found label text if (this.originalLabel) { options.label = this.originalLabel; } disabled = this.element[0].disabled; if (disabled != null) { options.disabled = disabled; } return options; }, _create: function () { var checked = this.element[0].checked; this._bindFormResetHandler(); if (this.options.disabled == null) { this.options.disabled = this.element[0].disabled; } this._setOption("disabled", this.options.disabled); this._addClass("ui-checkboxradio", "ui-helper-hidden-accessible"); this._addClass(this.label, "ui-checkboxradio-label", "ui-button ui-widget"); if (this.type === "radio") { this._addClass(this.label, "ui-checkboxradio-radio-label"); } if (this.options.label && this.options.label !== this.originalLabel) { this._updateLabel(); } else if (this.originalLabel) { this.options.label = this.originalLabel; } this._enhance(); if (checked) { this._addClass(this.label, "ui-checkboxradio-checked", "ui-state-active"); if (this.icon) { this._addClass(this.icon, null, "ui-state-hover"); } } this._on({ change: "_toggleClasses", focus: function () { this._addClass(this.label, null, "ui-state-focus ui-visual-focus"); }, blur: function () { this._removeClass(this.label, null, "ui-state-focus ui-visual-focus"); } }); }, _readType: function () { var nodeName = this.element[0].nodeName.toLowerCase(); this.type = this.element[0].type; if (nodeName !== "input" || !/radio|checkbox/.test(this.type)) { $.error("Can't create checkboxradio on element.nodeName=" + nodeName + " and element.type=" + this.type); } }, // Support jQuery Mobile enhanced option _enhance: function () { this._updateIcon(this.element[0].checked); }, widget: function () { return this.label; }, _getRadioGroup: function () { var group; var name = this.element[0].name; var nameSelector = "input[name='" + $.ui.escapeSelector(name) + "']"; if (!name) { return $([]); } if (this.form.length) { group = $(this.form[0].elements).filter(nameSelector); } else { // Not inside a form, check all inputs that also are not inside a form group = $(nameSelector).filter(function () { return $(this).form().length === 0; }); } return group.not(this.element); }, _toggleClasses: function () { var checked = this.element[0].checked; this._toggleClass(this.label, "ui-checkboxradio-checked", "ui-state-active", checked); if (this.options.icon && this.type === "checkbox") { this._toggleClass(this.icon, null, "ui-icon-check ui-state-checked", checked) ._toggleClass(this.icon, null, "ui-icon-blank", !checked); } if (this.type === "radio") { this._getRadioGroup() .each(function () { var instance = $(this).checkboxradio("instance"); if (instance) { instance._removeClass(instance.label, "ui-checkboxradio-checked", "ui-state-active"); } }); } }, _destroy: function () { this._unbindFormResetHandler(); if (this.icon) { this.icon.remove(); this.iconSpace.remove(); } }, _setOption: function (key, value) { // We don't allow the value to be set to nothing if (key === "label" && !value) { return; } this._super(key, value); if (key === "disabled") { this._toggleClass(this.label, null, "ui-state-disabled", value); this.element[0].disabled = value; // Don't refresh when setting disabled return; } this.refresh(); }, _updateIcon: function (checked) { var toAdd = "ui-icon ui-icon-background "; if (this.options.icon) { if (!this.icon) { this.icon = $("<span>"); this.iconSpace = $("<span> </span>"); this._addClass(this.iconSpace, "ui-checkboxradio-icon-space"); } if (this.type === "checkbox") { toAdd += checked ? "ui-icon-check ui-state-checked" : "ui-icon-blank"; this._removeClass(this.icon, null, checked ? "ui-icon-blank" : "ui-icon-check"); } else { toAdd += "ui-icon-blank"; } this._addClass(this.icon, "ui-checkboxradio-icon", toAdd); if (!checked) { this._removeClass(this.icon, null, "ui-icon-check ui-state-checked"); } this.icon.prependTo(this.label).after(this.iconSpace); } else if (this.icon !== undefined) { this.icon.remove(); this.iconSpace.remove(); delete this.icon; } }, _updateLabel: function () { // Remove the contents of the label ( minus the icon, icon space, and input ) var contents = this.label.contents().not(this.element[0]); if (this.icon) { contents = contents.not(this.icon[0]); } if (this.iconSpace) { contents = contents.not(this.iconSpace[0]); } contents.remove(); this.label.append(this.options.label); }, refresh: function () { var checked = this.element[0].checked, isDisabled = this.element[0].disabled; this._updateIcon(checked); this._toggleClass(this.label, "ui-checkboxradio-checked", "ui-state-active", checked); if (this.options.label !== null) { this._updateLabel(); } if (isDisabled !== this.options.disabled) { this._setOptions({ "disabled": isDisabled }); } } }]); var widgetsCheckboxradio = $.ui.checkboxradio; /*! * jQuery UI Button 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Button //>>group: Widgets //>>description: Enhances a form with themeable buttons. //>>docs: http://api.jqueryui.com/button/ //>>demos: http://jqueryui.com/button/ //>>css.structure: ../../themes/base/core.css //>>css.structure: ../../themes/base/button.css //>>css.theme: ../../themes/base/theme.css $.widget("ui.button", { version: "1.12.1", defaultElement: "<button>", options: { classes: { "ui-button": "ui-corner-all" }, disabled: null, icon: null, iconPosition: "beginning", label: null, showLabel: true }, _getCreateOptions: function () { var disabled, // This is to support cases like in jQuery Mobile where the base widget does have // an implementation of _getCreateOptions options = this._super() || {}; this.isInput = this.element.is("input"); disabled = this.element[0].disabled; if (disabled != null) { options.disabled = disabled; } this.originalLabel = this.isInput ? this.element.val() : this.element.html(); if (this.originalLabel) { options.label = this.originalLabel; } return options; }, _create: function () { if (!this.option.showLabel & !this.options.icon) { this.options.showLabel = true; } // We have to check the option again here even though we did in _getCreateOptions, // because null may have been passed on init which would override what was set in // _getCreateOptions if (this.options.disabled == null) { this.options.disabled = this.element[0].disabled || false; } this.hasTitle = !!this.element.attr("title"); // Check to see if the label needs to be set or if its already correct if (this.options.label && this.options.label !== this.originalLabel) { if (this.isInput) { this.element.val(this.options.label); } else { this.element.html(this.options.label); } } this._addClass("ui-button", "ui-widget"); this._setOption("disabled", this.options.disabled); this._enhance(); if (this.element.is("a")) { this._on({ "keyup": function (event) { if (event.keyCode === $.ui.keyCode.SPACE) { event.preventDefault(); // Support: PhantomJS <= 1.9, IE 8 Only // If a native click is available use it so we actually cause navigation // otherwise just trigger a click event if (this.element[0].click) { this.element[0].click(); } else { this.element.trigger("click"); } } } }); } }, _enhance: function () { if (!this.element.is("button")) { this.element.attr("role", "button"); } if (this.options.icon) { this._updateIcon("icon", this.options.icon); this._updateTooltip(); } }, _updateTooltip: function () { this.title = this.element.attr("title"); if (!this.options.showLabel && !this.title) { this.element.attr("title", this.options.label); } }, _updateIcon: function (option, value) { var icon = option !== "iconPosition", position = icon ? this.options.iconPosition : value, displayBlock = position === "top" || position === "bottom"; // Create icon if (!this.icon) { this.icon = $("<span>"); this._addClass(this.icon, "ui-button-icon", "ui-icon"); if (!this.options.showLabel) { this._addClass("ui-button-icon-only"); } } else if (icon) { // If we are updating the icon remove the old icon class this._removeClass(this.icon, null, this.options.icon); } // If we are updating the icon add the new icon class if (icon) { this._addClass(this.icon, null, value); } this._attachIcon(position); // If the icon is on top or bottom we need to add the ui-widget-icon-block class and remove // the iconSpace if there is one. if (displayBlock) { this._addClass(this.icon, null, "ui-widget-icon-block"); if (this.iconSpace) { this.iconSpace.remove(); } } else { // Position is beginning or end so remove the ui-widget-icon-block class and add the // space if it does not exist if (!this.iconSpace) { this.iconSpace = $("<span> </span>"); this._addClass(this.iconSpace, "ui-button-icon-space"); } this._removeClass(this.icon, null, "ui-wiget-icon-block"); this._attachIconSpace(position); } }, _destroy: function () { this.element.removeAttr("role"); if (this.icon) { this.icon.remove(); } if (this.iconSpace) { this.iconSpace.remove(); } if (!this.hasTitle) { this.element.removeAttr("title"); } }, _attachIconSpace: function (iconPosition) { this.icon[/^(?:end|bottom)/.test(iconPosition) ? "before" : "after"](this.iconSpace); }, _attachIcon: function (iconPosition) { this.element[/^(?:end|bottom)/.test(iconPosition) ? "append" : "prepend"](this.icon); }, _setOptions: function (options) { var newShowLabel = options.showLabel === undefined ? this.options.showLabel : options.showLabel, newIcon = options.icon === undefined ? this.options.icon : options.icon; if (!newShowLabel && !newIcon) { options.showLabel = true; } this._super(options); }, _setOption: function (key, value) { if (key === "icon") { if (value) { this._updateIcon(key, value); } else if (this.icon) { this.icon.remove(); if (this.iconSpace) { this.iconSpace.remove(); } } } if (key === "iconPosition") { this._updateIcon(key, value); } // Make sure we can't end up with a button that has neither text nor icon if (key === "showLabel") { this._toggleClass("ui-button-icon-only", null, !value); this._updateTooltip(); } if (key === "label") { if (this.isInput) { this.element.val(value); } else { // If there is an icon, append it, else nothing then append the value // this avoids removal of the icon when setting label text this.element.html(value); if (this.icon) { this._attachIcon(this.options.iconPosition); this._attachIconSpace(this.options.iconPosition); } } } this._super(key, value); if (key === "disabled") { this._toggleClass(null, "ui-state-disabled", value); this.element[0].disabled = value; if (value) { this.element.blur(); } } }, refresh: function () { // Make sure to only check disabled if its an element that supports this otherwise // check for the disabled class to determine state var isDisabled = this.element.is("input, button") ? this.element[0].disabled : this.element.hasClass("ui-button-disabled"); if (isDisabled !== this.options.disabled) { this._setOptions({ disabled: isDisabled }); } this._updateTooltip(); } }); // DEPRECATED if ($.uiBackCompat !== false) { // Text and Icons options $.widget("ui.button", $.ui.button, { options: { text: true, icons: { primary: null, secondary: null } }, _create: function () { if (this.options.showLabel && !this.options.text) { this.options.showLabel = this.options.text; } if (!this.options.showLabel && this.options.text) { this.options.text = this.options.showLabel; } if (!this.options.icon && (this.options.icons.primary || this.options.icons.secondary)) { if (this.options.icons.primary) { this.options.icon = this.options.icons.primary; } else { this.options.icon = this.options.icons.secondary; this.options.iconPosition = "end"; } } else if (this.options.icon) { this.options.icons.primary = this.options.icon; } this._super(); }, _setOption: function (key, value) { if (key === "text") { this._super("showLabel", value); return; } if (key === "showLabel") { this.options.text = value; } if (key === "icon") { this.options.icons.primary = value; } if (key === "icons") { if (value.primary) { this._super("icon", value.primary); this._super("iconPosition", "beginning"); } else if (value.secondary) { this._super("icon", value.secondary); this._super("iconPosition", "end"); } } this._superApply(arguments); } }); $.fn.button = (function (orig) { return function () { if (!this.length || (this.length && this[0].tagName !== "INPUT") || (this.length && this[0].tagName === "INPUT" && ( this.attr("type") !== "checkbox" && this.attr("type") !== "radio" ))) { return orig.apply(this, arguments); } if (!$.ui.checkboxradio) { $.error("Checkboxradio widget missing"); } if (arguments.length === 0) { return this.checkboxradio({ "icon": false }); } return this.checkboxradio.apply(this, arguments); }; })($.fn.button); $.fn.buttonset = function () { if (!$.ui.controlgroup) { $.error("Controlgroup widget missing"); } if (arguments[0] === "option" && arguments[1] === "items" && arguments[2]) { return this.controlgroup.apply(this, [arguments[0], "items.button", arguments[2]]); } if (arguments[0] === "option" && arguments[1] === "items") { return this.controlgroup.apply(this, [arguments[0], "items.button"]); } if (typeof arguments[0] === "object" && arguments[0].items) { arguments[0].items = { button: arguments[0].items }; } return this.controlgroup.apply(this, arguments); }; } var widgetsButton = $.ui.button; // jscs:disable maximumLineLength /* jscs:disable requireCamelCaseOrUpperCaseIdentifiers */ /*! * jQuery UI Datepicker 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Datepicker //>>group: Widgets //>>description: Displays a calendar from an input or inline for selecting dates. //>>docs: http://api.jqueryui.com/datepicker/ //>>demos: http://jqueryui.com/datepicker/ //>>css.structure: ../../themes/base/core.css //>>css.structure: ../../themes/base/datepicker.css //>>css.theme: ../../themes/base/theme.css $.extend($.ui, { datepicker: { version: "1.12.1" } }); var datepicker_instActive; function datepicker_getZindex(elem) { var position, value; while (elem.length && elem[0] !== document) { // Ignore z-index if position is set to a value where z-index is ignored by the browser // This makes behavior of this function consistent across browsers // WebKit always returns auto if the element is positioned position = elem.css("position"); if (position === "absolute" || position === "relative" || position === "fixed") { // IE returns 0 when zIndex is not specified // other browsers return a string // we ignore the case of nested elements with an explicit value of 0 // <div style="z-index: -10;"><div style="z-index: 0;"></div></div> value = parseInt(elem.css("zIndex"), 10); if (!isNaN(value) && value !== 0) { return value; } } elem = elem.parent(); } return 0; } /* Date picker manager. Use the singleton instance of this class, $.datepicker, to interact with the date picker. Settings for (groups of) date pickers are maintained in an instance object, allowing multiple different settings on the same page. */ function Datepicker() { this._curInst = null; // The current instance in use this._keyEvent = false; // If the last event was a key event this._disabledInputs = []; // List of date picker inputs that have been disabled this._datepickerShowing = false; // True if the popup picker is showing , false if not this._inDialog = false; // True if showing within a "dialog", false if not this._mainDivId = "ui-datepicker-div"; // The ID of the main datepicker division this._inlineClass = "ui-datepicker-inline"; // The name of the inline marker class this._appendClass = "ui-datepicker-append"; // The name of the append marker class this._triggerClass = "ui-datepicker-trigger"; // The name of the trigger marker class this._dialogClass = "ui-datepicker-dialog"; // The name of the dialog marker class this._disableClass = "ui-datepicker-disabled"; // The name of the disabled covering marker class this._unselectableClass = "ui-datepicker-unselectable"; // The name of the unselectable cell marker class this._currentClass = "ui-datepicker-current-day"; // The name of the current day marker class this._dayOverClass = "ui-datepicker-days-cell-over"; // The name of the day hover marker class this.regional = []; // Available regional settings, indexed by language code this.regional[""] = { // Default regional settings closeText: "Done", // Display text for close link prevText: "Prev", // Display text for previous month link nextText: "Next", // Display text for next month link currentText: "Today", // Display text for current month link monthNames: ["January", "February", "March", "April", "May", "June", "July", "August", "September", "October", "November", "December"], // Names of months for drop-down and formatting monthNamesShort: ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"], // For formatting dayNames: ["Sunday", "Monday", "Tuesday", "Wednesday", "Thursday", "Friday", "Saturday"], // For formatting dayNamesShort: ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"], // For formatting dayNamesMin: ["Su", "Mo", "Tu", "We", "Th", "Fr", "Sa"], // Column headings for days starting at Sunday weekHeader: "Wk", // Column header for week of the year dateFormat: "mm/dd/yy", // See format options on parseDate firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ... isRTL: false, // True if right-to-left language, false if left-to-right showMonthAfterYear: false, // True if the year select precedes month, false for month then year yearSuffix: "" // Additional text to append to the year in the month headers }; this._defaults = { // Global defaults for all the date picker instances showOn: "focus", // "focus" for popup on focus, // "button" for trigger button, or "both" for either showAnim: "fadeIn", // Name of jQuery animation for popup showOptions: {}, // Options for enhanced animations defaultDate: null, // Used when field is blank: actual date, // +/-number for offset from today, null for today appendText: "", // Display text following the input box, e.g. showing the format buttonText: "...", // Text for trigger button buttonImage: "", // URL for trigger button image buttonImageOnly: false, // True if the image appears alone, false if it appears on a button hideIfNoPrevNext: false, // True to hide next/previous month links // if not applicable, false to just disable them navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links gotoCurrent: false, // True if today link goes back to current selection instead changeMonth: false, // True if month can be selected directly, false if only prev/next changeYear: false, // True if year can be selected directly, false if only prev/next yearRange: "c-10:c+10", // Range of years to display in drop-down, // either relative to today's year (-nn:+nn), relative to currently displayed year // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n) showOtherMonths: false, // True to show dates in other months, false to leave blank selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable showWeek: false, // True to show week of the year, false to not show it calculateWeek: this.iso8601Week, // How to calculate the week of the year, // takes a Date and returns the number of the week for it shortYearCutoff: "+10", // Short year values < this are in the current century, // > this are in the previous century, // string value starting with "+" for current year + value minDate: null, // The earliest selectable date, or null for no limit maxDate: null, // The latest selectable date, or null for no limit duration: "fast", // Duration of display/closure beforeShowDay: null, // Function that takes a date and returns an array with // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or "", // [2] = cell title (optional), e.g. $.datepicker.noWeekends beforeShow: null, // Function that takes an input field and // returns a set of custom settings for the date picker onSelect: null, // Define a callback function when a date is selected onChangeMonthYear: null, // Define a callback function when the month or year is changed onClose: null, // Define a callback function when the datepicker is closed numberOfMonths: 1, // Number of months to show at a time showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0) stepMonths: 1, // Number of months to step back/forward stepBigMonths: 12, // Number of months to step back/forward for the big links altField: "", // Selector for an alternate field to store selected dates into altFormat: "", // The date format to use for the alternate field constrainInput: true, // The input is constrained by the current date format showButtonPanel: false, // True to show button panel, false to not show it autoSize: false, // True to size the input for the date format, false to leave as is disabled: false // The initial disabled state }; $.extend(this._defaults, this.regional[""]); this.regional.en = $.extend(true, {}, this.regional[""]); this.regional["en-US"] = $.extend(true, {}, this.regional.en); this.dpDiv = datepicker_bindHover($("<div id='" + this._mainDivId + "' class='ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all'></div>")); } $.extend(Datepicker.prototype, { /* Class name added to elements to indicate already configured with a date picker. */ markerClassName: "hasDatepicker", //Keep track of the maximum number of rows displayed (see #7043) maxRows: 4, // TODO rename to "widget" when switching to widget factory _widgetDatepicker: function () { return this.dpDiv; }, /* Override the default settings for all instances of the date picker. * @param settings object - the new settings to use as defaults (anonymous object) * @return the manager object */ setDefaults: function (settings) { datepicker_extendRemove(this._defaults, settings || {}); return this; }, /* Attach the date picker to a jQuery selection. * @param target element - the target input field or division or span * @param settings object - the new settings to use for this date picker instance (anonymous) */ _attachDatepicker: function (target, settings) { var nodeName, inline, inst; nodeName = target.nodeName.toLowerCase(); inline = (nodeName === "div" || nodeName === "span"); if (!target.id) { this.uuid += 1; target.id = "dp" + this.uuid; } inst = this._newInst($(target), inline); inst.settings = $.extend({}, settings || {}); if (nodeName === "input") { this._connectDatepicker(target, inst); } else if (inline) { this._inlineDatepicker(target, inst); } }, /* Create a new instance object. */ _newInst: function (target, inline) { var id = target[0].id.replace(/([^A-Za-z0-9_\-])/g, "\\\\$1"); // escape jQuery meta chars return { id: id, input: target, // associated target selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection drawMonth: 0, drawYear: 0, // month being drawn inline: inline, // is datepicker inline or not dpDiv: (!inline ? this.dpDiv : // presentation div datepicker_bindHover($("<div class='" + this._inlineClass + " ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all'></div>"))) }; }, /* Attach the date picker to an input field. */ _connectDatepicker: function (target, inst) { var input = $(target); inst.append = $([]); inst.trigger = $([]); if (input.hasClass(this.markerClassName)) { return; } this._attachments(input, inst); input.addClass(this.markerClassName).on("keydown", this._doKeyDown). on("keypress", this._doKeyPress).on("keyup", this._doKeyUp); this._autoSize(inst); $.data(target, "datepicker", inst); //If disabled option is true, disable the datepicker once it has been attached to the input (see ticket #5665) if (inst.settings.disabled) { this._disableDatepicker(target); } }, /* Make attachments based on settings. */ _attachments: function (input, inst) { var showOn, buttonText, buttonImage, appendText = this._get(inst, "appendText"), isRTL = this._get(inst, "isRTL"); if (inst.append) { inst.append.remove(); } if (appendText) { inst.append = $("<span class='" + this._appendClass + "'>" + appendText + "</span>"); input[isRTL ? "before" : "after"](inst.append); } input.off("focus", this._showDatepicker); if (inst.trigger) { inst.trigger.remove(); } showOn = this._get(inst, "showOn"); if (showOn === "focus" || showOn === "both") { // pop-up date picker when in the marked field input.on("focus", this._showDatepicker); } if (showOn === "button" || showOn === "both") { // pop-up date picker when button clicked buttonText = this._get(inst, "buttonText"); buttonImage = this._get(inst, "buttonImage"); inst.trigger = $(this._get(inst, "buttonImageOnly") ? $("<img/>").addClass(this._triggerClass). attr({ src: buttonImage, alt: buttonText, title: buttonText }) : $("<button type='button'></button>").addClass(this._triggerClass). html(!buttonImage ? buttonText : $("<img/>").attr( { src: buttonImage, alt: buttonText, title: buttonText }))); input[isRTL ? "before" : "after"](inst.trigger); inst.trigger.on("click", function () { if ($.datepicker._datepickerShowing && $.datepicker._lastInput === input[0]) { $.datepicker._hideDatepicker(); } else if ($.datepicker._datepickerShowing && $.datepicker._lastInput !== input[0]) { $.datepicker._hideDatepicker(); $.datepicker._showDatepicker(input[0]); } else { $.datepicker._showDatepicker(input[0]); } return false; }); } }, /* Apply the maximum length for the date format. */ _autoSize: function (inst) { if (this._get(inst, "autoSize") && !inst.inline) { var findMax, max, maxI, i, date = new Date(2009, 12 - 1, 20), // Ensure double digits dateFormat = this._get(inst, "dateFormat"); if (dateFormat.match(/[DM]/)) { findMax = function (names) { max = 0; maxI = 0; for (i = 0; i < names.length; i++) { if (names[i].length > max) { max = names[i].length; maxI = i; } } return maxI; }; date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ? "monthNames" : "monthNamesShort")))); date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ? "dayNames" : "dayNamesShort"))) + 20 - date.getDay()); } inst.input.attr("size", this._formatDate(inst, date).length); } }, /* Attach an inline date picker to a div. */ _inlineDatepicker: function (target, inst) { var divSpan = $(target); if (divSpan.hasClass(this.markerClassName)) { return; } divSpan.addClass(this.markerClassName).append(inst.dpDiv); $.data(target, "datepicker", inst); this._setDate(inst, this._getDefaultDate(inst), true); this._updateDatepicker(inst); this._updateAlternate(inst); //If disabled option is true, disable the datepicker before showing it (see ticket #5665) if (inst.settings.disabled) { this._disableDatepicker(target); } // Set display:block in place of inst.dpDiv.show() which won't work on disconnected elements // http://bugs.jqueryui.com/ticket/7552 - A Datepicker created on a detached div has zero height inst.dpDiv.css("display", "block"); }, /* Pop-up the date picker in a "dialog" box. * @param input element - ignored * @param date string or Date - the initial date to display * @param onSelect function - the function to call when a date is selected * @param settings object - update the dialog date picker instance's settings (anonymous object) * @param pos int[2] - coordinates for the dialog's position within the screen or * event - with x/y coordinates or * leave empty for default (screen centre) * @return the manager object */ _dialogDatepicker: function (input, date, onSelect, settings, pos) { var id, browserWidth, browserHeight, scrollX, scrollY, inst = this._dialogInst; // internal instance if (!inst) { this.uuid += 1; id = "dp" + this.uuid; this._dialogInput = $("<input type='text' id='" + id + "' style='position: absolute; top: -100px; width: 0px;'/>"); this._dialogInput.on("keydown", this._doKeyDown); $("body").append(this._dialogInput); inst = this._dialogInst = this._newInst(this._dialogInput, false); inst.settings = {}; $.data(this._dialogInput[0], "datepicker", inst); } datepicker_extendRemove(inst.settings, settings || {}); date = (date && date.constructor === Date ? this._formatDate(inst, date) : date); this._dialogInput.val(date); this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null); if (!this._pos) { browserWidth = document.documentElement.clientWidth; browserHeight = document.documentElement.clientHeight; scrollX = document.documentElement.scrollLeft || document.body.scrollLeft; scrollY = document.documentElement.scrollTop || document.body.scrollTop; this._pos = // should use actual width/height below [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY]; } // Move input on screen for focus, but hidden behind dialog this._dialogInput.css("left", (this._pos[0] + 20) + "px").css("top", this._pos[1] + "px"); inst.settings.onSelect = onSelect; this._inDialog = true; this.dpDiv.addClass(this._dialogClass); this._showDatepicker(this._dialogInput[0]); if ($.blockUI) { $.blockUI(this.dpDiv); } $.data(this._dialogInput[0], "datepicker", inst); return this; }, /* Detach a datepicker from its control. * @param target element - the target input field or division or span */ _destroyDatepicker: function (target) { var nodeName, $target = $(target), inst = $.data(target, "datepicker"); if (!$target.hasClass(this.markerClassName)) { return; } nodeName = target.nodeName.toLowerCase(); $.removeData(target, "datepicker"); if (nodeName === "input") { inst.append.remove(); inst.trigger.remove(); $target.removeClass(this.markerClassName). off("focus", this._showDatepicker). off("keydown", this._doKeyDown). off("keypress", this._doKeyPress). off("keyup", this._doKeyUp); } else if (nodeName === "div" || nodeName === "span") { $target.removeClass(this.markerClassName).empty(); } if (datepicker_instActive === inst) { datepicker_instActive = null; } }, /* Enable the date picker to a jQuery selection. * @param target element - the target input field or division or span */ _enableDatepicker: function (target) { var nodeName, inline, $target = $(target), inst = $.data(target, "datepicker"); if (!$target.hasClass(this.markerClassName)) { return; } nodeName = target.nodeName.toLowerCase(); if (nodeName === "input") { target.disabled = false; inst.trigger.filter("button"). each(function () { this.disabled = false; }).end(). filter("img").css({ opacity: "1.0", cursor: "" }); } else if (nodeName === "div" || nodeName === "span") { inline = $target.children("." + this._inlineClass); inline.children().removeClass("ui-state-disabled"); inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). prop("disabled", false); } this._disabledInputs = $.map(this._disabledInputs, function (value) { return (value === target ? null : value); }); // delete entry }, /* Disable the date picker to a jQuery selection. * @param target element - the target input field or division or span */ _disableDatepicker: function (target) { var nodeName, inline, $target = $(target), inst = $.data(target, "datepicker"); if (!$target.hasClass(this.markerClassName)) { return; } nodeName = target.nodeName.toLowerCase(); if (nodeName === "input") { target.disabled = true; inst.trigger.filter("button"). each(function () { this.disabled = true; }).end(). filter("img").css({ opacity: "0.5", cursor: "default" }); } else if (nodeName === "div" || nodeName === "span") { inline = $target.children("." + this._inlineClass); inline.children().addClass("ui-state-disabled"); inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). prop("disabled", true); } this._disabledInputs = $.map(this._disabledInputs, function (value) { return (value === target ? null : value); }); // delete entry this._disabledInputs[this._disabledInputs.length] = target; }, /* Is the first field in a jQuery collection disabled as a datepicker? * @param target element - the target input field or division or span * @return boolean - true if disabled, false if enabled */ _isDisabledDatepicker: function (target) { if (!target) { return false; } for (var i = 0; i < this._disabledInputs.length; i++) { if (this._disabledInputs[i] === target) { return true; } } return false; }, /* Retrieve the instance data for the target control. * @param target element - the target input field or division or span * @return object - the associated instance data * @throws error if a jQuery problem getting data */ _getInst: function (target) { try { return $.data(target, "datepicker"); } catch (err) { throw "Missing instance data for this datepicker"; } }, /* Update or retrieve the settings for a date picker attached to an input field or division. * @param target element - the target input field or division or span * @param name object - the new settings to update or * string - the name of the setting to change or retrieve, * when retrieving also "all" for all instance settings or * "defaults" for all global defaults * @param value any - the new value for the setting * (omit if above is an object or to retrieve a value) */ _optionDatepicker: function (target, name, value) { var settings, date, minDate, maxDate, inst = this._getInst(target); if (arguments.length === 2 && typeof name === "string") { return (name === "defaults" ? $.extend({}, $.datepicker._defaults) : (inst ? (name === "all" ? $.extend({}, inst.settings) : this._get(inst, name)) : null)); } settings = name || {}; if (typeof name === "string") { settings = {}; settings[name] = value; } if (inst) { if (this._curInst === inst) { this._hideDatepicker(); } date = this._getDateDatepicker(target, true); minDate = this._getMinMaxDate(inst, "min"); maxDate = this._getMinMaxDate(inst, "max"); datepicker_extendRemove(inst.settings, settings); // reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided if (minDate !== null && settings.dateFormat !== undefined && settings.minDate === undefined) { inst.settings.minDate = this._formatDate(inst, minDate); } if (maxDate !== null && settings.dateFormat !== undefined && settings.maxDate === undefined) { inst.settings.maxDate = this._formatDate(inst, maxDate); } if ("disabled" in settings) { if (settings.disabled) { this._disableDatepicker(target); } else { this._enableDatepicker(target); } } this._attachments($(target), inst); this._autoSize(inst); this._setDate(inst, date); this._updateAlternate(inst); this._updateDatepicker(inst); } }, // Change method deprecated _changeDatepicker: function (target, name, value) { this._optionDatepicker(target, name, value); }, /* Redraw the date picker attached to an input field or division. * @param target element - the target input field or division or span */ _refreshDatepicker: function (target) { var inst = this._getInst(target); if (inst) { this._updateDatepicker(inst); } }, /* Set the dates for a jQuery selection. * @param target element - the target input field or division or span * @param date Date - the new date */ _setDateDatepicker: function (target, date) { var inst = this._getInst(target); if (inst) { this._setDate(inst, date); this._updateDatepicker(inst); this._updateAlternate(inst); } }, /* Get the date(s) for the first entry in a jQuery selection. * @param target element - the target input field or division or span * @param noDefault boolean - true if no default date is to be used * @return Date - the current date */ _getDateDatepicker: function (target, noDefault) { var inst = this._getInst(target); if (inst && !inst.inline) { this._setDateFromField(inst, noDefault); } return (inst ? this._getDate(inst) : null); }, /* Handle keystrokes. */ _doKeyDown: function (event) { var onSelect, dateStr, sel, inst = $.datepicker._getInst(event.target), handled = true, isRTL = inst.dpDiv.is(".ui-datepicker-rtl"); inst._keyEvent = true; if ($.datepicker._datepickerShowing) { switch (event.keyCode) { case 9: $.datepicker._hideDatepicker(); handled = false; break; // hide on tab out case 13: sel = $("td." + $.datepicker._dayOverClass + ":not(." + $.datepicker._currentClass + ")", inst.dpDiv); if (sel[0]) { $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]); } onSelect = $.datepicker._get(inst, "onSelect"); if (onSelect) { dateStr = $.datepicker._formatDate(inst); // Trigger custom callback onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); } else { $.datepicker._hideDatepicker(); } return false; // don't submit the form case 27: $.datepicker._hideDatepicker(); break; // hide on escape case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ? -$.datepicker._get(inst, "stepBigMonths") : -$.datepicker._get(inst, "stepMonths")), "M"); break; // previous month/year on page up/+ ctrl case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ? +$.datepicker._get(inst, "stepBigMonths") : +$.datepicker._get(inst, "stepMonths")), "M"); break; // next month/year on page down/+ ctrl case 35: if (event.ctrlKey || event.metaKey) { $.datepicker._clearDate(event.target); } handled = event.ctrlKey || event.metaKey; break; // clear on ctrl or command +end case 36: if (event.ctrlKey || event.metaKey) { $.datepicker._gotoToday(event.target); } handled = event.ctrlKey || event.metaKey; break; // current on ctrl or command +home case 37: if (event.ctrlKey || event.metaKey) { $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), "D"); } handled = event.ctrlKey || event.metaKey; // -1 day on ctrl or command +left if (event.originalEvent.altKey) { $.datepicker._adjustDate(event.target, (event.ctrlKey ? -$.datepicker._get(inst, "stepBigMonths") : -$.datepicker._get(inst, "stepMonths")), "M"); } // next month/year on alt +left on Mac break; case 38: if (event.ctrlKey || event.metaKey) { $.datepicker._adjustDate(event.target, -7, "D"); } handled = event.ctrlKey || event.metaKey; break; // -1 week on ctrl or command +up case 39: if (event.ctrlKey || event.metaKey) { $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), "D"); } handled = event.ctrlKey || event.metaKey; // +1 day on ctrl or command +right if (event.originalEvent.altKey) { $.datepicker._adjustDate(event.target, (event.ctrlKey ? +$.datepicker._get(inst, "stepBigMonths") : +$.datepicker._get(inst, "stepMonths")), "M"); } // next month/year on alt +right break; case 40: if (event.ctrlKey || event.metaKey) { $.datepicker._adjustDate(event.target, +7, "D"); } handled = event.ctrlKey || event.metaKey; break; // +1 week on ctrl or command +down default: handled = false; } } else if (event.keyCode === 36 && event.ctrlKey) { // display the date picker on ctrl+home $.datepicker._showDatepicker(this); } else { handled = false; } if (handled) { event.preventDefault(); event.stopPropagation(); } }, /* Filter entered characters - based on date format. */ _doKeyPress: function (event) { var chars, chr, inst = $.datepicker._getInst(event.target); if ($.datepicker._get(inst, "constrainInput")) { chars = $.datepicker._possibleChars($.datepicker._get(inst, "dateFormat")); chr = String.fromCharCode(event.charCode == null ? event.keyCode : event.charCode); return event.ctrlKey || event.metaKey || (chr < " " || !chars || chars.indexOf(chr) > -1); } }, /* Synchronise manual entry and field/alternate field. */ _doKeyUp: function (event) { var date, inst = $.datepicker._getInst(event.target); if (inst.input.val() !== inst.lastVal) { try { date = $.datepicker.parseDate($.datepicker._get(inst, "dateFormat"), (inst.input ? inst.input.val() : null), $.datepicker._getFormatConfig(inst)); if (date) { // only if valid $.datepicker._setDateFromField(inst); $.datepicker._updateAlternate(inst); $.datepicker._updateDatepicker(inst); } } catch (err) { } } return true; }, /* Pop-up the date picker for a given input field. * If false returned from beforeShow event handler do not show. * @param input element - the input field attached to the date picker or * event - if triggered by focus */ _showDatepicker: function (input) { input = input.target || input; if (input.nodeName.toLowerCase() !== "input") { // find from button/image trigger input = $("input", input.parentNode)[0]; } if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput === input) { // already here return; } var inst, beforeShow, beforeShowSettings, isFixed, offset, showAnim, duration; inst = $.datepicker._getInst(input); if ($.datepicker._curInst && $.datepicker._curInst !== inst) { $.datepicker._curInst.dpDiv.stop(true, true); if (inst && $.datepicker._datepickerShowing) { $.datepicker._hideDatepicker($.datepicker._curInst.input[0]); } } beforeShow = $.datepicker._get(inst, "beforeShow"); beforeShowSettings = beforeShow ? beforeShow.apply(input, [input, inst]) : {}; if (beforeShowSettings === false) { return; } datepicker_extendRemove(inst.settings, beforeShowSettings); inst.lastVal = null; $.datepicker._lastInput = input; $.datepicker._setDateFromField(inst); if ($.datepicker._inDialog) { // hide cursor input.value = ""; } if (!$.datepicker._pos) { // position below input $.datepicker._pos = $.datepicker._findPos(input); $.datepicker._pos[1] += input.offsetHeight; // add the height } isFixed = false; $(input).parents().each(function () { isFixed |= $(this).css("position") === "fixed"; return !isFixed; }); offset = { left: $.datepicker._pos[0], top: $.datepicker._pos[1] }; $.datepicker._pos = null; //to avoid flashes on Firefox inst.dpDiv.empty(); // determine sizing offscreen inst.dpDiv.css({ position: "absolute", display: "block", top: "-1000px" }); $.datepicker._updateDatepicker(inst); // fix width for dynamic number of date pickers // and adjust position before showing offset = $.datepicker._checkOffset(inst, offset, isFixed); inst.dpDiv.css({ position: ($.datepicker._inDialog && $.blockUI ? "static" : (isFixed ? "fixed" : "absolute")), display: "none", left: offset.left + "px", top: offset.top + "px" }); if (!inst.inline) { showAnim = $.datepicker._get(inst, "showAnim"); duration = $.datepicker._get(inst, "duration"); inst.dpDiv.css("z-index", datepicker_getZindex($(input)) + 1); $.datepicker._datepickerShowing = true; if ($.effects && $.effects.effect[showAnim]) { inst.dpDiv.show(showAnim, $.datepicker._get(inst, "showOptions"), duration); } else { inst.dpDiv[showAnim || "show"](showAnim ? duration : null); } if ($.datepicker._shouldFocusInput(inst)) { inst.input.trigger("focus"); } $.datepicker._curInst = inst; } }, /* Generate the date picker content. */ _updateDatepicker: function (inst) { this.maxRows = 4; //Reset the max number of rows being displayed (see #7043) datepicker_instActive = inst; // for delegate hover events inst.dpDiv.empty().append(this._generateHTML(inst)); this._attachHandlers(inst); var origyearshtml, numMonths = this._getNumberOfMonths(inst), cols = numMonths[1], width = 17, activeCell = inst.dpDiv.find("." + this._dayOverClass + " a"); if (activeCell.length > 0) { datepicker_handleMouseover.apply(activeCell.get(0)); } inst.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width(""); if (cols > 1) { inst.dpDiv.addClass("ui-datepicker-multi-" + cols).css("width", (width * cols) + "em"); } inst.dpDiv[(numMonths[0] !== 1 || numMonths[1] !== 1 ? "add" : "remove") + "Class"]("ui-datepicker-multi"); inst.dpDiv[(this._get(inst, "isRTL") ? "add" : "remove") + "Class"]("ui-datepicker-rtl"); if (inst === $.datepicker._curInst && $.datepicker._datepickerShowing && $.datepicker._shouldFocusInput(inst)) { inst.input.trigger("focus"); } // Deffered render of the years select (to avoid flashes on Firefox) if (inst.yearshtml) { origyearshtml = inst.yearshtml; setTimeout(function () { //assure that inst.yearshtml didn't change. if (origyearshtml === inst.yearshtml && inst.yearshtml) { inst.dpDiv.find("select.ui-datepicker-year:first").replaceWith(inst.yearshtml); } origyearshtml = inst.yearshtml = null; }, 0); } }, // #6694 - don't focus the input if it's already focused // this breaks the change event in IE // Support: IE and jQuery <1.9 _shouldFocusInput: function (inst) { return inst.input && inst.input.is(":visible") && !inst.input.is(":disabled") && !inst.input.is(":focus"); }, /* Check positioning to remain on screen. */ _checkOffset: function (inst, offset, isFixed) { var dpWidth = inst.dpDiv.outerWidth(), dpHeight = inst.dpDiv.outerHeight(), inputWidth = inst.input ? inst.input.outerWidth() : 0, inputHeight = inst.input ? inst.input.outerHeight() : 0, viewWidth = document.documentElement.clientWidth + (isFixed ? 0 : $(document).scrollLeft()), viewHeight = document.documentElement.clientHeight + (isFixed ? 0 : $(document).scrollTop()); offset.left -= (this._get(inst, "isRTL") ? (dpWidth - inputWidth) : 0); offset.left -= (isFixed && offset.left === inst.input.offset().left) ? $(document).scrollLeft() : 0; offset.top -= (isFixed && offset.top === (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0; // Now check if datepicker is showing outside window viewport - move to a better place if so. offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? Math.abs(offset.left + dpWidth - viewWidth) : 0); offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? Math.abs(dpHeight + inputHeight) : 0); return offset; }, /* Find an object's position on the screen. */ _findPos: function (obj) { var position, inst = this._getInst(obj), isRTL = this._get(inst, "isRTL"); while (obj && (obj.type === "hidden" || obj.nodeType !== 1 || $.expr.filters.hidden(obj))) { obj = obj[isRTL ? "previousSibling" : "nextSibling"]; } position = $(obj).offset(); return [position.left, position.top]; }, /* Hide the date picker from view. * @param input element - the input field attached to the date picker */ _hideDatepicker: function (input) { var showAnim, duration, postProcess, onClose, inst = this._curInst; if (!inst || (input && inst !== $.data(input, "datepicker"))) { return; } if (this._datepickerShowing) { showAnim = this._get(inst, "showAnim"); duration = this._get(inst, "duration"); postProcess = function () { $.datepicker._tidyDialog(inst); }; // DEPRECATED: after BC for 1.8.x $.effects[ showAnim ] is not needed if ($.effects && ($.effects.effect[showAnim] || $.effects[showAnim])) { inst.dpDiv.hide(showAnim, $.datepicker._get(inst, "showOptions"), duration, postProcess); } else { inst.dpDiv[(showAnim === "slideDown" ? "slideUp" : (showAnim === "fadeIn" ? "fadeOut" : "hide"))]((showAnim ? duration : null), postProcess); } if (!showAnim) { postProcess(); } this._datepickerShowing = false; onClose = this._get(inst, "onClose"); if (onClose) { onClose.apply((inst.input ? inst.input[0] : null), [(inst.input ? inst.input.val() : ""), inst]); } this._lastInput = null; if (this._inDialog) { this._dialogInput.css({ position: "absolute", left: "0", top: "-100px" }); if ($.blockUI) { $.unblockUI(); $("body").append(this.dpDiv); } } this._inDialog = false; } }, /* Tidy up after a dialog display. */ _tidyDialog: function (inst) { inst.dpDiv.removeClass(this._dialogClass).off(".ui-datepicker-calendar"); }, /* Close date picker if clicked elsewhere. */ _checkExternalClick: function (event) { if (!$.datepicker._curInst) { return; } var $target = $(event.target), inst = $.datepicker._getInst($target[0]); if ((($target[0].id !== $.datepicker._mainDivId && $target.parents("#" + $.datepicker._mainDivId).length === 0 && !$target.hasClass($.datepicker.markerClassName) && !$target.closest("." + $.datepicker._triggerClass).length && $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI))) || ($target.hasClass($.datepicker.markerClassName) && $.datepicker._curInst !== inst)) { $.datepicker._hideDatepicker(); } }, /* Adjust one of the date sub-fields. */ _adjustDate: function (id, offset, period) { var target = $(id), inst = this._getInst(target[0]); if (this._isDisabledDatepicker(target[0])) { return; } this._adjustInstDate(inst, offset + (period === "M" ? this._get(inst, "showCurrentAtPos") : 0), // undo positioning period); this._updateDatepicker(inst); }, /* Action for current link. */ _gotoToday: function (id) { var date, target = $(id), inst = this._getInst(target[0]); if (this._get(inst, "gotoCurrent") && inst.currentDay) { inst.selectedDay = inst.currentDay; inst.drawMonth = inst.selectedMonth = inst.currentMonth; inst.drawYear = inst.selectedYear = inst.currentYear; } else { date = new Date(); inst.selectedDay = date.getDate(); inst.drawMonth = inst.selectedMonth = date.getMonth(); inst.drawYear = inst.selectedYear = date.getFullYear(); } this._notifyChange(inst); this._adjustDate(target); }, /* Action for selecting a new month/year. */ _selectMonthYear: function (id, select, period) { var target = $(id), inst = this._getInst(target[0]); inst["selected" + (period === "M" ? "Month" : "Year")] = inst["draw" + (period === "M" ? "Month" : "Year")] = parseInt(select.options[select.selectedIndex].value, 10); this._notifyChange(inst); this._adjustDate(target); }, /* Action for selecting a day. */ _selectDay: function (id, month, year, td) { var inst, target = $(id); if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) { return; } inst = this._getInst(target[0]); inst.selectedDay = inst.currentDay = $("a", td).html(); inst.selectedMonth = inst.currentMonth = month; inst.selectedYear = inst.currentYear = year; this._selectDate(id, this._formatDate(inst, inst.currentDay, inst.currentMonth, inst.currentYear)); }, /* Erase the input field and hide the date picker. */ _clearDate: function (id) { var target = $(id); this._selectDate(target, ""); }, /* Update the input field with the selected date. */ _selectDate: function (id, dateStr) { var onSelect, target = $(id), inst = this._getInst(target[0]); dateStr = (dateStr != null ? dateStr : this._formatDate(inst)); if (inst.input) { inst.input.val(dateStr); } this._updateAlternate(inst); onSelect = this._get(inst, "onSelect"); if (onSelect) { onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback } else if (inst.input) { inst.input.trigger("change"); // fire the change event } if (inst.inline) { this._updateDatepicker(inst); } else { this._hideDatepicker(); this._lastInput = inst.input[0]; if (typeof (inst.input[0]) !== "object") { inst.input.trigger("focus"); // restore focus } this._lastInput = null; } }, /* Update any alternate field to synchronise with the main field. */ _updateAlternate: function (inst) { var altFormat, date, dateStr, altField = this._get(inst, "altField"); if (altField) { // update alternate field too altFormat = this._get(inst, "altFormat") || this._get(inst, "dateFormat"); date = this._getDate(inst); dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst)); $(altField).val(dateStr); } }, /* Set as beforeShowDay function to prevent selection of weekends. * @param date Date - the date to customise * @return [boolean, string] - is this date selectable?, what is its CSS class? */ noWeekends: function (date) { var day = date.getDay(); return [(day > 0 && day < 6), ""]; }, /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition. * @param date Date - the date to get the week for * @return number - the number of the week within the year that contains this date */ iso8601Week: function (date) { var time, checkDate = new Date(date.getTime()); // Find Thursday of this week starting on Monday checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7)); time = checkDate.getTime(); checkDate.setMonth(0); // Compare with Jan 1 checkDate.setDate(1); return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1; }, /* Parse a string value into a date object. * See formatDate below for the possible formats. * * @param format string - the expected format of the date * @param value string - the date in the above format * @param settings Object - attributes include: * shortYearCutoff number - the cutoff year for determining the century (optional) * dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) * dayNames string[7] - names of the days from Sunday (optional) * monthNamesShort string[12] - abbreviated names of the months (optional) * monthNames string[12] - names of the months (optional) * @return Date - the extracted date value or null if value is blank */ parseDate: function (format, value, settings) { if (format == null || value == null) { throw "Invalid arguments"; } value = (typeof value === "object" ? value.toString() : value + ""); if (value === "") { return null; } var iFormat, dim, extra, iValue = 0, shortYearCutoffTemp = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff, shortYearCutoff = (typeof shortYearCutoffTemp !== "string" ? shortYearCutoffTemp : new Date().getFullYear() % 100 + parseInt(shortYearCutoffTemp, 10)), dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort, dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames, monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort, monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames, year = -1, month = -1, day = -1, doy = -1, literal = false, date, // Check whether a format character is doubled lookAhead = function (match) { var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) === match); if (matches) { iFormat++; } return matches; }, // Extract a number from the string value getNumber = function (match) { var isDoubled = lookAhead(match), size = (match === "@" ? 14 : (match === "!" ? 20 : (match === "y" && isDoubled ? 4 : (match === "o" ? 3 : 2)))), minSize = (match === "y" ? size : 1), digits = new RegExp("^\\d{" + minSize + "," + size + "}"), num = value.substring(iValue).match(digits); if (!num) { throw "Missing number at position " + iValue; } iValue += num[0].length; return parseInt(num[0], 10); }, // Extract a name from the string value and convert to an index getName = function (match, shortNames, longNames) { var index = -1, names = $.map(lookAhead(match) ? longNames : shortNames, function (v, k) { return [[k, v]]; }).sort(function (a, b) { return -(a[1].length - b[1].length); }); $.each(names, function (i, pair) { var name = pair[1]; if (value.substr(iValue, name.length).toLowerCase() === name.toLowerCase()) { index = pair[0]; iValue += name.length; return false; } }); if (index !== -1) { return index + 1; } else { throw "Unknown name at position " + iValue; } }, // Confirm that a literal character matches the string value checkLiteral = function () { if (value.charAt(iValue) !== format.charAt(iFormat)) { throw "Unexpected literal at position " + iValue; } iValue++; }; for (iFormat = 0; iFormat < format.length; iFormat++) { if (literal) { if (format.charAt(iFormat) === "'" && !lookAhead("'")) { literal = false; } else { checkLiteral(); } } else { switch (format.charAt(iFormat)) { case "d": day = getNumber("d"); break; case "D": getName("D", dayNamesShort, dayNames); break; case "o": doy = getNumber("o"); break; case "m": month = getNumber("m"); break; case "M": month = getName("M", monthNamesShort, monthNames); break; case "y": year = getNumber("y"); break; case "@": date = new Date(getNumber("@")); year = date.getFullYear(); month = date.getMonth() + 1; day = date.getDate(); break; case "!": date = new Date((getNumber("!") - this._ticksTo1970) / 10000); year = date.getFullYear(); month = date.getMonth() + 1; day = date.getDate(); break; case "'": if (lookAhead("'")) { checkLiteral(); } else { literal = true; } break; default: checkLiteral(); } } } if (iValue < value.length) { extra = value.substr(iValue); if (!/^\s+/.test(extra)) { throw "Extra/unparsed characters found in date: " + extra; } } if (year === -1) { year = new Date().getFullYear(); } else if (year < 100) { year += new Date().getFullYear() - new Date().getFullYear() % 100 + (year <= shortYearCutoff ? 0 : -100); } if (doy > -1) { month = 1; day = doy; do { dim = this._getDaysInMonth(year, month - 1); if (day <= dim) { break; } month++; day -= dim; } while (true); } date = this._daylightSavingAdjust(new Date(year, month - 1, day)); if (date.getFullYear() !== year || date.getMonth() + 1 !== month || date.getDate() !== day) { throw "Invalid date"; // E.g. 31/02/00 } return date; }, /* Standard date formats. */ ATOM: "yy-mm-dd", // RFC 3339 (ISO 8601) COOKIE: "D, dd M yy", ISO_8601: "yy-mm-dd", RFC_822: "D, d M y", RFC_850: "DD, dd-M-y", RFC_1036: "D, d M y", RFC_1123: "D, d M yy", RFC_2822: "D, d M yy", RSS: "D, d M y", // RFC 822 TICKS: "!", TIMESTAMP: "@", W3C: "yy-mm-dd", // ISO 8601 _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) + Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000), /* Format a date object into a string value. * The format can be combinations of the following: * d - day of month (no leading zero) * dd - day of month (two digit) * o - day of year (no leading zeros) * oo - day of year (three digit) * D - day name short * DD - day name long * m - month of year (no leading zero) * mm - month of year (two digit) * M - month name short * MM - month name long * y - year (two digit) * yy - year (four digit) * @ - Unix timestamp (ms since 01/01/1970) * ! - Windows ticks (100ns since 01/01/0001) * "..." - literal text * '' - single quote * * @param format string - the desired format of the date * @param date Date - the date value to format * @param settings Object - attributes include: * dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) * dayNames string[7] - names of the days from Sunday (optional) * monthNamesShort string[12] - abbreviated names of the months (optional) * monthNames string[12] - names of the months (optional) * @return string - the date in the above format */ formatDate: function (format, date, settings) { if (!date) { return ""; } var iFormat, dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort, dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames, monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort, monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames, // Check whether a format character is doubled lookAhead = function (match) { var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) === match); if (matches) { iFormat++; } return matches; }, // Format a number, with leading zero if necessary formatNumber = function (match, value, len) { var num = "" + value; if (lookAhead(match)) { while (num.length < len) { num = "0" + num; } } return num; }, // Format a name, short or long as requested formatName = function (match, value, shortNames, longNames) { return (lookAhead(match) ? longNames[value] : shortNames[value]); }, output = "", literal = false; if (date) { for (iFormat = 0; iFormat < format.length; iFormat++) { if (literal) { if (format.charAt(iFormat) === "'" && !lookAhead("'")) { literal = false; } else { output += format.charAt(iFormat); } } else { switch (format.charAt(iFormat)) { case "d": output += formatNumber("d", date.getDate(), 2); break; case "D": output += formatName("D", date.getDay(), dayNamesShort, dayNames); break; case "o": output += formatNumber("o", Math.round((new Date(date.getFullYear(), date.getMonth(), date.getDate()).getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000), 3); break; case "m": output += formatNumber("m", date.getMonth() + 1, 2); break; case "M": output += formatName("M", date.getMonth(), monthNamesShort, monthNames); break; case "y": output += (lookAhead("y") ? date.getFullYear() : (date.getFullYear() % 100 < 10 ? "0" : "") + date.getFullYear() % 100); break; case "@": output += date.getTime(); break; case "!": output += date.getTime() * 10000 + this._ticksTo1970; break; case "'": if (lookAhead("'")) { output += "'"; } else { literal = true; } break; default: output += format.charAt(iFormat); } } } } return output; }, /* Extract all possible characters from the date format. */ _possibleChars: function (format) { var iFormat, chars = "", literal = false, // Check whether a format character is doubled lookAhead = function (match) { var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) === match); if (matches) { iFormat++; } return matches; }; for (iFormat = 0; iFormat < format.length; iFormat++) { if (literal) { if (format.charAt(iFormat) === "'" && !lookAhead("'")) { literal = false; } else { chars += format.charAt(iFormat); } } else { switch (format.charAt(iFormat)) { case "d": case "m": case "y": case "@": chars += "0123456789"; break; case "D": case "M": return null; // Accept anything case "'": if (lookAhead("'")) { chars += "'"; } else { literal = true; } break; default: chars += format.charAt(iFormat); } } } return chars; }, /* Get a setting value, defaulting if necessary. */ _get: function (inst, name) { return inst.settings[name] !== undefined ? inst.settings[name] : this._defaults[name]; }, /* Parse existing date and initialise date picker. */ _setDateFromField: function (inst, noDefault) { if (inst.input.val() === inst.lastVal) { return; } var dateFormat = this._get(inst, "dateFormat"), dates = inst.lastVal = inst.input ? inst.input.val() : null, defaultDate = this._getDefaultDate(inst), date = defaultDate, settings = this._getFormatConfig(inst); try { date = this.parseDate(dateFormat, dates, settings) || defaultDate; } catch (event) { dates = (noDefault ? "" : dates); } inst.selectedDay = date.getDate(); inst.drawMonth = inst.selectedMonth = date.getMonth(); inst.drawYear = inst.selectedYear = date.getFullYear(); inst.currentDay = (dates ? date.getDate() : 0); inst.currentMonth = (dates ? date.getMonth() : 0); inst.currentYear = (dates ? date.getFullYear() : 0); this._adjustInstDate(inst); }, /* Retrieve the default date shown on opening. */ _getDefaultDate: function (inst) { return this._restrictMinMax(inst, this._determineDate(inst, this._get(inst, "defaultDate"), new Date())); }, /* A date may be specified as an exact value or a relative one. */ _determineDate: function (inst, date, defaultDate) { var offsetNumeric = function (offset) { var date = new Date(); date.setDate(date.getDate() + offset); return date; }, offsetString = function (offset) { try { return $.datepicker.parseDate($.datepicker._get(inst, "dateFormat"), offset, $.datepicker._getFormatConfig(inst)); } catch (e) { // Ignore } var date = (offset.toLowerCase().match(/^c/) ? $.datepicker._getDate(inst) : null) || new Date(), year = date.getFullYear(), month = date.getMonth(), day = date.getDate(), pattern = /([+\-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g, matches = pattern.exec(offset); while (matches) { switch (matches[2] || "d") { case "d": case "D": day += parseInt(matches[1], 10); break; case "w": case "W": day += parseInt(matches[1], 10) * 7; break; case "m": case "M": month += parseInt(matches[1], 10); day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); break; case "y": case "Y": year += parseInt(matches[1], 10); day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); break; } matches = pattern.exec(offset); } return new Date(year, month, day); }, newDate = (date == null || date === "" ? defaultDate : (typeof date === "string" ? offsetString(date) : (typeof date === "number" ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime())))); newDate = (newDate && newDate.toString() === "Invalid Date" ? defaultDate : newDate); if (newDate) { newDate.setHours(0); newDate.setMinutes(0); newDate.setSeconds(0); newDate.setMilliseconds(0); } return this._daylightSavingAdjust(newDate); }, /* Handle switch to/from daylight saving. * Hours may be non-zero on daylight saving cut-over: * > 12 when midnight changeover, but then cannot generate * midnight datetime, so jump to 1AM, otherwise reset. * @param date (Date) the date to check * @return (Date) the corrected date */ _daylightSavingAdjust: function (date) { if (!date) { return null; } date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0); return date; }, /* Set the date(s) directly. */ _setDate: function (inst, date, noChange) { var clear = !date, origMonth = inst.selectedMonth, origYear = inst.selectedYear, newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date())); inst.selectedDay = inst.currentDay = newDate.getDate(); inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth(); inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear(); if ((origMonth !== inst.selectedMonth || origYear !== inst.selectedYear) && !noChange) { this._notifyChange(inst); } this._adjustInstDate(inst); if (inst.input) { inst.input.val(clear ? "" : this._formatDate(inst)); } }, /* Retrieve the date(s) directly. */ _getDate: function (inst) { var startDate = (!inst.currentYear || (inst.input && inst.input.val() === "") ? null : this._daylightSavingAdjust(new Date( inst.currentYear, inst.currentMonth, inst.currentDay))); return startDate; }, /* Attach the onxxx handlers. These are declared statically so * they work with static code transformers like Caja. */ _attachHandlers: function (inst) { var stepMonths = this._get(inst, "stepMonths"), id = "#" + inst.id.replace(/\\\\/g, "\\"); inst.dpDiv.find("[data-handler]").map(function () { var handler = { prev: function () { $.datepicker._adjustDate(id, -stepMonths, "M"); }, next: function () { $.datepicker._adjustDate(id, +stepMonths, "M"); }, hide: function () { $.datepicker._hideDatepicker(); }, today: function () { $.datepicker._gotoToday(id); }, selectDay: function () { $.datepicker._selectDay(id, +this.getAttribute("data-month"), +this.getAttribute("data-year"), this); return false; }, selectMonth: function () { $.datepicker._selectMonthYear(id, this, "M"); return false; }, selectYear: function () { $.datepicker._selectMonthYear(id, this, "Y"); return false; } }; $(this).on(this.getAttribute("data-event"), handler[this.getAttribute("data-handler")]); }); }, /* Generate the HTML for the current state of the date picker. */ _generateHTML: function (inst) { var maxDraw, prevText, prev, nextText, next, currentText, gotoDate, controls, buttonPanel, firstDay, showWeek, dayNames, dayNamesMin, monthNames, monthNamesShort, beforeShowDay, showOtherMonths, selectOtherMonths, defaultDate, html, dow, row, group, col, selectedDate, cornerClass, calender, thead, day, daysInMonth, leadDays, curRows, numRows, printDate, dRow, tbody, daySettings, otherMonth, unselectable, tempDate = new Date(), today = this._daylightSavingAdjust( new Date(tempDate.getFullYear(), tempDate.getMonth(), tempDate.getDate())), // clear time isRTL = this._get(inst, "isRTL"), showButtonPanel = this._get(inst, "showButtonPanel"), hideIfNoPrevNext = this._get(inst, "hideIfNoPrevNext"), navigationAsDateFormat = this._get(inst, "navigationAsDateFormat"), numMonths = this._getNumberOfMonths(inst), showCurrentAtPos = this._get(inst, "showCurrentAtPos"), stepMonths = this._get(inst, "stepMonths"), isMultiMonth = (numMonths[0] !== 1 || numMonths[1] !== 1), currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) : new Date(inst.currentYear, inst.currentMonth, inst.currentDay))), minDate = this._getMinMaxDate(inst, "min"), maxDate = this._getMinMaxDate(inst, "max"), drawMonth = inst.drawMonth - showCurrentAtPos, drawYear = inst.drawYear; if (drawMonth < 0) { drawMonth += 12; drawYear--; } if (maxDate) { maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(), maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate())); maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw); while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) { drawMonth--; if (drawMonth < 0) { drawMonth = 11; drawYear--; } } } inst.drawMonth = drawMonth; inst.drawYear = drawYear; prevText = this._get(inst, "prevText"); prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText, this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)), this._getFormatConfig(inst))); prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ? "<a class='ui-datepicker-prev ui-corner-all' data-handler='prev' data-event='click'" + " title='" + prevText + "'><span class='ui-icon ui-icon-circle-triangle-" + (isRTL ? "e" : "w") + "'>" + prevText + "</span></a>" : (hideIfNoPrevNext ? "" : "<a class='ui-datepicker-prev ui-corner-all ui-state-disabled' title='" + prevText + "'><span class='ui-icon ui-icon-circle-triangle-" + (isRTL ? "e" : "w") + "'>" + prevText + "</span></a>")); nextText = this._get(inst, "nextText"); nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText, this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)), this._getFormatConfig(inst))); next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ? "<a class='ui-datepicker-next ui-corner-all' data-handler='next' data-event='click'" + " title='" + nextText + "'><span class='ui-icon ui-icon-circle-triangle-" + (isRTL ? "w" : "e") + "'>" + nextText + "</span></a>" : (hideIfNoPrevNext ? "" : "<a class='ui-datepicker-next ui-corner-all ui-state-disabled' title='" + nextText + "'><span class='ui-icon ui-icon-circle-triangle-" + (isRTL ? "w" : "e") + "'>" + nextText + "</span></a>")); currentText = this._get(inst, "currentText"); gotoDate = (this._get(inst, "gotoCurrent") && inst.currentDay ? currentDate : today); currentText = (!navigationAsDateFormat ? currentText : this.formatDate(currentText, gotoDate, this._getFormatConfig(inst))); controls = (!inst.inline ? "<button type='button' class='ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all' data-handler='hide' data-event='click'>" + this._get(inst, "closeText") + "</button>" : ""); buttonPanel = (showButtonPanel) ? "<div class='ui-datepicker-buttonpane ui-widget-content'>" + (isRTL ? controls : "") + (this._isInRange(inst, gotoDate) ? "<button type='button' class='ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all' data-handler='today' data-event='click'" + ">" + currentText + "</button>" : "") + (isRTL ? "" : controls) + "</div>" : ""; firstDay = parseInt(this._get(inst, "firstDay"), 10); firstDay = (isNaN(firstDay) ? 0 : firstDay); showWeek = this._get(inst, "showWeek"); dayNames = this._get(inst, "dayNames"); dayNamesMin = this._get(inst, "dayNamesMin"); monthNames = this._get(inst, "monthNames"); monthNamesShort = this._get(inst, "monthNamesShort"); beforeShowDay = this._get(inst, "beforeShowDay"); showOtherMonths = this._get(inst, "showOtherMonths"); selectOtherMonths = this._get(inst, "selectOtherMonths"); defaultDate = this._getDefaultDate(inst); html = ""; for (row = 0; row < numMonths[0]; row++) { group = ""; this.maxRows = 4; for (col = 0; col < numMonths[1]; col++) { selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay)); cornerClass = " ui-corner-all"; calender = ""; if (isMultiMonth) { calender += "<div class='ui-datepicker-group"; if (numMonths[1] > 1) { switch (col) { case 0: calender += " ui-datepicker-group-first"; cornerClass = " ui-corner-" + (isRTL ? "right" : "left"); break; case numMonths[1] - 1: calender += " ui-datepicker-group-last"; cornerClass = " ui-corner-" + (isRTL ? "left" : "right"); break; default: calender += " ui-datepicker-group-middle"; cornerClass = ""; break; } } calender += "'>"; } calender += "<div class='ui-datepicker-header ui-widget-header ui-helper-clearfix" + cornerClass + "'>" + (/all|left/.test(cornerClass) && row === 0 ? (isRTL ? next : prev) : "") + (/all|right/.test(cornerClass) && row === 0 ? (isRTL ? prev : next) : "") + this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate, row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers "</div><table class='ui-datepicker-calendar'><thead>" + "<tr>"; thead = (showWeek ? "<th class='ui-datepicker-week-col'>" + this._get(inst, "weekHeader") + "</th>" : ""); for (dow = 0; dow < 7; dow++) { // days of the week day = (dow + firstDay) % 7; thead += "<th scope='col'" + ((dow + firstDay + 6) % 7 >= 5 ? " class='ui-datepicker-week-end'" : "") + ">" + "<span title='" + dayNames[day] + "'>" + dayNamesMin[day] + "</span></th>"; } calender += thead + "</tr></thead><tbody>"; daysInMonth = this._getDaysInMonth(drawYear, drawMonth); if (drawYear === inst.selectedYear && drawMonth === inst.selectedMonth) { inst.selectedDay = Math.min(inst.selectedDay, daysInMonth); } leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7; curRows = Math.ceil((leadDays + daysInMonth) / 7); // calculate the number of rows to generate numRows = (isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows); //If multiple months, use the higher number of rows (see #7043) this.maxRows = numRows; printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays)); for (dRow = 0; dRow < numRows; dRow++) { // create date picker rows calender += "<tr>"; tbody = (!showWeek ? "" : "<td class='ui-datepicker-week-col'>" + this._get(inst, "calculateWeek")(printDate) + "</td>"); for (dow = 0; dow < 7; dow++) { // create date picker days daySettings = (beforeShowDay ? beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, ""]); otherMonth = (printDate.getMonth() !== drawMonth); unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] || (minDate && printDate < minDate) || (maxDate && printDate > maxDate); tbody += "<td class='" + ((dow + firstDay + 6) % 7 >= 5 ? " ui-datepicker-week-end" : "") + // highlight weekends (otherMonth ? " ui-datepicker-other-month" : "") + // highlight days from other months ((printDate.getTime() === selectedDate.getTime() && drawMonth === inst.selectedMonth && inst._keyEvent) || // user pressed key (defaultDate.getTime() === printDate.getTime() && defaultDate.getTime() === selectedDate.getTime()) ? // or defaultDate is current printedDate and defaultDate is selectedDate " " + this._dayOverClass : "") + // highlight selected day (unselectable ? " " + this._unselectableClass + " ui-state-disabled" : "") + // highlight unselectable days (otherMonth && !showOtherMonths ? "" : " " + daySettings[1] + // highlight custom dates (printDate.getTime() === currentDate.getTime() ? " " + this._currentClass : "") + // highlight selected day (printDate.getTime() === today.getTime() ? " ui-datepicker-today" : "")) + "'" + // highlight today (if different) ((!otherMonth || showOtherMonths) && daySettings[2] ? " title='" + daySettings[2].replace(/'/g, "'") + "'" : "") + // cell title (unselectable ? "" : " data-handler='selectDay' data-event='click' data-month='" + printDate.getMonth() + "' data-year='" + printDate.getFullYear() + "'") + ">" + // actions (otherMonth && !showOtherMonths ? " " : // display for other months (unselectable ? "<span class='ui-state-default'>" + printDate.getDate() + "</span>" : "<a class='ui-state-default" + (printDate.getTime() === today.getTime() ? " ui-state-highlight" : "") + (printDate.getTime() === currentDate.getTime() ? " ui-state-active" : "") + // highlight selected day (otherMonth ? " ui-priority-secondary" : "") + // distinguish dates from other months "' href='#'>" + printDate.getDate() + "</a>")) + "</td>"; // display selectable date printDate.setDate(printDate.getDate() + 1); printDate = this._daylightSavingAdjust(printDate); } calender += tbody + "</tr>"; } drawMonth++; if (drawMonth > 11) { drawMonth = 0; drawYear++; } calender += "</tbody></table>" + (isMultiMonth ? "</div>" + ((numMonths[0] > 0 && col === numMonths[1] - 1) ? "<div class='ui-datepicker-row-break'></div>" : "") : ""); group += calender; } html += group; } html += buttonPanel; inst._keyEvent = false; return html; }, /* Generate the month and year header. */ _generateMonthYearHeader: function (inst, drawMonth, drawYear, minDate, maxDate, secondary, monthNames, monthNamesShort) { var inMinYear, inMaxYear, month, years, thisYear, determineYear, year, endYear, changeMonth = this._get(inst, "changeMonth"), changeYear = this._get(inst, "changeYear"), showMonthAfterYear = this._get(inst, "showMonthAfterYear"), html = "<div class='ui-datepicker-title'>", monthHtml = ""; // Month selection if (secondary || !changeMonth) { monthHtml += "<span class='ui-datepicker-month'>" + monthNames[drawMonth] + "</span>"; } else { inMinYear = (minDate && minDate.getFullYear() === drawYear); inMaxYear = (maxDate && maxDate.getFullYear() === drawYear); monthHtml += "<select class='ui-datepicker-month' data-handler='selectMonth' data-event='change'>"; for (month = 0; month < 12; month++) { if ((!inMinYear || month >= minDate.getMonth()) && (!inMaxYear || month <= maxDate.getMonth())) { monthHtml += "<option value='" + month + "'" + (month === drawMonth ? " selected='selected'" : "") + ">" + monthNamesShort[month] + "</option>"; } } monthHtml += "</select>"; } if (!showMonthAfterYear) { html += monthHtml + (secondary || !(changeMonth && changeYear) ? " " : ""); } // Year selection if (!inst.yearshtml) { inst.yearshtml = ""; if (secondary || !changeYear) { html += "<span class='ui-datepicker-year'>" + drawYear + "</span>"; } else { // determine range of years to display years = this._get(inst, "yearRange").split(":"); thisYear = new Date().getFullYear(); determineYear = function (value) { var year = (value.match(/c[+\-].*/) ? drawYear + parseInt(value.substring(1), 10) : (value.match(/[+\-].*/) ? thisYear + parseInt(value, 10) : parseInt(value, 10))); return (isNaN(year) ? thisYear : year); }; year = determineYear(years[0]); endYear = Math.max(year, determineYear(years[1] || "")); year = (minDate ? Math.max(year, minDate.getFullYear()) : year); endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear); inst.yearshtml += "<select class='ui-datepicker-year' data-handler='selectYear' data-event='change'>"; for (; year <= endYear; year++) { inst.yearshtml += "<option value='" + year + "'" + (year === drawYear ? " selected='selected'" : "") + ">" + year + "</option>"; } inst.yearshtml += "</select>"; html += inst.yearshtml; inst.yearshtml = null; } } html += this._get(inst, "yearSuffix"); if (showMonthAfterYear) { html += (secondary || !(changeMonth && changeYear) ? " " : "") + monthHtml; } html += "</div>"; // Close datepicker_header return html; }, /* Adjust one of the date sub-fields. */ _adjustInstDate: function (inst, offset, period) { var year = inst.selectedYear + (period === "Y" ? offset : 0), month = inst.selectedMonth + (period === "M" ? offset : 0), day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + (period === "D" ? offset : 0), date = this._restrictMinMax(inst, this._daylightSavingAdjust(new Date(year, month, day))); inst.selectedDay = date.getDate(); inst.drawMonth = inst.selectedMonth = date.getMonth(); inst.drawYear = inst.selectedYear = date.getFullYear(); if (period === "M" || period === "Y") { this._notifyChange(inst); } }, /* Ensure a date is within any min/max bounds. */ _restrictMinMax: function (inst, date) { var minDate = this._getMinMaxDate(inst, "min"), maxDate = this._getMinMaxDate(inst, "max"), newDate = (minDate && date < minDate ? minDate : date); return (maxDate && newDate > maxDate ? maxDate : newDate); }, /* Notify change of month/year. */ _notifyChange: function (inst) { var onChange = this._get(inst, "onChangeMonthYear"); if (onChange) { onChange.apply((inst.input ? inst.input[0] : null), [inst.selectedYear, inst.selectedMonth + 1, inst]); } }, /* Determine the number of months to show. */ _getNumberOfMonths: function (inst) { var numMonths = this._get(inst, "numberOfMonths"); return (numMonths == null ? [1, 1] : (typeof numMonths === "number" ? [1, numMonths] : numMonths)); }, /* Determine the current maximum date - ensure no time components are set. */ _getMinMaxDate: function (inst, minMax) { return this._determineDate(inst, this._get(inst, minMax + "Date"), null); }, /* Find the number of days in a given month. */ _getDaysInMonth: function (year, month) { return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate(); }, /* Find the day of the week of the first of a month. */ _getFirstDayOfMonth: function (year, month) { return new Date(year, month, 1).getDay(); }, /* Determines if we should allow a "next/prev" month display change. */ _canAdjustMonth: function (inst, offset, curYear, curMonth) { var numMonths = this._getNumberOfMonths(inst), date = this._daylightSavingAdjust(new Date(curYear, curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1)); if (offset < 0) { date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth())); } return this._isInRange(inst, date); }, /* Is the given date in the accepted range? */ _isInRange: function (inst, date) { var yearSplit, currentYear, minDate = this._getMinMaxDate(inst, "min"), maxDate = this._getMinMaxDate(inst, "max"), minYear = null, maxYear = null, years = this._get(inst, "yearRange"); if (years) { yearSplit = years.split(":"); currentYear = new Date().getFullYear(); minYear = parseInt(yearSplit[0], 10); maxYear = parseInt(yearSplit[1], 10); if (yearSplit[0].match(/[+\-].*/)) { minYear += currentYear; } if (yearSplit[1].match(/[+\-].*/)) { maxYear += currentYear; } } return ((!minDate || date.getTime() >= minDate.getTime()) && (!maxDate || date.getTime() <= maxDate.getTime()) && (!minYear || date.getFullYear() >= minYear) && (!maxYear || date.getFullYear() <= maxYear)); }, /* Provide the configuration settings for formatting/parsing. */ _getFormatConfig: function (inst) { var shortYearCutoff = this._get(inst, "shortYearCutoff"); shortYearCutoff = (typeof shortYearCutoff !== "string" ? shortYearCutoff : new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); return { shortYearCutoff: shortYearCutoff, dayNamesShort: this._get(inst, "dayNamesShort"), dayNames: this._get(inst, "dayNames"), monthNamesShort: this._get(inst, "monthNamesShort"), monthNames: this._get(inst, "monthNames") }; }, /* Format the given date for display. */ _formatDate: function (inst, day, month, year) { if (!day) { inst.currentDay = inst.selectedDay; inst.currentMonth = inst.selectedMonth; inst.currentYear = inst.selectedYear; } var date = (day ? (typeof day === "object" ? day : this._daylightSavingAdjust(new Date(year, month, day))) : this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); return this.formatDate(this._get(inst, "dateFormat"), date, this._getFormatConfig(inst)); } }); /* * Bind hover events for datepicker elements. * Done via delegate so the binding only occurs once in the lifetime of the parent div. * Global datepicker_instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker. */ function datepicker_bindHover(dpDiv) { var selector = "button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a"; return dpDiv.on("mouseout", selector, function () { $(this).removeClass("ui-state-hover"); if (this.className.indexOf("ui-datepicker-prev") !== -1) { $(this).removeClass("ui-datepicker-prev-hover"); } if (this.className.indexOf("ui-datepicker-next") !== -1) { $(this).removeClass("ui-datepicker-next-hover"); } }) .on("mouseover", selector, datepicker_handleMouseover); } function datepicker_handleMouseover() { if (!$.datepicker._isDisabledDatepicker(datepicker_instActive.inline ? datepicker_instActive.dpDiv.parent()[0] : datepicker_instActive.input[0])) { $(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover"); $(this).addClass("ui-state-hover"); if (this.className.indexOf("ui-datepicker-prev") !== -1) { $(this).addClass("ui-datepicker-prev-hover"); } if (this.className.indexOf("ui-datepicker-next") !== -1) { $(this).addClass("ui-datepicker-next-hover"); } } } /* jQuery extend now ignores nulls! */ function datepicker_extendRemove(target, props) { $.extend(target, props); for (var name in props) { if (props[name] == null) { target[name] = props[name]; } } return target; } /* Invoke the datepicker functionality. @param options string - a command, optionally followed by additional parameters or Object - settings for attaching new datepicker functionality @return jQuery object */ $.fn.datepicker = function (options) { /* Verify an empty collection wasn't passed - Fixes #6976 */ if (!this.length) { return this; } /* Initialise the date picker. */ if (!$.datepicker.initialized) { $(document).on("mousedown", $.datepicker._checkExternalClick); $.datepicker.initialized = true; } /* Append datepicker main container to body if not exist. */ if ($("#" + $.datepicker._mainDivId).length === 0) { $("body").append($.datepicker.dpDiv); } var otherArgs = Array.prototype.slice.call(arguments, 1); if (typeof options === "string" && (options === "isDisabled" || options === "getDate" || options === "widget")) { return $.datepicker["_" + options + "Datepicker"]. apply($.datepicker, [this[0]].concat(otherArgs)); } if (options === "option" && arguments.length === 2 && typeof arguments[1] === "string") { return $.datepicker["_" + options + "Datepicker"]. apply($.datepicker, [this[0]].concat(otherArgs)); } return this.each(function () { typeof options === "string" ? $.datepicker["_" + options + "Datepicker"]. apply($.datepicker, [this].concat(otherArgs)) : $.datepicker._attachDatepicker(this, options); }); }; $.datepicker = new Datepicker(); // singleton instance $.datepicker.initialized = false; $.datepicker.uuid = new Date().getTime(); $.datepicker.version = "1.12.1"; var widgetsDatepicker = $.datepicker; /*! * jQuery UI Dialog 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Dialog //>>group: Widgets //>>description: Displays customizable dialog windows. //>>docs: http://api.jqueryui.com/dialog/ //>>demos: http://jqueryui.com/dialog/ //>>css.structure: ../../themes/base/core.css //>>css.structure: ../../themes/base/dialog.css //>>css.theme: ../../themes/base/theme.css $.widget("ui.dialog", { version: "1.12.1", options: { appendTo: "body", autoOpen: true, buttons: [], classes: { "ui-dialog": "ui-corner-all", "ui-dialog-titlebar": "ui-corner-all" }, closeOnEscape: true, closeText: "Close", draggable: true, hide: null, height: "auto", maxHeight: null, maxWidth: null, minHeight: 150, minWidth: 150, modal: false, position: { my: "center", at: "center", of: window, collision: "fit", // Ensure the titlebar is always visible using: function (pos) { var topOffset = $(this).css(pos).offset().top; if (topOffset < 0) { $(this).css("top", pos.top - topOffset); } } }, resizable: true, show: null, title: null, width: 300, // Callbacks beforeClose: null, close: null, drag: null, dragStart: null, dragStop: null, focus: null, open: null, resize: null, resizeStart: null, resizeStop: null }, sizeRelatedOptions: { buttons: true, height: true, maxHeight: true, maxWidth: true, minHeight: true, minWidth: true, width: true }, resizableRelatedOptions: { maxHeight: true, maxWidth: true, minHeight: true, minWidth: true }, _create: function () { this.originalCss = { display: this.element[0].style.display, width: this.element[0].style.width, minHeight: this.element[0].style.minHeight, maxHeight: this.element[0].style.maxHeight, height: this.element[0].style.height }; this.originalPosition = { parent: this.element.parent(), index: this.element.parent().children().index(this.element) }; this.originalTitle = this.element.attr("title"); if (this.options.title == null && this.originalTitle != null) { this.options.title = this.originalTitle; } // Dialogs can't be disabled if (this.options.disabled) { this.options.disabled = false; } this._createWrapper(); this.element .show() .removeAttr("title") .appendTo(this.uiDialog); this._addClass("ui-dialog-content", "ui-widget-content"); this._createTitlebar(); this._createButtonPane(); if (this.options.draggable && $.fn.draggable) { this._makeDraggable(); } if (this.options.resizable && $.fn.resizable) { this._makeResizable(); } this._isOpen = false; this._trackFocus(); }, _init: function () { if (this.options.autoOpen) { this.open(); } }, _appendTo: function () { var element = this.options.appendTo; if (element && (element.jquery || element.nodeType)) { return $(element); } return this.document.find(element || "body").eq(0); }, _destroy: function () { var next, originalPosition = this.originalPosition; this._untrackInstance(); this._destroyOverlay(); this.element .removeUniqueId() .css(this.originalCss) // Without detaching first, the following becomes really slow .detach(); this.uiDialog.remove(); if (this.originalTitle) { this.element.attr("title", this.originalTitle); } next = originalPosition.parent.children().eq(originalPosition.index); // Don't try to place the dialog next to itself (#8613) if (next.length && next[0] !== this.element[0]) { next.before(this.element); } else { originalPosition.parent.append(this.element); } }, widget: function () { return this.uiDialog; }, disable: $.noop, enable: $.noop, close: function (event) { var that = this; if (!this._isOpen || this._trigger("beforeClose", event) === false) { return; } this._isOpen = false; this._focusedElement = null; this._destroyOverlay(); this._untrackInstance(); if (!this.opener.filter(":focusable").trigger("focus").length) { // Hiding a focused element doesn't trigger blur in WebKit // so in case we have nothing to focus on, explicitly blur the active element // https://bugs.webkit.org/show_bug.cgi?id=47182 $.ui.safeBlur($.ui.safeActiveElement(this.document[0])); } this._hide(this.uiDialog, this.options.hide, function () { that._trigger("close", event); }); }, isOpen: function () { return this._isOpen; }, moveToTop: function () { this._moveToTop(); }, _moveToTop: function (event, silent) { var moved = false, zIndices = this.uiDialog.siblings(".ui-front:visible").map(function () { return +$(this).css("z-index"); }).get(), zIndexMax = Math.max.apply(null, zIndices); if (zIndexMax >= +this.uiDialog.css("z-index")) { this.uiDialog.css("z-index", zIndexMax + 1); moved = true; } if (moved && !silent) { this._trigger("focus", event); } return moved; }, open: function () { var that = this; if (this._isOpen) { if (this._moveToTop()) { this._focusTabbable(); } return; } this._isOpen = true; this.opener = $($.ui.safeActiveElement(this.document[0])); this._size(); this._position(); this._createOverlay(); this._moveToTop(null, true); // Ensure the overlay is moved to the top with the dialog, but only when // opening. The overlay shouldn't move after the dialog is open so that // modeless dialogs opened after the modal dialog stack properly. if (this.overlay) { this.overlay.css("z-index", this.uiDialog.css("z-index") - 1); } this._show(this.uiDialog, this.options.show, function () { that._focusTabbable(); that._trigger("focus"); }); // Track the dialog immediately upon openening in case a focus event // somehow occurs outside of the dialog before an element inside the // dialog is focused (#10152) this._makeFocusTarget(); this._trigger("open"); }, _focusTabbable: function () { // Set focus to the first match: // 1. An element that was focused previously // 2. First element inside the dialog matching [autofocus] // 3. Tabbable element inside the content element // 4. Tabbable element inside the buttonpane // 5. The close button // 6. The dialog itself var hasFocus = this._focusedElement; if (!hasFocus) { hasFocus = this.element.find("[autofocus]"); } if (!hasFocus.length) { hasFocus = this.element.find(":tabbable"); } if (!hasFocus.length) { hasFocus = this.uiDialogButtonPane.find(":tabbable"); } if (!hasFocus.length) { hasFocus = this.uiDialogTitlebarClose.filter(":tabbable"); } if (!hasFocus.length) { hasFocus = this.uiDialog; } hasFocus.eq(0).trigger("focus"); }, _keepFocus: function (event) { function checkFocus() { var activeElement = $.ui.safeActiveElement(this.document[0]), isActive = this.uiDialog[0] === activeElement || $.contains(this.uiDialog[0], activeElement); if (!isActive) { this._focusTabbable(); } } event.preventDefault(); checkFocus.call(this); // support: IE // IE <= 8 doesn't prevent moving focus even with event.preventDefault() // so we check again later this._delay(checkFocus); }, _createWrapper: function () { this.uiDialog = $("<div>") .hide() .attr({ // Setting tabIndex makes the div focusable tabIndex: -1, role: "dialog" }) .appendTo(this._appendTo()); this._addClass(this.uiDialog, "ui-dialog", "ui-widget ui-widget-content ui-front"); this._on(this.uiDialog, { keydown: function (event) { if (this.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && event.keyCode === $.ui.keyCode.ESCAPE) { event.preventDefault(); this.close(event); return; } // Prevent tabbing out of dialogs if (event.keyCode !== $.ui.keyCode.TAB || event.isDefaultPrevented()) { return; } var tabbables = this.uiDialog.find(":tabbable"), first = tabbables.filter(":first"), last = tabbables.filter(":last"); if ((event.target === last[0] || event.target === this.uiDialog[0]) && !event.shiftKey) { this._delay(function () { first.trigger("focus"); }); event.preventDefault(); } else if ((event.target === first[0] || event.target === this.uiDialog[0]) && event.shiftKey) { this._delay(function () { last.trigger("focus"); }); event.preventDefault(); } }, mousedown: function (event) { if (this._moveToTop(event)) { this._focusTabbable(); } } }); // We assume that any existing aria-describedby attribute means // that the dialog content is marked up properly // otherwise we brute force the content as the description if (!this.element.find("[aria-describedby]").length) { this.uiDialog.attr({ "aria-describedby": this.element.uniqueId().attr("id") }); } }, _createTitlebar: function () { var uiDialogTitle; this.uiDialogTitlebar = $("<div>"); this._addClass(this.uiDialogTitlebar, "ui-dialog-titlebar", "ui-widget-header ui-helper-clearfix"); this._on(this.uiDialogTitlebar, { mousedown: function (event) { // Don't prevent click on close button (#8838) // Focusing a dialog that is partially scrolled out of view // causes the browser to scroll it into view, preventing the click event if (!$(event.target).closest(".ui-dialog-titlebar-close")) { // Dialog isn't getting focus when dragging (#8063) this.uiDialog.trigger("focus"); } } }); // Support: IE // Use type="button" to prevent enter keypresses in textboxes from closing the // dialog in IE (#9312) this.uiDialogTitlebarClose = $("<button type='button'></button>") .button({ label: $("<a>").text(this.options.closeText).html(), icon: "ui-icon-closethick", showLabel: false }) .appendTo(this.uiDialogTitlebar); this._addClass(this.uiDialogTitlebarClose, "ui-dialog-titlebar-close"); this._on(this.uiDialogTitlebarClose, { click: function (event) { event.preventDefault(); this.close(event); } }); uiDialogTitle = $("<span>").uniqueId().prependTo(this.uiDialogTitlebar); this._addClass(uiDialogTitle, "ui-dialog-title"); this._title(uiDialogTitle); this.uiDialogTitlebar.prependTo(this.uiDialog); this.uiDialog.attr({ "aria-labelledby": uiDialogTitle.attr("id") }); }, _title: function (title) { if (this.options.title) { title.text(this.options.title); } else { title.html(" "); } }, _createButtonPane: function () { this.uiDialogButtonPane = $("<div>"); this._addClass(this.uiDialogButtonPane, "ui-dialog-buttonpane", "ui-widget-content ui-helper-clearfix"); this.uiButtonSet = $("<div>") .appendTo(this.uiDialogButtonPane); this._addClass(this.uiButtonSet, "ui-dialog-buttonset"); this._createButtons(); }, _createButtons: function () { var that = this, buttons = this.options.buttons; // If we already have a button pane, remove it this.uiDialogButtonPane.remove(); this.uiButtonSet.empty(); if ($.isEmptyObject(buttons) || ($.isArray(buttons) && !buttons.length)) { this._removeClass(this.uiDialog, "ui-dialog-buttons"); return; } $.each(buttons, function (name, props) { var click, buttonOptions; props = $.isFunction(props) ? { click: props, text: name } : props; // Default to a non-submitting button props = $.extend({ type: "button" }, props); // Change the context for the click callback to be the main element click = props.click; buttonOptions = { icon: props.icon, iconPosition: props.iconPosition, showLabel: props.showLabel, // Deprecated options icons: props.icons, text: props.text }; delete props.click; delete props.icon; delete props.iconPosition; delete props.showLabel; // Deprecated options delete props.icons; if (typeof props.text === "boolean") { delete props.text; } $("<button></button>", props) .button(buttonOptions) .appendTo(that.uiButtonSet) .on("click", function () { click.apply(that.element[0], arguments); }); }); this._addClass(this.uiDialog, "ui-dialog-buttons"); this.uiDialogButtonPane.appendTo(this.uiDialog); }, _makeDraggable: function () { var that = this, options = this.options; function filteredUi(ui) { return { position: ui.position, offset: ui.offset }; } this.uiDialog.draggable({ cancel: ".ui-dialog-content, .ui-dialog-titlebar-close", handle: ".ui-dialog-titlebar", containment: "document", start: function (event, ui) { that._addClass($(this), "ui-dialog-dragging"); that._blockFrames(); that._trigger("dragStart", event, filteredUi(ui)); }, drag: function (event, ui) { that._trigger("drag", event, filteredUi(ui)); }, stop: function (event, ui) { var left = ui.offset.left - that.document.scrollLeft(), top = ui.offset.top - that.document.scrollTop(); options.position = { my: "left top", at: "left" + (left >= 0 ? "+" : "") + left + " " + "top" + (top >= 0 ? "+" : "") + top, of: that.window }; that._removeClass($(this), "ui-dialog-dragging"); that._unblockFrames(); that._trigger("dragStop", event, filteredUi(ui)); } }); }, _makeResizable: function () { var that = this, options = this.options, handles = options.resizable, // .ui-resizable has position: relative defined in the stylesheet // but dialogs have to use absolute or fixed positioning position = this.uiDialog.css("position"), resizeHandles = typeof handles === "string" ? handles : "n,e,s,w,se,sw,ne,nw"; function filteredUi(ui) { return { originalPosition: ui.originalPosition, originalSize: ui.originalSize, position: ui.position, size: ui.size }; } this.uiDialog.resizable({ cancel: ".ui-dialog-content", containment: "document", alsoResize: this.element, maxWidth: options.maxWidth, maxHeight: options.maxHeight, minWidth: options.minWidth, minHeight: this._minHeight(), handles: resizeHandles, start: function (event, ui) { that._addClass($(this), "ui-dialog-resizing"); that._blockFrames(); that._trigger("resizeStart", event, filteredUi(ui)); }, resize: function (event, ui) { that._trigger("resize", event, filteredUi(ui)); }, stop: function (event, ui) { var offset = that.uiDialog.offset(), left = offset.left - that.document.scrollLeft(), top = offset.top - that.document.scrollTop(); options.height = that.uiDialog.height(); options.width = that.uiDialog.width(); options.position = { my: "left top", at: "left" + (left >= 0 ? "+" : "") + left + " " + "top" + (top >= 0 ? "+" : "") + top, of: that.window }; that._removeClass($(this), "ui-dialog-resizing"); that._unblockFrames(); that._trigger("resizeStop", event, filteredUi(ui)); } }) .css("position", position); }, _trackFocus: function () { this._on(this.widget(), { focusin: function (event) { this._makeFocusTarget(); this._focusedElement = $(event.target); } }); }, _makeFocusTarget: function () { this._untrackInstance(); this._trackingInstances().unshift(this); }, _untrackInstance: function () { var instances = this._trackingInstances(), exists = $.inArray(this, instances); if (exists !== -1) { instances.splice(exists, 1); } }, _trackingInstances: function () { var instances = this.document.data("ui-dialog-instances"); if (!instances) { instances = []; this.document.data("ui-dialog-instances", instances); } return instances; }, _minHeight: function () { var options = this.options; return options.height === "auto" ? options.minHeight : Math.min(options.minHeight, options.height); }, _position: function () { // Need to show the dialog to get the actual offset in the position plugin var isVisible = this.uiDialog.is(":visible"); if (!isVisible) { this.uiDialog.show(); } this.uiDialog.position(this.options.position); if (!isVisible) { this.uiDialog.hide(); } }, _setOptions: function (options) { var that = this, resize = false, resizableOptions = {}; $.each(options, function (key, value) { that._setOption(key, value); if (key in that.sizeRelatedOptions) { resize = true; } if (key in that.resizableRelatedOptions) { resizableOptions[key] = value; } }); if (resize) { this._size(); this._position(); } if (this.uiDialog.is(":data(ui-resizable)")) { this.uiDialog.resizable("option", resizableOptions); } }, _setOption: function (key, value) { var isDraggable, isResizable, uiDialog = this.uiDialog; if (key === "disabled") { return; } this._super(key, value); if (key === "appendTo") { this.uiDialog.appendTo(this._appendTo()); } if (key === "buttons") { this._createButtons(); } if (key === "closeText") { this.uiDialogTitlebarClose.button({ // Ensure that we always pass a string label: $("<a>").text("" + this.options.closeText).html() }); } if (key === "draggable") { isDraggable = uiDialog.is(":data(ui-draggable)"); if (isDraggable && !value) { uiDialog.draggable("destroy"); } if (!isDraggable && value) { this._makeDraggable(); } } if (key === "position") { this._position(); } if (key === "resizable") { // currently resizable, becoming non-resizable isResizable = uiDialog.is(":data(ui-resizable)"); if (isResizable && !value) { uiDialog.resizable("destroy"); } // Currently resizable, changing handles if (isResizable && typeof value === "string") { uiDialog.resizable("option", "handles", value); } // Currently non-resizable, becoming resizable if (!isResizable && value !== false) { this._makeResizable(); } } if (key === "title") { this._title(this.uiDialogTitlebar.find(".ui-dialog-title")); } }, _size: function () { // If the user has resized the dialog, the .ui-dialog and .ui-dialog-content // divs will both have width and height set, so we need to reset them var nonContentHeight, minContentHeight, maxContentHeight, options = this.options; // Reset content sizing this.element.show().css({ width: "auto", minHeight: 0, maxHeight: "none", height: 0 }); if (options.minWidth > options.width) { options.width = options.minWidth; } // Reset wrapper sizing // determine the height of all the non-content elements nonContentHeight = this.uiDialog.css({ height: "auto", width: options.width }) .outerHeight(); minContentHeight = Math.max(0, options.minHeight - nonContentHeight); maxContentHeight = typeof options.maxHeight === "number" ? Math.max(0, options.maxHeight - nonContentHeight) : "none"; if (options.height === "auto") { this.element.css({ minHeight: minContentHeight, maxHeight: maxContentHeight, height: "auto" }); } else { this.element.height(Math.max(0, options.height - nonContentHeight)); } if (this.uiDialog.is(":data(ui-resizable)")) { this.uiDialog.resizable("option", "minHeight", this._minHeight()); } }, _blockFrames: function () { this.iframeBlocks = this.document.find("iframe").map(function () { var iframe = $(this); return $("<div>") .css({ position: "absolute", width: iframe.outerWidth(), height: iframe.outerHeight() }) .appendTo(iframe.parent()) .offset(iframe.offset())[0]; }); }, _unblockFrames: function () { if (this.iframeBlocks) { this.iframeBlocks.remove(); delete this.iframeBlocks; } }, _allowInteraction: function (event) { if ($(event.target).closest(".ui-dialog").length) { return true; } // TODO: Remove hack when datepicker implements // the .ui-front logic (#8989) return !!$(event.target).closest(".ui-datepicker").length; }, _createOverlay: function () { if (!this.options.modal) { return; } // We use a delay in case the overlay is created from an // event that we're going to be cancelling (#2804) var isOpening = true; this._delay(function () { isOpening = false; }); if (!this.document.data("ui-dialog-overlays")) { // Prevent use of anchors and inputs // Using _on() for an event handler shared across many instances is // safe because the dialogs stack and must be closed in reverse order this._on(this.document, { focusin: function (event) { if (isOpening) { return; } if (!this._allowInteraction(event)) { event.preventDefault(); this._trackingInstances()[0]._focusTabbable(); } } }); } this.overlay = $("<div>") .appendTo(this._appendTo()); this._addClass(this.overlay, null, "ui-widget-overlay ui-front"); this._on(this.overlay, { mousedown: "_keepFocus" }); this.document.data("ui-dialog-overlays", (this.document.data("ui-dialog-overlays") || 0) + 1); }, _destroyOverlay: function () { if (!this.options.modal) { return; } if (this.overlay) { var overlays = this.document.data("ui-dialog-overlays") - 1; if (!overlays) { this._off(this.document, "focusin"); this.document.removeData("ui-dialog-overlays"); } else { this.document.data("ui-dialog-overlays", overlays); } this.overlay.remove(); this.overlay = null; } } }); // DEPRECATED // TODO: switch return back to widget declaration at top of file when this is removed if ($.uiBackCompat !== false) { // Backcompat for dialogClass option $.widget("ui.dialog", $.ui.dialog, { options: { dialogClass: "" }, _createWrapper: function () { this._super(); this.uiDialog.addClass(this.options.dialogClass); }, _setOption: function (key, value) { if (key === "dialogClass") { this.uiDialog .removeClass(this.options.dialogClass) .addClass(value); } this._superApply(arguments); } }); } var widgetsDialog = $.ui.dialog; /*! * jQuery UI Progressbar 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Progressbar //>>group: Widgets // jscs:disable maximumLineLength //>>description: Displays a status indicator for loading state, standard percentage, and other progress indicators. // jscs:enable maximumLineLength //>>docs: http://api.jqueryui.com/progressbar/ //>>demos: http://jqueryui.com/progressbar/ //>>css.structure: ../../themes/base/core.css //>>css.structure: ../../themes/base/progressbar.css //>>css.theme: ../../themes/base/theme.css var widgetsProgressbar = $.widget("ui.progressbar", { version: "1.12.1", options: { classes: { "ui-progressbar": "ui-corner-all", "ui-progressbar-value": "ui-corner-left", "ui-progressbar-complete": "ui-corner-right" }, max: 100, value: 0, change: null, complete: null }, min: 0, _create: function () { // Constrain initial value this.oldValue = this.options.value = this._constrainedValue(); this.element.attr({ // Only set static values; aria-valuenow and aria-valuemax are // set inside _refreshValue() role: "progressbar", "aria-valuemin": this.min }); this._addClass("ui-progressbar", "ui-widget ui-widget-content"); this.valueDiv = $("<div>").appendTo(this.element); this._addClass(this.valueDiv, "ui-progressbar-value", "ui-widget-header"); this._refreshValue(); }, _destroy: function () { this.element.removeAttr("role aria-valuemin aria-valuemax aria-valuenow"); this.valueDiv.remove(); }, value: function (newValue) { if (newValue === undefined) { return this.options.value; } this.options.value = this._constrainedValue(newValue); this._refreshValue(); }, _constrainedValue: function (newValue) { if (newValue === undefined) { newValue = this.options.value; } this.indeterminate = newValue === false; // Sanitize value if (typeof newValue !== "number") { newValue = 0; } return this.indeterminate ? false : Math.min(this.options.max, Math.max(this.min, newValue)); }, _setOptions: function (options) { // Ensure "value" option is set after other values (like max) var value = options.value; delete options.value; this._super(options); this.options.value = this._constrainedValue(value); this._refreshValue(); }, _setOption: function (key, value) { if (key === "max") { // Don't allow a max less than min value = Math.max(this.min, value); } this._super(key, value); }, _setOptionDisabled: function (value) { this._super(value); this.element.attr("aria-disabled", value); this._toggleClass(null, "ui-state-disabled", !!value); }, _percentage: function () { return this.indeterminate ? 100 : 100 * (this.options.value - this.min) / (this.options.max - this.min); }, _refreshValue: function () { var value = this.options.value, percentage = this._percentage(); this.valueDiv .toggle(this.indeterminate || value > this.min) .width(percentage.toFixed(0) + "%"); this ._toggleClass(this.valueDiv, "ui-progressbar-complete", null, value === this.options.max) ._toggleClass("ui-progressbar-indeterminate", null, this.indeterminate); if (this.indeterminate) { this.element.removeAttr("aria-valuenow"); if (!this.overlayDiv) { this.overlayDiv = $("<div>").appendTo(this.valueDiv); this._addClass(this.overlayDiv, "ui-progressbar-overlay"); } } else { this.element.attr({ "aria-valuemax": this.options.max, "aria-valuenow": value }); if (this.overlayDiv) { this.overlayDiv.remove(); this.overlayDiv = null; } } if (this.oldValue !== value) { this.oldValue = value; this._trigger("change"); } if (value === this.options.max) { this._trigger("complete"); } } }); /*! * jQuery UI Selectmenu 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Selectmenu //>>group: Widgets // jscs:disable maximumLineLength //>>description: Duplicates and extends the functionality of a native HTML select element, allowing it to be customizable in behavior and appearance far beyond the limitations of a native select. // jscs:enable maximumLineLength //>>docs: http://api.jqueryui.com/selectmenu/ //>>demos: http://jqueryui.com/selectmenu/ //>>css.structure: ../../themes/base/core.css //>>css.structure: ../../themes/base/selectmenu.css, ../../themes/base/button.css //>>css.theme: ../../themes/base/theme.css var widgetsSelectmenu = $.widget("ui.selectmenu", [$.ui.formResetMixin, { version: "1.12.1", defaultElement: "<select>", options: { appendTo: null, classes: { "ui-selectmenu-button-open": "ui-corner-top", "ui-selectmenu-button-closed": "ui-corner-all" }, disabled: null, icons: { button: "ui-icon-triangle-1-s" }, position: { my: "left top", at: "left bottom", collision: "none" }, width: false, // Callbacks change: null, close: null, focus: null, open: null, select: null }, _create: function () { var selectmenuId = this.element.uniqueId().attr("id"); this.ids = { element: selectmenuId, button: selectmenuId + "-button", menu: selectmenuId + "-menu" }; this._drawButton(); this._drawMenu(); this._bindFormResetHandler(); this._rendered = false; this.menuItems = $(); }, _drawButton: function () { var icon, that = this, item = this._parseOption( this.element.find("option:selected"), this.element[0].selectedIndex ); // Associate existing label with the new button this.labels = this.element.labels().attr("for", this.ids.button); this._on(this.labels, { click: function (event) { this.button.focus(); event.preventDefault(); } }); // Hide original select element this.element.hide(); // Create button this.button = $("<span>", { tabindex: this.options.disabled ? -1 : 0, id: this.ids.button, role: "combobox", "aria-expanded": "false", "aria-autocomplete": "list", "aria-owns": this.ids.menu, "aria-haspopup": "true", title: this.element.attr("title") }) .insertAfter(this.element); this._addClass(this.button, "ui-selectmenu-button ui-selectmenu-button-closed", "ui-button ui-widget"); icon = $("<span>").appendTo(this.button); this._addClass(icon, "ui-selectmenu-icon", "ui-icon " + this.options.icons.button); this.buttonItem = this._renderButtonItem(item) .appendTo(this.button); if (this.options.width !== false) { this._resizeButton(); } this._on(this.button, this._buttonEvents); this.button.one("focusin", function () { // Delay rendering the menu items until the button receives focus. // The menu may have already been rendered via a programmatic open. if (!that._rendered) { that._refreshMenu(); } }); }, _drawMenu: function () { var that = this; // Create menu this.menu = $("<ul>", { "aria-hidden": "true", "aria-labelledby": this.ids.button, id: this.ids.menu }); // Wrap menu this.menuWrap = $("<div>").append(this.menu); this._addClass(this.menuWrap, "ui-selectmenu-menu", "ui-front"); this.menuWrap.appendTo(this._appendTo()); // Initialize menu widget this.menuInstance = this.menu .menu({ classes: { "ui-menu": "ui-corner-bottom" }, role: "listbox", select: function (event, ui) { event.preventDefault(); // Support: IE8 // If the item was selected via a click, the text selection // will be destroyed in IE that._setSelection(); that._select(ui.item.data("ui-selectmenu-item"), event); }, focus: function (event, ui) { var item = ui.item.data("ui-selectmenu-item"); // Prevent inital focus from firing and check if its a newly focused item if (that.focusIndex != null && item.index !== that.focusIndex) { that._trigger("focus", event, { item: item }); if (!that.isOpen) { that._select(item, event); } } that.focusIndex = item.index; that.button.attr("aria-activedescendant", that.menuItems.eq(item.index).attr("id")); } }) .menu("instance"); // Don't close the menu on mouseleave this.menuInstance._off(this.menu, "mouseleave"); // Cancel the menu's collapseAll on document click this.menuInstance._closeOnDocumentClick = function () { return false; }; // Selects often contain empty items, but never contain dividers this.menuInstance._isDivider = function () { return false; }; }, refresh: function () { this._refreshMenu(); this.buttonItem.replaceWith( this.buttonItem = this._renderButtonItem( // Fall back to an empty object in case there are no options this._getSelectedItem().data("ui-selectmenu-item") || {} ) ); if (this.options.width === null) { this._resizeButton(); } }, _refreshMenu: function () { var item, options = this.element.find("option"); this.menu.empty(); this._parseOptions(options); this._renderMenu(this.menu, this.items); this.menuInstance.refresh(); this.menuItems = this.menu.find("li") .not(".ui-selectmenu-optgroup") .find(".ui-menu-item-wrapper"); this._rendered = true; if (!options.length) { return; } item = this._getSelectedItem(); // Update the menu to have the correct item focused this.menuInstance.focus(null, item); this._setAria(item.data("ui-selectmenu-item")); // Set disabled state this._setOption("disabled", this.element.prop("disabled")); }, open: function (event) { if (this.options.disabled) { return; } // If this is the first time the menu is being opened, render the items if (!this._rendered) { this._refreshMenu(); } else { // Menu clears focus on close, reset focus to selected item this._removeClass(this.menu.find(".ui-state-active"), null, "ui-state-active"); this.menuInstance.focus(null, this._getSelectedItem()); } // If there are no options, don't open the menu if (!this.menuItems.length) { return; } this.isOpen = true; this._toggleAttr(); this._resizeMenu(); this._position(); this._on(this.document, this._documentClick); this._trigger("open", event); }, _position: function () { this.menuWrap.position($.extend({ of: this.button }, this.options.position)); }, close: function (event) { if (!this.isOpen) { return; } this.isOpen = false; this._toggleAttr(); this.range = null; this._off(this.document); this._trigger("close", event); }, widget: function () { return this.button; }, menuWidget: function () { return this.menu; }, _renderButtonItem: function (item) { var buttonItem = $("<span>"); this._setText(buttonItem, item.label); this._addClass(buttonItem, "ui-selectmenu-text"); return buttonItem; }, _renderMenu: function (ul, items) { var that = this, currentOptgroup = ""; $.each(items, function (index, item) { var li; if (item.optgroup !== currentOptgroup) { li = $("<li>", { text: item.optgroup }); that._addClass(li, "ui-selectmenu-optgroup", "ui-menu-divider" + (item.element.parent("optgroup").prop("disabled") ? " ui-state-disabled" : "")); li.appendTo(ul); currentOptgroup = item.optgroup; } that._renderItemData(ul, item); }); }, _renderItemData: function (ul, item) { return this._renderItem(ul, item).data("ui-selectmenu-item", item); }, _renderItem: function (ul, item) { var li = $("<li>"), wrapper = $("<div>", { title: item.element.attr("title") }); if (item.disabled) { this._addClass(li, null, "ui-state-disabled"); } this._setText(wrapper, item.label); return li.append(wrapper).appendTo(ul); }, _setText: function (element, value) { if (value) { element.text(value); } else { element.html(" "); } }, _move: function (direction, event) { var item, next, filter = ".ui-menu-item"; if (this.isOpen) { item = this.menuItems.eq(this.focusIndex).parent("li"); } else { item = this.menuItems.eq(this.element[0].selectedIndex).parent("li"); filter += ":not(.ui-state-disabled)"; } if (direction === "first" || direction === "last") { next = item[direction === "first" ? "prevAll" : "nextAll"](filter).eq(-1); } else { next = item[direction + "All"](filter).eq(0); } if (next.length) { this.menuInstance.focus(event, next); } }, _getSelectedItem: function () { return this.menuItems.eq(this.element[0].selectedIndex).parent("li"); }, _toggle: function (event) { this[this.isOpen ? "close" : "open"](event); }, _setSelection: function () { var selection; if (!this.range) { return; } if (window.getSelection) { selection = window.getSelection(); selection.removeAllRanges(); selection.addRange(this.range); // Support: IE8 } else { this.range.select(); } // Support: IE // Setting the text selection kills the button focus in IE, but // restoring the focus doesn't kill the selection. this.button.focus(); }, _documentClick: { mousedown: function (event) { if (!this.isOpen) { return; } if (!$(event.target).closest(".ui-selectmenu-menu, #" + $.ui.escapeSelector(this.ids.button)).length) { this.close(event); } } }, _buttonEvents: { // Prevent text selection from being reset when interacting with the selectmenu (#10144) mousedown: function () { var selection; if (window.getSelection) { selection = window.getSelection(); if (selection.rangeCount) { this.range = selection.getRangeAt(0); } // Support: IE8 } else { this.range = document.selection.createRange(); } }, click: function (event) { this._setSelection(); this._toggle(event); }, keydown: function (event) { var preventDefault = true; switch (event.keyCode) { case $.ui.keyCode.TAB: case $.ui.keyCode.ESCAPE: this.close(event); preventDefault = false; break; case $.ui.keyCode.ENTER: if (this.isOpen) { this._selectFocusedItem(event); } break; case $.ui.keyCode.UP: if (event.altKey) { this._toggle(event); } else { this._move("prev", event); } break; case $.ui.keyCode.DOWN: if (event.altKey) { this._toggle(event); } else { this._move("next", event); } break; case $.ui.keyCode.SPACE: if (this.isOpen) { this._selectFocusedItem(event); } else { this._toggle(event); } break; case $.ui.keyCode.LEFT: this._move("prev", event); break; case $.ui.keyCode.RIGHT: this._move("next", event); break; case $.ui.keyCode.HOME: case $.ui.keyCode.PAGE_UP: this._move("first", event); break; case $.ui.keyCode.END: case $.ui.keyCode.PAGE_DOWN: this._move("last", event); break; default: this.menu.trigger(event); preventDefault = false; } if (preventDefault) { event.preventDefault(); } } }, _selectFocusedItem: function (event) { var item = this.menuItems.eq(this.focusIndex).parent("li"); if (!item.hasClass("ui-state-disabled")) { this._select(item.data("ui-selectmenu-item"), event); } }, _select: function (item, event) { var oldIndex = this.element[0].selectedIndex; // Change native select element this.element[0].selectedIndex = item.index; this.buttonItem.replaceWith(this.buttonItem = this._renderButtonItem(item)); this._setAria(item); this._trigger("select", event, { item: item }); if (item.index !== oldIndex) { this._trigger("change", event, { item: item }); } this.close(event); }, _setAria: function (item) { var id = this.menuItems.eq(item.index).attr("id"); this.button.attr({ "aria-labelledby": id, "aria-activedescendant": id }); this.menu.attr("aria-activedescendant", id); }, _setOption: function (key, value) { if (key === "icons") { var icon = this.button.find("span.ui-icon"); this._removeClass(icon, null, this.options.icons.button) ._addClass(icon, null, value.button); } this._super(key, value); if (key === "appendTo") { this.menuWrap.appendTo(this._appendTo()); } if (key === "width") { this._resizeButton(); } }, _setOptionDisabled: function (value) { this._super(value); this.menuInstance.option("disabled", value); this.button.attr("aria-disabled", value); this._toggleClass(this.button, null, "ui-state-disabled", value); this.element.prop("disabled", value); if (value) { this.button.attr("tabindex", -1); this.close(); } else { this.button.attr("tabindex", 0); } }, _appendTo: function () { var element = this.options.appendTo; if (element) { element = element.jquery || element.nodeType ? $(element) : this.document.find(element).eq(0); } if (!element || !element[0]) { element = this.element.closest(".ui-front, dialog"); } if (!element.length) { element = this.document[0].body; } return element; }, _toggleAttr: function () { this.button.attr("aria-expanded", this.isOpen); // We can't use two _toggleClass() calls here, because we need to make sure // we always remove classes first and add them second, otherwise if both classes have the // same theme class, it will be removed after we add it. this._removeClass(this.button, "ui-selectmenu-button-" + (this.isOpen ? "closed" : "open")) ._addClass(this.button, "ui-selectmenu-button-" + (this.isOpen ? "open" : "closed")) ._toggleClass(this.menuWrap, "ui-selectmenu-open", null, this.isOpen); this.menu.attr("aria-hidden", !this.isOpen); }, _resizeButton: function () { var width = this.options.width; // For `width: false`, just remove inline style and stop if (width === false) { this.button.css("width", ""); return; } // For `width: null`, match the width of the original element if (width === null) { width = this.element.show().outerWidth(); this.element.hide(); } this.button.outerWidth(width); }, _resizeMenu: function () { this.menu.outerWidth(Math.max( this.button.outerWidth(), // Support: IE10 // IE10 wraps long text (possibly a rounding bug) // so we add 1px to avoid the wrapping this.menu.width("").outerWidth() + 1 )); }, _getCreateOptions: function () { var options = this._super(); options.disabled = this.element.prop("disabled"); return options; }, _parseOptions: function (options) { var that = this, data = []; options.each(function (index, item) { data.push(that._parseOption($(item), index)); }); this.items = data; }, _parseOption: function (option, index) { var optgroup = option.parent("optgroup"); return { element: option, index: index, value: option.val(), label: option.text(), optgroup: optgroup.attr("label") || "", disabled: optgroup.prop("disabled") || option.prop("disabled") }; }, _destroy: function () { this._unbindFormResetHandler(); this.menuWrap.remove(); this.button.remove(); this.element.show(); this.element.removeUniqueId(); this.labels.attr("for", this.ids.element); } }]); /*! * jQuery UI Slider 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Slider //>>group: Widgets //>>description: Displays a flexible slider with ranges and accessibility via keyboard. //>>docs: http://api.jqueryui.com/slider/ //>>demos: http://jqueryui.com/slider/ //>>css.structure: ../../themes/base/core.css //>>css.structure: ../../themes/base/slider.css //>>css.theme: ../../themes/base/theme.css var widgetsSlider = $.widget("ui.slider", $.ui.mouse, { version: "1.12.1", widgetEventPrefix: "slide", options: { animate: false, classes: { "ui-slider": "ui-corner-all", "ui-slider-handle": "ui-corner-all", // Note: ui-widget-header isn't the most fittingly semantic framework class for this // element, but worked best visually with a variety of themes "ui-slider-range": "ui-corner-all ui-widget-header" }, distance: 0, max: 100, min: 0, orientation: "horizontal", range: false, step: 1, value: 0, values: null, // Callbacks change: null, slide: null, start: null, stop: null }, // Number of pages in a slider // (how many times can you page up/down to go through the whole range) numPages: 5, _create: function () { this._keySliding = false; this._mouseSliding = false; this._animateOff = true; this._handleIndex = null; this._detectOrientation(); this._mouseInit(); this._calculateNewMax(); this._addClass("ui-slider ui-slider-" + this.orientation, "ui-widget ui-widget-content"); this._refresh(); this._animateOff = false; }, _refresh: function () { this._createRange(); this._createHandles(); this._setupEvents(); this._refreshValue(); }, _createHandles: function () { var i, handleCount, options = this.options, existingHandles = this.element.find(".ui-slider-handle"), handle = "<span tabindex='0'></span>", handles = []; handleCount = (options.values && options.values.length) || 1; if (existingHandles.length > handleCount) { existingHandles.slice(handleCount).remove(); existingHandles = existingHandles.slice(0, handleCount); } for (i = existingHandles.length; i < handleCount; i++) { handles.push(handle); } this.handles = existingHandles.add($(handles.join("")).appendTo(this.element)); this._addClass(this.handles, "ui-slider-handle", "ui-state-default"); this.handle = this.handles.eq(0); this.handles.each(function (i) { $(this) .data("ui-slider-handle-index", i) .attr("tabIndex", 0); }); }, _createRange: function () { var options = this.options; if (options.range) { if (options.range === true) { if (!options.values) { options.values = [this._valueMin(), this._valueMin()]; } else if (options.values.length && options.values.length !== 2) { options.values = [options.values[0], options.values[0]]; } else if ($.isArray(options.values)) { options.values = options.values.slice(0); } } if (!this.range || !this.range.length) { this.range = $("<div>") .appendTo(this.element); this._addClass(this.range, "ui-slider-range"); } else { this._removeClass(this.range, "ui-slider-range-min ui-slider-range-max"); // Handle range switching from true to min/max this.range.css({ "left": "", "bottom": "" }); } if (options.range === "min" || options.range === "max") { this._addClass(this.range, "ui-slider-range-" + options.range); } } else { if (this.range) { this.range.remove(); } this.range = null; } }, _setupEvents: function () { this._off(this.handles); this._on(this.handles, this._handleEvents); this._hoverable(this.handles); this._focusable(this.handles); }, _destroy: function () { this.handles.remove(); if (this.range) { this.range.remove(); } this._mouseDestroy(); }, _mouseCapture: function (event) { var position, normValue, distance, closestHandle, index, allowed, offset, mouseOverHandle, that = this, o = this.options; if (o.disabled) { return false; } this.elementSize = { width: this.element.outerWidth(), height: this.element.outerHeight() }; this.elementOffset = this.element.offset(); position = { x: event.pageX, y: event.pageY }; normValue = this._normValueFromMouse(position); distance = this._valueMax() - this._valueMin() + 1; this.handles.each(function (i) { var thisDistance = Math.abs(normValue - that.values(i)); if ((distance > thisDistance) || (distance === thisDistance && (i === that._lastChangedValue || that.values(i) === o.min))) { distance = thisDistance; closestHandle = $(this); index = i; } }); allowed = this._start(event, index); if (allowed === false) { return false; } this._mouseSliding = true; this._handleIndex = index; this._addClass(closestHandle, null, "ui-state-active"); closestHandle.trigger("focus"); offset = closestHandle.offset(); mouseOverHandle = !$(event.target).parents().addBack().is(".ui-slider-handle"); this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { left: event.pageX - offset.left - (closestHandle.width() / 2), top: event.pageY - offset.top - (closestHandle.height() / 2) - (parseInt(closestHandle.css("borderTopWidth"), 10) || 0) - (parseInt(closestHandle.css("borderBottomWidth"), 10) || 0) + (parseInt(closestHandle.css("marginTop"), 10) || 0) }; if (!this.handles.hasClass("ui-state-hover")) { this._slide(event, index, normValue); } this._animateOff = true; return true; }, _mouseStart: function () { return true; }, _mouseDrag: function (event) { var position = { x: event.pageX, y: event.pageY }, normValue = this._normValueFromMouse(position); this._slide(event, this._handleIndex, normValue); return false; }, _mouseStop: function (event) { this._removeClass(this.handles, null, "ui-state-active"); this._mouseSliding = false; this._stop(event, this._handleIndex); this._change(event, this._handleIndex); this._handleIndex = null; this._clickOffset = null; this._animateOff = false; return false; }, _detectOrientation: function () { this.orientation = (this.options.orientation === "vertical") ? "vertical" : "horizontal"; }, _normValueFromMouse: function (position) { var pixelTotal, pixelMouse, percentMouse, valueTotal, valueMouse; if (this.orientation === "horizontal") { pixelTotal = this.elementSize.width; pixelMouse = position.x - this.elementOffset.left - (this._clickOffset ? this._clickOffset.left : 0); } else { pixelTotal = this.elementSize.height; pixelMouse = position.y - this.elementOffset.top - (this._clickOffset ? this._clickOffset.top : 0); } percentMouse = (pixelMouse / pixelTotal); if (percentMouse > 1) { percentMouse = 1; } if (percentMouse < 0) { percentMouse = 0; } if (this.orientation === "vertical") { percentMouse = 1 - percentMouse; } valueTotal = this._valueMax() - this._valueMin(); valueMouse = this._valueMin() + percentMouse * valueTotal; return this._trimAlignValue(valueMouse); }, _uiHash: function (index, value, values) { var uiHash = { handle: this.handles[index], handleIndex: index, value: value !== undefined ? value : this.value() }; if (this._hasMultipleValues()) { uiHash.value = value !== undefined ? value : this.values(index); uiHash.values = values || this.values(); } return uiHash; }, _hasMultipleValues: function () { return this.options.values && this.options.values.length; }, _start: function (event, index) { return this._trigger("start", event, this._uiHash(index)); }, _slide: function (event, index, newVal) { var allowed, otherVal, currentValue = this.value(), newValues = this.values(); if (this._hasMultipleValues()) { otherVal = this.values(index ? 0 : 1); currentValue = this.values(index); if (this.options.values.length === 2 && this.options.range === true) { newVal = index === 0 ? Math.min(otherVal, newVal) : Math.max(otherVal, newVal); } newValues[index] = newVal; } if (newVal === currentValue) { return; } allowed = this._trigger("slide", event, this._uiHash(index, newVal, newValues)); // A slide can be canceled by returning false from the slide callback if (allowed === false) { return; } if (this._hasMultipleValues()) { this.values(index, newVal); } else { this.value(newVal); } }, _stop: function (event, index) { this._trigger("stop", event, this._uiHash(index)); }, _change: function (event, index) { if (!this._keySliding && !this._mouseSliding) { //store the last changed value index for reference when handles overlap this._lastChangedValue = index; this._trigger("change", event, this._uiHash(index)); } }, value: function (newValue) { if (arguments.length) { this.options.value = this._trimAlignValue(newValue); this._refreshValue(); this._change(null, 0); return; } return this._value(); }, values: function (index, newValue) { var vals, newValues, i; if (arguments.length > 1) { this.options.values[index] = this._trimAlignValue(newValue); this._refreshValue(); this._change(null, index); return; } if (arguments.length) { if ($.isArray(arguments[0])) { vals = this.options.values; newValues = arguments[0]; for (i = 0; i < vals.length; i += 1) { vals[i] = this._trimAlignValue(newValues[i]); this._change(null, i); } this._refreshValue(); } else { if (this._hasMultipleValues()) { return this._values(index); } else { return this.value(); } } } else { return this._values(); } }, _setOption: function (key, value) { var i, valsLength = 0; if (key === "range" && this.options.range === true) { if (value === "min") { this.options.value = this._values(0); this.options.values = null; } else if (value === "max") { this.options.value = this._values(this.options.values.length - 1); this.options.values = null; } } if ($.isArray(this.options.values)) { valsLength = this.options.values.length; } this._super(key, value); switch (key) { case "orientation": this._detectOrientation(); this._removeClass("ui-slider-horizontal ui-slider-vertical") ._addClass("ui-slider-" + this.orientation); this._refreshValue(); if (this.options.range) { this._refreshRange(value); } // Reset positioning from previous orientation this.handles.css(value === "horizontal" ? "bottom" : "left", ""); break; case "value": this._animateOff = true; this._refreshValue(); this._change(null, 0); this._animateOff = false; break; case "values": this._animateOff = true; this._refreshValue(); // Start from the last handle to prevent unreachable handles (#9046) for (i = valsLength - 1; i >= 0; i--) { this._change(null, i); } this._animateOff = false; break; case "step": case "min": case "max": this._animateOff = true; this._calculateNewMax(); this._refreshValue(); this._animateOff = false; break; case "range": this._animateOff = true; this._refresh(); this._animateOff = false; break; } }, _setOptionDisabled: function (value) { this._super(value); this._toggleClass(null, "ui-state-disabled", !!value); }, //internal value getter // _value() returns value trimmed by min and max, aligned by step _value: function () { var val = this.options.value; val = this._trimAlignValue(val); return val; }, //internal values getter // _values() returns array of values trimmed by min and max, aligned by step // _values( index ) returns single value trimmed by min and max, aligned by step _values: function (index) { var val, vals, i; if (arguments.length) { val = this.options.values[index]; val = this._trimAlignValue(val); return val; } else if (this._hasMultipleValues()) { // .slice() creates a copy of the array // this copy gets trimmed by min and max and then returned vals = this.options.values.slice(); for (i = 0; i < vals.length; i += 1) { vals[i] = this._trimAlignValue(vals[i]); } return vals; } else { return []; } }, // Returns the step-aligned value that val is closest to, between (inclusive) min and max _trimAlignValue: function (val) { if (val <= this._valueMin()) { return this._valueMin(); } if (val >= this._valueMax()) { return this._valueMax(); } var step = (this.options.step > 0) ? this.options.step : 1, valModStep = (val - this._valueMin()) % step, alignValue = val - valModStep; if (Math.abs(valModStep) * 2 >= step) { alignValue += (valModStep > 0) ? step : (-step); } // Since JavaScript has problems with large floats, round // the final value to 5 digits after the decimal point (see #4124) return parseFloat(alignValue.toFixed(5)); }, _calculateNewMax: function () { var max = this.options.max, min = this._valueMin(), step = this.options.step, aboveMin = Math.round((max - min) / step) * step; max = aboveMin + min; if (max > this.options.max) { //If max is not divisible by step, rounding off may increase its value max -= step; } this.max = parseFloat(max.toFixed(this._precision())); }, _precision: function () { var precision = this._precisionOf(this.options.step); if (this.options.min !== null) { precision = Math.max(precision, this._precisionOf(this.options.min)); } return precision; }, _precisionOf: function (num) { var str = num.toString(), decimal = str.indexOf("."); return decimal === -1 ? 0 : str.length - decimal - 1; }, _valueMin: function () { return this.options.min; }, _valueMax: function () { return this.max; }, _refreshRange: function (orientation) { if (orientation === "vertical") { this.range.css({ "width": "", "left": "" }); } if (orientation === "horizontal") { this.range.css({ "height": "", "bottom": "" }); } }, _refreshValue: function () { var lastValPercent, valPercent, value, valueMin, valueMax, oRange = this.options.range, o = this.options, that = this, animate = (!this._animateOff) ? o.animate : false, _set = {}; if (this._hasMultipleValues()) { this.handles.each(function (i) { valPercent = (that.values(i) - that._valueMin()) / (that._valueMax() - that._valueMin()) * 100; _set[that.orientation === "horizontal" ? "left" : "bottom"] = valPercent + "%"; $(this).stop(1, 1)[animate ? "animate" : "css"](_set, o.animate); if (that.options.range === true) { if (that.orientation === "horizontal") { if (i === 0) { that.range.stop(1, 1)[animate ? "animate" : "css"]({ left: valPercent + "%" }, o.animate); } if (i === 1) { that.range[animate ? "animate" : "css"]({ width: (valPercent - lastValPercent) + "%" }, { queue: false, duration: o.animate }); } } else { if (i === 0) { that.range.stop(1, 1)[animate ? "animate" : "css"]({ bottom: (valPercent) + "%" }, o.animate); } if (i === 1) { that.range[animate ? "animate" : "css"]({ height: (valPercent - lastValPercent) + "%" }, { queue: false, duration: o.animate }); } } } lastValPercent = valPercent; }); } else { value = this.value(); valueMin = this._valueMin(); valueMax = this._valueMax(); valPercent = (valueMax !== valueMin) ? (value - valueMin) / (valueMax - valueMin) * 100 : 0; _set[this.orientation === "horizontal" ? "left" : "bottom"] = valPercent + "%"; this.handle.stop(1, 1)[animate ? "animate" : "css"](_set, o.animate); if (oRange === "min" && this.orientation === "horizontal") { this.range.stop(1, 1)[animate ? "animate" : "css"]({ width: valPercent + "%" }, o.animate); } if (oRange === "max" && this.orientation === "horizontal") { this.range.stop(1, 1)[animate ? "animate" : "css"]({ width: (100 - valPercent) + "%" }, o.animate); } if (oRange === "min" && this.orientation === "vertical") { this.range.stop(1, 1)[animate ? "animate" : "css"]({ height: valPercent + "%" }, o.animate); } if (oRange === "max" && this.orientation === "vertical") { this.range.stop(1, 1)[animate ? "animate" : "css"]({ height: (100 - valPercent) + "%" }, o.animate); } } }, _handleEvents: { keydown: function (event) { var allowed, curVal, newVal, step, index = $(event.target).data("ui-slider-handle-index"); switch (event.keyCode) { case $.ui.keyCode.HOME: case $.ui.keyCode.END: case $.ui.keyCode.PAGE_UP: case $.ui.keyCode.PAGE_DOWN: case $.ui.keyCode.UP: case $.ui.keyCode.RIGHT: case $.ui.keyCode.DOWN: case $.ui.keyCode.LEFT: event.preventDefault(); if (!this._keySliding) { this._keySliding = true; this._addClass($(event.target), null, "ui-state-active"); allowed = this._start(event, index); if (allowed === false) { return; } } break; } step = this.options.step; if (this._hasMultipleValues()) { curVal = newVal = this.values(index); } else { curVal = newVal = this.value(); } switch (event.keyCode) { case $.ui.keyCode.HOME: newVal = this._valueMin(); break; case $.ui.keyCode.END: newVal = this._valueMax(); break; case $.ui.keyCode.PAGE_UP: newVal = this._trimAlignValue( curVal + ((this._valueMax() - this._valueMin()) / this.numPages) ); break; case $.ui.keyCode.PAGE_DOWN: newVal = this._trimAlignValue( curVal - ((this._valueMax() - this._valueMin()) / this.numPages)); break; case $.ui.keyCode.UP: case $.ui.keyCode.RIGHT: if (curVal === this._valueMax()) { return; } newVal = this._trimAlignValue(curVal + step); break; case $.ui.keyCode.DOWN: case $.ui.keyCode.LEFT: if (curVal === this._valueMin()) { return; } newVal = this._trimAlignValue(curVal - step); break; } this._slide(event, index, newVal); }, keyup: function (event) { var index = $(event.target).data("ui-slider-handle-index"); if (this._keySliding) { this._keySliding = false; this._stop(event, index); this._change(event, index); this._removeClass($(event.target), null, "ui-state-active"); } } } }); /*! * jQuery UI Spinner 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Spinner //>>group: Widgets //>>description: Displays buttons to easily input numbers via the keyboard or mouse. //>>docs: http://api.jqueryui.com/spinner/ //>>demos: http://jqueryui.com/spinner/ //>>css.structure: ../../themes/base/core.css //>>css.structure: ../../themes/base/spinner.css //>>css.theme: ../../themes/base/theme.css function spinnerModifer(fn) { return function () { var previous = this.element.val(); fn.apply(this, arguments); this._refresh(); if (previous !== this.element.val()) { this._trigger("change"); } }; } $.widget("ui.spinner", { version: "1.12.1", defaultElement: "<input>", widgetEventPrefix: "spin", options: { classes: { "ui-spinner": "ui-corner-all", "ui-spinner-down": "ui-corner-br", "ui-spinner-up": "ui-corner-tr" }, culture: null, icons: { down: "ui-icon-triangle-1-s", up: "ui-icon-triangle-1-n" }, incremental: true, max: null, min: null, numberFormat: null, page: 10, step: 1, change: null, spin: null, start: null, stop: null }, _create: function () { // handle string values that need to be parsed this._setOption("max", this.options.max); this._setOption("min", this.options.min); this._setOption("step", this.options.step); // Only format if there is a value, prevents the field from being marked // as invalid in Firefox, see #9573. if (this.value() !== "") { // Format the value, but don't constrain. this._value(this.element.val(), true); } this._draw(); this._on(this._events); this._refresh(); // Turning off autocomplete prevents the browser from remembering the // value when navigating through history, so we re-enable autocomplete // if the page is unloaded before the widget is destroyed. #7790 this._on(this.window, { beforeunload: function () { this.element.removeAttr("autocomplete"); } }); }, _getCreateOptions: function () { var options = this._super(); var element = this.element; $.each(["min", "max", "step"], function (i, option) { var value = element.attr(option); if (value != null && value.length) { options[option] = value; } }); return options; }, _events: { keydown: function (event) { if (this._start(event) && this._keydown(event)) { event.preventDefault(); } }, keyup: "_stop", focus: function () { this.previous = this.element.val(); }, blur: function (event) { if (this.cancelBlur) { delete this.cancelBlur; return; } this._stop(); this._refresh(); if (this.previous !== this.element.val()) { this._trigger("change", event); } }, mousewheel: function (event, delta) { if (!delta) { return; } if (!this.spinning && !this._start(event)) { return false; } this._spin((delta > 0 ? 1 : -1) * this.options.step, event); clearTimeout(this.mousewheelTimer); this.mousewheelTimer = this._delay(function () { if (this.spinning) { this._stop(event); } }, 100); event.preventDefault(); }, "mousedown .ui-spinner-button": function (event) { var previous; // We never want the buttons to have focus; whenever the user is // interacting with the spinner, the focus should be on the input. // If the input is focused then this.previous is properly set from // when the input first received focus. If the input is not focused // then we need to set this.previous based on the value before spinning. previous = this.element[0] === $.ui.safeActiveElement(this.document[0]) ? this.previous : this.element.val(); function checkFocus() { var isActive = this.element[0] === $.ui.safeActiveElement(this.document[0]); if (!isActive) { this.element.trigger("focus"); this.previous = previous; // support: IE // IE sets focus asynchronously, so we need to check if focus // moved off of the input because the user clicked on the button. this._delay(function () { this.previous = previous; }); } } // Ensure focus is on (or stays on) the text field event.preventDefault(); checkFocus.call(this); // Support: IE // IE doesn't prevent moving focus even with event.preventDefault() // so we set a flag to know when we should ignore the blur event // and check (again) if focus moved off of the input. this.cancelBlur = true; this._delay(function () { delete this.cancelBlur; checkFocus.call(this); }); if (this._start(event) === false) { return; } this._repeat(null, $(event.currentTarget) .hasClass("ui-spinner-up") ? 1 : -1, event); }, "mouseup .ui-spinner-button": "_stop", "mouseenter .ui-spinner-button": function (event) { // button will add ui-state-active if mouse was down while mouseleave and kept down if (!$(event.currentTarget).hasClass("ui-state-active")) { return; } if (this._start(event) === false) { return false; } this._repeat(null, $(event.currentTarget) .hasClass("ui-spinner-up") ? 1 : -1, event); }, // TODO: do we really want to consider this a stop? // shouldn't we just stop the repeater and wait until mouseup before // we trigger the stop event? "mouseleave .ui-spinner-button": "_stop" }, // Support mobile enhanced option and make backcompat more sane _enhance: function () { this.uiSpinner = this.element .attr("autocomplete", "off") .wrap("<span>") .parent() // Add buttons .append( "<a></a><a></a>" ); }, _draw: function () { this._enhance(); this._addClass(this.uiSpinner, "ui-spinner", "ui-widget ui-widget-content"); this._addClass("ui-spinner-input"); this.element.attr("role", "spinbutton"); // Button bindings this.buttons = this.uiSpinner.children("a") .attr("tabIndex", -1) .attr("aria-hidden", true) .button({ classes: { "ui-button": "" } }); // TODO: Right now button does not support classes this is already updated in button PR this._removeClass(this.buttons, "ui-corner-all"); this._addClass(this.buttons.first(), "ui-spinner-button ui-spinner-up"); this._addClass(this.buttons.last(), "ui-spinner-button ui-spinner-down"); this.buttons.first().button({ "icon": this.options.icons.up, "showLabel": false }); this.buttons.last().button({ "icon": this.options.icons.down, "showLabel": false }); // IE 6 doesn't understand height: 50% for the buttons // unless the wrapper has an explicit height if (this.buttons.height() > Math.ceil(this.uiSpinner.height() * 0.5) && this.uiSpinner.height() > 0) { this.uiSpinner.height(this.uiSpinner.height()); } }, _keydown: function (event) { var options = this.options, keyCode = $.ui.keyCode; switch (event.keyCode) { case keyCode.UP: this._repeat(null, 1, event); return true; case keyCode.DOWN: this._repeat(null, -1, event); return true; case keyCode.PAGE_UP: this._repeat(null, options.page, event); return true; case keyCode.PAGE_DOWN: this._repeat(null, -options.page, event); return true; } return false; }, _start: function (event) { if (!this.spinning && this._trigger("start", event) === false) { return false; } if (!this.counter) { this.counter = 1; } this.spinning = true; return true; }, _repeat: function (i, steps, event) { i = i || 500; clearTimeout(this.timer); this.timer = this._delay(function () { this._repeat(40, steps, event); }, i); this._spin(steps * this.options.step, event); }, _spin: function (step, event) { var value = this.value() || 0; if (!this.counter) { this.counter = 1; } value = this._adjustValue(value + step * this._increment(this.counter)); if (!this.spinning || this._trigger("spin", event, { value: value }) !== false) { this._value(value); this.counter++; } }, _increment: function (i) { var incremental = this.options.incremental; if (incremental) { return $.isFunction(incremental) ? incremental(i) : Math.floor(i * i * i / 50000 - i * i / 500 + 17 * i / 200 + 1); } return 1; }, _precision: function () { var precision = this._precisionOf(this.options.step); if (this.options.min !== null) { precision = Math.max(precision, this._precisionOf(this.options.min)); } return precision; }, _precisionOf: function (num) { var str = num.toString(), decimal = str.indexOf("."); return decimal === -1 ? 0 : str.length - decimal - 1; }, _adjustValue: function (value) { var base, aboveMin, options = this.options; // Make sure we're at a valid step // - find out where we are relative to the base (min or 0) base = options.min !== null ? options.min : 0; aboveMin = value - base; // - round to the nearest step aboveMin = Math.round(aboveMin / options.step) * options.step; // - rounding is based on 0, so adjust back to our base value = base + aboveMin; // Fix precision from bad JS floating point math value = parseFloat(value.toFixed(this._precision())); // Clamp the value if (options.max !== null && value > options.max) { return options.max; } if (options.min !== null && value < options.min) { return options.min; } return value; }, _stop: function (event) { if (!this.spinning) { return; } clearTimeout(this.timer); clearTimeout(this.mousewheelTimer); this.counter = 0; this.spinning = false; this._trigger("stop", event); }, _setOption: function (key, value) { var prevValue, first, last; if (key === "culture" || key === "numberFormat") { prevValue = this._parse(this.element.val()); this.options[key] = value; this.element.val(this._format(prevValue)); return; } if (key === "max" || key === "min" || key === "step") { if (typeof value === "string") { value = this._parse(value); } } if (key === "icons") { first = this.buttons.first().find(".ui-icon"); this._removeClass(first, null, this.options.icons.up); this._addClass(first, null, value.up); last = this.buttons.last().find(".ui-icon"); this._removeClass(last, null, this.options.icons.down); this._addClass(last, null, value.down); } this._super(key, value); }, _setOptionDisabled: function (value) { this._super(value); this._toggleClass(this.uiSpinner, null, "ui-state-disabled", !!value); this.element.prop("disabled", !!value); this.buttons.button(value ? "disable" : "enable"); }, _setOptions: spinnerModifer(function (options) { this._super(options); }), _parse: function (val) { if (typeof val === "string" && val !== "") { val = window.Globalize && this.options.numberFormat ? Globalize.parseFloat(val, 10, this.options.culture) : +val; } return val === "" || isNaN(val) ? null : val; }, _format: function (value) { if (value === "") { return ""; } return window.Globalize && this.options.numberFormat ? Globalize.format(value, this.options.numberFormat, this.options.culture) : value; }, _refresh: function () { this.element.attr({ "aria-valuemin": this.options.min, "aria-valuemax": this.options.max, // TODO: what should we do with values that can't be parsed? "aria-valuenow": this._parse(this.element.val()) }); }, isValid: function () { var value = this.value(); // Null is invalid if (value === null) { return false; } // If value gets adjusted, it's invalid return value === this._adjustValue(value); }, // Update the value without triggering change _value: function (value, allowAny) { var parsed; if (value !== "") { parsed = this._parse(value); if (parsed !== null) { if (!allowAny) { parsed = this._adjustValue(parsed); } value = this._format(parsed); } } this.element.val(value); this._refresh(); }, _destroy: function () { this.element .prop("disabled", false) .removeAttr("autocomplete role aria-valuemin aria-valuemax aria-valuenow"); this.uiSpinner.replaceWith(this.element); }, stepUp: spinnerModifer(function (steps) { this._stepUp(steps); }), _stepUp: function (steps) { if (this._start()) { this._spin((steps || 1) * this.options.step); this._stop(); } }, stepDown: spinnerModifer(function (steps) { this._stepDown(steps); }), _stepDown: function (steps) { if (this._start()) { this._spin((steps || 1) * -this.options.step); this._stop(); } }, pageUp: spinnerModifer(function (pages) { this._stepUp((pages || 1) * this.options.page); }), pageDown: spinnerModifer(function (pages) { this._stepDown((pages || 1) * this.options.page); }), value: function (newVal) { if (!arguments.length) { return this._parse(this.element.val()); } spinnerModifer(this._value).call(this, newVal); }, widget: function () { return this.uiSpinner; } }); // DEPRECATED // TODO: switch return back to widget declaration at top of file when this is removed if ($.uiBackCompat !== false) { // Backcompat for spinner html extension points $.widget("ui.spinner", $.ui.spinner, { _enhance: function () { this.uiSpinner = this.element .attr("autocomplete", "off") .wrap(this._uiSpinnerHtml()) .parent() // Add buttons .append(this._buttonHtml()); }, _uiSpinnerHtml: function () { return "<span>"; }, _buttonHtml: function () { return "<a></a><a></a>"; } }); } var widgetsSpinner = $.ui.spinner; /*! * jQuery UI Tabs 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Tabs //>>group: Widgets //>>description: Transforms a set of container elements into a tab structure. //>>docs: http://api.jqueryui.com/tabs/ //>>demos: http://jqueryui.com/tabs/ //>>css.structure: ../../themes/base/core.css //>>css.structure: ../../themes/base/tabs.css //>>css.theme: ../../themes/base/theme.css $.widget("ui.tabs", { version: "1.12.1", delay: 300, options: { active: null, classes: { "ui-tabs": "ui-corner-all", "ui-tabs-nav": "ui-corner-all", "ui-tabs-panel": "ui-corner-bottom", "ui-tabs-tab": "ui-corner-top" }, collapsible: false, event: "click", heightStyle: "content", hide: null, show: null, // Callbacks activate: null, beforeActivate: null, beforeLoad: null, load: null }, _isLocal: (function () { var rhash = /#.*$/; return function (anchor) { var anchorUrl, locationUrl; anchorUrl = anchor.href.replace(rhash, ""); locationUrl = location.href.replace(rhash, ""); // Decoding may throw an error if the URL isn't UTF-8 (#9518) try { anchorUrl = decodeURIComponent(anchorUrl); } catch (error) { } try { locationUrl = decodeURIComponent(locationUrl); } catch (error) { } return anchor.hash.length > 1 && anchorUrl === locationUrl; }; })(), _create: function () { var that = this, options = this.options; this.running = false; this._addClass("ui-tabs", "ui-widget ui-widget-content"); this._toggleClass("ui-tabs-collapsible", null, options.collapsible); this._processTabs(); options.active = this._initialActive(); // Take disabling tabs via class attribute from HTML // into account and update option properly. if ($.isArray(options.disabled)) { options.disabled = $.unique(options.disabled.concat( $.map(this.tabs.filter(".ui-state-disabled"), function (li) { return that.tabs.index(li); }) )).sort(); } // Check for length avoids error when initializing empty list if (this.options.active !== false && this.anchors.length) { this.active = this._findActive(options.active); } else { this.active = $(); } this._refresh(); if (this.active.length) { this.load(options.active); } }, _initialActive: function () { var active = this.options.active, collapsible = this.options.collapsible, locationHash = location.hash.substring(1); if (active === null) { // check the fragment identifier in the URL if (locationHash) { this.tabs.each(function (i, tab) { if ($(tab).attr("aria-controls") === locationHash) { active = i; return false; } }); } // Check for a tab marked active via a class if (active === null) { active = this.tabs.index(this.tabs.filter(".ui-tabs-active")); } // No active tab, set to false if (active === null || active === -1) { active = this.tabs.length ? 0 : false; } } // Handle numbers: negative, out of range if (active !== false) { active = this.tabs.index(this.tabs.eq(active)); if (active === -1) { active = collapsible ? false : 0; } } // Don't allow collapsible: false and active: false if (!collapsible && active === false && this.anchors.length) { active = 0; } return active; }, _getCreateEventData: function () { return { tab: this.active, panel: !this.active.length ? $() : this._getPanelForTab(this.active) }; }, _tabKeydown: function (event) { var focusedTab = $($.ui.safeActiveElement(this.document[0])).closest("li"), selectedIndex = this.tabs.index(focusedTab), goingForward = true; if (this._handlePageNav(event)) { return; } switch (event.keyCode) { case $.ui.keyCode.RIGHT: case $.ui.keyCode.DOWN: selectedIndex++; break; case $.ui.keyCode.UP: case $.ui.keyCode.LEFT: goingForward = false; selectedIndex--; break; case $.ui.keyCode.END: selectedIndex = this.anchors.length - 1; break; case $.ui.keyCode.HOME: selectedIndex = 0; break; case $.ui.keyCode.SPACE: // Activate only, no collapsing event.preventDefault(); clearTimeout(this.activating); this._activate(selectedIndex); return; case $.ui.keyCode.ENTER: // Toggle (cancel delayed activation, allow collapsing) event.preventDefault(); clearTimeout(this.activating); // Determine if we should collapse or activate this._activate(selectedIndex === this.options.active ? false : selectedIndex); return; default: return; } // Focus the appropriate tab, based on which key was pressed event.preventDefault(); clearTimeout(this.activating); selectedIndex = this._focusNextTab(selectedIndex, goingForward); // Navigating with control/command key will prevent automatic activation if (!event.ctrlKey && !event.metaKey) { // Update aria-selected immediately so that AT think the tab is already selected. // Otherwise AT may confuse the user by stating that they need to activate the tab, // but the tab will already be activated by the time the announcement finishes. focusedTab.attr("aria-selected", "false"); this.tabs.eq(selectedIndex).attr("aria-selected", "true"); this.activating = this._delay(function () { this.option("active", selectedIndex); }, this.delay); } }, _panelKeydown: function (event) { if (this._handlePageNav(event)) { return; } // Ctrl+up moves focus to the current tab if (event.ctrlKey && event.keyCode === $.ui.keyCode.UP) { event.preventDefault(); this.active.trigger("focus"); } }, // Alt+page up/down moves focus to the previous/next tab (and activates) _handlePageNav: function (event) { if (event.altKey && event.keyCode === $.ui.keyCode.PAGE_UP) { this._activate(this._focusNextTab(this.options.active - 1, false)); return true; } if (event.altKey && event.keyCode === $.ui.keyCode.PAGE_DOWN) { this._activate(this._focusNextTab(this.options.active + 1, true)); return true; } }, _findNextTab: function (index, goingForward) { var lastTabIndex = this.tabs.length - 1; function constrain() { if (index > lastTabIndex) { index = 0; } if (index < 0) { index = lastTabIndex; } return index; } while ($.inArray(constrain(), this.options.disabled) !== -1) { index = goingForward ? index + 1 : index - 1; } return index; }, _focusNextTab: function (index, goingForward) { index = this._findNextTab(index, goingForward); this.tabs.eq(index).trigger("focus"); return index; }, _setOption: function (key, value) { if (key === "active") { // _activate() will handle invalid values and update this.options this._activate(value); return; } this._super(key, value); if (key === "collapsible") { this._toggleClass("ui-tabs-collapsible", null, value); // Setting collapsible: false while collapsed; open first panel if (!value && this.options.active === false) { this._activate(0); } } if (key === "event") { this._setupEvents(value); } if (key === "heightStyle") { this._setupHeightStyle(value); } }, _sanitizeSelector: function (hash) { return hash ? hash.replace(/[!"$%&'()*+,.\/:;<=>?@\[\]\^`{|}~]/g, "\\$&") : ""; }, refresh: function () { var options = this.options, lis = this.tablist.children(":has(a[href])"); // Get disabled tabs from class attribute from HTML // this will get converted to a boolean if needed in _refresh() options.disabled = $.map(lis.filter(".ui-state-disabled"), function (tab) { return lis.index(tab); }); this._processTabs(); // Was collapsed or no tabs if (options.active === false || !this.anchors.length) { options.active = false; this.active = $(); // was active, but active tab is gone } else if (this.active.length && !$.contains(this.tablist[0], this.active[0])) { // all remaining tabs are disabled if (this.tabs.length === options.disabled.length) { options.active = false; this.active = $(); // activate previous tab } else { this._activate(this._findNextTab(Math.max(0, options.active - 1), false)); } // was active, active tab still exists } else { // make sure active index is correct options.active = this.tabs.index(this.active); } this._refresh(); }, _refresh: function () { this._setOptionDisabled(this.options.disabled); this._setupEvents(this.options.event); this._setupHeightStyle(this.options.heightStyle); this.tabs.not(this.active).attr({ "aria-selected": "false", "aria-expanded": "false", tabIndex: -1 }); this.panels.not(this._getPanelForTab(this.active)) .hide() .attr({ "aria-hidden": "true" }); // Make sure one tab is in the tab order if (!this.active.length) { this.tabs.eq(0).attr("tabIndex", 0); } else { this.active .attr({ "aria-selected": "true", "aria-expanded": "true", tabIndex: 0 }); this._addClass(this.active, "ui-tabs-active", "ui-state-active"); this._getPanelForTab(this.active) .show() .attr({ "aria-hidden": "false" }); } }, _processTabs: function () { var that = this, prevTabs = this.tabs, prevAnchors = this.anchors, prevPanels = this.panels; this.tablist = this._getList().attr("role", "tablist"); this._addClass(this.tablist, "ui-tabs-nav", "ui-helper-reset ui-helper-clearfix ui-widget-header"); // Prevent users from focusing disabled tabs via click this.tablist .on("mousedown" + this.eventNamespace, "> li", function (event) { if ($(this).is(".ui-state-disabled")) { event.preventDefault(); } }) // Support: IE <9 // Preventing the default action in mousedown doesn't prevent IE // from focusing the element, so if the anchor gets focused, blur. // We don't have to worry about focusing the previously focused // element since clicking on a non-focusable element should focus // the body anyway. .on("focus" + this.eventNamespace, ".ui-tabs-anchor", function () { if ($(this).closest("li").is(".ui-state-disabled")) { this.blur(); } }); this.tabs = this.tablist.find("> li:has(a[href])") .attr({ role: "tab", tabIndex: -1 }); this._addClass(this.tabs, "ui-tabs-tab", "ui-state-default"); this.anchors = this.tabs.map(function () { return $("a", this)[0]; }) .attr({ role: "presentation", tabIndex: -1 }); this._addClass(this.anchors, "ui-tabs-anchor"); this.panels = $(); this.anchors.each(function (i, anchor) { var selector, panel, panelId, anchorId = $(anchor).uniqueId().attr("id"), tab = $(anchor).closest("li"), originalAriaControls = tab.attr("aria-controls"); // Inline tab if (that._isLocal(anchor)) { selector = anchor.hash; panelId = selector.substring(1); panel = that.element.find(that._sanitizeSelector(selector)); // remote tab } else { // If the tab doesn't already have aria-controls, // generate an id by using a throw-away element panelId = tab.attr("aria-controls") || $({}).uniqueId()[0].id; selector = "#" + panelId; panel = that.element.find(selector); if (!panel.length) { panel = that._createPanel(panelId); panel.insertAfter(that.panels[i - 1] || that.tablist); } panel.attr("aria-live", "polite"); } if (panel.length) { that.panels = that.panels.add(panel); } if (originalAriaControls) { tab.data("ui-tabs-aria-controls", originalAriaControls); } tab.attr({ "aria-controls": panelId, "aria-labelledby": anchorId }); panel.attr("aria-labelledby", anchorId); }); this.panels.attr("role", "tabpanel"); this._addClass(this.panels, "ui-tabs-panel", "ui-widget-content"); // Avoid memory leaks (#10056) if (prevTabs) { this._off(prevTabs.not(this.tabs)); this._off(prevAnchors.not(this.anchors)); this._off(prevPanels.not(this.panels)); } }, // Allow overriding how to find the list for rare usage scenarios (#7715) _getList: function () { return this.tablist || this.element.find("ol, ul").eq(0); }, _createPanel: function (id) { return $("<div>") .attr("id", id) .data("ui-tabs-destroy", true); }, _setOptionDisabled: function (disabled) { var currentItem, li, i; if ($.isArray(disabled)) { if (!disabled.length) { disabled = false; } else if (disabled.length === this.anchors.length) { disabled = true; } } // Disable tabs for (i = 0; (li = this.tabs[i]); i++) { currentItem = $(li); if (disabled === true || $.inArray(i, disabled) !== -1) { currentItem.attr("aria-disabled", "true"); this._addClass(currentItem, null, "ui-state-disabled"); } else { currentItem.removeAttr("aria-disabled"); this._removeClass(currentItem, null, "ui-state-disabled"); } } this.options.disabled = disabled; this._toggleClass(this.widget(), this.widgetFullName + "-disabled", null, disabled === true); }, _setupEvents: function (event) { var events = {}; if (event) { $.each(event.split(" "), function (index, eventName) { events[eventName] = "_eventHandler"; }); } this._off(this.anchors.add(this.tabs).add(this.panels)); // Always prevent the default action, even when disabled this._on(true, this.anchors, { click: function (event) { event.preventDefault(); } }); this._on(this.anchors, events); this._on(this.tabs, { keydown: "_tabKeydown" }); this._on(this.panels, { keydown: "_panelKeydown" }); this._focusable(this.tabs); this._hoverable(this.tabs); }, _setupHeightStyle: function (heightStyle) { var maxHeight, parent = this.element.parent(); if (heightStyle === "fill") { maxHeight = parent.height(); maxHeight -= this.element.outerHeight() - this.element.height(); this.element.siblings(":visible").each(function () { var elem = $(this), position = elem.css("position"); if (position === "absolute" || position === "fixed") { return; } maxHeight -= elem.outerHeight(true); }); this.element.children().not(this.panels).each(function () { maxHeight -= $(this).outerHeight(true); }); this.panels.each(function () { $(this).height(Math.max(0, maxHeight - $(this).innerHeight() + $(this).height())); }) .css("overflow", "auto"); } else if (heightStyle === "auto") { maxHeight = 0; this.panels.each(function () { maxHeight = Math.max(maxHeight, $(this).height("").height()); }).height(maxHeight); } }, _eventHandler: function (event) { var options = this.options, active = this.active, anchor = $(event.currentTarget), tab = anchor.closest("li"), clickedIsActive = tab[0] === active[0], collapsing = clickedIsActive && options.collapsible, toShow = collapsing ? $() : this._getPanelForTab(tab), toHide = !active.length ? $() : this._getPanelForTab(active), eventData = { oldTab: active, oldPanel: toHide, newTab: collapsing ? $() : tab, newPanel: toShow }; event.preventDefault(); if (tab.hasClass("ui-state-disabled") || // tab is already loading tab.hasClass("ui-tabs-loading") || // can't switch durning an animation this.running || // click on active header, but not collapsible (clickedIsActive && !options.collapsible) || // allow canceling activation (this._trigger("beforeActivate", event, eventData) === false)) { return; } options.active = collapsing ? false : this.tabs.index(tab); this.active = clickedIsActive ? $() : tab; if (this.xhr) { this.xhr.abort(); } if (!toHide.length && !toShow.length) { $.error("jQuery UI Tabs: Mismatching fragment identifier."); } if (toShow.length) { this.load(this.tabs.index(tab), event); } this._toggle(event, eventData); }, // Handles show/hide for selecting tabs _toggle: function (event, eventData) { var that = this, toShow = eventData.newPanel, toHide = eventData.oldPanel; this.running = true; function complete() { that.running = false; that._trigger("activate", event, eventData); } function show() { that._addClass(eventData.newTab.closest("li"), "ui-tabs-active", "ui-state-active"); if (toShow.length && that.options.show) { that._show(toShow, that.options.show, complete); } else { toShow.show(); complete(); } } // Start out by hiding, then showing, then completing if (toHide.length && this.options.hide) { this._hide(toHide, this.options.hide, function () { that._removeClass(eventData.oldTab.closest("li"), "ui-tabs-active", "ui-state-active"); show(); }); } else { this._removeClass(eventData.oldTab.closest("li"), "ui-tabs-active", "ui-state-active"); toHide.hide(); show(); } toHide.attr("aria-hidden", "true"); eventData.oldTab.attr({ "aria-selected": "false", "aria-expanded": "false" }); // If we're switching tabs, remove the old tab from the tab order. // If we're opening from collapsed state, remove the previous tab from the tab order. // If we're collapsing, then keep the collapsing tab in the tab order. if (toShow.length && toHide.length) { eventData.oldTab.attr("tabIndex", -1); } else if (toShow.length) { this.tabs.filter(function () { return $(this).attr("tabIndex") === 0; }) .attr("tabIndex", -1); } toShow.attr("aria-hidden", "false"); eventData.newTab.attr({ "aria-selected": "true", "aria-expanded": "true", tabIndex: 0 }); }, _activate: function (index) { var anchor, active = this._findActive(index); // Trying to activate the already active panel if (active[0] === this.active[0]) { return; } // Trying to collapse, simulate a click on the current active header if (!active.length) { active = this.active; } anchor = active.find(".ui-tabs-anchor")[0]; this._eventHandler({ target: anchor, currentTarget: anchor, preventDefault: $.noop }); }, _findActive: function (index) { return index === false ? $() : this.tabs.eq(index); }, _getIndex: function (index) { // meta-function to give users option to provide a href string instead of a numerical index. if (typeof index === "string") { index = this.anchors.index(this.anchors.filter("[href$='" + $.ui.escapeSelector(index) + "']")); } return index; }, _destroy: function () { if (this.xhr) { this.xhr.abort(); } this.tablist .removeAttr("role") .off(this.eventNamespace); this.anchors .removeAttr("role tabIndex") .removeUniqueId(); this.tabs.add(this.panels).each(function () { if ($.data(this, "ui-tabs-destroy")) { $(this).remove(); } else { $(this).removeAttr("role tabIndex " + "aria-live aria-busy aria-selected aria-labelledby aria-hidden aria-expanded"); } }); this.tabs.each(function () { var li = $(this), prev = li.data("ui-tabs-aria-controls"); if (prev) { li .attr("aria-controls", prev) .removeData("ui-tabs-aria-controls"); } else { li.removeAttr("aria-controls"); } }); this.panels.show(); if (this.options.heightStyle !== "content") { this.panels.css("height", ""); } }, enable: function (index) { var disabled = this.options.disabled; if (disabled === false) { return; } if (index === undefined) { disabled = false; } else { index = this._getIndex(index); if ($.isArray(disabled)) { disabled = $.map(disabled, function (num) { return num !== index ? num : null; }); } else { disabled = $.map(this.tabs, function (li, num) { return num !== index ? num : null; }); } } this._setOptionDisabled(disabled); }, disable: function (index) { var disabled = this.options.disabled; if (disabled === true) { return; } if (index === undefined) { disabled = true; } else { index = this._getIndex(index); if ($.inArray(index, disabled) !== -1) { return; } if ($.isArray(disabled)) { disabled = $.merge([index], disabled).sort(); } else { disabled = [index]; } } this._setOptionDisabled(disabled); }, load: function (index, event) { index = this._getIndex(index); var that = this, tab = this.tabs.eq(index), anchor = tab.find(".ui-tabs-anchor"), panel = this._getPanelForTab(tab), eventData = { tab: tab, panel: panel }, complete = function (jqXHR, status) { if (status === "abort") { that.panels.stop(false, true); } that._removeClass(tab, "ui-tabs-loading"); panel.removeAttr("aria-busy"); if (jqXHR === that.xhr) { delete that.xhr; } }; // Not remote if (this._isLocal(anchor[0])) { return; } this.xhr = $.ajax(this._ajaxSettings(anchor, event, eventData)); // Support: jQuery <1.8 // jQuery <1.8 returns false if the request is canceled in beforeSend, // but as of 1.8, $.ajax() always returns a jqXHR object. if (this.xhr && this.xhr.statusText !== "canceled") { this._addClass(tab, "ui-tabs-loading"); panel.attr("aria-busy", "true"); this.xhr .done(function (response, status, jqXHR) { // support: jQuery <1.8 // http://bugs.jquery.com/ticket/11778 setTimeout(function () { panel.html(response); that._trigger("load", event, eventData); complete(jqXHR, status); }, 1); }) .fail(function (jqXHR, status) { // support: jQuery <1.8 // http://bugs.jquery.com/ticket/11778 setTimeout(function () { complete(jqXHR, status); }, 1); }); } }, _ajaxSettings: function (anchor, event, eventData) { var that = this; return { // Support: IE <11 only // Strip any hash that exists to prevent errors with the Ajax request url: anchor.attr("href").replace(/#.*$/, ""), beforeSend: function (jqXHR, settings) { return that._trigger("beforeLoad", event, $.extend({ jqXHR: jqXHR, ajaxSettings: settings }, eventData)); } }; }, _getPanelForTab: function (tab) { var id = $(tab).attr("aria-controls"); return this.element.find(this._sanitizeSelector("#" + id)); } }); // DEPRECATED // TODO: Switch return back to widget declaration at top of file when this is removed if ($.uiBackCompat !== false) { // Backcompat for ui-tab class (now ui-tabs-tab) $.widget("ui.tabs", $.ui.tabs, { _processTabs: function () { this._superApply(arguments); this._addClass(this.tabs, "ui-tab"); } }); } var widgetsTabs = $.ui.tabs; /*! * jQuery UI Tooltip 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Tooltip //>>group: Widgets //>>description: Shows additional information for any element on hover or focus. //>>docs: http://api.jqueryui.com/tooltip/ //>>demos: http://jqueryui.com/tooltip/ //>>css.structure: ../../themes/base/core.css //>>css.structure: ../../themes/base/tooltip.css //>>css.theme: ../../themes/base/theme.css $.widget("ui.tooltip", { version: "1.12.1", options: { classes: { "ui-tooltip": "ui-corner-all ui-widget-shadow" }, content: function () { // support: IE<9, Opera in jQuery <1.7 // .text() can't accept undefined, so coerce to a string var title = $(this).attr("title") || ""; // Escape title, since we're going from an attribute to raw HTML return $("<a>").text(title).html(); }, hide: true, // Disabled elements have inconsistent behavior across browsers (#8661) items: "[title]:not([disabled])", position: { my: "left top+15", at: "left bottom", collision: "flipfit flip" }, show: true, track: false, // Callbacks close: null, open: null }, _addDescribedBy: function (elem, id) { var describedby = (elem.attr("aria-describedby") || "").split(/\s+/); describedby.push(id); elem .data("ui-tooltip-id", id) .attr("aria-describedby", $.trim(describedby.join(" "))); }, _removeDescribedBy: function (elem) { var id = elem.data("ui-tooltip-id"), describedby = (elem.attr("aria-describedby") || "").split(/\s+/), index = $.inArray(id, describedby); if (index !== -1) { describedby.splice(index, 1); } elem.removeData("ui-tooltip-id"); describedby = $.trim(describedby.join(" ")); if (describedby) { elem.attr("aria-describedby", describedby); } else { elem.removeAttr("aria-describedby"); } }, _create: function () { this._on({ mouseover: "open", focusin: "open" }); // IDs of generated tooltips, needed for destroy this.tooltips = {}; // IDs of parent tooltips where we removed the title attribute this.parents = {}; // Append the aria-live region so tooltips announce correctly this.liveRegion = $("<div>") .attr({ role: "log", "aria-live": "assertive", "aria-relevant": "additions" }) .appendTo(this.document[0].body); this._addClass(this.liveRegion, null, "ui-helper-hidden-accessible"); this.disabledTitles = $([]); }, _setOption: function (key, value) { var that = this; this._super(key, value); if (key === "content") { $.each(this.tooltips, function (id, tooltipData) { that._updateContent(tooltipData.element); }); } }, _setOptionDisabled: function (value) { this[value ? "_disable" : "_enable"](); }, _disable: function () { var that = this; // Close open tooltips $.each(this.tooltips, function (id, tooltipData) { var event = $.Event("blur"); event.target = event.currentTarget = tooltipData.element[0]; that.close(event, true); }); // Remove title attributes to prevent native tooltips this.disabledTitles = this.disabledTitles.add( this.element.find(this.options.items).addBack() .filter(function () { var element = $(this); if (element.is("[title]")) { return element .data("ui-tooltip-title", element.attr("title")) .removeAttr("title"); } }) ); }, _enable: function () { // restore title attributes this.disabledTitles.each(function () { var element = $(this); if (element.data("ui-tooltip-title")) { element.attr("title", element.data("ui-tooltip-title")); } }); this.disabledTitles = $([]); }, open: function (event) { var that = this, target = $(event ? event.target : this.element) // we need closest here due to mouseover bubbling, // but always pointing at the same event target .closest(this.options.items); // No element to show a tooltip for or the tooltip is already open if (!target.length || target.data("ui-tooltip-id")) { return; } if (target.attr("title")) { target.data("ui-tooltip-title", target.attr("title")); } target.data("ui-tooltip-open", true); // Kill parent tooltips, custom or native, for hover if (event && event.type === "mouseover") { target.parents().each(function () { var parent = $(this), blurEvent; if (parent.data("ui-tooltip-open")) { blurEvent = $.Event("blur"); blurEvent.target = blurEvent.currentTarget = this; that.close(blurEvent, true); } if (parent.attr("title")) { parent.uniqueId(); that.parents[this.id] = { element: this, title: parent.attr("title") }; parent.attr("title", ""); } }); } this._registerCloseHandlers(event, target); this._updateContent(target, event); }, _updateContent: function (target, event) { var content, contentOption = this.options.content, that = this, eventType = event ? event.type : null; if (typeof contentOption === "string" || contentOption.nodeType || contentOption.jquery) { return this._open(event, target, contentOption); } content = contentOption.call(target[0], function (response) { // IE may instantly serve a cached response for ajax requests // delay this call to _open so the other call to _open runs first that._delay(function () { // Ignore async response if tooltip was closed already if (!target.data("ui-tooltip-open")) { return; } // JQuery creates a special event for focusin when it doesn't // exist natively. To improve performance, the native event // object is reused and the type is changed. Therefore, we can't // rely on the type being correct after the event finished // bubbling, so we set it back to the previous value. (#8740) if (event) { event.type = eventType; } this._open(event, target, response); }); }); if (content) { this._open(event, target, content); } }, _open: function (event, target, content) { var tooltipData, tooltip, delayedShow, a11yContent, positionOption = $.extend({}, this.options.position); if (!content) { return; } // Content can be updated multiple times. If the tooltip already // exists, then just update the content and bail. tooltipData = this._find(target); if (tooltipData) { tooltipData.tooltip.find(".ui-tooltip-content").html(content); return; } // If we have a title, clear it to prevent the native tooltip // we have to check first to avoid defining a title if none exists // (we don't want to cause an element to start matching [title]) // // We use removeAttr only for key events, to allow IE to export the correct // accessible attributes. For mouse events, set to empty string to avoid // native tooltip showing up (happens only when removing inside mouseover). if (target.is("[title]")) { if (event && event.type === "mouseover") { target.attr("title", ""); } else { target.removeAttr("title"); } } tooltipData = this._tooltip(target); tooltip = tooltipData.tooltip; this._addDescribedBy(target, tooltip.attr("id")); tooltip.find(".ui-tooltip-content").html(content); // Support: Voiceover on OS X, JAWS on IE <= 9 // JAWS announces deletions even when aria-relevant="additions" // Voiceover will sometimes re-read the entire log region's contents from the beginning this.liveRegion.children().hide(); a11yContent = $("<div>").html(tooltip.find(".ui-tooltip-content").html()); a11yContent.removeAttr("name").find("[name]").removeAttr("name"); a11yContent.removeAttr("id").find("[id]").removeAttr("id"); a11yContent.appendTo(this.liveRegion); function position(event) { positionOption.of = event; if (tooltip.is(":hidden")) { return; } tooltip.position(positionOption); } if (this.options.track && event && /^mouse/.test(event.type)) { this._on(this.document, { mousemove: position }); // trigger once to override element-relative positioning position(event); } else { tooltip.position($.extend({ of: target }, this.options.position)); } tooltip.hide(); this._show(tooltip, this.options.show); // Handle tracking tooltips that are shown with a delay (#8644). As soon // as the tooltip is visible, position the tooltip using the most recent // event. // Adds the check to add the timers only when both delay and track options are set (#14682) if (this.options.track && this.options.show && this.options.show.delay) { delayedShow = this.delayedShow = setInterval(function () { if (tooltip.is(":visible")) { position(positionOption.of); clearInterval(delayedShow); } }, $.fx.interval); } this._trigger("open", event, { tooltip: tooltip }); }, _registerCloseHandlers: function (event, target) { var events = { keyup: function (event) { if (event.keyCode === $.ui.keyCode.ESCAPE) { var fakeEvent = $.Event(event); fakeEvent.currentTarget = target[0]; this.close(fakeEvent, true); } } }; // Only bind remove handler for delegated targets. Non-delegated // tooltips will handle this in destroy. if (target[0] !== this.element[0]) { events.remove = function () { this._removeTooltip(this._find(target).tooltip); }; } if (!event || event.type === "mouseover") { events.mouseleave = "close"; } if (!event || event.type === "focusin") { events.focusout = "close"; } this._on(true, target, events); }, close: function (event) { var tooltip, that = this, target = $(event ? event.currentTarget : this.element), tooltipData = this._find(target); // The tooltip may already be closed if (!tooltipData) { // We set ui-tooltip-open immediately upon open (in open()), but only set the // additional data once there's actually content to show (in _open()). So even if the // tooltip doesn't have full data, we always remove ui-tooltip-open in case we're in // the period between open() and _open(). target.removeData("ui-tooltip-open"); return; } tooltip = tooltipData.tooltip; // Disabling closes the tooltip, so we need to track when we're closing // to avoid an infinite loop in case the tooltip becomes disabled on close if (tooltipData.closing) { return; } // Clear the interval for delayed tracking tooltips clearInterval(this.delayedShow); // Only set title if we had one before (see comment in _open()) // If the title attribute has changed since open(), don't restore if (target.data("ui-tooltip-title") && !target.attr("title")) { target.attr("title", target.data("ui-tooltip-title")); } this._removeDescribedBy(target); tooltipData.hiding = true; tooltip.stop(true); this._hide(tooltip, this.options.hide, function () { that._removeTooltip($(this)); }); target.removeData("ui-tooltip-open"); this._off(target, "mouseleave focusout keyup"); // Remove 'remove' binding only on delegated targets if (target[0] !== this.element[0]) { this._off(target, "remove"); } this._off(this.document, "mousemove"); if (event && event.type === "mouseleave") { $.each(this.parents, function (id, parent) { $(parent.element).attr("title", parent.title); delete that.parents[id]; }); } tooltipData.closing = true; this._trigger("close", event, { tooltip: tooltip }); if (!tooltipData.hiding) { tooltipData.closing = false; } }, _tooltip: function (element) { var tooltip = $("<div>").attr("role", "tooltip"), content = $("<div>").appendTo(tooltip), id = tooltip.uniqueId().attr("id"); this._addClass(content, "ui-tooltip-content"); this._addClass(tooltip, "ui-tooltip", "ui-widget ui-widget-content"); tooltip.appendTo(this._appendTo(element)); return this.tooltips[id] = { element: element, tooltip: tooltip }; }, _find: function (target) { var id = target.data("ui-tooltip-id"); return id ? this.tooltips[id] : null; }, _removeTooltip: function (tooltip) { tooltip.remove(); delete this.tooltips[tooltip.attr("id")]; }, _appendTo: function (target) { var element = target.closest(".ui-front, dialog"); if (!element.length) { element = this.document[0].body; } return element; }, _destroy: function () { var that = this; // Close open tooltips $.each(this.tooltips, function (id, tooltipData) { // Delegate to close method to handle common cleanup var event = $.Event("blur"), element = tooltipData.element; event.target = event.currentTarget = element[0]; that.close(event, true); // Remove immediately; destroying an open tooltip doesn't use the // hide animation $("#" + id).remove(); // Restore the title if (element.data("ui-tooltip-title")) { // If the title attribute has changed since open(), don't restore if (!element.attr("title")) { element.attr("title", element.data("ui-tooltip-title")); } element.removeData("ui-tooltip-title"); } }); this.liveRegion.remove(); } }); // DEPRECATED // TODO: Switch return back to widget declaration at top of file when this is removed if ($.uiBackCompat !== false) { // Backcompat for tooltipClass option $.widget("ui.tooltip", $.ui.tooltip, { options: { tooltipClass: null }, _tooltip: function () { var tooltipData = this._superApply(arguments); if (this.options.tooltipClass) { tooltipData.tooltip.addClass(this.options.tooltipClass); } return tooltipData; } }); } var widgetsTooltip = $.ui.tooltip; /*! * jQuery UI Effects 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Effects Core //>>group: Effects // jscs:disable maximumLineLength //>>description: Extends the internal jQuery effects. Includes morphing and easing. Required by all other effects. // jscs:enable maximumLineLength //>>docs: http://api.jqueryui.com/category/effects-core/ //>>demos: http://jqueryui.com/effect/ var dataSpace = "ui-effects-", dataSpaceStyle = "ui-effects-style", dataSpaceAnimated = "ui-effects-animated", // Create a local jQuery because jQuery Color relies on it and the // global may not exist with AMD and a custom build (#10199) jQuery = $; $.effects = { effect: {} }; /*! * jQuery Color Animations v2.1.2 * https://github.com/jquery/jquery-color * * Copyright 2014 jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license * * Date: Wed Jan 16 08:47:09 2013 -0600 */ (function (jQuery, undefined) { var stepHooks = "backgroundColor borderBottomColor borderLeftColor borderRightColor " + "borderTopColor color columnRuleColor outlineColor textDecorationColor textEmphasisColor", // Plusequals test for += 100 -= 100 rplusequals = /^([\-+])=\s*(\d+\.?\d*)/, // A set of RE's that can match strings and generate color tuples. stringParsers = [{ re: /rgba?\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/, parse: function (execResult) { return [ execResult[1], execResult[2], execResult[3], execResult[4] ]; } }, { re: /rgba?\(\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/, parse: function (execResult) { return [ execResult[1] * 2.55, execResult[2] * 2.55, execResult[3] * 2.55, execResult[4] ]; } }, { // This regex ignores A-F because it's compared against an already lowercased string re: /#([a-f0-9]{2})([a-f0-9]{2})([a-f0-9]{2})/, parse: function (execResult) { return [ parseInt(execResult[1], 16), parseInt(execResult[2], 16), parseInt(execResult[3], 16) ]; } }, { // This regex ignores A-F because it's compared against an already lowercased string re: /#([a-f0-9])([a-f0-9])([a-f0-9])/, parse: function (execResult) { return [ parseInt(execResult[1] + execResult[1], 16), parseInt(execResult[2] + execResult[2], 16), parseInt(execResult[3] + execResult[3], 16) ]; } }, { re: /hsla?\(\s*(\d+(?:\.\d+)?)\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/, space: "hsla", parse: function (execResult) { return [ execResult[1], execResult[2] / 100, execResult[3] / 100, execResult[4] ]; } }], // JQuery.Color( ) color = jQuery.Color = function (color, green, blue, alpha) { return new jQuery.Color.fn.parse(color, green, blue, alpha); }, spaces = { rgba: { props: { red: { idx: 0, type: "byte" }, green: { idx: 1, type: "byte" }, blue: { idx: 2, type: "byte" } } }, hsla: { props: { hue: { idx: 0, type: "degrees" }, saturation: { idx: 1, type: "percent" }, lightness: { idx: 2, type: "percent" } } } }, propTypes = { "byte": { floor: true, max: 255 }, "percent": { max: 1 }, "degrees": { mod: 360, floor: true } }, support = color.support = {}, // Element for support tests supportElem = jQuery("<p>")[0], // Colors = jQuery.Color.names colors, // Local aliases of functions called often each = jQuery.each; // Determine rgba support immediately supportElem.style.cssText = "background-color:rgba(1,1,1,.5)"; support.rgba = supportElem.style.backgroundColor.indexOf("rgba") > -1; // Define cache name and alpha properties // for rgba and hsla spaces each(spaces, function (spaceName, space) { space.cache = "_" + spaceName; space.props.alpha = { idx: 3, type: "percent", def: 1 }; }); function clamp(value, prop, allowEmpty) { var type = propTypes[prop.type] || {}; if (value == null) { return (allowEmpty || !prop.def) ? null : prop.def; } // ~~ is an short way of doing floor for positive numbers value = type.floor ? ~~value : parseFloat(value); // IE will pass in empty strings as value for alpha, // which will hit this case if (isNaN(value)) { return prop.def; } if (type.mod) { // We add mod before modding to make sure that negatives values // get converted properly: -10 -> 350 return (value + type.mod) % type.mod; } // For now all property types without mod have min and max return 0 > value ? 0 : type.max < value ? type.max : value; } function stringParse(string) { var inst = color(), rgba = inst._rgba = []; string = string.toLowerCase(); each(stringParsers, function (i, parser) { var parsed, match = parser.re.exec(string), values = match && parser.parse(match), spaceName = parser.space || "rgba"; if (values) { parsed = inst[spaceName](values); // If this was an rgba parse the assignment might happen twice // oh well.... inst[spaces[spaceName].cache] = parsed[spaces[spaceName].cache]; rgba = inst._rgba = parsed._rgba; // Exit each( stringParsers ) here because we matched return false; } }); // Found a stringParser that handled it if (rgba.length) { // If this came from a parsed string, force "transparent" when alpha is 0 // chrome, (and maybe others) return "transparent" as rgba(0,0,0,0) if (rgba.join() === "0,0,0,0") { jQuery.extend(rgba, colors.transparent); } return inst; } // Named colors return colors[string]; } color.fn = jQuery.extend(color.prototype, { parse: function (red, green, blue, alpha) { if (red === undefined) { this._rgba = [null, null, null, null]; return this; } if (red.jquery || red.nodeType) { red = jQuery(red).css(green); green = undefined; } var inst = this, type = jQuery.type(red), rgba = this._rgba = []; // More than 1 argument specified - assume ( red, green, blue, alpha ) if (green !== undefined) { red = [red, green, blue, alpha]; type = "array"; } if (type === "string") { return this.parse(stringParse(red) || colors._default); } if (type === "array") { each(spaces.rgba.props, function (key, prop) { rgba[prop.idx] = clamp(red[prop.idx], prop); }); return this; } if (type === "object") { if (red instanceof color) { each(spaces, function (spaceName, space) { if (red[space.cache]) { inst[space.cache] = red[space.cache].slice(); } }); } else { each(spaces, function (spaceName, space) { var cache = space.cache; each(space.props, function (key, prop) { // If the cache doesn't exist, and we know how to convert if (!inst[cache] && space.to) { // If the value was null, we don't need to copy it // if the key was alpha, we don't need to copy it either if (key === "alpha" || red[key] == null) { return; } inst[cache] = space.to(inst._rgba); } // This is the only case where we allow nulls for ALL properties. // call clamp with alwaysAllowEmpty inst[cache][prop.idx] = clamp(red[key], prop, true); }); // Everything defined but alpha? if (inst[cache] && jQuery.inArray(null, inst[cache].slice(0, 3)) < 0) { // Use the default of 1 inst[cache][3] = 1; if (space.from) { inst._rgba = space.from(inst[cache]); } } }); } return this; } }, is: function (compare) { var is = color(compare), same = true, inst = this; each(spaces, function (_, space) { var localCache, isCache = is[space.cache]; if (isCache) { localCache = inst[space.cache] || space.to && space.to(inst._rgba) || []; each(space.props, function (_, prop) { if (isCache[prop.idx] != null) { same = (isCache[prop.idx] === localCache[prop.idx]); return same; } }); } return same; }); return same; }, _space: function () { var used = [], inst = this; each(spaces, function (spaceName, space) { if (inst[space.cache]) { used.push(spaceName); } }); return used.pop(); }, transition: function (other, distance) { var end = color(other), spaceName = end._space(), space = spaces[spaceName], startColor = this.alpha() === 0 ? color("transparent") : this, start = startColor[space.cache] || space.to(startColor._rgba), result = start.slice(); end = end[space.cache]; each(space.props, function (key, prop) { var index = prop.idx, startValue = start[index], endValue = end[index], type = propTypes[prop.type] || {}; // If null, don't override start value if (endValue === null) { return; } // If null - use end if (startValue === null) { result[index] = endValue; } else { if (type.mod) { if (endValue - startValue > type.mod / 2) { startValue += type.mod; } else if (startValue - endValue > type.mod / 2) { startValue -= type.mod; } } result[index] = clamp((endValue - startValue) * distance + startValue, prop); } }); return this[spaceName](result); }, blend: function (opaque) { // If we are already opaque - return ourself if (this._rgba[3] === 1) { return this; } var rgb = this._rgba.slice(), a = rgb.pop(), blend = color(opaque)._rgba; return color(jQuery.map(rgb, function (v, i) { return (1 - a) * blend[i] + a * v; })); }, toRgbaString: function () { var prefix = "rgba(", rgba = jQuery.map(this._rgba, function (v, i) { return v == null ? (i > 2 ? 1 : 0) : v; }); if (rgba[3] === 1) { rgba.pop(); prefix = "rgb("; } return prefix + rgba.join() + ")"; }, toHslaString: function () { var prefix = "hsla(", hsla = jQuery.map(this.hsla(), function (v, i) { if (v == null) { v = i > 2 ? 1 : 0; } // Catch 1 and 2 if (i && i < 3) { v = Math.round(v * 100) + "%"; } return v; }); if (hsla[3] === 1) { hsla.pop(); prefix = "hsl("; } return prefix + hsla.join() + ")"; }, toHexString: function (includeAlpha) { var rgba = this._rgba.slice(), alpha = rgba.pop(); if (includeAlpha) { rgba.push(~~(alpha * 255)); } return "#" + jQuery.map(rgba, function (v) { // Default to 0 when nulls exist v = (v || 0).toString(16); return v.length === 1 ? "0" + v : v; }).join(""); }, toString: function () { return this._rgba[3] === 0 ? "transparent" : this.toRgbaString(); } }); color.fn.parse.prototype = color.fn; // Hsla conversions adapted from: // https://code.google.com/p/maashaack/source/browse/packages/graphics/trunk/src/graphics/colors/HUE2RGB.as?r=5021 function hue2rgb(p, q, h) { h = (h + 1) % 1; if (h * 6 < 1) { return p + (q - p) * h * 6; } if (h * 2 < 1) { return q; } if (h * 3 < 2) { return p + (q - p) * ((2 / 3) - h) * 6; } return p; } spaces.hsla.to = function (rgba) { if (rgba[0] == null || rgba[1] == null || rgba[2] == null) { return [null, null, null, rgba[3]]; } var r = rgba[0] / 255, g = rgba[1] / 255, b = rgba[2] / 255, a = rgba[3], max = Math.max(r, g, b), min = Math.min(r, g, b), diff = max - min, add = max + min, l = add * 0.5, h, s; if (min === max) { h = 0; } else if (r === max) { h = (60 * (g - b) / diff) + 360; } else if (g === max) { h = (60 * (b - r) / diff) + 120; } else { h = (60 * (r - g) / diff) + 240; } // Chroma (diff) == 0 means greyscale which, by definition, saturation = 0% // otherwise, saturation is based on the ratio of chroma (diff) to lightness (add) if (diff === 0) { s = 0; } else if (l <= 0.5) { s = diff / add; } else { s = diff / (2 - add); } return [Math.round(h) % 360, s, l, a == null ? 1 : a]; }; spaces.hsla.from = function (hsla) { if (hsla[0] == null || hsla[1] == null || hsla[2] == null) { return [null, null, null, hsla[3]]; } var h = hsla[0] / 360, s = hsla[1], l = hsla[2], a = hsla[3], q = l <= 0.5 ? l * (1 + s) : l + s - l * s, p = 2 * l - q; return [ Math.round(hue2rgb(p, q, h + (1 / 3)) * 255), Math.round(hue2rgb(p, q, h) * 255), Math.round(hue2rgb(p, q, h - (1 / 3)) * 255), a ]; }; each(spaces, function (spaceName, space) { var props = space.props, cache = space.cache, to = space.to, from = space.from; // Makes rgba() and hsla() color.fn[spaceName] = function (value) { // Generate a cache for this space if it doesn't exist if (to && !this[cache]) { this[cache] = to(this._rgba); } if (value === undefined) { return this[cache].slice(); } var ret, type = jQuery.type(value), arr = (type === "array" || type === "object") ? value : arguments, local = this[cache].slice(); each(props, function (key, prop) { var val = arr[type === "object" ? key : prop.idx]; if (val == null) { val = local[prop.idx]; } local[prop.idx] = clamp(val, prop); }); if (from) { ret = color(from(local)); ret[cache] = local; return ret; } else { return color(local); } }; // Makes red() green() blue() alpha() hue() saturation() lightness() each(props, function (key, prop) { // Alpha is included in more than one space if (color.fn[key]) { return; } color.fn[key] = function (value) { var vtype = jQuery.type(value), fn = (key === "alpha" ? (this._hsla ? "hsla" : "rgba") : spaceName), local = this[fn](), cur = local[prop.idx], match; if (vtype === "undefined") { return cur; } if (vtype === "function") { value = value.call(this, cur); vtype = jQuery.type(value); } if (value == null && prop.empty) { return this; } if (vtype === "string") { match = rplusequals.exec(value); if (match) { value = cur + parseFloat(match[2]) * (match[1] === "+" ? 1 : -1); } } local[prop.idx] = value; return this[fn](local); }; }); }); // Add cssHook and .fx.step function for each named hook. // accept a space separated string of properties color.hook = function (hook) { var hooks = hook.split(" "); each(hooks, function (i, hook) { jQuery.cssHooks[hook] = { set: function (elem, value) { var parsed, curElem, backgroundColor = ""; if (value !== "transparent" && (jQuery.type(value) !== "string" || (parsed = stringParse(value)))) { value = color(parsed || value); if (!support.rgba && value._rgba[3] !== 1) { curElem = hook === "backgroundColor" ? elem.parentNode : elem; while ( (backgroundColor === "" || backgroundColor === "transparent") && curElem && curElem.style ) { try { backgroundColor = jQuery.css(curElem, "backgroundColor"); curElem = curElem.parentNode; } catch (e) { } } value = value.blend(backgroundColor && backgroundColor !== "transparent" ? backgroundColor : "_default"); } value = value.toRgbaString(); } try { elem.style[hook] = value; } catch (e) { // Wrapped to prevent IE from throwing errors on "invalid" values like // 'auto' or 'inherit' } } }; jQuery.fx.step[hook] = function (fx) { if (!fx.colorInit) { fx.start = color(fx.elem, hook); fx.end = color(fx.end); fx.colorInit = true; } jQuery.cssHooks[hook].set(fx.elem, fx.start.transition(fx.end, fx.pos)); }; }); }; color.hook(stepHooks); jQuery.cssHooks.borderColor = { expand: function (value) { var expanded = {}; each(["Top", "Right", "Bottom", "Left"], function (i, part) { expanded["border" + part + "Color"] = value; }); return expanded; } }; // Basic color names only. // Usage of any of the other color names requires adding yourself or including // jquery.color.svg-names.js. colors = jQuery.Color.names = { // 4.1. Basic color keywords aqua: "#00ffff", black: "#000000", blue: "#0000ff", fuchsia: "#ff00ff", gray: "#808080", green: "#008000", lime: "#00ff00", maroon: "#800000", navy: "#000080", olive: "#808000", purple: "#800080", red: "#ff0000", silver: "#c0c0c0", teal: "#008080", white: "#ffffff", yellow: "#ffff00", // 4.2.3. "transparent" color keyword transparent: [null, null, null, 0], _default: "#ffffff" }; })(jQuery); /******************************************************************************/ /****************************** CLASS ANIMATIONS ******************************/ /******************************************************************************/ (function () { var classAnimationActions = ["add", "remove", "toggle"], shorthandStyles = { border: 1, borderBottom: 1, borderColor: 1, borderLeft: 1, borderRight: 1, borderTop: 1, borderWidth: 1, margin: 1, padding: 1 }; $.each( ["borderLeftStyle", "borderRightStyle", "borderBottomStyle", "borderTopStyle"], function (_, prop) { $.fx.step[prop] = function (fx) { if (fx.end !== "none" && !fx.setAttr || fx.pos === 1 && !fx.setAttr) { jQuery.style(fx.elem, prop, fx.end); fx.setAttr = true; } }; } ); function getElementStyles(elem) { var key, len, style = elem.ownerDocument.defaultView ? elem.ownerDocument.defaultView.getComputedStyle(elem, null) : elem.currentStyle, styles = {}; if (style && style.length && style[0] && style[style[0]]) { len = style.length; while (len--) { key = style[len]; if (typeof style[key] === "string") { styles[$.camelCase(key)] = style[key]; } } // Support: Opera, IE <9 } else { for (key in style) { if (typeof style[key] === "string") { styles[key] = style[key]; } } } return styles; } function styleDifference(oldStyle, newStyle) { var diff = {}, name, value; for (name in newStyle) { value = newStyle[name]; if (oldStyle[name] !== value) { if (!shorthandStyles[name]) { if ($.fx.step[name] || !isNaN(parseFloat(value))) { diff[name] = value; } } } } return diff; } // Support: jQuery <1.8 if (!$.fn.addBack) { $.fn.addBack = function (selector) { return this.add(selector == null ? this.prevObject : this.prevObject.filter(selector) ); }; } $.effects.animateClass = function (value, duration, easing, callback) { var o = $.speed(duration, easing, callback); return this.queue(function () { var animated = $(this), baseClass = animated.attr("class") || "", applyClassChange, allAnimations = o.children ? animated.find("*").addBack() : animated; // Map the animated objects to store the original styles. allAnimations = allAnimations.map(function () { var el = $(this); return { el: el, start: getElementStyles(this) }; }); // Apply class change applyClassChange = function () { $.each(classAnimationActions, function (i, action) { if (value[action]) { animated[action + "Class"](value[action]); } }); }; applyClassChange(); // Map all animated objects again - calculate new styles and diff allAnimations = allAnimations.map(function () { this.end = getElementStyles(this.el[0]); this.diff = styleDifference(this.start, this.end); return this; }); // Apply original class animated.attr("class", baseClass); // Map all animated objects again - this time collecting a promise allAnimations = allAnimations.map(function () { var styleInfo = this, dfd = $.Deferred(), opts = $.extend({}, o, { queue: false, complete: function () { dfd.resolve(styleInfo); } }); this.el.animate(this.diff, opts); return dfd.promise(); }); // Once all animations have completed: $.when.apply($, allAnimations.get()).done(function () { // Set the final class applyClassChange(); // For each animated element, // clear all css properties that were animated $.each(arguments, function () { var el = this.el; $.each(this.diff, function (key) { el.css(key, ""); }); }); // This is guarnteed to be there if you use jQuery.speed() // it also handles dequeuing the next anim... o.complete.call(animated[0]); }); }); }; $.fn.extend({ addClass: (function (orig) { return function (classNames, speed, easing, callback) { return speed ? $.effects.animateClass.call(this, { add: classNames }, speed, easing, callback) : orig.apply(this, arguments); }; })($.fn.addClass), removeClass: (function (orig) { return function (classNames, speed, easing, callback) { return arguments.length > 1 ? $.effects.animateClass.call(this, { remove: classNames }, speed, easing, callback) : orig.apply(this, arguments); }; })($.fn.removeClass), toggleClass: (function (orig) { return function (classNames, force, speed, easing, callback) { if (typeof force === "boolean" || force === undefined) { if (!speed) { // Without speed parameter return orig.apply(this, arguments); } else { return $.effects.animateClass.call(this, (force ? { add: classNames } : { remove: classNames }), speed, easing, callback); } } else { // Without force parameter return $.effects.animateClass.call(this, { toggle: classNames }, force, speed, easing); } }; })($.fn.toggleClass), switchClass: function (remove, add, speed, easing, callback) { return $.effects.animateClass.call(this, { add: add, remove: remove }, speed, easing, callback); } }); })(); /******************************************************************************/ /*********************************** EFFECTS **********************************/ /******************************************************************************/ (function () { if ($.expr && $.expr.filters && $.expr.filters.animated) { $.expr.filters.animated = (function (orig) { return function (elem) { return !!$(elem).data(dataSpaceAnimated) || orig(elem); }; })($.expr.filters.animated); } if ($.uiBackCompat !== false) { $.extend($.effects, { // Saves a set of properties in a data storage save: function (element, set) { var i = 0, length = set.length; for (; i < length; i++) { if (set[i] !== null) { element.data(dataSpace + set[i], element[0].style[set[i]]); } } }, // Restores a set of previously saved properties from a data storage restore: function (element, set) { var val, i = 0, length = set.length; for (; i < length; i++) { if (set[i] !== null) { val = element.data(dataSpace + set[i]); element.css(set[i], val); } } }, setMode: function (el, mode) { if (mode === "toggle") { mode = el.is(":hidden") ? "show" : "hide"; } return mode; }, // Wraps the element around a wrapper that copies position properties createWrapper: function (element) { // If the element is already wrapped, return it if (element.parent().is(".ui-effects-wrapper")) { return element.parent(); } // Wrap the element var props = { width: element.outerWidth(true), height: element.outerHeight(true), "float": element.css("float") }, wrapper = $("<div></div>") .addClass("ui-effects-wrapper") .css({ fontSize: "100%", background: "transparent", border: "none", margin: 0, padding: 0 }), // Store the size in case width/height are defined in % - Fixes #5245 size = { width: element.width(), height: element.height() }, active = document.activeElement; // Support: Firefox // Firefox incorrectly exposes anonymous content // https://bugzilla.mozilla.org/show_bug.cgi?id=561664 try { active.id; } catch (e) { active = document.body; } element.wrap(wrapper); // Fixes #7595 - Elements lose focus when wrapped. if (element[0] === active || $.contains(element[0], active)) { $(active).trigger("focus"); } // Hotfix for jQuery 1.4 since some change in wrap() seems to actually // lose the reference to the wrapped element wrapper = element.parent(); // Transfer positioning properties to the wrapper if (element.css("position") === "static") { wrapper.css({ position: "relative" }); element.css({ position: "relative" }); } else { $.extend(props, { position: element.css("position"), zIndex: element.css("z-index") }); $.each(["top", "left", "bottom", "right"], function (i, pos) { props[pos] = element.css(pos); if (isNaN(parseInt(props[pos], 10))) { props[pos] = "auto"; } }); element.css({ position: "relative", top: 0, left: 0, right: "auto", bottom: "auto" }); } element.css(size); return wrapper.css(props).show(); }, removeWrapper: function (element) { var active = document.activeElement; if (element.parent().is(".ui-effects-wrapper")) { element.parent().replaceWith(element); // Fixes #7595 - Elements lose focus when wrapped. if (element[0] === active || $.contains(element[0], active)) { $(active).trigger("focus"); } } return element; } }); } $.extend($.effects, { version: "1.12.1", define: function (name, mode, effect) { if (!effect) { effect = mode; mode = "effect"; } $.effects.effect[name] = effect; $.effects.effect[name].mode = mode; return effect; }, scaledDimensions: function (element, percent, direction) { if (percent === 0) { return { height: 0, width: 0, outerHeight: 0, outerWidth: 0 }; } var x = direction !== "horizontal" ? ((percent || 100) / 100) : 1, y = direction !== "vertical" ? ((percent || 100) / 100) : 1; return { height: element.height() * y, width: element.width() * x, outerHeight: element.outerHeight() * y, outerWidth: element.outerWidth() * x }; }, clipToBox: function (animation) { return { width: animation.clip.right - animation.clip.left, height: animation.clip.bottom - animation.clip.top, left: animation.clip.left, top: animation.clip.top }; }, // Injects recently queued functions to be first in line (after "inprogress") unshift: function (element, queueLength, count) { var queue = element.queue(); if (queueLength > 1) { queue.splice.apply(queue, [1, 0].concat(queue.splice(queueLength, count))); } element.dequeue(); }, saveStyle: function (element) { element.data(dataSpaceStyle, element[0].style.cssText); }, restoreStyle: function (element) { element[0].style.cssText = element.data(dataSpaceStyle) || ""; element.removeData(dataSpaceStyle); }, mode: function (element, mode) { var hidden = element.is(":hidden"); if (mode === "toggle") { mode = hidden ? "show" : "hide"; } if (hidden ? mode === "hide" : mode === "show") { mode = "none"; } return mode; }, // Translates a [top,left] array into a baseline value getBaseline: function (origin, original) { var y, x; switch (origin[0]) { case "top": y = 0; break; case "middle": y = 0.5; break; case "bottom": y = 1; break; default: y = origin[0] / original.height; } switch (origin[1]) { case "left": x = 0; break; case "center": x = 0.5; break; case "right": x = 1; break; default: x = origin[1] / original.width; } return { x: x, y: y }; }, // Creates a placeholder element so that the original element can be made absolute createPlaceholder: function (element) { var placeholder, cssPosition = element.css("position"), position = element.position(); // Lock in margins first to account for form elements, which // will change margin if you explicitly set height // see: http://jsfiddle.net/JZSMt/3/ https://bugs.webkit.org/show_bug.cgi?id=107380 // Support: Safari element.css({ marginTop: element.css("marginTop"), marginBottom: element.css("marginBottom"), marginLeft: element.css("marginLeft"), marginRight: element.css("marginRight") }) .outerWidth(element.outerWidth()) .outerHeight(element.outerHeight()); if (/^(static|relative)/.test(cssPosition)) { cssPosition = "absolute"; placeholder = $("<" + element[0].nodeName + ">").insertAfter(element).css({ // Convert inline to inline block to account for inline elements // that turn to inline block based on content (like img) display: /^(inline|ruby)/.test(element.css("display")) ? "inline-block" : "block", visibility: "hidden", // Margins need to be set to account for margin collapse marginTop: element.css("marginTop"), marginBottom: element.css("marginBottom"), marginLeft: element.css("marginLeft"), marginRight: element.css("marginRight"), "float": element.css("float") }) .outerWidth(element.outerWidth()) .outerHeight(element.outerHeight()) .addClass("ui-effects-placeholder"); element.data(dataSpace + "placeholder", placeholder); } element.css({ position: cssPosition, left: position.left, top: position.top }); return placeholder; }, removePlaceholder: function (element) { var dataKey = dataSpace + "placeholder", placeholder = element.data(dataKey); if (placeholder) { placeholder.remove(); element.removeData(dataKey); } }, // Removes a placeholder if it exists and restores // properties that were modified during placeholder creation cleanUp: function (element) { $.effects.restoreStyle(element); $.effects.removePlaceholder(element); }, setTransition: function (element, list, factor, value) { value = value || {}; $.each(list, function (i, x) { var unit = element.cssUnit(x); if (unit[0] > 0) { value[x] = unit[0] * factor + unit[1]; } }); return value; } }); // Return an effect options object for the given parameters: function _normalizeArguments(effect, options, speed, callback) { // Allow passing all options as the first parameter if ($.isPlainObject(effect)) { options = effect; effect = effect.effect; } // Convert to an object effect = { effect: effect }; // Catch (effect, null, ...) if (options == null) { options = {}; } // Catch (effect, callback) if ($.isFunction(options)) { callback = options; speed = null; options = {}; } // Catch (effect, speed, ?) if (typeof options === "number" || $.fx.speeds[options]) { callback = speed; speed = options; options = {}; } // Catch (effect, options, callback) if ($.isFunction(speed)) { callback = speed; speed = null; } // Add options to effect if (options) { $.extend(effect, options); } speed = speed || options.duration; effect.duration = $.fx.off ? 0 : typeof speed === "number" ? speed : speed in $.fx.speeds ? $.fx.speeds[speed] : $.fx.speeds._default; effect.complete = callback || options.complete; return effect; } function standardAnimationOption(option) { // Valid standard speeds (nothing, number, named speed) if (!option || typeof option === "number" || $.fx.speeds[option]) { return true; } // Invalid strings - treat as "normal" speed if (typeof option === "string" && !$.effects.effect[option]) { return true; } // Complete callback if ($.isFunction(option)) { return true; } // Options hash (but not naming an effect) if (typeof option === "object" && !option.effect) { return true; } // Didn't match any standard API return false; } $.fn.extend({ effect: function ( /* effect, options, speed, callback */) { var args = _normalizeArguments.apply(this, arguments), effectMethod = $.effects.effect[args.effect], defaultMode = effectMethod.mode, queue = args.queue, queueName = queue || "fx", complete = args.complete, mode = args.mode, modes = [], prefilter = function (next) { var el = $(this), normalizedMode = $.effects.mode(el, mode) || defaultMode; // Sentinel for duck-punching the :animated psuedo-selector el.data(dataSpaceAnimated, true); // Save effect mode for later use, // we can't just call $.effects.mode again later, // as the .show() below destroys the initial state modes.push(normalizedMode); // See $.uiBackCompat inside of run() for removal of defaultMode in 1.13 if (defaultMode && (normalizedMode === "show" || (normalizedMode === defaultMode && normalizedMode === "hide"))) { el.show(); } if (!defaultMode || normalizedMode !== "none") { $.effects.saveStyle(el); } if ($.isFunction(next)) { next(); } }; if ($.fx.off || !effectMethod) { // Delegate to the original method (e.g., .show()) if possible if (mode) { return this[mode](args.duration, complete); } else { return this.each(function () { if (complete) { complete.call(this); } }); } } function run(next) { var elem = $(this); function cleanup() { elem.removeData(dataSpaceAnimated); $.effects.cleanUp(elem); if (args.mode === "hide") { elem.hide(); } done(); } function done() { if ($.isFunction(complete)) { complete.call(elem[0]); } if ($.isFunction(next)) { next(); } } // Override mode option on a per element basis, // as toggle can be either show or hide depending on element state args.mode = modes.shift(); if ($.uiBackCompat !== false && !defaultMode) { if (elem.is(":hidden") ? mode === "hide" : mode === "show") { // Call the core method to track "olddisplay" properly elem[mode](); done(); } else { effectMethod.call(elem[0], args, done); } } else { if (args.mode === "none") { // Call the core method to track "olddisplay" properly elem[mode](); done(); } else { effectMethod.call(elem[0], args, cleanup); } } } // Run prefilter on all elements first to ensure that // any showing or hiding happens before placeholder creation, // which ensures that any layout changes are correctly captured. return queue === false ? this.each(prefilter).each(run) : this.queue(queueName, prefilter).queue(queueName, run); }, show: (function (orig) { return function (option) { if (standardAnimationOption(option)) { return orig.apply(this, arguments); } else { var args = _normalizeArguments.apply(this, arguments); args.mode = "show"; return this.effect.call(this, args); } }; })($.fn.show), hide: (function (orig) { return function (option) { if (standardAnimationOption(option)) { return orig.apply(this, arguments); } else { var args = _normalizeArguments.apply(this, arguments); args.mode = "hide"; return this.effect.call(this, args); } }; })($.fn.hide), toggle: (function (orig) { return function (option) { if (standardAnimationOption(option) || typeof option === "boolean") { return orig.apply(this, arguments); } else { var args = _normalizeArguments.apply(this, arguments); args.mode = "toggle"; return this.effect.call(this, args); } }; })($.fn.toggle), cssUnit: function (key) { var style = this.css(key), val = []; $.each(["em", "px", "%", "pt"], function (i, unit) { if (style.indexOf(unit) > 0) { val = [parseFloat(style), unit]; } }); return val; }, cssClip: function (clipObj) { if (clipObj) { return this.css("clip", "rect(" + clipObj.top + "px " + clipObj.right + "px " + clipObj.bottom + "px " + clipObj.left + "px)"); } return parseClip(this.css("clip"), this); }, transfer: function (options, done) { var element = $(this), target = $(options.to), targetFixed = target.css("position") === "fixed", body = $("body"), fixTop = targetFixed ? body.scrollTop() : 0, fixLeft = targetFixed ? body.scrollLeft() : 0, endPosition = target.offset(), animation = { top: endPosition.top - fixTop, left: endPosition.left - fixLeft, height: target.innerHeight(), width: target.innerWidth() }, startPosition = element.offset(), transfer = $("<div class='ui-effects-transfer'></div>") .appendTo("body") .addClass(options.className) .css({ top: startPosition.top - fixTop, left: startPosition.left - fixLeft, height: element.innerHeight(), width: element.innerWidth(), position: targetFixed ? "fixed" : "absolute" }) .animate(animation, options.duration, options.easing, function () { transfer.remove(); if ($.isFunction(done)) { done(); } }); } }); function parseClip(str, element) { var outerWidth = element.outerWidth(), outerHeight = element.outerHeight(), clipRegex = /^rect\((-?\d*\.?\d*px|-?\d+%|auto),?\s*(-?\d*\.?\d*px|-?\d+%|auto),?\s*(-?\d*\.?\d*px|-?\d+%|auto),?\s*(-?\d*\.?\d*px|-?\d+%|auto)\)$/, values = clipRegex.exec(str) || ["", 0, outerWidth, outerHeight, 0]; return { top: parseFloat(values[1]) || 0, right: values[2] === "auto" ? outerWidth : parseFloat(values[2]), bottom: values[3] === "auto" ? outerHeight : parseFloat(values[3]), left: parseFloat(values[4]) || 0 }; } $.fx.step.clip = function (fx) { if (!fx.clipInit) { fx.start = $(fx.elem).cssClip(); if (typeof fx.end === "string") { fx.end = parseClip(fx.end, fx.elem); } fx.clipInit = true; } $(fx.elem).cssClip({ top: fx.pos * (fx.end.top - fx.start.top) + fx.start.top, right: fx.pos * (fx.end.right - fx.start.right) + fx.start.right, bottom: fx.pos * (fx.end.bottom - fx.start.bottom) + fx.start.bottom, left: fx.pos * (fx.end.left - fx.start.left) + fx.start.left }); }; })(); /******************************************************************************/ /*********************************** EASING ***********************************/ /******************************************************************************/ (function () { // Based on easing equations from Robert Penner (http://www.robertpenner.com/easing) var baseEasings = {}; $.each(["Quad", "Cubic", "Quart", "Quint", "Expo"], function (i, name) { baseEasings[name] = function (p) { return Math.pow(p, i + 2); }; }); $.extend(baseEasings, { Sine: function (p) { return 1 - Math.cos(p * Math.PI / 2); }, Circ: function (p) { return 1 - Math.sqrt(1 - p * p); }, Elastic: function (p) { return p === 0 || p === 1 ? p : -Math.pow(2, 8 * (p - 1)) * Math.sin(((p - 1) * 80 - 7.5) * Math.PI / 15); }, Back: function (p) { return p * p * (3 * p - 2); }, Bounce: function (p) { var pow2, bounce = 4; while (p < ((pow2 = Math.pow(2, --bounce)) - 1) / 11) { } return 1 / Math.pow(4, 3 - bounce) - 7.5625 * Math.pow((pow2 * 3 - 2) / 22 - p, 2); } }); $.each(baseEasings, function (name, easeIn) { $.easing["easeIn" + name] = easeIn; $.easing["easeOut" + name] = function (p) { return 1 - easeIn(1 - p); }; $.easing["easeInOut" + name] = function (p) { return p < 0.5 ? easeIn(p * 2) / 2 : 1 - easeIn(p * -2 + 2) / 2; }; }); })(); var effect = $.effects; /*! * jQuery UI Effects Blind 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Blind Effect //>>group: Effects //>>description: Blinds the element. //>>docs: http://api.jqueryui.com/blind-effect/ //>>demos: http://jqueryui.com/effect/ var effectsEffectBlind = $.effects.define("blind", "hide", function (options, done) { var map = { up: ["bottom", "top"], vertical: ["bottom", "top"], down: ["top", "bottom"], left: ["right", "left"], horizontal: ["right", "left"], right: ["left", "right"] }, element = $(this), direction = options.direction || "up", start = element.cssClip(), animate = { clip: $.extend({}, start) }, placeholder = $.effects.createPlaceholder(element); animate.clip[map[direction][0]] = animate.clip[map[direction][1]]; if (options.mode === "show") { element.cssClip(animate.clip); if (placeholder) { placeholder.css($.effects.clipToBox(animate)); } animate.clip = start; } if (placeholder) { placeholder.animate($.effects.clipToBox(animate), options.duration, options.easing); } element.animate(animate, { queue: false, duration: options.duration, easing: options.easing, complete: done }); }); /*! * jQuery UI Effects Bounce 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Bounce Effect //>>group: Effects //>>description: Bounces an element horizontally or vertically n times. //>>docs: http://api.jqueryui.com/bounce-effect/ //>>demos: http://jqueryui.com/effect/ var effectsEffectBounce = $.effects.define("bounce", function (options, done) { var upAnim, downAnim, refValue, element = $(this), // Defaults: mode = options.mode, hide = mode === "hide", show = mode === "show", direction = options.direction || "up", distance = options.distance, times = options.times || 5, // Number of internal animations anims = times * 2 + (show || hide ? 1 : 0), speed = options.duration / anims, easing = options.easing, // Utility: ref = (direction === "up" || direction === "down") ? "top" : "left", motion = (direction === "up" || direction === "left"), i = 0, queuelen = element.queue().length; $.effects.createPlaceholder(element); refValue = element.css(ref); // Default distance for the BIGGEST bounce is the outer Distance / 3 if (!distance) { distance = element[ref === "top" ? "outerHeight" : "outerWidth"]() / 3; } if (show) { downAnim = { opacity: 1 }; downAnim[ref] = refValue; // If we are showing, force opacity 0 and set the initial position // then do the "first" animation element .css("opacity", 0) .css(ref, motion ? -distance * 2 : distance * 2) .animate(downAnim, speed, easing); } // Start at the smallest distance if we are hiding if (hide) { distance = distance / Math.pow(2, times - 1); } downAnim = {}; downAnim[ref] = refValue; // Bounces up/down/left/right then back to 0 -- times * 2 animations happen here for (; i < times; i++) { upAnim = {}; upAnim[ref] = (motion ? "-=" : "+=") + distance; element .animate(upAnim, speed, easing) .animate(downAnim, speed, easing); distance = hide ? distance * 2 : distance / 2; } // Last Bounce when Hiding if (hide) { upAnim = { opacity: 0 }; upAnim[ref] = (motion ? "-=" : "+=") + distance; element.animate(upAnim, speed, easing); } element.queue(done); $.effects.unshift(element, queuelen, anims + 1); }); /*! * jQuery UI Effects Clip 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Clip Effect //>>group: Effects //>>description: Clips the element on and off like an old TV. //>>docs: http://api.jqueryui.com/clip-effect/ //>>demos: http://jqueryui.com/effect/ var effectsEffectClip = $.effects.define("clip", "hide", function (options, done) { var start, animate = {}, element = $(this), direction = options.direction || "vertical", both = direction === "both", horizontal = both || direction === "horizontal", vertical = both || direction === "vertical"; start = element.cssClip(); animate.clip = { top: vertical ? (start.bottom - start.top) / 2 : start.top, right: horizontal ? (start.right - start.left) / 2 : start.right, bottom: vertical ? (start.bottom - start.top) / 2 : start.bottom, left: horizontal ? (start.right - start.left) / 2 : start.left }; $.effects.createPlaceholder(element); if (options.mode === "show") { element.cssClip(animate.clip); animate.clip = start; } element.animate(animate, { queue: false, duration: options.duration, easing: options.easing, complete: done }); }); /*! * jQuery UI Effects Drop 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Drop Effect //>>group: Effects //>>description: Moves an element in one direction and hides it at the same time. //>>docs: http://api.jqueryui.com/drop-effect/ //>>demos: http://jqueryui.com/effect/ var effectsEffectDrop = $.effects.define("drop", "hide", function (options, done) { var distance, element = $(this), mode = options.mode, show = mode === "show", direction = options.direction || "left", ref = (direction === "up" || direction === "down") ? "top" : "left", motion = (direction === "up" || direction === "left") ? "-=" : "+=", oppositeMotion = (motion === "+=") ? "-=" : "+=", animation = { opacity: 0 }; $.effects.createPlaceholder(element); distance = options.distance || element[ref === "top" ? "outerHeight" : "outerWidth"](true) / 2; animation[ref] = motion + distance; if (show) { element.css(animation); animation[ref] = oppositeMotion + distance; animation.opacity = 1; } // Animate element.animate(animation, { queue: false, duration: options.duration, easing: options.easing, complete: done }); }); /*! * jQuery UI Effects Explode 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Explode Effect //>>group: Effects // jscs:disable maximumLineLength //>>description: Explodes an element in all directions into n pieces. Implodes an element to its original wholeness. // jscs:enable maximumLineLength //>>docs: http://api.jqueryui.com/explode-effect/ //>>demos: http://jqueryui.com/effect/ var effectsEffectExplode = $.effects.define("explode", "hide", function (options, done) { var i, j, left, top, mx, my, rows = options.pieces ? Math.round(Math.sqrt(options.pieces)) : 3, cells = rows, element = $(this), mode = options.mode, show = mode === "show", // Show and then visibility:hidden the element before calculating offset offset = element.show().css("visibility", "hidden").offset(), // Width and height of a piece width = Math.ceil(element.outerWidth() / cells), height = Math.ceil(element.outerHeight() / rows), pieces = []; // Children animate complete: function childComplete() { pieces.push(this); if (pieces.length === rows * cells) { animComplete(); } } // Clone the element for each row and cell. for (i = 0; i < rows; i++) { // ===> top = offset.top + i * height; my = i - (rows - 1) / 2; for (j = 0; j < cells; j++) { // ||| left = offset.left + j * width; mx = j - (cells - 1) / 2; // Create a clone of the now hidden main element that will be absolute positioned // within a wrapper div off the -left and -top equal to size of our pieces element .clone() .appendTo("body") .wrap("<div></div>") .css({ position: "absolute", visibility: "visible", left: -j * width, top: -i * height }) // Select the wrapper - make it overflow: hidden and absolute positioned based on // where the original was located +left and +top equal to the size of pieces .parent() .addClass("ui-effects-explode") .css({ position: "absolute", overflow: "hidden", width: width, height: height, left: left + (show ? mx * width : 0), top: top + (show ? my * height : 0), opacity: show ? 0 : 1 }) .animate({ left: left + (show ? 0 : mx * width), top: top + (show ? 0 : my * height), opacity: show ? 1 : 0 }, options.duration || 500, options.easing, childComplete); } } function animComplete() { element.css({ visibility: "visible" }); $(pieces).remove(); done(); } }); /*! * jQuery UI Effects Fade 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Fade Effect //>>group: Effects //>>description: Fades the element. //>>docs: http://api.jqueryui.com/fade-effect/ //>>demos: http://jqueryui.com/effect/ var effectsEffectFade = $.effects.define("fade", "toggle", function (options, done) { var show = options.mode === "show"; $(this) .css("opacity", show ? 0 : 1) .animate({ opacity: show ? 1 : 0 }, { queue: false, duration: options.duration, easing: options.easing, complete: done }); }); /*! * jQuery UI Effects Fold 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Fold Effect //>>group: Effects //>>description: Folds an element first horizontally and then vertically. //>>docs: http://api.jqueryui.com/fold-effect/ //>>demos: http://jqueryui.com/effect/ var effectsEffectFold = $.effects.define("fold", "hide", function (options, done) { // Create element var element = $(this), mode = options.mode, show = mode === "show", hide = mode === "hide", size = options.size || 15, percent = /([0-9]+)%/.exec(size), horizFirst = !!options.horizFirst, ref = horizFirst ? ["right", "bottom"] : ["bottom", "right"], duration = options.duration / 2, placeholder = $.effects.createPlaceholder(element), start = element.cssClip(), animation1 = { clip: $.extend({}, start) }, animation2 = { clip: $.extend({}, start) }, distance = [start[ref[0]], start[ref[1]]], queuelen = element.queue().length; if (percent) { size = parseInt(percent[1], 10) / 100 * distance[hide ? 0 : 1]; } animation1.clip[ref[0]] = size; animation2.clip[ref[0]] = size; animation2.clip[ref[1]] = 0; if (show) { element.cssClip(animation2.clip); if (placeholder) { placeholder.css($.effects.clipToBox(animation2)); } animation2.clip = start; } // Animate element .queue(function (next) { if (placeholder) { placeholder .animate($.effects.clipToBox(animation1), duration, options.easing) .animate($.effects.clipToBox(animation2), duration, options.easing); } next(); }) .animate(animation1, duration, options.easing) .animate(animation2, duration, options.easing) .queue(done); $.effects.unshift(element, queuelen, 4); }); /*! * jQuery UI Effects Highlight 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Highlight Effect //>>group: Effects //>>description: Highlights the background of an element in a defined color for a custom duration. //>>docs: http://api.jqueryui.com/highlight-effect/ //>>demos: http://jqueryui.com/effect/ var effectsEffectHighlight = $.effects.define("highlight", "show", function (options, done) { var element = $(this), animation = { backgroundColor: element.css("backgroundColor") }; if (options.mode === "hide") { animation.opacity = 0; } $.effects.saveStyle(element); element .css({ backgroundImage: "none", backgroundColor: options.color || "#ffff99" }) .animate(animation, { queue: false, duration: options.duration, easing: options.easing, complete: done }); }); /*! * jQuery UI Effects Size 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Size Effect //>>group: Effects //>>description: Resize an element to a specified width and height. //>>docs: http://api.jqueryui.com/size-effect/ //>>demos: http://jqueryui.com/effect/ var effectsEffectSize = $.effects.define("size", function (options, done) { // Create element var baseline, factor, temp, element = $(this), // Copy for children cProps = ["fontSize"], vProps = ["borderTopWidth", "borderBottomWidth", "paddingTop", "paddingBottom"], hProps = ["borderLeftWidth", "borderRightWidth", "paddingLeft", "paddingRight"], // Set options mode = options.mode, restore = mode !== "effect", scale = options.scale || "both", origin = options.origin || ["middle", "center"], position = element.css("position"), pos = element.position(), original = $.effects.scaledDimensions(element), from = options.from || original, to = options.to || $.effects.scaledDimensions(element, 0); $.effects.createPlaceholder(element); if (mode === "show") { temp = from; from = to; to = temp; } // Set scaling factor factor = { from: { y: from.height / original.height, x: from.width / original.width }, to: { y: to.height / original.height, x: to.width / original.width } }; // Scale the css box if (scale === "box" || scale === "both") { // Vertical props scaling if (factor.from.y !== factor.to.y) { from = $.effects.setTransition(element, vProps, factor.from.y, from); to = $.effects.setTransition(element, vProps, factor.to.y, to); } // Horizontal props scaling if (factor.from.x !== factor.to.x) { from = $.effects.setTransition(element, hProps, factor.from.x, from); to = $.effects.setTransition(element, hProps, factor.to.x, to); } } // Scale the content if (scale === "content" || scale === "both") { // Vertical props scaling if (factor.from.y !== factor.to.y) { from = $.effects.setTransition(element, cProps, factor.from.y, from); to = $.effects.setTransition(element, cProps, factor.to.y, to); } } // Adjust the position properties based on the provided origin points if (origin) { baseline = $.effects.getBaseline(origin, original); from.top = (original.outerHeight - from.outerHeight) * baseline.y + pos.top; from.left = (original.outerWidth - from.outerWidth) * baseline.x + pos.left; to.top = (original.outerHeight - to.outerHeight) * baseline.y + pos.top; to.left = (original.outerWidth - to.outerWidth) * baseline.x + pos.left; } element.css(from); // Animate the children if desired if (scale === "content" || scale === "both") { vProps = vProps.concat(["marginTop", "marginBottom"]).concat(cProps); hProps = hProps.concat(["marginLeft", "marginRight"]); // Only animate children with width attributes specified // TODO: is this right? should we include anything with css width specified as well element.find("*[width]").each(function () { var child = $(this), childOriginal = $.effects.scaledDimensions(child), childFrom = { height: childOriginal.height * factor.from.y, width: childOriginal.width * factor.from.x, outerHeight: childOriginal.outerHeight * factor.from.y, outerWidth: childOriginal.outerWidth * factor.from.x }, childTo = { height: childOriginal.height * factor.to.y, width: childOriginal.width * factor.to.x, outerHeight: childOriginal.height * factor.to.y, outerWidth: childOriginal.width * factor.to.x }; // Vertical props scaling if (factor.from.y !== factor.to.y) { childFrom = $.effects.setTransition(child, vProps, factor.from.y, childFrom); childTo = $.effects.setTransition(child, vProps, factor.to.y, childTo); } // Horizontal props scaling if (factor.from.x !== factor.to.x) { childFrom = $.effects.setTransition(child, hProps, factor.from.x, childFrom); childTo = $.effects.setTransition(child, hProps, factor.to.x, childTo); } if (restore) { $.effects.saveStyle(child); } // Animate children child.css(childFrom); child.animate(childTo, options.duration, options.easing, function () { // Restore children if (restore) { $.effects.restoreStyle(child); } }); }); } // Animate element.animate(to, { queue: false, duration: options.duration, easing: options.easing, complete: function () { var offset = element.offset(); if (to.opacity === 0) { element.css("opacity", from.opacity); } if (!restore) { element .css("position", position === "static" ? "relative" : position) .offset(offset); // Need to save style here so that automatic style restoration // doesn't restore to the original styles from before the animation. $.effects.saveStyle(element); } done(); } }); }); /*! * jQuery UI Effects Scale 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Scale Effect //>>group: Effects //>>description: Grows or shrinks an element and its content. //>>docs: http://api.jqueryui.com/scale-effect/ //>>demos: http://jqueryui.com/effect/ var effectsEffectScale = $.effects.define("scale", function (options, done) { // Create element var el = $(this), mode = options.mode, percent = parseInt(options.percent, 10) || (parseInt(options.percent, 10) === 0 ? 0 : (mode !== "effect" ? 0 : 100)), newOptions = $.extend(true, { from: $.effects.scaledDimensions(el), to: $.effects.scaledDimensions(el, percent, options.direction || "both"), origin: options.origin || ["middle", "center"] }, options); // Fade option to support puff if (options.fade) { newOptions.from.opacity = 1; newOptions.to.opacity = 0; } $.effects.effect.size.call(this, newOptions, done); }); /*! * jQuery UI Effects Puff 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Puff Effect //>>group: Effects //>>description: Creates a puff effect by scaling the element up and hiding it at the same time. //>>docs: http://api.jqueryui.com/puff-effect/ //>>demos: http://jqueryui.com/effect/ var effectsEffectPuff = $.effects.define("puff", "hide", function (options, done) { var newOptions = $.extend(true, {}, options, { fade: true, percent: parseInt(options.percent, 10) || 150 }); $.effects.effect.scale.call(this, newOptions, done); }); /*! * jQuery UI Effects Pulsate 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Pulsate Effect //>>group: Effects //>>description: Pulsates an element n times by changing the opacity to zero and back. //>>docs: http://api.jqueryui.com/pulsate-effect/ //>>demos: http://jqueryui.com/effect/ var effectsEffectPulsate = $.effects.define("pulsate", "show", function (options, done) { var element = $(this), mode = options.mode, show = mode === "show", hide = mode === "hide", showhide = show || hide, // Showing or hiding leaves off the "last" animation anims = ((options.times || 5) * 2) + (showhide ? 1 : 0), duration = options.duration / anims, animateTo = 0, i = 1, queuelen = element.queue().length; if (show || !element.is(":visible")) { element.css("opacity", 0).show(); animateTo = 1; } // Anims - 1 opacity "toggles" for (; i < anims; i++) { element.animate({ opacity: animateTo }, duration, options.easing); animateTo = 1 - animateTo; } element.animate({ opacity: animateTo }, duration, options.easing); element.queue(done); $.effects.unshift(element, queuelen, anims + 1); }); /*! * jQuery UI Effects Shake 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Shake Effect //>>group: Effects //>>description: Shakes an element horizontally or vertically n times. //>>docs: http://api.jqueryui.com/shake-effect/ //>>demos: http://jqueryui.com/effect/ var effectsEffectShake = $.effects.define("shake", function (options, done) { var i = 1, element = $(this), direction = options.direction || "left", distance = options.distance || 20, times = options.times || 3, anims = times * 2 + 1, speed = Math.round(options.duration / anims), ref = (direction === "up" || direction === "down") ? "top" : "left", positiveMotion = (direction === "up" || direction === "left"), animation = {}, animation1 = {}, animation2 = {}, queuelen = element.queue().length; $.effects.createPlaceholder(element); // Animation animation[ref] = (positiveMotion ? "-=" : "+=") + distance; animation1[ref] = (positiveMotion ? "+=" : "-=") + distance * 2; animation2[ref] = (positiveMotion ? "-=" : "+=") + distance * 2; // Animate element.animate(animation, speed, options.easing); // Shakes for (; i < times; i++) { element .animate(animation1, speed, options.easing) .animate(animation2, speed, options.easing); } element .animate(animation1, speed, options.easing) .animate(animation, speed / 2, options.easing) .queue(done); $.effects.unshift(element, queuelen, anims + 1); }); /*! * jQuery UI Effects Slide 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Slide Effect //>>group: Effects //>>description: Slides an element in and out of the viewport. //>>docs: http://api.jqueryui.com/slide-effect/ //>>demos: http://jqueryui.com/effect/ var effectsEffectSlide = $.effects.define("slide", "show", function (options, done) { var startClip, startRef, element = $(this), map = { up: ["bottom", "top"], down: ["top", "bottom"], left: ["right", "left"], right: ["left", "right"] }, mode = options.mode, direction = options.direction || "left", ref = (direction === "up" || direction === "down") ? "top" : "left", positiveMotion = (direction === "up" || direction === "left"), distance = options.distance || element[ref === "top" ? "outerHeight" : "outerWidth"](true), animation = {}; $.effects.createPlaceholder(element); startClip = element.cssClip(); startRef = element.position()[ref]; // Define hide animation animation[ref] = (positiveMotion ? -1 : 1) * distance + startRef; animation.clip = element.cssClip(); animation.clip[map[direction][1]] = animation.clip[map[direction][0]]; // Reverse the animation if we're showing if (mode === "show") { element.cssClip(animation.clip); element.css(ref, animation[ref]); animation.clip = startClip; animation[ref] = startRef; } // Actually animate element.animate(animation, { queue: false, duration: options.duration, easing: options.easing, complete: done }); }); /*! * jQuery UI Effects Transfer 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Transfer Effect //>>group: Effects //>>description: Displays a transfer effect from one element to another. //>>docs: http://api.jqueryui.com/transfer-effect/ //>>demos: http://jqueryui.com/effect/ var effect; if ($.uiBackCompat !== false) { effect = $.effects.define("transfer", function (options, done) { $(this).transfer(options, done); }); } var effectsEffectTransfer = effect; }));
Save
Cancel